` need to be moved\r\n * as well.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Sprite.prototype.appendDefs = function () {\n if (this.filterElement) {\n this.paper.appendDef(this.filterElement);\n }\n\n var fill = this.fill;\n\n if (fill && fill.element) {\n this.paper.appendDef(fill.element);\n }\n\n var stroke = this.stroke;\n\n if (stroke && stroke.element) {\n this.paper.appendDef(stroke.element);\n }\n\n if (this.fillModifier && this.fill instanceof Color) {\n var fill_1 = this.fillModifier.modify(this.fill);\n\n if (fill_1 && fill_1.element) {\n this.paper.appendDef(fill_1.element);\n }\n }\n\n if (this.strokeModifier && this.stroke instanceof Color) {\n var stroke_1 = this.strokeModifier.modify(this.stroke);\n\n if (stroke_1 && stroke_1.element) {\n this.paper.appendDef(stroke_1.element);\n }\n }\n\n if (this._clipPath) {\n this.paper.appendDef(this._clipPath);\n }\n\n if (this._exportable === false) {\n this.exportable = false;\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"map\", {\n /**\r\n * Returns a [[Dictionary]] which maps object ids with their respective\r\n * objects.\r\n *\r\n * Can be used to retrieve any object by id, e.g.:\r\n *\r\n * ```TypeScript\r\n * console.log(mySprite.map.getKey(\"myid\"));\r\n * ```\r\n * ```JavaScript\r\n * console.log(mySprite.map.getKey(\"myid\"));\r\n * ```\r\n *\r\n * @return Map collection\r\n */\n get: function get() {\n var top = this.topParent;\n\n if (top) {\n return top.map;\n } else if (!this._map) {\n this._map = new Dictionary();\n }\n\n return this._map;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"delayedMap\", {\n /**\r\n * @ignore\r\n * @return Map collection\r\n */\n get: function get() {\n var top = this.topParent;\n\n if (top) {\n return top.delayedMap;\n } else if (!this._delayedMap) {\n this._delayedMap = new Dictionary();\n }\n\n return this._delayedMap;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"id\", {\n /**\r\n * @return ID\r\n */\n get: function get() {\n return this._id;\n },\n\n /**\r\n * Element's user-defined ID.\r\n *\r\n * Will throw an Error if there already is an object with the same ID.\r\n *\r\n * Please note that above check will be performed withing the scope of the\r\n * current chart instance. It will not do checks across other chart instances\r\n * or in globally in DOM.\r\n *\r\n * Make sure the IDs are unique.\r\n *\r\n * @param value ID\r\n */\n set: function set(value) {\n if (this._id != value) {\n this._id = value;\n\n if (this.map.hasKey(value)) {\n throw Error(\"Duplicate id (\" + value + \") used on multiple objects.\");\n } else {\n this.map.setKey(value, this);\n }\n\n if (options.autoSetClassName) {\n this.setClassName();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"dom\", {\n /**\r\n * ==========================================================================\r\n * ELEMENT AND DOM TREE MANIPULATION AND MEASURING\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns DOM element reference associated with this element.\r\n *\r\n * @readonly\r\n * @return DOM element\r\n */\n get: function get() {\n return this.group.node;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"paper\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Paper\r\n */\n get: function get() {\n if (this._paper) {\n return this._paper;\n } else {\n var parent_2 = this._parent;\n\n if (parent_2) {\n return parent_2.paper;\n }\n }\n\n return getGhostPaper();\n },\n\n /**\r\n * A [[Paper]] instance to place elements on.\r\n *\r\n * If there's no Paper set for this element, it goes up the ascendant tree\r\n * until it finds one.\r\n *\r\n * This method is used by important `addChild()` method, so it's essential\r\n * to have a [[Paper]] instance.\r\n *\r\n * If this element has a separate `htmlContainer` set, it will have a\r\n * [[Paper]] instance itself.\r\n *\r\n * @ignore Exclude from docs\r\n * @param paper Paper\r\n */\n set: function set(paper) {\n this.setPaper(paper);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets [[Paper]] instance to use to draw elements.\r\n * @ignore\r\n * @param paper Paper\r\n * @return true if paper was changed, false, if it's the same\r\n */\n\n Sprite.prototype.setPaper = function (paper) {\n var oldPaper = this._paper;\n\n if (oldPaper != paper) {\n this._paper = paper;\n this.appendDefs();\n return true;\n }\n\n return false;\n };\n\n Object.defineProperty(Sprite.prototype, \"htmlContainer\", {\n /**\r\n * @return HTML element\r\n */\n get: function get() {\n if (this._htmlContainer) {\n return this._htmlContainer;\n } else {\n var parent_3 = this._parent;\n\n if (parent_3) {\n return parent_3.htmlContainer;\n }\n }\n },\n\n /**\r\n * An HTML element to be used when placing wrapper element (``)\r\n * for the whole chart.\r\n *\r\n * This is the same for **all** elements within the same chart.\r\n *\r\n * @param htmlContainer HTML element\r\n */\n set: function set(htmlContainer) {\n this._htmlContainer = htmlContainer;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"titleElement\", {\n /**\r\n * Creates (if not yet created) and returns element's `
` element.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Title element\r\n */\n get: function get() {\n if (!this._titleElement) {\n this._titleElement = this.paper.add(\"title\");\n this.group.add(this._titleElement);\n }\n\n return this._titleElement;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"descriptionElement\", {\n /**\r\n * Creates (if not yet created) and returns element's `<desc>` element.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Desc element\r\n */\n get: function get() {\n if (!this._descriptionElement) {\n this._descriptionElement = this.paper.add(\"desc\");\n this.group.add(this._descriptionElement);\n }\n\n return this._descriptionElement;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"filters\", {\n /**\r\n * Returns list of SVG filters (effects) applied to element. If the filter\r\n * list is not yet initilized, creates and returns an empty one.\r\n * Note, not all filters combine well with one another. We recommend using one filter per sprite.\r\n *\r\n * @return List of filters\r\n */\n get: function get() {\n if (!this._filters) {\n this._filters = new List(); // TODO only add certain events ?\n\n this._disposers.push(this._filters.events.onAll(this.applyFilters, this));\n\n this._disposers.push(new ListDisposer(this._filters));\n }\n\n return this._filters;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets required SVG attributes. Must be called every time an element is\r\n * redrawn so that attributes are (re)applied.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Sprite.prototype.setSVGAttributes = function () {\n this.fill = this.fill;\n this.opacity = this.opacity;\n this.fillOpacity = this.fillOpacity;\n this.stroke = this.stroke;\n this.strokeOpacity = this.strokeOpacity;\n this.shapeRendering = this.shapeRendering;\n this.strokeDasharray = this.strokeDasharray;\n this.strokeDashoffset = this.strokeDashoffset;\n this.strokeLinecap = this.strokeLinecap;\n this.strokeLinejoin = this.strokeLinejoin;\n this.focusable = this.focusable;\n this.tabindex = this.tabindex;\n this.role = this.role;\n };\n /**\r\n * Sets an attribute directly on an SVG element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param attribute Attribute object\r\n */\n\n\n Sprite.prototype.setSVGAttribute = function (attribute) {\n this.group.attr(attribute);\n };\n /**\r\n * Removes an attribute directly from SVG element.\r\n *\r\n * @param attribute Attribute key to remove\r\n */\n\n\n Sprite.prototype.removeSVGAttribute = function (attribute) {\n this.group.removeAttr(attribute);\n };\n /**\r\n * Sets `class` attribute of the elements SVG node.\r\n *\r\n * Uses `am4core.options.classNamePrefix`.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.setClassName = function () {\n var className = this.className;\n var classNamePrefix = options.classNamePrefix;\n\n if (this.element) {\n this.element.addClass(classNamePrefix + className);\n }\n\n this.group.addClass(classNamePrefix + className + \"-group\");\n\n if ($type.hasValue(this.id)) {\n this.group.addClass(classNamePrefix + this.id);\n }\n\n if (this.userClassName) {\n this.group.addClass(this.userClassName);\n }\n };\n /**\r\n * Adds an `id` attribute the the element and returns the id.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Element's ID\r\n */\n\n\n Sprite.prototype.uidAttr = function () {\n this.setSVGAttribute({\n \"id\": this.uid\n });\n return this.uid;\n };\n /**\r\n * [updateClipPath description]\r\n *\r\n * @todo Description\r\n */\n\n\n Sprite.prototype.updateClipPath = function () {\n var element = this._clipElement;\n\n if (element) {\n element.moveTo({\n x: this.mask.pixelX,\n y: this.mask.pixelY\n });\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n Sprite.prototype.createClipPath = function () {\n if (!this._clipPath) {\n this._clipPath = this.paper.addGroup(\"clipPath\");\n this.paper.appendDef(this._clipPath);\n\n this._disposers.push(this._clipPath);\n\n var id = registry.getUniqueId();\n\n this._clipPath.attr({\n \"id\": id\n });\n\n this.group.attr({\n \"clip-path\": \"url(\\\"\" + $utils.getBaseURI() + id + \"\\\")\"\n });\n }\n };\n /**\r\n * Applies the mask Sprite.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.applyMask = function () {\n var mask = this.mask;\n\n if (this._clipPath && mask) {\n // Container\n if (mask instanceof Container) {\n this._clipElement.attr({\n \"width\": $math.max(0, mask.pixelWidth),\n \"height\": $math.max(0, mask.pixelHeight)\n });\n\n var point = $utils.spritePointToSprite({\n x: mask.pixelX,\n y: mask.pixelY\n }, mask.parent, this);\n this._clipPath.x = point.x;\n this._clipPath.y = point.y;\n } // Sprite\n else {\n if (mask.element && mask.element != this._clipElement) {\n this._clipElement = mask.element;\n\n this._clipPath.add(this._clipElement);\n }\n\n this._clipPath.scale = mask.scale;\n this._clipPath.x = mask.pixelX;\n this._clipPath.y = mask.pixelY;\n this._clipPath.rotation = mask.rotation;\n }\n }\n };\n /**\r\n * Applies filters to the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.applyFilters = function () {\n var _this = this; // we create a separate filter for each sprite as otherwise it would be impossible to animate filter.\n // svg doesn't support multiple filters applied to one element, so we put all the primitives to one filterElement of a sprite.\n\n\n if (this._filters && this._filters.length > 0) {\n var width_1 = 100;\n var height_1 = 100;\n\n if (!this.filterElement) {\n this.filterElement = this.paper.addGroup(\"filter\");\n\n this._disposers.push(this.filterElement);\n } else {\n this.filterElement.removeChildNodes();\n }\n\n this.paper.appendDef(this.filterElement);\n var id = \"filter-\" + this.uid;\n this.filterElement.attr({\n \"id\": id\n });\n $iter.each(this.filters.iterator(), function (filter) {\n filter.sprite = _this;\n filter.paper = _this.paper;\n\n _this.filterElement.attr({\n filterUnits: filter.filterUnits\n });\n\n filter.appendPrimitives(_this.filterElement);\n\n if (filter.width > width_1) {\n width_1 = filter.width;\n }\n\n if (filter.height > height_1) {\n height_1 = filter.height;\n }\n\n filter.scale = _this.globalScale;\n });\n var w = width_1 + \"%\";\n var h = height_1 + \"%\";\n /* temporarily removed as it is breaking tooltips on Safari @todo come back to this\r\n if (this._measuredHeight <= 1) {\r\n h = height + \"\";\r\n }\r\n if (this._measuredWidth <= 1) {\r\n h = width + \"\";\r\n }*/\n\n this.filterElement.attr({\n \"width\": w,\n \"height\": h,\n \"x\": -(width_1 - 100) / 2 + \"%\",\n \"y\": -(height_1 - 100) / 2 + \"%\"\n });\n this.group.attr({\n \"filter\": \"url(\\\"\" + $utils.getBaseURI() + id + \"\\\")\"\n });\n } else if (this.filterElement) {\n this.group.removeAttr(\"filter\");\n this.filterElement.removeChildNodes();\n }\n };\n /**\r\n * [removeClipPath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Sprite.prototype.removeClipPath = function () {\n if (this._clipPath) {\n //this._clipPath.dispose();\n this.removeDispose(this._clipPath);\n this._clipPath = undefined;\n }\n };\n /**\r\n * [setElement description]\r\n *\r\n * @ignore\r\n * @todo Description\r\n * @param element [description]\r\n */\n\n\n Sprite.prototype.setElement = function (element) {\n this.element = element;\n this.setSVGAttributes();\n this.applyAccessibility();\n };\n\n Object.defineProperty(Sprite.prototype, \"element\", {\n /**\r\n * @return Element\r\n */\n get: function get() {\n return this._element;\n },\n\n /**\r\n * The main element for this Sprite, usually an SVG `<g>`.\r\n *\r\n * All other sub-elements are created in it.\r\n *\r\n * @param element Element\r\n */\n set: function set(element) {\n // Destroy previous element if there was one before\n this.removeElement(); // Set new element\n\n this._element = element; // Add element to group\n // Since we are adding Element to group, which is already in the\n // `.disposers` it will be removed automatically when Sprite is disposed\n // of\n\n this.group.add(element);\n\n if (element.node instanceof SVGPathElement) {\n this._isPath = true;\n } // This is needed if someone is setting element not in draw method but\n // from outside\n\n\n if (!this.invalid) {\n this.validate();\n }\n\n if (options.autoSetClassName) {\n this.setClassName();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"svgContainer\", {\n /**\r\n * HTML container (`<div>`) which is used to place chart's `<svg>` element\r\n * in.\r\n *\r\n * @return Container for chart elements\r\n */\n get: function get() {\n if (this._svgContainer) {\n return this._svgContainer;\n } else if (this._parent) {\n return this._parent.svgContainer;\n }\n },\n\n /**\r\n * Sets HTML container to add SVG and other chart elements to.\r\n *\r\n * @param svgContainer Container for chart elements\r\n */\n set: function set(svgContainer) {\n this._svgContainer = svgContainer;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Measures main element.\r\n *\r\n * Saves measurements into private `_bbox` property.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Sprite.prototype.measureElement = function () {\n if (this.element) {\n if (this.definedBBox) {\n this._bbox = this.definedBBox;\n } else {\n var svgBBox = this.element.getBBox();\n this._bbox = {\n x: svgBBox.x,\n y: svgBBox.y,\n width: svgBBox.width,\n height: svgBBox.height\n };\n }\n }\n };\n /**\r\n * Positions element according its center settings.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.updateCenter = function () {\n if (this.element) {\n var prevElementTransform = this.element.transformString;\n var bbox = this.bbox;\n var ex = 0;\n var ey = 0;\n var elementX = bbox.x;\n var elementY = bbox.y;\n var elementWidth = bbox.width;\n var elementHeigth = bbox.height;\n var pixelPaddingLeft = this.pixelPaddingLeft;\n var pixelPaddingRight = this.pixelPaddingRight;\n var pixelPaddingTop = this.pixelPaddingTop;\n var pixelPaddingBottom = this.pixelPaddingBottom; // add padding to the measured size\n\n var measuredWidth = $math.max(elementWidth + pixelPaddingLeft + pixelPaddingRight, this.pixelWidth);\n var measuredHeight = $math.max(elementHeigth + pixelPaddingTop + pixelPaddingBottom, this.pixelHeight); // extremes\n\n var left = bbox.x;\n var right = bbox.x + measuredWidth;\n var top_1 = bbox.y;\n var bottom = bbox.y + measuredHeight;\n var horizontalCenter = this.horizontalCenter;\n var verticalCenter = this.verticalCenter;\n\n switch (horizontalCenter) {\n case \"none\":\n ex = elementX + pixelPaddingLeft;\n break;\n\n case \"left\":\n ex = pixelPaddingLeft;\n break;\n\n case \"middle\":\n ex = pixelPaddingLeft - (elementWidth + pixelPaddingRight + pixelPaddingLeft) / 2;\n break;\n\n case \"right\":\n ex = -pixelPaddingRight - elementWidth;\n break;\n }\n\n switch (verticalCenter) {\n case \"none\":\n ey = elementY + pixelPaddingTop;\n break;\n\n case \"top\":\n ey = pixelPaddingTop;\n break;\n\n case \"middle\":\n ey = pixelPaddingTop - (elementHeigth + pixelPaddingBottom + pixelPaddingTop) / 2;\n break;\n\n case \"bottom\":\n ey = -pixelPaddingBottom - elementHeigth;\n break;\n }\n\n this._measuredHeight = measuredHeight;\n this._measuredWidth = measuredWidth;\n var x = $math.round(ex - elementX, this._positionPrecision, true);\n var y = $math.round(ey - elementY, this._positionPrecision, true);\n this.ex = x - pixelPaddingLeft;\n this.ey = y - pixelPaddingTop;\n this.maxLeft = left + x - pixelPaddingLeft;\n this.maxRight = right + x - pixelPaddingLeft;\n this.maxTop = top_1 + y - pixelPaddingTop;\n this.maxBottom = bottom + y - pixelPaddingTop;\n\n if (this.pixelPerfect && options.pixelPerfectPrecision == 0) {\n x -= 0.5;\n y -= 0.5;\n }\n\n this.element.moveTo({\n x: x,\n y: y\n });\n\n if (prevElementTransform != this.element.transformString) {\n this.dispatchImmediately(\"transformed\");\n }\n }\n };\n /**\r\n * Measures the whole element.\r\n *\r\n * Returns `true` if the size has changed from the last measurement.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Did the size changed from the last measurement?\r\n */\n\n\n Sprite.prototype.measure = function () {\n this.updateCenter();\n var measuredWidth = this._measuredWidth;\n var measuredHeight = this._measuredHeight; // extremes\n\n var left = this.maxLeft;\n var right = this.maxRight;\n var top = this.maxTop;\n var bottom = this.maxBottom; // non-parent wise size\n\n this._measuredWidthSelf = measuredWidth;\n this._measuredHeightSelf = measuredHeight;\n var positionPrecision = this._positionPrecision;\n this.maxLeftSelf = this.maxLeft;\n this.maxRightSelf = this.maxRight;\n this.maxTopSelf = this.maxTop;\n this.maxBottomSelf = this.maxBottom; // if a sprite is rotated or scaled, calculate measured size after transformations\n\n if (this.rotation !== 0 || this.scale !== 1 || this.nonScaling) {\n // not good to handleGlobalScale here.\n if (this.nonScalingStroke) {\n this.strokeWidth = this.strokeWidth;\n }\n\n var svg = this.paper.svg;\n var matrix = svg.createSVGMatrix();\n var rotation = this.rotation;\n var scale = this.scale;\n\n if (this.nonScaling) {\n scale = this.scale / this.globalScale;\n }\n\n matrix.a = $math.cos(rotation) * scale;\n matrix.c = -$math.sin(rotation) * scale;\n matrix.e = 0;\n matrix.b = $math.sin(rotation) * scale;\n matrix.d = $math.cos(rotation) * scale;\n matrix.f = 0;\n var p1 = svg.createSVGPoint();\n p1.x = left;\n p1.y = top;\n var p2 = svg.createSVGPoint();\n p2.x = right;\n p2.y = top;\n var p3 = svg.createSVGPoint();\n p3.x = right;\n p3.y = bottom;\n var p4 = svg.createSVGPoint();\n p4.x = left;\n p4.y = bottom;\n var pt1 = p1.matrixTransform(matrix);\n var pt2 = p2.matrixTransform(matrix);\n var pt3 = p3.matrixTransform(matrix);\n var pt4 = p4.matrixTransform(matrix);\n left = Math.min(pt1.x, pt2.x, pt3.x, pt4.x);\n right = Math.max(pt1.x, pt2.x, pt3.x, pt4.x);\n top = Math.min(pt1.y, pt2.y, pt3.y, pt4.y);\n bottom = Math.max(pt1.y, pt2.y, pt3.y, pt4.y);\n measuredWidth = right - left;\n measuredHeight = bottom - top;\n this.maxLeft = $math.round(left, positionPrecision, true);\n this.maxRight = $math.round(right, positionPrecision, true);\n this.maxTop = $math.round(top, positionPrecision, true);\n this.maxBottom = $math.round(bottom, positionPrecision, true);\n }\n\n this._measuredWidth = $math.round(measuredWidth, positionPrecision, true);\n this._measuredHeight = $math.round(measuredHeight, positionPrecision, true); // dispatch event\n\n if (this._measuredWidth != this._prevMeasuredWidth || this._measuredHeight != this._prevMeasuredHeight) {\n this._prevMeasuredHeight = this._measuredHeight;\n this._prevMeasuredWidth = this._measuredWidth; // TODO clear existing sizechanged dispatches ?\n\n this.dispatch(\"sizechanged\");\n\n if ((this.isHover || this.showTooltipOn == \"hit\" || this.showTooltipOn == \"always\") && this.tooltip && this.tooltip.visible && ($type.hasValue(this.tooltipText) || $type.hasValue(this.tooltipHTML))) {\n this.updateTooltipPosition();\n }\n\n return true;\n }\n\n return false;\n };\n /**\r\n * Insert this element before sibling element.\r\n *\r\n * @param sprite Target element\r\n * @return This element\r\n */\n\n\n Sprite.prototype.insertBefore = function (sprite) {\n var parent = this._parent;\n\n if (parent) {\n var index = parent.children.indexOf(sprite);\n\n if (index !== -1) {\n parent.children.moveValue(this, index);\n parent.sortChildren();\n }\n }\n\n return this;\n };\n /**\r\n * Insert this element after sibling element.\r\n *\r\n * @param sprite Target element\r\n * @return This element\r\n */\n\n\n Sprite.prototype.insertAfter = function (sprite) {\n var parent = this._parent;\n\n if (parent) {\n var index = parent.children.indexOf(sprite);\n\n if (index !== -1) {\n parent.children.moveValue(this, index + 1);\n parent.sortChildren();\n }\n }\n\n return this;\n };\n /**\r\n * Removes the main SVG element.\r\n *\r\n * This does not destroy the whole Sprite element. To do that use\r\n * `dispose()` instead.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.removeElement = function () {\n // remove visual element\n if (this._element) {\n this.removeDispose(this._element);\n this._element = undefined;\n }\n };\n /**\r\n * Returns relative (percent) value of the X coordindate within this element.\r\n *\r\n * A relative value is a hundredth of a percent. So 100% would result in a 1\r\n * as relative value.\r\n *\r\n * @param value Absolute or relative X coordinate\r\n * @return Relative value\r\n */\n\n\n Sprite.prototype.getRelativeX = function (value) {\n if (value instanceof Percent) {\n return value.value;\n } else if (this._parent) {\n return value / this._parent.innerWidth;\n }\n\n return 0;\n };\n /**\r\n * Returns relative (percent) value of the Y coordindate within this element.\r\n *\r\n * A relative value is a hundredth of a percent. So 100% would result in a 1\r\n * as relative value.\r\n *\r\n * @param value Absolute or relative Y coordinate\r\n * @return Relative value\r\n */\n\n\n Sprite.prototype.getRelativeY = function (value) {\n if (value instanceof Percent) {\n return value.value;\n } else if (this._parent) {\n return value / this._parent.innerHeight;\n }\n\n return 0;\n };\n /**\r\n * Returns an X coordinate in pixel within the element.\r\n *\r\n * If number is passed in as parameter, the same number will be returned\r\n * back.\r\n *\r\n * If [[Percent]] is passed in, it will be recalculated to pixels.\r\n *\r\n * @param value Absolute or relative X coordinate\r\n * @return X coordinate in pixels\r\n */\n\n\n Sprite.prototype.getPixelX = function (value) {\n // we don't use $utils.valueToRelative as this would mean that we should access parent.innerWidth\n // all the time and this would result chain of the same actions and will slow down the system a lot\n var pixel = 0;\n\n if ($type.isNumber(value)) {\n pixel = value;\n } else if (value instanceof Percent) {\n var relative = value.value;\n\n if (this._parent) {\n pixel = $math.round(this._parent.innerWidth * relative, this._positionPrecision, true);\n }\n }\n\n return pixel;\n };\n /**\r\n * Returns an Y coordinate in pixel within the element.\r\n *\r\n * If number is passed in as parameter, the same number will be returned\r\n * back.\r\n *\r\n * If [[Percent]] is passed in, it will be recalculated to pixels.\r\n *\r\n * @param value Absolute or relative Y coordinate\r\n * @return Y coordinate in pixels\r\n */\n\n\n Sprite.prototype.getPixelY = function (value) {\n // we don't use $utils.valueToRelative as this would mean that we should access parent.innerWidth\n // all the time and this would result chain of the same actions and will slow down the system a lot\n var pixel = 0;\n\n if ($type.isNumber(value)) {\n pixel = value;\n } else if (value instanceof Percent) {\n var relative = value.value;\n\n if (this._parent) {\n pixel = $math.round(this._parent.innerHeight * relative, this._positionPrecision, true);\n }\n }\n\n return pixel;\n };\n /**\r\n * Moves the element to a specified coordinates.\r\n *\r\n * Using this method is preferred method of moving element, as it saves some\r\n * CPU processing power over setting `x` and `y` properties separately.\r\n *\r\n * The method respects element's center settings. The element will be\r\n * positioned so that `point` coordinates come in whatever \"center\" of the\r\n * element is, as set in `horizontalCenter` and `verticalCenter`.\r\n *\r\n * Besides moving the element, you can also at the same time scale and\r\n * rotate the element.\r\n *\r\n * @param point New coordinates\r\n * @param rotation New rotation\r\n * @param scale New Scale\r\n */\n\n\n Sprite.prototype.moveTo = function (point, rotation, scale, isDragged) {\n if (this.isDragged && !isDragged) {\n return;\n }\n\n if (point) {\n if ($type.isNumber(point.x)) {\n this.setPropertyValue(\"x\", $math.round(point.x, this._positionPrecision, true));\n }\n\n if ($type.isNumber(point.y)) {\n this.setPropertyValue(\"y\", $math.round(point.y, this._positionPrecision, true));\n }\n }\n\n if ($type.isNumber(rotation)) {\n this.rotation = rotation;\n }\n\n if ($type.isNumber(scale)) {\n this.scale = scale;\n } // must leave this\n\n\n this.invalidatePosition();\n };\n\n Object.defineProperty(Sprite.prototype, \"mask\", {\n /**\r\n * Returns [[Sprite]] element currently used as mask for this element.\r\n *\r\n * @ignore Exclude from docs\r\n * @return A [[Sprite]] to use as mask\r\n */\n get: function get() {\n if (!this._adapterO) {\n return this._mask.get();\n } else {\n return this._adapterO.apply(\"mask\", this._mask.get());\n }\n },\n\n /**\r\n * Sets another [[Sprite]] element as this elements mask.\r\n *\r\n * @ignore Exclude from docs\r\n * @param mask A [[Sprite]] to use as mask\r\n */\n set: function set(mask) {\n var _this = this;\n\n if (this._mask.get() !== mask) {\n // this is good\n if (mask) {\n this.createClipPath();\n\n if (!(mask instanceof Container)) {\n mask.isMeasured = false;\n\n if (mask.element) {\n this._clipElement = mask.element;\n }\n } else {\n this._clipElement = this.paper.add(\"rect\");\n }\n\n if (this._clipElement) {\n this._clipPath.add(this._clipElement);\n }\n\n this._mask.set(mask, new MultiDisposer([//mask.addEventListener(SpriteEvent.TRANSFORMED, this.applyMask, false, this);\n mask.events.on(\"maxsizechanged\", function () {\n if (_this.inited) {\n _this.applyMask();\n }\n }, undefined, false), mask.events.on(\"validated\", this.applyMask, this, false), mask.events.on(\"positionchanged\", this.applyMask, this, false)]));\n\n this.applyMask();\n } else {\n this._mask.reset();\n\n this.group.removeAttr(\"clip-path\");\n this.removeClipPath();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"maskRectangle\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Mask Rectangle\r\n */\n get: function get() {\n return this._maskRectangle;\n },\n // you can set IRectangle as a mask instead o a sprite. Note, the changes of the object won't be monitored\n\n /**\r\n * Instead of creating a [[Sprite]] for mask, you can just use a\r\n * [[Rectangle]] by setting this accessor.\r\n *\r\n * Please note that the element will not monitor any changes to the mask\r\n * rectangle.\r\n *\r\n * @ignore Exclude from docs\r\n * @param rect Mask Rectangle\r\n */\n set: function set(rect) {\n if (rect) {\n this.createClipPath();\n\n if (!this._clipElement) {\n this._clipElement = this.paper.add(\"rect\");\n\n this._clipPath.add(this._clipElement);\n }\n\n this._clipElement.attr({\n \"width\": rect.width,\n \"height\": rect.height\n });\n } else {\n this.removeClipPath();\n this._clipElement = undefined;\n }\n\n this._maskRectangle = rect;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"isMeasured\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Was element already measured?\r\n */\n get: function get() {\n return this._isMeasured;\n },\n\n /**\r\n * Indicates if this element was already measured.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Was element already measured?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (!value) {\n this._measuredWidth = 0;\n this._measuredHeight = 0; //this._pixelHeight = 0;\n //this._pixelWidth = 0;\n }\n\n if (this._isMeasured != value) {\n this._isMeasured = value;\n this.invalidatePosition();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Checks if the this element has any of its parts overlapping with another\r\n * element.\r\n *\r\n * @todo Description (review)\r\n * @param sprite Second element to test again\r\n * @return Overlapping?\r\n */\n\n Sprite.prototype.hitTest = function (sprite) {\n // validate, otherwise we will not know measuredWidth and measuredHeight\n if (this.invalid) {\n this.validate();\n }\n\n if (sprite.invalid) {\n sprite.validate();\n }\n\n var ax1 = this.pixelX + this.maxLeft;\n var ay1 = this.pixelY + this.maxTop;\n var ax2 = ax1 + this.maxRight;\n var ay2 = ay1 + this.maxBottom;\n var bx1 = sprite.pixelX + sprite.maxLeft;\n var by1 = sprite.pixelY + sprite.maxTop;\n var bx2 = bx1 + sprite.maxRight;\n var by2 = by1 + sprite.maxBottom;\n return !(bx1 > ax2 || bx2 < ax1 || by1 > ay2 || by2 < ay1);\n };\n\n Object.defineProperty(Sprite.prototype, \"inited\", {\n /**\r\n * ==========================================================================\r\n * STATE-RELATED\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns `true` if Sprite has already finished initializing.\r\n *\r\n * @return Initialized?\r\n */\n get: function get() {\n return this._inited;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns `true` if Sprite has already finished initializing and is ready.\r\n *\r\n * If this object is a [[Container]] it will wait for all of its children\r\n * are ready before becoming ready itself and firing a `\"ready\"` event.\r\n *\r\n * @return is ready?\r\n */\n\n Sprite.prototype.isReady = function () {\n return this._ready;\n };\n\n Object.defineProperty(Sprite.prototype, \"states\", {\n /**\r\n * Returns a collection of element's available [[SpriteState]] entries.\r\n *\r\n * @see {@link SpriteState}\r\n * @return States\r\n */\n get: function get() {\n if (!this._states) {\n var state = new SpriteState(); // works\n\n this._states = new DictionaryTemplate(state); // TODO what about removeKey ?\n\n this._disposers.push(this._states.events.on(\"insertKey\", this.processState, this, false));\n\n this._disposers.push(this._states.events.on(\"setKey\", this.processState, this, false));\n\n this._disposers.push(new DictionaryDisposer(this._states));\n\n this._disposers.push(state);\n }\n\n return this._states;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"hiddenState\", {\n /**\r\n * Returns a [[SpriteState]] object for \"hidden\" state.\r\n *\r\n * This is a shortcut to `this.states.getKey(\"hidden\")`.\r\n *\r\n * @return Hidden state\r\n */\n get: function get() {\n if (!this.states.getKey(\"hidden\")) {\n var hiddenState = this.states.create(\"hidden\");\n hiddenState.properties.opacity = 0;\n hiddenState.properties.visible = false;\n }\n\n return this.states.getKey(\"hidden\");\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"defaultState\", {\n /**\r\n * Returns a [[SpriteState]] object for \"default\" state.\r\n *\r\n * This is a shortcut to `this.states.getKey(\"default\")`.\r\n *\r\n * @return Hidden state\r\n */\n get: function get() {\n if (!this.states.getKey(\"default\")) {\n var defaultState = this.states.create(\"default\");\n defaultState.properties.opacity = 1;\n }\n\n return this.states.getKey(\"default\");\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Checks if some key states are defined and updates Sprite properties\r\n * accordingly.\r\n *\r\n * For example if there's a state \"down\" defined for Sprite, we automatically\r\n * make it \"clickable\".\r\n *\r\n * @ignore Exclude from docs\r\n * @param event An event which caused state list update\r\n */\n\n Sprite.prototype.processState = function (event) {\n var state = event.newValue;\n state.sprite = this;\n state.name = event.key;\n\n if (this.states.hasKey(\"hover\") || this.showTooltipOn == \"hover\" && ($type.hasValue(this.tooltipHTML) || $type.hasValue(this.tooltipText))) {\n this.hoverable = true;\n }\n\n if (this.states.hasKey(\"down\") || this.showTooltipOn == \"hover\" && ($type.hasValue(this.tooltipHTML) || $type.hasValue(this.tooltipText))) {\n this.clickable = true;\n }\n\n if (this.states.hasKey(\"focus\")) {\n this.focusable = true;\n } // Propagate the new state to clones\n\n\n if (this.applyOnClones) {\n var clones = this.clones.values;\n var length_1 = clones.length;\n\n for (var i = 0; i < length_1; ++i) {\n var clone = clones[i];\n\n if (!clone.isDisposed()) {\n clone.states.setKey(state.name, state);\n }\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"animations\", {\n /**\r\n * Returns a list elements's animations currently being played.\r\n *\r\n * If the list has not been initialized it is created.\r\n *\r\n * @return List of animations\r\n */\n get: function get() {\n if (!this._animations) {\n this._animations = [];\n\n this._disposers.push(new AnimationDisposer(this._animations));\n }\n\n return this._animations;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts element's local coordinates to the coordinates within the main\r\n * chart container.\r\n *\r\n * @param point Local point\r\n * @return Global point\r\n */\n\n Sprite.prototype.getSvgPoint = function (point) {\n try {\n // Calculate SVG point\n var bbox = this.htmlContainer.getBoundingClientRect();\n return {\n \"x\": point.x - bbox.left,\n \"y\": point.y - bbox.top\n };\n } catch (e) {\n return point;\n }\n };\n /**\r\n * Creates and starts an [[Animation]] with given `animationOptions`.\r\n *\r\n * @see {@link Animation} for additional information about available options\r\n * @param animationOptions Animation options\r\n * @param duration Duration in milliseconds\r\n * @param easing Easing function\r\n * @return Animation instance\r\n */\n\n\n Sprite.prototype.animate = function (animationOptions, duration, easing) {\n return new Animation(this, animationOptions, duration, easing).start();\n };\n /**\r\n * Applies a [[SpriteState]] on this element.\r\n *\r\n * The first parameter can either be a name state or a [[SpriteState]]\r\n * instance.\r\n *\r\n * When run, this method will apply SVG properties defined in a\r\n * [[SpriteState]], but only those that are relevant to this particular\r\n * element, i.e. are in the `properties` array.\r\n *\r\n * @see {@link SpriteState}\r\n * @param value A state - name key or instance\r\n * @param transitionDuration Duration of the transition between current and new state\r\n * @param easing An easing function\r\n */\n\n\n Sprite.prototype.setState = function (value, transitionDuration, easing) {\n var state;\n\n if (value instanceof SpriteState) {\n this.states.setKey(value.name, value);\n state = value;\n } else {\n state = this.states.getKey(value);\n\n if (!state) {\n return;\n }\n } // stop previous transition\n // not good - foe expample, we are animating to some \"active\" state and in them middle \"hover\" state happens. then \"active\" stat won't be applied\n //if (this._transition) {\n //this._transition.stop();\n //}\n\n\n if (state.name == \"hover\") {\n if (this.isHidden) {\n return;\n }\n\n this.isHover = true;\n }\n\n if (state.name == \"hidden\") {\n this.isHiding = true;\n } else {\n if (!this.visible) {\n this.setVisibility(state.properties.visible || this.defaultState.properties.visible);\n }\n }\n\n if (state.name == \"active\") {\n this.isActive = true;\n } // we do not set isActive = false here if it's not active, but container does that if setStateOnChildren = true\n\n\n if (!$type.isNumber(transitionDuration)) {\n transitionDuration = state.transitionDuration;\n }\n\n if (!$type.hasValue(easing)) {\n easing = state.transitionEasing;\n }\n\n return this.transitTo(state, transitionDuration, easing);\n };\n /**\r\n * Applies proper state based on the condition of the element. A condition is\r\n * deducted in this order:\r\n * * \"hover\" if Sprite has currently any pointers over it\r\n * * \"down\" if Sprite has any pointers (touch or mouse) currently pressed over it\r\n * * \"focus\" if Sprite has currently got focus (accessibility)\r\n * * \"hidden\" if Sprite is currently hidden\r\n *\r\n * Returns an [[Animation]] object, which is handling gradual transition from\r\n * current values of properties, to the new target state(s).\r\n *\r\n * @param duration Duration for the animation (ms)\r\n * @return [[Animation]] object which is handling the transition\r\n */\n\n\n Sprite.prototype.applyCurrentState = function (duration) {\n //if (!this.isHidden) { // this was done for hover state not to take effect if \"hidden\" is actually visible, need to think about it.\n var animation = this.setState(this.defaultState, duration);\n\n if (this.isHover) {\n animation = this.setState(\"hover\", duration);\n }\n\n if (this.isDown && this.interactions.downPointers.length) {\n animation = this.setState(\"down\", duration);\n }\n\n this.isFocused = this.isFocused;\n\n if (this.isActive) {\n animation = this.setState(\"active\", duration);\n\n if (this.isHover && this.states.hasKey(\"hoverActive\")) {\n animation = this.setState(\"hoverActive\", duration);\n }\n }\n\n return animation; //}\n };\n /**\r\n * Starts an [[Animation]] of the properties to specific values as they are\r\n * set in `state`.\r\n *\r\n * @ignore Exclude from docs\r\n * @param state Target State\r\n * @param duration Duration in milliseconds\r\n * @param easing Easing function\r\n * @return Transition Animation\r\n */\n\n\n Sprite.prototype.transitTo = function (state, duration, easing) {\n var _this = this; // Init\n\n\n var options = [],\n propValues = state.allValues,\n transition; // todo: do this for numeric/color properties only?\n // @todo use state.getPropertyValue instead\n\n $object.each(propValues, function (propertyName, finalValue) {\n var currentValue = _this[propertyName]; // save current value to default state. this solves a big problem where values must be set both on sprite and default state\n\n if (finalValue != currentValue && _this.defaultState.properties[propertyName] == undefined) {\n _this.defaultState.properties[propertyName] = currentValue;\n } //if (finalValue != currentValue && $type.hasValue(finalValue)) {\n\n\n if (finalValue != \"__unset\") {\n var option = {\n from: currentValue,\n to: finalValue,\n property: propertyName\n };\n options.push(option);\n }\n });\n\n if (options.length > 0) {\n transition = this.animate(options, duration, easing);\n\n if (transition && !transition.isFinished()) {\n // TODO should this use events.once ?\n // TODO push onto _disposers array ?\n this._disposers.push(transition.events.on(\"animationended\", function () {\n _this.dispatchImmediately(\"transitionended\");\n }));\n } else {\n this.dispatchImmediately(\"transitionended\");\n }\n } // apply filters if set\n\n\n if (state.filters.length > 0) {\n var newFilters_1 = []; // check for the same filters\n\n $iter.each(state.filters.iterator(), function (stateFilter) {\n var newFilter = stateFilter.clone();\n newFilters_1.push(newFilter);\n var animationOptions = [];\n $iter.each(_this.filters.iterator(), function (currentFilter) {\n // if we have the same filters\n if (currentFilter.className == newFilter.className) {\n if (!$iter.contains(_this.defaultState.filters.iterator(), function (x) {\n return x.className === newFilter.className;\n })) {\n _this.defaultState.filters.push(currentFilter);\n }\n\n $object.each(newFilter.properties, function (propertyName, newValue) {\n var currentValue = currentFilter.properties[propertyName]; // if values are not the same, push to animation options array\n\n if (currentValue != newValue) {\n animationOptions.push({\n property: propertyName,\n from: currentValue,\n to: newValue\n });\n }\n });\n }\n }); // animate to new value\n\n newFilter.animate(animationOptions, duration, easing);\n });\n this.filters.clear();\n this.filters.pushAll(newFilters_1);\n }\n\n return transition;\n };\n /**\r\n * Returns `true` if Sprite is currently transiting from one state/value to\r\n * another.\r\n *\r\n * @return Is in transition?\r\n */\n\n\n Sprite.prototype.isInTransition = function () {\n return this.animations.length > 0;\n };\n\n Object.defineProperty(Sprite.prototype, \"isHover\", {\n /**\r\n * @return Is hovered?\r\n */\n get: function get() {\n if (this.isInteractive()) {\n return this.interactions.isHover;\n }\n\n return false;\n },\n\n /**\r\n * Indicates if this element has a mouse pointer currently hovering\r\n * over it, or if it has any touch pointers pressed on it.\r\n *\r\n * You can force element to be \"hovered\" manually, by setting this property\r\n * to `true`.\r\n *\r\n * @param value Is hovered?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (value !== this.isHover) {\n if (this.isInteractive()) {\n this.interactions.isHover = value;\n\n if (value) {\n this.handleOver();\n } else {\n this.interactions.isRealHover = false;\n this.handleOut();\n }\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"isDragged\", {\n /**\r\n * Returns indicator if this element is being dragged at the moment.\r\n *\r\n * @return Is dragged?\r\n */\n get: function get() {\n return this._isDragged;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"isResized\", {\n /**\r\n * Returns indicator if this element is being resized at the moment.\r\n *\r\n * @return Is resized?\r\n */\n get: function get() {\n return this._isResized;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"isDown\", {\n /**\r\n * @return Is down?\r\n */\n get: function get() {\n if (this.isInteractive()) {\n return this.interactions.isDown;\n }\n\n return false;\n },\n\n /**\r\n * Indicates if this element has any pointers (mouse or touch) pressing down\r\n * on it.\r\n *\r\n * @param value Is down?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.isInteractive() && this.isDown != value) {\n this.interactions.isDown = value;\n\n if (value) {\n this.handleDown();\n } else {\n this.handleUp();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"isFocused\", {\n /**\r\n * @return Is focused?\r\n */\n get: function get() {\n if (this.isInteractive()) {\n return this.interactions.isFocused;\n }\n\n return false;\n },\n\n /**\r\n * Indicates if this element is focused (possibly by tab navigation).\r\n *\r\n * @param value Is focused?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.focusable && this.isFocused != value) {\n if (this.isInteractive()) {\n this.interactions.isFocused = value;\n\n if (value === true) {\n this.handleFocus();\n } else {\n this.handleBlur();\n }\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"isActive\", {\n /**\r\n * @return Is active?\r\n */\n get: function get() {\n return this._isActive;\n },\n\n /**\r\n * Indicates if this element is currently active (toggled on) or not\r\n * (toggled off).\r\n *\r\n * @param value Is active?\r\n */\n set: function set(value) {\n this.setActive(value);\n },\n enumerable: true,\n configurable: true\n });\n\n Sprite.prototype.setActive = function (value) {\n value = $type.toBoolean(value);\n\n if (this._isActive !== value) {\n this._isActive = value;\n\n if (value && this.states.hasKey(\"active\")) {\n this.setState(\"active\");\n\n if (this.isHover && this.states.hasKey(\"hoverActive\")) {\n this.setState(\"hoverActive\");\n }\n } else {\n this.applyCurrentState();\n }\n\n this.dispatchImmediately(\"toggled\");\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"disabled\", {\n /**\r\n * @return Disabled?\r\n */\n get: function get() {\n //if(this._internalDisabled){\n //\treturn true;\n //}\n var current = this.getPropertyValue(\"disabled\");\n\n if ($type.hasValue(current)) {\n return current;\n } else {\n if (this.virtualParent) {\n return this.virtualParent.disabled;\n }\n\n if (this._parent) {\n return this._parent.disabled;\n }\n }\n\n return false;\n },\n\n /**\r\n * Controls if element is disabled.\r\n *\r\n * A disabled element is hidden, and is removed from any processing, layout\r\n * calculations, and generally treated as if it does not exist.\r\n *\r\n * The element itself is not destroyed, though. Setting this back to `false`,\r\n * will \"resurrect\" the element.\r\n *\r\n * @param value Disabled?\r\n */\n set: function set(value) {\n this.setDisabled(value);\n },\n enumerable: true,\n configurable: true\n });\n\n Sprite.prototype.setDisabled = function (value) {\n value = $type.toBoolean(value);\n var current = this.getPropertyValue(\"disabled\");\n\n if (current != value) {\n this.setPropertyValue(\"disabled\", value, true);\n\n if (value) {\n this.parent = this._parent;\n this.removeFromInvalids();\n this.group.attr({\n \"display\": \"none\"\n });\n this.dispatch(\"disabled\");\n } else {\n if (this._parent) {\n var group = this._parent.element;\n\n if (!group.hasChild(this.group)) {\n group.add(this.group);\n }\n }\n\n if (this instanceof Container) {\n this.deepInvalidate();\n\n if (this._background) {\n this._background.invalidate();\n }\n } else {\n this.invalidate();\n }\n\n if (!this.__disabled) {\n this.removeSVGAttribute(\"display\");\n }\n\n this.dispatch(\"enabled\");\n }\n\n this.dispatch(\"transformed\");\n system.requestFrame();\n return true;\n }\n\n return false;\n };\n\n Object.defineProperty(Sprite.prototype, \"__disabled\", {\n /**\r\n * @ignore\r\n * @return Disabled?\r\n */\n get: function get() {\n return this._internalDisabled;\n },\n\n /**\r\n * Internal disable method.\r\n *\r\n * Do not use it for disabling elements. Use `disabled` accessor instead.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Disabled?\r\n */\n set: function set(value) {\n if (this._internalDisabled != value) {\n this._internalDisabled = value;\n this._updateDisabled = true;\n this.invalidatePosition(); // better use this instead of invalidate()\n\n if (!value) {\n this.invalidate();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"numberFormatter\", {\n /**\r\n * @return A [[NumberFormatter]] instance to be used\r\n */\n get: function get() {\n if (this._numberFormatter) {\n return this._numberFormatter;\n } else if (this.virtualParent) {\n return this.virtualParent.numberFormatter;\n } else if (this._parent) {\n return this._parent.numberFormatter;\n }\n\n this._numberFormatter = new NumberFormatter();\n this._numberFormatter.language = this.language;\n return this.numberFormatter;\n },\n\n /**\r\n * ==========================================================================\r\n * FORMATTERS AND OTHER EXTERNAL HELPERS\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * A [[NumberFormatter]] instance.\r\n *\r\n * This is used to format numbers.\r\n *\r\n * ```TypeScript\r\n * chart.numberFormatter.numberFormat = \"#,###.#####\";\r\n * ```\r\n * ```JavaScript\r\n * chart.numberFormatter.numberFormat = \"#,###.#####\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"numberFormatter\": {\r\n * \"numberFormat\": \"#,###.#####\"\r\n * }\r\n * }\r\n * ```\r\n *\r\n * You can set a separate instance of formatter for each\r\n * individual element. However that would be unnecessary overhead as\r\n * all elements would automatically inherit formatter from their parents,\r\n * all the way up to the chart itself.\r\n *\r\n *\r\n * @see {@link NumberFormatter} for more info on formatting numbers\r\n * @param value An instance of NumberFormatter\r\n */\n set: function set(value) {\n this._numberFormatter = value;\n this._numberFormatter.language = this.language;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"dateFormatter\", {\n /**\r\n * @return An instance of DateFormatter\r\n */\n get: function get() {\n if (this._dateFormatter) {\n return this._dateFormatter;\n } else if (this.virtualParent) {\n return this.virtualParent.dateFormatter;\n } else if (this._parent) {\n return this._parent.dateFormatter;\n }\n\n this._dateFormatter = new DateFormatter();\n this._dateFormatter.language = this.language;\n return this.dateFormatter;\n },\n\n /**\r\n * A [[DateFormatter]] instance.\r\n *\r\n * This is used to format dates, e.g. on a date axes, balloons, etc.\r\n *\r\n * ```TypeScript\r\n * chart.dateFormatter.dateFormat = \"yyyy-MM-dd\";\r\n * ```\r\n * ```JavaScript\r\n * chart.dateFormatter.dateFormat = \"yyyy-MM-dd\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"dateFormatter\": {\r\n * \"dateFormat\": \"yyyy-MM-dd\"\r\n * }\r\n * }\r\n * ```\r\n *\r\n * You can set a separate instance of formatter for each\r\n * individual element. However that would be unnecessary overhead as\r\n * all elements would automatically inherit formatter from their parents,\r\n * all the way up to the chart itself.\r\n *\r\n * @see {@link DateFormatter} for more info on dates formatting\r\n * @param value An instance of DateFormatter\r\n */\n set: function set(value) {\n this._dateFormatter = value;\n this._dateFormatter.language = this.language;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"durationFormatter\", {\n /**\r\n * @return An instance of DurationFormatter\r\n */\n get: function get() {\n if (this._durationFormatter) {\n return this._durationFormatter;\n } else if (this.virtualParent) {\n return this.virtualParent.durationFormatter;\n } else if (this._parent) {\n return this._parent.durationFormatter;\n }\n\n this._durationFormatter = new DurationFormatter();\n this._durationFormatter.language = this.language;\n return this.durationFormatter;\n },\n\n /**\r\n * A [[DurationFormatter]] instance.\r\n *\r\n * This is used to format numbers as durations, e.g. on a value axes.\r\n *\r\n * You can set a separate instance of formatter for each\r\n * individual element. However that would be unnecessary overhead as\r\n * all elements would automatically inherit formatter from their parents,\r\n * all the way up to the chart itself.\r\n *\r\n * @see {@link DurationFormatter} for more info on durations\r\n * @param value An instance of DurationFormatter\r\n */\n set: function set(value) {\n this._durationFormatter = value;\n this._durationFormatter.language = this.language;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"language\", {\n /**\r\n * @return An instance of Language\r\n */\n get: function get() {\n var language = this._language.get();\n\n if (language) {\n return language;\n } else if (this.virtualParent) {\n return this.virtualParent.language;\n } else if (this._parent) {\n return this._parent.language;\n }\n\n language = new Language();\n this.language = language;\n return language;\n },\n\n /**\r\n * A [[Language]] instance to use for translations.\r\n *\r\n * Normally it is enough to set language for the top-most element - chart.\r\n *\r\n * All other element child elements will automatically re-use that language\r\n * object.\r\n *\r\n * @param value An instance of Language\r\n */\n set: function set(value) {\n var _this = this;\n\n if (this._language.get() !== value) {\n this._language.set(value, value.events.on(\"localechanged\", function (ev) {\n if (_this._numberFormatter) {\n _this._numberFormatter.language = _this.language;\n }\n\n if (_this._dateFormatter) {\n _this._dateFormatter.language = _this.language;\n }\n\n if (_this._durationFormatter) {\n _this._durationFormatter.language = _this.language;\n }\n\n if (_this._exporting.get()) {\n var exporting = _this._exporting.get();\n\n exporting.numberFormatter.language = _this.language;\n exporting.dateFormatter.language = _this.language;\n exporting.durationFormatter.language = _this.language;\n exporting.language = _this.language;\n }\n\n if (_this instanceof Container) {\n _this.deepInvalidate();\n }\n }));\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * ==========================================================================\r\n * DATA-RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Parses the string for meta tags `{tag}` and replaces them with a real\r\n * value. Supports straight up tags referring to the field in data, i.e.\r\n * `{value}` or tags with additional formatting info. E.g.:\r\n *\r\n * ```Text\r\n * {myfield.formatDate(\"yyyy-MM-dd\")}\r\n * {myfield.formatDate()}\r\n * {myfield.formatNumber(\"#,####.00\")}\r\n * {myfield.formatNumber()}\r\n * {myField.formatDuration(\"mm:ss\")}\r\n * ```\r\n *\r\n * Etc.\r\n *\r\n * This method Will automatically detect and use proper formatter for the\r\n * value.\r\n *\r\n * The source value will be looked up in various places: (in order)\r\n * * Sprite's own `dataItem`\r\n * * Sprite's properties\r\n * * Parent's `dataItem`\r\n * * Parent's properties\r\n *\r\n * @ignore Exclude from docs\r\n * @param string A string to format\r\n * @param dataItem DataItem\r\n * @return Formatted string\r\n */\n\n Sprite.prototype.populateString = function (string, dataItem) {\n if ($type.hasValue(string)) {\n string = $type.castString(string);\n string = getTextFormatter().escape(string);\n var tags = string.match(/\\{([^}]+)\\}/g);\n var i = void 0;\n\n if (tags) {\n for (i = 0; i < tags.length; i++) {\n var tag = tags[i].replace(/\\{([^}]+)\\}/, \"$1\");\n var value = this.getTagValue(tag, \"\", dataItem);\n\n if (!$type.hasValue(value)) {\n value = \"\";\n }\n\n string = string.split(tags[i]).join(value);\n }\n }\n\n string = getTextFormatter().unescape(string);\n } else {\n string = \"\";\n }\n\n if (!this._adapterO) {\n return string;\n } else {\n return this._adapterO.apply(\"populateString\", string);\n }\n };\n /**\r\n * Gets the value from data item and formats it according to specified format.\r\n *\r\n * If `format` is specified, it will use its contents to choose formatter for\r\n * the value. Otherwise it will select formatter accordingly to actual value\r\n * type.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Ability to force certain formatter on known numeric and date values\r\n * @see {@link NumberFormatter}\r\n * @see {@link DateFormatter}\r\n * @see {@link DurationFormatter}\r\n * @param tagName Tag name to replace\r\n * @param format Format to use\r\n * @param dataItem DataItem\r\n * @return Formatted value\r\n */\n\n\n Sprite.prototype.getTagValue = function (tagName, format, dataItem) {\n var value;\n\n if (!$type.hasValue(dataItem)) {\n dataItem = this.dataItem;\n } // Parse parts\n\n\n var parts = [];\n var reg = /([^.]+)\\(([^)]*)\\)|([^.]+)/g;\n ;\n var matches;\n\n while (true) {\n matches = reg.exec(tagName);\n\n if (matches === null) {\n break;\n }\n\n if (matches[3]) {\n // Simple property\n parts.push({\n prop: matches[3]\n });\n } else {\n // Method\n // Parse parameters\n var params = [];\n\n if ($utils.trim(matches[2]) != \"\") {\n var reg2 = /'([^']*)'|\"([^\"]*)\"|([0-9\\-]+)/g;\n var matches2 = void 0;\n\n while (true) {\n matches2 = reg2.exec(matches[2]);\n\n if (matches2 === null) {\n break;\n }\n\n params.push(matches2[1] || matches2[2] || matches2[3]);\n }\n }\n\n parts.push({\n method: matches[1],\n params: params\n });\n }\n } // Check if we can retrieve the value from data item\n\n\n if (dataItem) {\n // Check values\n value = this.getTagValueFromObject(parts, dataItem.values); // Check properties\n\n if (!$type.hasValue(value) || $type.isObject(value)) {\n // isObject helps to solve problem with date axis, as for example dateX will get dateX from values object and won't get to the dateX date.\n value = this.getTagValueFromObject(parts, dataItem);\n } // Check data context\n\n\n var dataContext = dataItem.dataContext;\n\n if (!$type.hasValue(value) && dataContext) {\n value = this.getTagValueFromObject(parts, dataItem.dataContext); // Maybe it's a literal dot-separated name of the key in dataContext?\n\n if (!$type.hasValue(value)) {\n value = this.getTagValueFromObject([{\n prop: tagName\n }], dataContext);\n } // scond data context level sometimes exist (tree map)\n\n\n if (!$type.hasValue(value) && dataContext.dataContext) {\n value = this.getTagValueFromObject(parts, dataContext.dataContext);\n }\n } // Check component's data item\n\n\n if (!$type.hasValue(value) && dataItem.component && dataItem.component.dataItem !== dataItem) {\n value = dataItem.component.getTagValue(tagName, format);\n }\n } // Check sprite's properties\n\n\n if (!$type.hasValue(value)) {\n value = this.getTagValueFromObject(parts, this.populateStringFrom || this);\n } // Finally, check the parent\n\n\n if (!$type.hasValue(value) && this._parent) {\n value = this._parent.getTagValue(tagName, format);\n }\n\n return value;\n };\n /**\r\n * Tries to retrieve values from properties of any object, then applies\r\n * proper formatting to it.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (improve)\r\n * @param parts Properties ant methods to access\r\n * @param object Source object\r\n * @param format A specific format to apply\r\n * @return Formatted value\r\n */\n\n\n Sprite.prototype.getTagValueFromObject = function (parts, object, format) {\n var current = object;\n var formatApplied = false;\n\n for (var i = 0, len = parts.length; i < len; i++) {\n var part = parts[i];\n\n if (part.prop) {\n // Regular property\n current = current[part.prop];\n\n if (!$type.hasValue(current)) {\n // Not set, return undefined\n return;\n }\n } else {\n // Method\n switch (part.method) {\n case \"formatNumber\":\n var numberValue = $utils.anyToNumber(current);\n\n if ($type.hasValue(numberValue)) {\n current = this.numberFormatter.format(numberValue, format || part.params[0] || undefined);\n formatApplied = true;\n }\n\n break;\n\n case \"formatDate\":\n var dateValue = void 0;\n\n if ($type.isString(current)) {\n dateValue = this.dateFormatter.parse(current);\n } else {\n dateValue = $utils.anyToDate(current);\n }\n\n if (!$type.isDate(dateValue) || $type.isNaN(dateValue.getTime())) {\n // Was not able to get date out of value, quitting and letting\n // calling method try another value\n return;\n }\n\n if ($type.hasValue(dateValue)) {\n current = this.dateFormatter.format(dateValue, format || part.params[0] || undefined);\n formatApplied = true;\n }\n\n break;\n\n case \"formatDuration\":\n var durationValue = $utils.anyToNumber(current);\n\n if ($type.hasValue(durationValue)) {\n current = this.durationFormatter.format(durationValue, format || part.params[0] || undefined, part.params[1] || undefined);\n formatApplied = true;\n }\n\n break;\n\n case \"urlEncode\":\n case \"encodeURIComponent\":\n current = encodeURIComponent(current);\n break;\n\n default:\n if (current[part.method]) {\n current[part.method].apply(this, part.params);\n }\n\n break;\n }\n }\n } // Apply default format if it wasn't applied explicitly\n\n\n if (!formatApplied) {\n var formatParts = [{\n method: \"\",\n params: format\n }];\n\n if (!$type.hasValue(format)) {\n // Format is not set\n // Determine from the type of the value\n if ($type.isNumber(current)) {\n formatParts[0].method = \"formatNumber\";\n formatParts[0].params = \"\";\n } else if ($type.isDate(current)) {\n formatParts[0].method = \"formatDate\";\n formatParts[0].params = \"\";\n }\n } else {\n // Format set\n // Try to determine formatter based on the format\n var formatterType = $utils.getFormat(format); // format\n\n if (formatterType === $strings.NUMBER) {\n formatParts[0].method = \"formatNumber\";\n } else if (formatterType === $strings.DATE) {\n formatParts[0].method = \"formatDate\";\n } else if (formatterType === $strings.DURATION) {\n formatParts[0].method = \"formatDuration\";\n }\n } // Apply format\n\n\n if (formatParts[0].method) {\n current = this.getTagValueFromObject(formatParts, current);\n }\n }\n\n return current;\n };\n\n Object.defineProperty(Sprite.prototype, \"dataItem\", {\n /**\r\n * @return [[DataItem]]\r\n */\n get: function get() {\n if (!this._dataItem) {\n if (this.virtualParent) {\n return this.virtualParent.dataItem;\n }\n\n if (this._parent) {\n return this._parent.dataItem;\n }\n }\n\n return this._dataItem;\n },\n\n /**\r\n * A [[DataItem]] to use as element's data source.\r\n *\r\n * @todo Review type\r\n * @param dataItem DataItem\r\n */\n set: function set(dataItem) {\n //an not use this[\"_dataItem\"] here, as we return parent data item if this sprite doesn't have one.\n // @todo:think about it\n this.setDataItem(dataItem);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets currently used [[DataItem]].\r\n *\r\n * If the element has also `configField` set, it will also look for any\r\n * config in DataItem's data context to apply to this element.\r\n *\r\n * @param dataItem DataItem\r\n */\n\n Sprite.prototype.setDataItem = function (dataItem) {\n var _this = this;\n\n if (this._dataItem != dataItem) {\n this._dataItem = dataItem;\n\n if (dataItem) {\n if (this.configField) {\n var dataContext_1 = dataItem.dataContext;\n\n if (dataContext_1) {\n this.config = dataContext_1[this.configField];\n\n if (!this.config && dataContext_1.dataContext) {\n this.config = dataContext_1.dataContext[this.configField];\n }\n }\n }\n\n var dataContext_2 = dataItem.dataContext;\n\n if (dataContext_2) {\n var dataContext2_1 = dataContext_2.dataContext;\n $object.each(this.propertyFields, function (propertyName, fieldValue) {\n if ($type.hasValue(dataContext_2[fieldValue])) {\n var anyThis = _this;\n anyThis[propertyName] = dataContext_2[fieldValue];\n } else {\n if (dataContext2_1) {\n var value = dataContext2_1[fieldValue];\n\n if ($type.hasValue(value)) {\n var anyThis = _this;\n anyThis[propertyName] = value;\n }\n }\n }\n });\n }\n }\n\n this.invalidate();\n }\n };\n /**\r\n * ==========================================================================\r\n * PROPERTY UTILITIES\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns element's property value.\r\n *\r\n * Will check if there are any bindings with [[DataItem]].\r\n *\r\n * Will also apply any adapters bound to `propertyName`.\r\n *\r\n * @param propertyName Property name\r\n * @return Property value\r\n */\n\n\n Sprite.prototype.getPropertyValue = function (propertyName) {\n var propValue = this.properties[propertyName]; // Apply adapter\n\n if (!this._isTemplate) {\n if (this._adapterO) {\n propValue = this._adapterO.apply(propertyName, propValue);\n }\n\n propValue = globalAdapter.applyAll(this, propertyName, propValue);\n }\n\n return propValue;\n };\n\n Sprite.prototype.setColorProperty = function (property, value, invalidate) {\n var currentValue = this.properties[property];\n\n if (value instanceof Color && currentValue instanceof Color && value.toString() == currentValue.toString()) {\n return false;\n } else {\n return this.setPropertyValue(property, value, invalidate);\n }\n };\n\n Sprite.prototype.setPercentProperty = function (property, value, invalidate, transform, precision, floor) {\n value = $type.toNumberOrPercent(value);\n\n if ($type.isNumber(value)) {\n if ($type.isNumber(precision)) {\n value = $math.round(value, precision, floor);\n }\n\n return this.setPropertyValue(property, value, invalidate, transform);\n } else {\n var currentValue = this.properties[property];\n\n if (value instanceof Percent && currentValue instanceof Percent && value.value == currentValue.value) {\n return false;\n } else {\n return this.setPropertyValue(property, value, invalidate, transform);\n }\n }\n };\n /**\r\n * Sets elements's property value. Will also propagate the same property value\r\n * on all element's clones.\r\n *\r\n * @param property Property\r\n * @param value Value\r\n * @param invalidate Should the sprite be invalidated, cause it's re-rendering\r\n * @param transform Re-apply positioning of the element\r\n * @return Did the value change? It will return `true` if the new value and the old value of the property are not the same\r\n * @todo Review propagation to clones. Right now we simply check if clone is disposed before setting the same property on it. It's better to remove from clone list altogether.\r\n */\n\n\n Sprite.prototype.setPropertyValue = function (property, value, invalidate, transform) {\n if (this.properties[property] !== value && !this.isDisposed()) {\n this.properties[property] = value;\n\n if (this.events.isEnabled(\"propertychanged\")) {\n var event_1 = {\n type: \"propertychanged\",\n target: this,\n property: property\n };\n this.events.dispatchImmediately(\"propertychanged\", event_1);\n }\n\n if (invalidate) {\n this.invalidate();\n }\n\n if (transform) {\n this.invalidatePosition();\n }\n\n if (this.applyOnClones) {\n var clones = this.clones.values;\n var length_2 = clones.length;\n\n for (var i = 0; i < length_2; ++i) {\n var clone = clones[i];\n\n if (!clone.isDisposed()) {\n //(<Sprite>clone).setPropertyValue(<any>property, value, invalidate, transform);\n clone[property] = value;\n }\n }\n }\n\n return true;\n }\n\n return false;\n };\n\n Sprite.prototype.bind = function (property, source, bindToProperty, modifier) {\n var _this = this;\n\n if (bindToProperty === void 0) {\n bindToProperty = property;\n }\n\n if ($type.hasValue(this._bindings[property])) {\n this._bindings[property].dispose();\n } // set current value\n\n\n this[property] = source[bindToProperty]; //source.addEventListener(AMEvent.PROPERTY_CHANGED, this.handleBindings, false, this);\n\n this._bindings[property] = source.events.on(\"propertychanged\", function (event) {\n if (event.property === bindToProperty) {\n var value = source[bindToProperty];\n\n if (modifier) {\n value = modifier(value);\n } // TODO clonesById\n\n\n _this[property] = value;\n }\n });\n };\n /**\r\n * Sets up and obeserver function to monitor changes in particular property\r\n * or properties.\r\n *\r\n * @ignore Exclude from docs\r\n * @param property Element's property name\r\n * @param listener Handler function\r\n * @param context Context for handler function\r\n * @returns Event Disposer\r\n */\n\n\n Sprite.prototype.observe = function (property, listener, context, shouldClone) {\n var _this = this;\n\n return new MultiDisposer($array.map($array.toArray(property), function (prop) {\n return _this.events.on(\"propertychanged\", function (e) {\n if (e.property === prop) {\n listener.call(context, e);\n }\n }, context, shouldClone);\n }));\n };\n /**\r\n * ==========================================================================\r\n * ACCESSIBILITY-RELATED PROPERTIES\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Applies accessibility to the SVG element.\r\n *\r\n * Adds `<title>` and `<description>` elements as well as `aria-labelledby`\r\n * and `role` properties.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.applyAccessibility = function () {\n // Check if we need to add label and description\n var title = this.readerTitle,\n description = this.readerDescription,\n role = this.role,\n hidden = this.readerHidden,\n checked = this.readerChecked,\n controls = this.readerControls,\n live = this.readerLive,\n orientation = this.readerOrientation,\n valueNow = this.readerValueNow,\n valueText = this.readerValueText; // Init label/describe ids\n\n var labelledByIds = [];\n var describedByIds = [];\n var labelledBy = this.readerLabelledBy;\n\n if (labelledBy) {\n labelledByIds.push(labelledBy);\n }\n\n var describedBy = this.readerDescribedBy;\n\n if (describedBy) {\n describedByIds.push(describedBy);\n } // Add arial-label attribute if present\n // If not readerTitle and labelledBy is set we will use <title> element\n // instead of aria-label\n // TODO: should we check agains this.showSystemTooltip?\n\n\n if (title) {\n if (labelledByIds.length || this.showSystemTooltip) {\n var titleElement = this.titleElement;\n var titleId = this.uid + \"-title\";\n\n if (titleElement.node.textContent != title) {\n titleElement.node.textContent = title;\n titleElement.attr({\n id: titleId\n });\n }\n\n labelledByIds.push(titleId);\n } else {\n if (this._titleElement) {\n this.group.removeElement(this._titleElement);\n this._titleElement = undefined;\n }\n\n this.setSVGAttribute({\n \"aria-label\": title\n });\n }\n } else {\n this.removeSVGAttribute(\"aria-label\");\n\n if (this._titleElement) {\n this.group.removeElement(this._titleElement);\n this._titleElement = undefined;\n }\n } // Add description\n\n\n if (description) {\n var descriptionElement = this.descriptionElement;\n var descriptionId = this.uid + \"-description\";\n\n if (descriptionElement.node.textContent != description) {\n descriptionElement.node.textContent = description;\n descriptionElement.attr({\n id: descriptionId\n });\n }\n\n describedByIds.push(descriptionId);\n } else if (this._descriptionElement) {\n this.group.removeElement(this._descriptionElement);\n this._descriptionElement = undefined;\n } // Add label and described properties\n\n\n if (labelledByIds.length) {\n this.setSVGAttribute({\n \"aria-labelledby\": labelledByIds.join(\" \")\n });\n } else {\n this.removeSVGAttribute(\"aria-labelledby\");\n }\n\n if (describedByIds.length) {\n this.setSVGAttribute({\n \"aria-describedby\": describedByIds.join(\" \")\n });\n } else {\n this.removeSVGAttribute(\"aria-describedby\");\n } // Apply role\n\n\n if (role) {\n this.setSVGAttribute({\n \"role\": role\n });\n } else {\n this.removeSVGAttribute(\"role\");\n } // Apply aria-hidden\n\n\n if (hidden) {\n this.setSVGAttribute({\n \"aria-hidden\": \"true\"\n });\n } else {\n this.removeSVGAttribute(\"aria-hidden\");\n } // Apply aria-checked\n\n\n if (checked) {\n this.setSVGAttribute({\n \"aria-checked\": \"true\"\n });\n } else if (checked === false) {\n this.setSVGAttribute({\n \"aria-checked\": \"false\"\n });\n } else {\n this.removeSVGAttribute(\"aria-checked\");\n } // Apply aria-controls\n\n\n if (controls) {\n this.setSVGAttribute({\n \"aria-controls\": controls\n });\n } else {\n this.removeSVGAttribute(\"aria-controls\");\n } // Apply aria-live\n\n\n if (live) {\n this.setSVGAttribute({\n \"aria-live\": live\n });\n } else {\n this.removeSVGAttribute(\"aria-live\");\n } // Apply aria-orientation\n\n\n if (orientation) {\n this.setSVGAttribute({\n \"aria-orientation\": orientation\n });\n } else {\n this.removeSVGAttribute(\"aria-orientation\");\n } // Apply aria-valuenow\n\n\n if (valueNow) {\n this.setSVGAttribute({\n \"aria-valuenow\": valueNow\n });\n } else {\n this.removeSVGAttribute(\"aria-valuenow\");\n } // Apply aria-valuetext\n\n\n if (valueText) {\n this.setSVGAttribute({\n \"aria-valuetext\": valueText\n });\n } else {\n this.removeSVGAttribute(\"aria-valuetext\");\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"readerTitle\", {\n /**\r\n * @return Title\r\n */\n get: function get() {\n var title = this.getPropertyValue(\"readerTitle\");\n\n if ($type.hasValue(title) && this.dataItem) {\n return this.populateString(title);\n }\n\n return title;\n },\n\n /**\r\n * Screen reader title of the element.\r\n *\r\n * @param value Title\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerTitle\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerDescription\", {\n /**\r\n * @return Description\r\n */\n get: function get() {\n var description = this.getPropertyValue(\"readerDescription\");\n\n if ($type.hasValue(description) && this.dataItem) {\n return this.populateString(description);\n }\n\n return this.getPropertyValue(\"readerDescription\");\n },\n\n /**\r\n * Screen reader description of the element.\r\n *\r\n * @param value Description\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerDescription\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"role\", {\n /**\r\n * @return Role\r\n */\n get: function get() {\n return this.getPropertyValue(\"role\");\n },\n\n /**\r\n * A WAI-ARIA role for the element.\r\n *\r\n * @see {@link https://www.w3.org/TR/wai-aria-1.1/#role_definitions} for more information on WAI-ARIA roles\r\n * @param value Role\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"role\", value)) {\n this.applyAccessibility();\n\n if (value == \"slider\") {\n this.setSVGAttribute({\n \"aria-valuemin\": \"0\"\n });\n this.setSVGAttribute({\n \"aria-valuemax\": \"100\"\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerHidden\", {\n /**\r\n * @return Hidden?\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerHidden\");\n },\n\n /**\r\n * Controls if element should be hidden from screen readers.\r\n *\r\n * @see {@link https://www.w3.org/TR/wai-aria-1.1/#aria-hidden} for more information\r\n * @param value Hidden?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"readerHidden\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerChecked\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Checked?\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerChecked\");\n },\n\n /**\r\n * Controls if element is currently marked as \"checked\".\r\n *\r\n * @ignore Exclude from docs\r\n * @see {@link https://www.w3.org/TR/wai-aria-1.1/#aria-checked} for more information\r\n * @param value Checked?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"readerChecked\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerControls\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Setting value\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerControls\");\n },\n\n /**\r\n * A `uid` of an element this element controls.\r\n *\r\n * @ignore Exclude from docs\r\n * @see {@link https://www.w3.org/TR/wai-aria-1.1/#aria-controls} for more information\r\n * @param value Setting value\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerControls\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerLive\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Setting value\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerLive\");\n },\n\n /**\r\n * Controls accessibility setting \"aria-live\" for the element.\r\n *\r\n * @ignore Exclude from docs\r\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/Accessibility/ARIA/ARIA_Live_Regions} for more information\r\n * @param value Setting value\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerLive\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerLabelledBy\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Target element\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerLabelledBy\");\n },\n\n /**\r\n * A `uid` of an element that describes this element.\r\n *\r\n * @ignore Exclude from docs\r\n * @see {@link https://www.w3.org/TR/wai-aria-1.1/#aria-labelledby} for more information\r\n * @param value Target element\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerLabelledBy\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerDescribedBy\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Target element\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerDescribedBy\");\n },\n\n /**\r\n * A `uid` of an element that describes this element.\r\n *\r\n * @ignore Exclude from docs\r\n * @see {@link https://www.w3.org/TR/wai-aria-1.1/#aria-describedby} for more information\r\n * @param value Target element\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerDescribedBy\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerOrientation\", {\n /**\r\n * @return Orientation\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerOrientation\");\n },\n\n /**\r\n * Orientation of the element.\r\n *\r\n * @since 4.7.16\r\n * @param value Orientation\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerOrientation\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerValueNow\", {\n /**\r\n * @return Current value\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerValueNow\");\n },\n\n /**\r\n * Current value of the element.\r\n *\r\n * @since 4.7.16\r\n * @param value Current value\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerValueNow\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"readerValueText\", {\n /**\r\n * @return Current value (text)\r\n */\n get: function get() {\n return this.getPropertyValue(\"readerValueText\");\n },\n\n /**\r\n * Text representation of the current value of the element.\r\n *\r\n * @since 4.7.16\r\n * @param value Current value (text)\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerValueText\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"keyboardOptions\", {\n /**\r\n * ==========================================================================\r\n * USER INTERACTIONS\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns elements keyboard options.\r\n *\r\n * @return Keyboard options\r\n */\n get: function get() {\n if (!this.interactions.keyboardOptions) {\n if (this.virtualParent) {\n return this.virtualParent.keyboardOptions;\n }\n\n if (this._parent) {\n return this._parent.keyboardOptions;\n }\n }\n\n return this.interactions.keyboardOptions;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"mouseOptions\", {\n /**\r\n * Mouse options.\r\n *\r\n * Enables controlling options related to the mouse, for example sensitivity\r\n * of its mouse wheel.\r\n *\r\n * E.g. the below will reduce chart's wheel-zoom speed to half its default\r\n * speed:\r\n *\r\n * ```TypeScript\r\n * chart.plotContainer.mouseOptions.sensitivity = 0.5;\r\n * ```\r\n * ```JavaScript\r\n * chart.plotContainer.mouseOptions.sensitivity = 0.5;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"plotContainer\": {\r\n * \"mouseOptions\": {\r\n * \"sensitivity\": 0.5\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * @return Mouse options\r\n */\n get: function get() {\n if (!this.interactions.mouseOptions) {\n if (this.virtualParent) {\n return this.virtualParent.mouseOptions;\n }\n\n if (this._parent) {\n return this._parent.mouseOptions;\n }\n }\n\n return this.interactions.mouseOptions;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"interactions\", {\n /**\r\n * Returns (creates if necessary) an [[InteractionObject]] associated with\r\n * this element.\r\n *\r\n * [[InteractionObject]] is used to attach all kinds of user-interactions to\r\n * the element, e.g. click/touch, dragging, hovering, and similar events.\r\n *\r\n * @return Interaction object\r\n */\n get: function get() {\n if (!this._interaction) {\n var interaction = getInteraction().getInteraction(this.dom);\n this._interaction = interaction;\n this._interaction.clickable = this.clickable;\n this._interaction.hoverable = this.hoverable;\n this._interaction.trackable = this.trackable;\n this._interaction.draggable = this.draggable;\n this._interaction.swipeable = this.swipeable;\n this._interaction.resizable = this.resizable;\n this._interaction.wheelable = this.wheelable;\n this._interaction.contextMenuDisabled = this.contextMenuDisabled;\n this._interaction.inert = this.inert;\n this._interaction.sprite = this;\n\n this._disposers.push(this._interaction);\n }\n\n return this._interaction;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns true if interactions object was created. Mostly used just to avoid creating interactions object if not needed.\r\n * @return Is Sprite interactive?\r\n */\n\n Sprite.prototype.isInteractive = function () {\n if (this._interaction) {\n return true;\n } else {\n return false;\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"focusable\", {\n /**\r\n * @return Can element be focused?\r\n */\n get: function get() {\n return this.getPropertyValue(\"focusable\");\n },\n\n /**\r\n * ==========================================================================\r\n * ELEMENT FOCUS-RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Controls if the element can gain focus.\r\n *\r\n * Focusable element will be selectable via TAB key.\r\n *\r\n * Please note, clicking it with a mouse or touching will not add focus to\r\n * it.\r\n *\r\n * Focused element will show a system-specific highlight, which might ruin\r\n * the overal look. This is why we don't focus element on click/touch.\r\n *\r\n * A default setting varies for different elements. By default all elements\r\n * are not focusable, except certain items like buttons, legend items, etc.\r\n *\r\n * @default undefined (auto)\r\n * @param value Can element be focused?\r\n */\n set: function set(value) {\n var _this = this;\n\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"focusable\", value)) {\n if (!value && !this.isInteractive()) {} else {\n this.interactions.focusable = value;\n\n if (value) {\n this.setSVGAttribute({\n \"focusable\": value\n });\n\n if (!this._tabindex) {\n this.tabindex = 0;\n }\n } else {\n this.removeSVGAttribute(\"focusable\");\n this.tabindex = undefined;\n } // Set focus events that would apply \"focus\" state\n // setEventDisposer will also remove listeners if value == false\n\n\n this.interactions.setEventDisposer(\"sprite-focusable\", value, function () {\n return new MultiDisposer([_this.events.on(\"blur\", _this.handleBlur, _this, false), _this.events.on(\"focus\", _this.handleFocus, _this, false)]);\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Applies filters (if set) when element gains focus.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Original event\r\n */\n\n Sprite.prototype.handleFocus = function (ev) {\n if (this.focusable) {\n if (this.topParent) {\n this.topParent.hasFocused = true;\n this.topParent.focusedElement = this;\n }\n\n if (this.focusFilter) {\n // Any `filters` manipulation will trigger `applyFilters()` so we don't\n // need to call it here\n this.filters.push(this.focusFilter);\n }\n\n if (this.hoverOnFocus) {\n // Trigger a hover event as well\n this.isHover = true;\n this.handleOver();\n }\n }\n };\n /**\r\n * Removes focus filter (if set) when elementloses focus.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Original event\r\n */\n\n\n Sprite.prototype.handleBlur = function (ev) {\n if (this.focusable) {\n if (this.topParent) {\n this.topParent.hasFocused = false;\n this.topParent.focusedElement = undefined;\n }\n\n if (this.focusFilter) {\n // Any `filters` manipulation will trigger `applyFilters()` so we don't\n // need to call it here\n this.filters.removeValue(this.focusFilter);\n }\n\n if (this.hoverOnFocus) {\n // Trigger a out event as well\n this.isHover = false;\n this.handleOut();\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"focusFilter\", {\n /**\r\n * A reference to a [[Filter]] to apply to element when it gains focus.\r\n *\r\n * Normally, browsers will draw a default ugly square around focused element,\r\n * which totally makes sense because its purpose is to help identify active\r\n * element for visually impaired people.\r\n *\r\n * However, if you would rather apply a filter, so you can modify how focused\r\n * element looks like, use `focusFilter`.\r\n *\r\n * Simply set it to an anstance of [[FocusFilter]], or any other filter\r\n * object.\r\n *\r\n * ```TypeScript\r\n * chart.focusFilter = new am4core.FocusFilter();\r\n * ```\r\n * ```JavaScript\r\n * chart.focusFilter = new am4core.FocusFilter();\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"focusFilter\": {\r\n * \"type\": \"FocusFilter\"\r\n * },\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @see {@link Filter}\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/accessibility/} more about accessibility\r\n * @see {@link https://www.amcharts.com/docs/v4/tutorials/changing-appearance-of-focused-items/} cusomizing focus appearance\r\n * @ignore Exclude from docs\r\n * @return Focused element filter\r\n */\n get: function get() {\n /*if (!this._focusFilter) {\r\n this._focusFilter = new FocusFilter();\r\n this._disposers.push(this._focusFilter);\r\n }*/\n //return this._focusFilter;\n var focusFilter = this._focusFilter;\n\n if (focusFilter) {\n return focusFilter;\n }\n\n if (this.virtualParent) {\n return this.virtualParent.focusFilter;\n } else if (this._parent) {\n return this._parent.focusFilter;\n } //this._focusFilter = new FocusFilter();\n //this._disposers.push(this._focusFilter);\n\n },\n\n /**\r\n * @see {@link Filter}\r\n * @ignore Exclude from docs\r\n * @todo This is still experimental, don't use it\r\n */\n set: function set(value) {\n this._focusFilter = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"hoverOnFocus\", {\n /**\r\n * @return Trigger hover on focus?\r\n */\n get: function get() {\n return this.getPropertyValue(\"hoverOnFocus\");\n },\n\n /**\r\n * If set to `true`, this element will also trigger `\"over\"` event with all\r\n * the related consequences, like \"hover\" state being applied and tooltip\r\n * being shown.\r\n *\r\n * Useful as an accessibility feature to display rollover tooltips on items\r\n * selected via keyboard.\r\n *\r\n * @param value Trigger hover on focus?\r\n * @default false\r\n */\n set: function set(value) {\n if (value !== this.hoverOnFocus) {\n this.setPropertyValue(\"hoverOnFocus\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tabindex\", {\n /**\r\n * @return TAB index\r\n */\n get: function get() {\n var index = this._tabindex;\n\n if (index != null) {\n return index;\n } else if (this.virtualParent) {\n return this.virtualParent.tabindex;\n } else if (this._parent) {\n return this._parent.tabindex;\n }\n },\n\n /**\r\n * Sets or returns TAB index.\r\n *\r\n * Tab index maintains the order in which focusable elements gain focus when\r\n * TAB key is pressed.\r\n *\r\n * Please note, tab index is not local to the chart. It affects the whole\r\n * of the page, including non-SVG elements. Maintain extreme causion when\r\n * setting tab indexes, as it affects the user experience for the whole\r\n * web page.\r\n *\r\n * @param value TAB index\r\n */\n set: function set(value) {\n value = $type.toNumber(value);\n\n if (this.setPropertyValue(\"tabindex\", value) && $type.isNumber(value)) {\n this.interactions.tabindex = value;\n this.setSVGAttribute({\n \"tabindex\": value\n });\n this._tabindex = value;\n\n if (value > -1) {\n this.focusable = true;\n } else {\n this.focusable = undefined;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"inertiaOptions\", {\n /**\r\n * ==========================================================================\r\n * DRAGGING AND RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns element's options to be used for inertia. This setting is\r\n * inheritable, meaning that if not set directly, it will search in all its\r\n * ascendants until very top.\r\n *\r\n * Inertia is used only if element's `inert` is set to `true`.\r\n *\r\n * \"Inert\" element, when dragged and released, will carry the momentum of the\r\n * movement, and will continue moving in the same drag direction, gradually\r\n * reducing in speed until finally stops.\r\n *\r\n * Check [[IInertiaOptions]] for how you tweak inertia animations.\r\n *\r\n * @return Inertia options\r\n */\n get: function get() {\n if (!this.interactions.inertiaOptions) {\n if (this._parent) {\n return this._parent.inertiaOptions;\n }\n }\n\n return this.interactions.inertiaOptions;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"draggable\", {\n /**\r\n * @return `true` if element can be dragged\r\n */\n get: function get() {\n return this.getPropertyValue(\"draggable\");\n },\n\n /**\r\n * Controls if the element is draggable.\r\n *\r\n * @param value `true` if element can be dragged\r\n */\n set: function set(value) {\n var _this = this;\n\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"draggable\", value)) {\n if (!value && !this.isInteractive()) {} else {\n this.applyCursorStyle();\n this.interactions.draggable = value; //interaction.processDraggable(this);\n // Add events\n // @todo Maybe attach to InteractionObject's multidisposer so that\n // sprites events get disposed together with them?\n // this.interactions.disposers.getItem(\"movable\")\n // setEventDisposer will also remove listeners if value == false\n\n this.interactions.setEventDisposer(\"sprite-draggable\", value, function () {\n return new MultiDisposer([_this.events.on(\"down\", _this.handleDown, _this, false), _this.events.on(\"dragstart\", _this.handleDragStart, _this, false), _this.events.on(\"drag\", _this.handleDragMove, _this, false), _this.events.on(\"dragstop\", _this.handleDragStop, _this, false)]);\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Executes when dragged element is being started to drag.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Sprite.prototype.handleDragStart = function (ev) {\n if (!this.interactions.isTouchProtected || !ev.touch) {\n this.interactions.originalPosition = {\n x: this.pixelX,\n y: this.pixelY\n };\n this._isDragged = true;\n this.hideTooltip(0);\n }\n };\n /**\r\n * Tell this element to start being dragged. This is useful if you want to\r\n * drag items by interactions performed not directly on the target element.\r\n *\r\n * Parameter `pointer` is highly recommended. By passing in the Pointer you\r\n * will ensure that movement is tracked for the pointer that you want. If not\r\n * supplied, the system will try to determine the most logical pointer.\r\n *\r\n * However this may fail if you have more than one pointer active, which\r\n * might happen if you have several objects being dragged on a touch device.\r\n *\r\n * @ignore Exclude from docs\r\n * @param pointer Pointer to use for movement\r\n */\n\n\n Sprite.prototype.dragStart = function (pointer) {\n //this.dragStop(pointer);\n //this.draggable = true;\n this._isDragged = true;\n getInteraction().dragStart(this.interactions, pointer);\n };\n /**\r\n * Executes when dragged element is being dropped.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype.handleDragStop = function (ev) {\n if (!this.interactions.isTouchProtected || !ev.touch) {\n this._isDragged = false;\n this.showTooltip();\n this.interactions.originalPosition = undefined;\n }\n };\n /**\r\n * Stops manually initiated dragging of the element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param pointer Pointer to use as a reference\r\n */\n\n\n Sprite.prototype.dragStop = function (pointer, cancelled) {\n //this.draggable = false;\n this._isDragged = false;\n getInteraction().dragStop(this.interactions, pointer, cancelled); //this.handleDragStop();\n };\n /**\r\n * Executes when {Sprite} is being dragged.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Event object\r\n * @todo Implement parent position offset calculation\r\n */\n\n\n Sprite.prototype.handleDragMove = function (ev) {\n if (!this.interactions.isTouchProtected || !ev.touch) {\n var point = this.interactions.originalPosition;\n\n if (point && this._isDragged) {\n var globalScale = this._parent.globalScale * this.svgContainer.cssScale;\n this.moveTo({\n x: point.x + ev.shift.x / globalScale,\n y: point.y + ev.shift.y / globalScale\n }, undefined, undefined, true);\n }\n\n this.dispatchImmediately(\"dragged\", ev);\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"inert\", {\n /**\r\n * @return `true` if element should use inertia when animated\r\n */\n get: function get() {\n return this.getPropertyValue(\"inert\");\n },\n\n /**\r\n * Controls if the element should use inertia when interacted with.\r\n *\r\n * \"Inert\" element, when dragged and released, will carry the momentum of the\r\n * movement, and will continue moving in the same drag direction, gradually\r\n * reducing in speed until finally stops.\r\n *\r\n * @default false\r\n * @param value `true` if element should use inertia when animated\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"inert\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n this.interactions.inert = value;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"hoverOptions\", {\n /**\r\n * ==========================================================================\r\n * HOVERING\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns Sprite's hover options.\r\n *\r\n * @see {@link IHoverOptions} for available options.\r\n * @return Options\r\n */\n get: function get() {\n if (!this.interactions.hoverOptions) {\n if (this.virtualParent) {\n return this.virtualParent.hoverOptions;\n }\n\n if (this._parent) {\n return this._parent.hoverOptions;\n }\n }\n\n return this.interactions.hoverOptions;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"hoverable\", {\n /**\r\n * @return `true` if element is hoverable\r\n */\n get: function get() {\n return this.getPropertyValue(\"hoverable\");\n },\n\n /**\r\n * Controls if the element is hoverable (hover events are registered).\r\n *\r\n * Use `over` and `out` events, to watch for those respective actions.\r\n *\r\n * @default false\r\n * @param value `true` if element can be hovered\r\n */\n set: function set(value) {\n var _this = this;\n\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"hoverable\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n this.applyCursorStyle();\n this.interactions.hoverable = value; // setEventDisposer will also remove listeners if value == false\n\n this.interactions.setEventDisposer(\"sprite-hoverable\", value, function () {\n return new MultiDisposer([_this.events.on(\"over\", _this.handleOver, _this, false), _this.events.on(\"out\", _this.handleOut, _this, false)]);\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Handles tasks when element becomes hovered:\r\n * * Shows [[Tooltip]] if applicable\r\n * * Applies \"hover\" state\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Event object\r\n */\n\n Sprite.prototype.handleOver = function (ev) {\n if (this._outTimeout) {\n this._outTimeout.dispose();\n }\n\n if (this.isHover) {\n if (this.states.hasKey(\"hover\")) {\n //this.setState(\"hover\");\n // This will check `isHover` and will set \"hover\" state\n if (!this.isHidden) {\n this.applyCurrentState();\n }\n }\n\n var point = void 0;\n\n if (ev && ev.pointer) {\n point = $utils.documentPointToSvg(ev.pointer.point, this.svgContainer.SVGContainer, this.svgContainer.cssScale);\n }\n\n if (this.showTooltipOn == \"hover\") {\n this.showTooltip(point);\n }\n } else {\n if (this.showTooltipOn == \"hover\") {\n this.hideTooltip();\n }\n\n if (!this.isHidden && this.states.hasKey(\"hover\")) {\n this.applyCurrentState();\n }\n }\n };\n /**\r\n * Handles tasks when element loses hover:\r\n *\r\n * * Hides [[Tooltip]]\r\n * * Applies default state\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev [description]\r\n */\n\n\n Sprite.prototype.handleOut = function (ev) {\n var _this = this;\n\n if (this.tooltip && this.tooltip.targetSprite == this && this.tooltip.keepTargetHover) {\n this._outTimeout = this.setTimeout(function () {\n if (!_this.tooltip.isHover) {\n if (_this.tooltip.targetSprite == _this) {\n _this.hideTooltip();\n }\n\n _this._outTimeout = _this.setTimeout(_this.handleOutReal.bind(_this), _this.rollOutDelay);\n }\n }, 10);\n return;\n }\n\n if (this.showTooltipOn == \"hover\") {\n this.hideTooltip();\n }\n\n this._outTimeout = this.setTimeout(this.handleOutReal.bind(this), this.rollOutDelay);\n };\n /**\r\n * [handleOutReal description]\r\n *\r\n * @ignore\r\n * @todo description\r\n */\n\n\n Sprite.prototype.handleOutReal = function () {\n if (!this.isHidden && !this.isHiding && this.states.hasKey(\"hover\")) {\n this.applyCurrentState();\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"hitOptions\", {\n /**\r\n * ==========================================================================\r\n * CLICKING/TAPPING AND TOGGLING STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns Sprite's click (hit) options.\r\n *\r\n * Click (hit) options control things like double-click, timeouts, etc.\r\n *\r\n * @see {@link IHitOptions} for available options.\r\n * @return Options\r\n */\n get: function get() {\n if (!this.interactions.hitOptions) {\n if (this.virtualParent) {\n return this.virtualParent.hitOptions;\n }\n\n if (this._parent) {\n return this._parent.hitOptions;\n }\n }\n\n return this.interactions.hitOptions;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Prepares element's after `down` event.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Event\r\n */\n\n Sprite.prototype.handleDown = function (ev) {\n if (this.interactions.downPointers.length === 1) {\n this.interactions.originalPosition = {\n x: this.pixelX,\n y: this.pixelY\n };\n this.interactions.originalAngle = this.rotation;\n this.interactions.originalScale = this.scale;\n\n if (this.states.hasKey(\"down\")) {\n this.setState(\"down\");\n }\n }\n };\n /**\r\n * Prepares element's after `up` event.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Event\r\n */\n\n\n Sprite.prototype.handleUp = function (ev) {\n var _this = this;\n /*if (!this.isDown) {\r\n this.interactions.originalPosition = null;\r\n this.interactions.originalAngle = null;\r\n this.interactions.originalScale = null;\r\n }*/\n\n\n this._isResized = false;\n\n if (this.states.hasKey(\"down\")) {\n this.applyCurrentState();\n }\n\n if (this.showTooltipOn == \"hit\") {\n this.updateTooltipPosition(ev.pointer ? ev.pointer.point : undefined);\n\n this._disposers.push(registry.events.once(\"exitframe\", function () {\n _this.showTooltip();\n }));\n\n this._disposers.push(getInteraction().body.events.once(\"down\", function (ev) {\n _this.hideTooltip();\n }));\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"clickable\", {\n /**\r\n * @return {boolean}\r\n */\n get: function get() {\n return this.getPropertyValue(\"clickable\");\n },\n\n /**\r\n * Indicates if the element is clickable.\r\n *\r\n * Some type of the elements, like buttons are clickable by default.\r\n *\r\n * Most of the elements are not clickable by default.\r\n *\r\n * Use `hit`, `doublehit`, `up`, `down`, `toggled` events to watch for\r\n * respective click/touch actions.\r\n *\r\n * @param value `true` if element can be clicked\r\n */\n set: function set(value) {\n var _this = this;\n\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"clickable\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n this.applyCursorStyle();\n this.interactions.clickable = value; // setEventDisposer will also remove listeners if value == false\n\n this.interactions.setEventDisposer(\"sprite-clickable\", value, function () {\n return new MultiDisposer([_this.events.on(\"down\", _this.handleDown, _this, false), _this.events.on(\"up\", _this.handleUp, _this, false)]);\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"togglable\", {\n /**\r\n * @return Is togglable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"togglable\");\n },\n\n /**\r\n * Indicates if element can be toggled on and off by subsequent clicks/taps.\r\n *\r\n * Togglable element will alternate its `isActive` property between `true`\r\n * and `false` with each click.\r\n *\r\n * @param value Is togglable?\r\n */\n set: function set(value) {\n var _this = this;\n\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"togglable\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n // setEventDisposer will also remove listeners if value == false\n this.interactions.setEventDisposer(\"sprite-togglable\", value, function () {\n return _this.events.on(\"hit\", _this.handleToggle, _this, false);\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Handles toggling of the element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Event\r\n */\n\n Sprite.prototype.handleToggle = function (ev) {\n this.isActive = !this.isActive;\n };\n\n Object.defineProperty(Sprite.prototype, \"contextMenuDisabled\", {\n /**\r\n * @return Context menu disabled?\r\n */\n get: function get() {\n return this.getPropertyValue(\"contextMenuDisabled\");\n },\n\n /**\r\n * Should element prevent context menu to be displayed, e.g. when\r\n * right-clicked?\r\n *\r\n * @default false\r\n * @param value Context menu disabled?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"contextMenuDisabled\", value)) {\n this.interactions.contextMenuDisabled = value;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"url\", {\n /**\r\n * @return URL\r\n */\n get: function get() {\n return this.getPropertyValue(\"url\");\n },\n\n /**\r\n * Click-through URL for this element.\r\n *\r\n * If set, clicking/tapping this element will open the new URL in a target\r\n * window/tab as set by `urlTarget`.\r\n *\r\n * Please note that URL will be parsed by data placeholders in curly\r\n * brackets, to be populated from data. E.g.:\r\n *\r\n * ```TypeScript\r\n * series.columns.template.url = \"https://www.google.com/search?q={category.urlEncode()}\";\r\n * ```\r\n * ```JavaScript\r\n * series.columns.template.url = \"https://www.google.com/search?q={category.urlEncode()}\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"series\": [{\r\n * // ...\r\n * \"columns\": {\r\n * \"url\": \"https://www.google.com/search?q={category.urlEncode()}\"\r\n * }\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @param value URL\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"url\", value)) {\n if (this._urlDisposer) {\n this._urlDisposer.dispose();\n } // If URL is not empty, set up events\n\n\n if ($utils.isNotEmpty(value)) {\n this._urlDisposer = this.events.on(\"hit\", this.urlHandler, this, false); // Set other required parameters\n\n this.clickable = true;\n this.cursorOverStyle = MouseCursorStyle.pointer;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"baseId\", {\n /**\r\n * [baseId description]\r\n *\r\n * @ignore\r\n * @return [description]\r\n */\n get: function get() {\n if (!this._baseId && this._parent) {\n this.baseId = this._parent.baseId;\n }\n\n return this._baseId;\n },\n\n /**\r\n * [baseId description]\r\n *\r\n * @ignore\r\n * @param value [description]\r\n */\n set: function set(value) {\n this.setBaseId(value);\n },\n enumerable: true,\n configurable: true\n });\n\n Sprite.prototype.setBaseId = function (value) {\n if (value != this._baseId) {\n if (this.invalid) {\n this.invalid = false;\n registry.removeFromInvalidSprites(this);\n this.invalidate();\n }\n\n this._baseId = value;\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"baseSprite\", {\n /**\r\n * Returns the mail chart object that this element belongs to.\r\n *\r\n * In most cases it will mean the chart object.\r\n *\r\n * Can be used to retrieve chart object in various events and adapters.\r\n *\r\n * ```TypeScript\r\n * chart.seriesContainer.events.on(\"hit\", function(ev) {\r\n * console.log(ev.target.baseSprite);\r\n * });\r\n * ```\r\n * ```JavaScript\r\n * chart.seriesContainer.events.on(\"hit\", function(ev) {\r\n * console.log(ev.target.baseSprite);\r\n * });\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"seriesContainer\": {\r\n * \"events\": {\r\n * \"hit\": function(ev) {\r\n * console.log(ev.target.baseSprite);\r\n * }\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * @readonly\r\n * @return Base chart object\r\n */\n get: function get() {\n if (this.isBaseSprite) {\n return this;\n } else if (this._parent) {\n return this._parent.baseSprite;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"urlTarget\", {\n /**\r\n * @return URL target\r\n */\n get: function get() {\n return this.getPropertyValue(\"urlTarget\");\n },\n\n /**\r\n * Target to use for URL clicks:\r\n *\r\n * * _blank\r\n * * _self (default)\r\n * * _parent\r\n * * _top\r\n * * Name of the window/frame\r\n *\r\n * Ignored if `url` is not set.\r\n *\r\n * @param value URL target\r\n */\n set: function set(value) {\n this.setPropertyValue(\"urlTarget\", value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Handles URL transition on element click.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev An event object\r\n */\n\n Sprite.prototype.urlHandler = function (ev) {\n // Is URL set?\n if ($utils.isNotEmpty(this.url)) {\n // Proceed to the URL\n var url = this.populateString(this.url);\n\n if (this.urlTarget === \"_self\") {\n window.location.href = url;\n } else {\n window.open(url, this.urlTarget);\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"swipeOptions\", {\n /**\r\n * ==========================================================================\r\n * SWIPING GESTURE TRACKING\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns element's swipe gesture options.\r\n *\r\n * @return Swipe gesture options\r\n */\n get: function get() {\n if (!this.interactions.swipeOptions) {\n if (this.virtualParent) {\n return this.virtualParent.swipeOptions;\n }\n\n if (this._parent) {\n return this._parent.swipeOptions;\n }\n }\n\n return this.interactions.swipeOptions;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"swipeable\", {\n /**\r\n * @return Element swipable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"swipeable\");\n },\n\n /**\r\n * Controls if element is swipeable.\r\n *\r\n * Swipable element will invoke `swipe`, `swipeleft` and `swiperight` events,\r\n * when quick horizontal drag action is performed with either mouse or touch.\r\n *\r\n * Please note that combining swipe and drag is possible, however will incur\r\n * a slight but noticeable delay in drag start.\r\n *\r\n * @param value Element swipable?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"swipeable\", value)) {\n this.applyCursorStyle();\n\n if (!value && !this.isInteractive()) {// void\n } else {\n this.interactions.swipeable = value;\n } //interaction.processSwipeable(this);\n\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"trackable\", {\n /**\r\n * @return Track cursor movement over element?\r\n */\n get: function get() {\n return this.getPropertyValue(\"trackable\");\n },\n\n /**\r\n * ==========================================================================\r\n * POINTER TRACKING\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Indicates if the element is trackable (mouse position over it is reported to\r\n * event listeners).\r\n *\r\n * Will invoke `track` events whenever pointer (cursor) changes position\r\n * while over element.\r\n *\r\n * Please note, touch devices will also invoke `track` events when touch\r\n * point is moved while holding down on a trackable element.\r\n *\r\n * @param value Track cursor movement over element?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"trackable\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n this.applyCursorStyle();\n this.interactions.trackable = value;\n } //interaction.processTrackable(this);\n\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"wheelable\", {\n /**\r\n * @return Mouse wheel events enabled?\r\n */\n get: function get() {\n return this.getPropertyValue(\"wheelable\");\n },\n\n /**\r\n * ==========================================================================\r\n * MOUSE-WHEEL RELATED\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Indicates if the element can be interacted with mouse wheel.\r\n *\r\n * Will invoke `wheel`, `wheelup`, `wheeldown`, `wheelleft`, and `wheelright`\r\n * events when using mouse wheel over the element.\r\n *\r\n * @param value Mouse wheel events enabled?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"wheelable\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n this.applyCursorStyle();\n this.interactions.wheelable = value;\n } //interaction.processWheelable(this);\n\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"resizable\", {\n /**\r\n * @return Element resizable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"resizable\");\n },\n\n /**\r\n * ==========================================================================\r\n * RESIZE\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Indicates if this element is resizable.\r\n *\r\n * Enabling resize will turn on various interactions on the element. Their\r\n * actual functionality will depend on other properties.\r\n *\r\n * If the element also `draggable`, resize will only happen with two points\r\n * of contact on a touch device.\r\n *\r\n * If the element is not draggable, resize can be performed with just one\r\n * point of contact, touch or mouse.\r\n *\r\n * Will invoke `resize` event every time the size of the element changes.\r\n *\r\n * @param value Element resizable?\r\n */\n set: function set(value) {\n var _this = this;\n\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"resizable\", value)) {\n if (!value && !this.isInteractive()) {// void\n } else {\n this.applyCursorStyle();\n this.interactions.resizable = value; // setEventDisposer will also remove listeners if value == false\n\n this.interactions.setEventDisposer(\"sprite-resizable\", value, function () {\n return new MultiDisposer([_this.events.on(\"down\", _this.handleDown, _this, false), _this.events.on(\"resize\", _this.handleResize, _this, false)]);\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Handles resize intermediate step.\r\n *\r\n * By default this method resizes actual element. Each element, can override\r\n * this method to implement their own resize logic.\r\n *\r\n * @ignore Exclude from docs\r\n * @param ev Event object\r\n */\n\n Sprite.prototype.handleResize = function (ev) {\n if (!this.interactions.isTouchProtected || !ev.touch) {\n this._isResized = true;\n this.scale = this.interactions.originalScale * ev.scale;\n this.validatePosition();\n /*center: (io.draggable\r\n ? $math.getMidPoint(point1, point2)\r\n : {\r\n \"x\": io.originalPosition.x,\r\n \"y\": io.originalPosition.y\r\n })*/\n //this.moveTo(this.originalPosition.x + ev.shift.x, this.originalPosition.y + ev.shift.y);\n\n if (this.draggable || this.dragWhileResize) {\n this._isDragged = false;\n var svgPoint1 = $utils.documentPointToSvg(ev.point1, this.htmlContainer, this.svgContainer.cssScale);\n var svgPoint2 = $utils.documentPointToSvg(ev.point2, this.htmlContainer, this.svgContainer.cssScale);\n var svgMidPoint = $math.getMidPoint(svgPoint1, svgPoint2);\n var parentPoint1 = $utils.documentPointToSprite(ev.startPoint1, this._parent);\n var parentPoint2 = $utils.documentPointToSprite(ev.startPoint2, this._parent);\n var originalPosition = this.interactions.originalPosition;\n var originalScale = this.interactions.originalScale;\n\n if (originalPosition) {\n var spritePoint1 = {\n x: (parentPoint1.x - originalPosition.x) / originalScale,\n y: (parentPoint1.y - originalPosition.y) / originalScale\n };\n var spritePoint2 = {\n x: (parentPoint2.x - originalPosition.x) / originalScale,\n y: (parentPoint2.y - originalPosition.y) / originalScale\n };\n var spriteMidPoint = $math.getMidPoint(spritePoint1, spritePoint2);\n var parentPoint = $utils.svgPointToSprite(svgMidPoint, this._parent);\n this.moveTo({\n x: parentPoint.x - spriteMidPoint.x * this.scale,\n y: parentPoint.y - spriteMidPoint.y * this.scale\n }, undefined, undefined, true);\n }\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"cursorOptions\", {\n /**\r\n * ==========================================================================\r\n * MOUSE-RELATED\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Returns element's cursor options.\r\n *\r\n * Cursor options usually define cursor style for various states of the\r\n * hovered element.\r\n *\r\n * Elements inherit `cursorOptions` from their parents if they don't have\r\n * them set explicitly.\r\n *\r\n * @see {@link ICursorOptions} for a list of available options\r\n * @return Cursor options\r\n */\n get: function get() {\n if (!this.interactions.cursorOptions) {\n if (this.virtualParent) {\n return this.virtualParent.cursorOptions;\n }\n\n if (this._parent) {\n return this._parent.cursorOptions;\n }\n }\n\n return this.interactions.cursorOptions;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"cursorOverStyle\", {\n /**\r\n * A shortcut to setting mouse cursor on hover.\r\n *\r\n * Example:\r\n *\r\n * ```TypeScript\r\n * series.slices.template.cursorOverStyle = am4core.MouseCursorStyle.pointer;\r\n * ```\r\n * ```JavaScript\r\n * series.slices.template.cursorOverStyle = am4core.MouseCursorStyle.pointer;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"series\": {\r\n * // ...\r\n * \"slices\": {\r\n * \"cursorOverStyle\": \"pointer\"\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * @param style An array of styles to apply onhover\r\n */\n set: function set(style) {\n if (!this.cursorOptions.overStyle) {\n this.interactions.cursorOptions = {\n defaultStyle: this.cursorOptions.defaultStyle\n };\n }\n\n this.cursorOptions.overStyle = style;\n getInteraction().applyCursorOverStyle(this.interactions);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"cursorDownStyle\", {\n /**\r\n * A shortcut to setting mouse cursor when button is pressed down.\r\n *\r\n * Example:\r\n *\r\n * ```TypeScript\r\n * series.slices.template.cursorDownStyle = am4core.MouseCursorStyle.grabbing;\r\n * ```\r\n * ```JavaScript\r\n * series.slices.template.cursorDownStyle = am4core.MouseCursorStyle.grabbing;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"series\": {\r\n * // ...\r\n * \"slices\": {\r\n * \"cursorDownStyle\": \"grabbing\"\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * @param style An array of styles to apply onhover\r\n */\n set: function set(style) {\n this.cursorOptions.downStyle = style;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Applies default cursor styles for interactable elements.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Determine if this is necessary. Maybe let's not apply any cursor styles by default\r\n */\n\n Sprite.prototype.applyCursorStyle = function () {// Draggable styles\n\n /*if (this.draggable) {\r\n if (!$type.hasValue(this.cursorOptions.overStyle)) {\r\n this.cursorOptions.overStyle = MouseCursorStyle.grab;\r\n }\r\n if (!$type.hasValue(this.cursorOptions.downStyle)) {\r\n this.cursorOptions.downStyle = MouseCursorStyle.grabbing;\r\n }\r\n }*/\n };\n\n Object.defineProperty(Sprite.prototype, \"interactionsEnabled\", {\n /**\r\n * @return Is interaction enabled for this element?\r\n */\n get: function get() {\n var value = this.getPropertyValue(\"interactionsEnabled\");\n\n if (value === false) {\n return false;\n }\n\n if (this.virtualParent) {\n return this.virtualParent.interactionsEnabled;\n }\n\n if (this._parent) {\n return this._parent.interactionsEnabled;\n }\n\n return true;\n },\n\n /**\r\n * Setting this to `false` will effectively disable all interactivity on the\r\n * element.\r\n *\r\n * @param value Is interaction enabled for this element?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"interactionsEnabled\", value)) {\n var pointerEvents = null; // must be null, not \"null\"!\n\n if (!value) {\n pointerEvents = \"none\";\n } else {\n // this is for IE\n this.group.node.style.pointerEvents = \"\";\n }\n\n this.group.node.style.pointerEvents = pointerEvents;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"exporting\", {\n /**\r\n * @return Export instance\r\n */\n get: function get() {\n return this.getExporting();\n },\n\n /**\r\n * ==========================================================================\r\n * EXPORT-RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * An [[Export]] instance.\r\n *\r\n * Used to access API of the chart export functionality.\r\n *\r\n * If `exporting` is not set, the element inherits [[Export]] instance from\r\n * its parents.\r\n *\r\n * Upon request, if no parent has such instance, a new one is created, using\r\n * default settings, what in most cases is just enough.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/exporting/} for more info about exporting\r\n * @param exp Export\r\n */\n set: function set(exp) {\n this._exporting.set(exp, exp);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * This is here as a method so that inheriting classes could override it.\r\n *\r\n * @return Export instance\r\n */\n\n Sprite.prototype.getExporting = function () {\n var _export = this._exporting.get();\n\n if (_export) {\n return _export;\n } else {\n if (this.isStandaloneInstance || !this._parent) {\n _export = new Export(this.svgContainer.SVGContainer);\n _export.sprite = this;\n _export.language = this.language;\n _export.numberFormatter = this.numberFormatter;\n _export.dateFormatter = this.dateFormatter;\n _export.durationFormatter = this.durationFormatter;\n\n this._exporting.set(_export, _export);\n } else {\n return this._parent.exporting;\n }\n }\n\n return _export;\n };\n\n Object.defineProperty(Sprite.prototype, \"exportable\", {\n /**\r\n * @return Export?\r\n */\n get: function get() {\n return this._exportable;\n /*const svgContainer = this.svgContainer;\r\n return !svgContainer || $array.indexOf(svgContainer.nonExportableSprites, this) == -1;*/\n },\n\n /**\r\n * If set to `false` this element will be omitted when exporting the chart\r\n * to an image.\r\n *\r\n * @default true\r\n * @param value Export?\r\n */\n set: function set(value) {\n var svgContainer = this.svgContainer;\n this._exportable = value;\n\n if (svgContainer) {\n if (value) {\n $array.remove(svgContainer.nonExportableSprites, this);\n } else if ($array.indexOf(svgContainer.nonExportableSprites, this) == -1) {\n svgContainer.nonExportableSprites.push(this);\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * ==========================================================================\r\n * MODAL/POPUP RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Private method to be used for \"classPrefix\" adapter for modals/popups.\r\n *\r\n * @param value Prefix\r\n */\n\n Sprite.prototype.modalPrefix = function (value) {\n value = options.classNamePrefix + value;\n return value;\n };\n\n Object.defineProperty(Sprite.prototype, \"modal\", {\n /**\r\n * Returns a [[Modal]] instance, associated with this chart.\r\n * (elements top parent)\r\n *\r\n * Accessing modal does not make it appear. To make a modal appear, use\r\n * `showModal()` method.\r\n *\r\n * @see {@link Modal} for more information about using Modal windows\r\n * @return Modal instance\r\n */\n get: function get() {\n var svgContainer = this.svgContainer;\n\n if (svgContainer) {\n var modal = svgContainer.modal;\n\n if (!modal.adapter.has(\"classPrefix\", this.modalPrefix)) {\n modal.adapter.add(\"classPrefix\", this.modalPrefix);\n }\n\n return modal;\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Opens a modal window with specific content (`text` parameter) and,\r\n * optionally, `title`.\r\n *\r\n * The `text` parameter can contain HTML content.\r\n *\r\n * @see {@link Modal} for more information about using Modal windows\r\n * @param text Modal contents\r\n * @param title Title for the modal window\r\n */\n\n Sprite.prototype.openModal = function (text, title) {\n var svgContainer = this.svgContainer;\n\n if (svgContainer) {\n return svgContainer.openModal(text, title);\n }\n };\n /**\r\n * Hides modal window if there is one currently open.\r\n */\n\n\n Sprite.prototype.closeModal = function () {\n var svgContainer = this.svgContainer;\n\n if (svgContainer) {\n svgContainer.closeModal();\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"popups\", {\n /**\r\n * A list of popups for this chart.\r\n *\r\n * @return Popups\r\n */\n get: function get() {\n var svgContainer = this.svgContainer;\n\n if (svgContainer) {\n var popups = svgContainer.popups;\n popups.template.sprite = this;\n\n if (!popups.template.adapter.has(\"classPrefix\", this.modalPrefix)) {\n popups.template.adapter.add(\"classPrefix\", this.modalPrefix);\n }\n\n return popups;\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates, opens, and returns a new [[Popup]] window.\r\n *\r\n * `text` can be any valid HTML.\r\n *\r\n * `title` is currently not supported.\r\n *\r\n * @param text Popup contents\r\n * @param title Popup title\r\n * @return Popup instance\r\n */\n\n Sprite.prototype.openPopup = function (text, title) {\n var svgContainer = this.svgContainer;\n\n if (svgContainer) {\n return svgContainer.openPopup(text, title);\n }\n };\n /**\r\n * Closes all currently open popup windows\r\n */\n\n\n Sprite.prototype.closeAllPopups = function () {\n var svgContainer = this.svgContainer;\n\n if (svgContainer) {\n svgContainer.closeAllPopups();\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"x\", {\n /**\r\n * @return X coordinate\r\n */\n get: function get() {\n return this.getPropertyValue(\"x\");\n },\n\n /**\r\n * ==========================================================================\r\n * POSITIONAL PROPERTIES AND RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Element's absolute or relative X coordinate.\r\n *\r\n * If setting both X and Y, please consider using `moveTo()` method instead,\r\n * as it will be faster to set both coordinates at once.\r\n *\r\n * @param value X coordinate\r\n */\n set: function set(value) {\n if (!this.isDragged) {\n this.setPercentProperty(\"x\", value, false, true, this._positionPrecision, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelX\", {\n /**\r\n * Returns element's current absolute X coordinate in pixels.\r\n *\r\n * @readonly\r\n * @return X coordinate (px)\r\n */\n get: function get() {\n var value = $math.fitToRange(this.getPixelX(this.x), this.minX, this.maxX);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelX\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeX\", {\n /**\r\n * Returns element's current relative X coordinate in [[Percent]].\r\n *\r\n * @return X coordinate ([[Percent]])\r\n */\n get: function get() {\n if (!this._adapterO) {\n return this.getRelativeX(this.x);\n } else {\n return this._adapterO.apply(\"relativeX\", this.getRelativeX(this.x));\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"minX\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Min X (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minX\");\n },\n\n /**\r\n * The smallest allowable absolute X coordinate for this element.\r\n *\r\n * This is used to contain element movement within certain boundaries.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Min X (px)\r\n */\n set: function set(value) {\n if ($type.isNumber(value)) {\n value = $math.round(value, this._positionPrecision, true);\n this.setPropertyValue(\"minX\", value, false, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"maxX\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Max X (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxX\");\n },\n\n /**\r\n * The biggest allowable absolute X coordinate for this element.\r\n *\r\n * This is used to contain element movement within certain boundaries.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Max X (px)\r\n */\n set: function set(value) {\n if ($type.isNumber(value)) {\n value = $math.round(value, this._positionPrecision, true);\n this.setPropertyValue(\"maxX\", value, false, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"y\", {\n /**\r\n * @return Y coordinate\r\n */\n get: function get() {\n return this.getPropertyValue(\"y\");\n },\n\n /**\r\n * Element's absolute or relative Y coordinate.\r\n *\r\n * If setting both X and Y, please consider using `moveTo()` method instead,\r\n * as it will be faster to set both coordinates at once.\r\n *\r\n * @param value Y coordinate\r\n */\n set: function set(value) {\n if (!this.isDragged) {\n this.setPercentProperty(\"y\", value, false, true, this._positionPrecision, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelY\", {\n /**\r\n * Returns element's current absolute Y coordinate in pixels.\r\n *\r\n * @readonly\r\n * @return Y coordinate (px)\r\n */\n get: function get() {\n var value = $math.fitToRange(this.getPixelY(this.y), this.minY, this.maxY);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelY\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeY\", {\n /**\r\n * Returns element's current relative Y coordinate in [[Percent]].\r\n *\r\n * @readonly\r\n * @return Y coordinate ([[Percent]])\r\n */\n get: function get() {\n if (!this._adapterO) {\n return this.getRelativeX(this.y);\n } else {\n return this._adapterO.apply(\"relativeY\", this.getRelativeX(this.y));\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"minY\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Min Y (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minY\");\n },\n\n /**\r\n * The smallest allowable absolute Y coordinate for this element.\r\n *\r\n * This is used to contain element movement within certain boundaries.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Min Y (px)\r\n */\n set: function set(value) {\n if ($type.isNumber(value)) {\n value = $math.round(value, this._positionPrecision, true);\n this.setPropertyValue(\"minY\", value, false, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"maxY\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Max Y (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxY\");\n },\n\n /**\r\n * The biggest allowable absolute Y coordinate for this element.\r\n *\r\n * This is used to contain element movement within certain boundaries.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Max Y (px)\r\n */\n set: function set(value) {\n if ($type.isNumber(value)) {\n value = $math.round(value, this._positionPrecision, true);\n this.setPropertyValue(\"maxY\", value, false, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"dx\", {\n /**\r\n * @return Horizontal offset (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"dx\");\n },\n\n /**\r\n * A horizontal offset for the element in pixels.\r\n *\r\n * Can be negative value for offset to the left.\r\n *\r\n * @param value Horizontal offset (px)\r\n */\n set: function set(value) {\n if ($type.isNumber(value)) {\n value = $math.round(value, this._positionPrecision, true);\n this.setPropertyValue(\"dx\", value, false, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"dy\", {\n /**\r\n * @return Vertical offset (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"dy\");\n },\n\n /**\r\n * A vertical offset for the element in pixels.\r\n *\r\n * Can be negative value for offset upwards.\r\n *\r\n * @param value Vertical offset (px)\r\n */\n set: function set(value) {\n if ($type.isNumber(value)) {\n value = $math.round(value, this._positionPrecision, true);\n this.setPropertyValue(\"dy\", value, false, true);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"rotation\", {\n /**\r\n * @return Rotation (0-360)\r\n */\n get: function get() {\n return this.getPropertyValue(\"rotation\");\n },\n\n /**\r\n * Rotation of the element in degrees. (0-360)\r\n *\r\n * Note: For convenience purposes, negative values (for counter-clockwise\r\n * rotation) and values exceeding 360 can also be used.\r\n *\r\n * @param value Rotation (0-360)\r\n */\n set: function set(value) {\n value = $type.toNumber(value);\n\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n this.setPropertyValue(\"rotation\", value, false, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"align\", {\n /**\r\n * @return Horizontal align\r\n */\n get: function get() {\n return this.getPropertyValue(\"align\");\n },\n\n /**\r\n * Controls horizontal alignment of the element.\r\n *\r\n * This is used by parent [[Container]] when layouting its children.\r\n *\r\n * @param value Horizontal align\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"align\", value)) {\n if (this._parent) {\n this._parent.invalidateLayout();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"valign\", {\n /**\r\n * @return Vertical align\r\n */\n get: function get() {\n return this.getPropertyValue(\"valign\");\n },\n\n /**\r\n * Controls vertical alignment of the element.\r\n *\r\n * This is used by parent [[Container]] when layouting its children.\r\n *\r\n * @param value Vertical align\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"valign\", value)) {\n if (this._parent) {\n this._parent.invalidateLayout();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"horizontalCenter\", {\n /**\r\n * @return Horizontal center\r\n */\n get: function get() {\n return this.getPropertyValue(\"horizontalCenter\");\n },\n\n /**\r\n * Controls which part of the element to treat as a horizontal center.\r\n *\r\n * The setting will be used when positioning, resizing and rotating the\r\n * element.\r\n *\r\n * @param value Horizontal center\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"horizontalCenter\", value)) {\n this.updateCenter();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"verticalCenter\", {\n /**\r\n * @return Vertical center\r\n */\n get: function get() {\n return this.getPropertyValue(\"verticalCenter\");\n },\n\n /**\r\n * Controls which part of the element to treat as a vertical center.\r\n *\r\n * The setting will be used when positioning, resizing and rotating the\r\n * element.\r\n *\r\n * @param value Vertical center\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"verticalCenter\", value)) {\n this.updateCenter();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"maxWidth\", {\n /**\r\n * @return Maximum width (px)\r\n */\n get: function get() {\n var maxWidth = this.getPropertyValue(\"maxWidth\");\n\n if (!$type.isNumber(maxWidth)) {\n if (this._parent) {\n var parentWidth = this._parent.maxWidth;\n\n if (this._parent.layout != \"absolute\" && this.align != \"none\" && this.align != undefined) {\n parentWidth = parentWidth - this.pixelMarginLeft - this.pixelMarginRight;\n }\n\n return parentWidth;\n }\n }\n\n return maxWidth;\n },\n\n /**\r\n * ==========================================================================\r\n * DIMENSIONAL PROPERTIES AND RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Maximum allowed width for the element in pixels.\r\n *\r\n * @param value Maximum width (px)\r\n */\n set: function set(value) {\n this.setMaxWidth(value);\n },\n enumerable: true,\n configurable: true\n });\n\n Sprite.prototype.setMaxWidth = function (value) {\n var prevWidth = this.maxWidth;\n var prevHeight = this.maxHeight;\n\n if (this.setPropertyValue(\"maxWidth\", value)) {\n if ($type.isNumber(this.relativeWidth)) {\n this.invalidate();\n }\n\n var event_2 = {\n type: \"maxsizechanged\",\n target: this,\n previousWidth: prevWidth,\n previousHeight: prevHeight\n };\n this.dispatchImmediately(\"maxsizechanged\", event_2);\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"maxHeight\", {\n /**\r\n * @return Maximum height (px)\r\n */\n get: function get() {\n var maxHeight = this.getPropertyValue(\"maxHeight\");\n\n if (!$type.isNumber(maxHeight)) {\n if (this._parent) {\n var parentHeight = this._parent.maxHeight;\n\n if (this._parent.layout != \"absolute\" && this.valign != \"none\" && this.valign != undefined) {\n parentHeight = parentHeight - this.pixelMarginTop - this.pixelMarginBottom;\n }\n\n return parentHeight;\n }\n }\n\n return maxHeight;\n },\n\n /**\r\n * Maximum allowed height for the element in pixels.\r\n *\r\n * @param value Maximum height (px)\r\n */\n set: function set(value) {\n this.setMaxHeight(value);\n },\n enumerable: true,\n configurable: true\n });\n\n Sprite.prototype.setMaxHeight = function (value) {\n var prevWidth = this.maxWidth;\n var prevHeight = this.maxHeight;\n\n if (this.setPropertyValue(\"maxHeight\", value)) {\n if ($type.isNumber(this.relativeHeight)) {\n this.invalidate();\n }\n\n var event_3 = {\n type: \"maxsizechanged\",\n target: this,\n previousWidth: prevWidth,\n previousHeight: prevHeight\n };\n this.dispatchImmediately(\"maxsizechanged\", event_3);\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"minWidth\", {\n /**\r\n * @return Minimum width (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minWidth\");\n },\n\n /**\r\n * Minimum width of the element in pixels.\r\n *\r\n * Set to `undefined` to remove the limit.\r\n *\r\n * @param value Minimum width (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"minWidth\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"minHeight\", {\n /**\r\n * @return Minimum height (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minHeight\");\n },\n\n /**\r\n * Minimum height for the element in pixels.\r\n *\r\n * Set to `undefined` to remove the limit.\r\n *\r\n * @param value Minimum height (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"minHeight\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"width\", {\n /**\r\n * @return Width (absolute or relative)\r\n */\n get: function get() {\n return this.getPropertyValue(\"width\");\n },\n\n /**\r\n * Element's absolute or relative width.\r\n *\r\n * The width can either be absolute, set in numeric pixels, or relative, set\r\n * in [[Percent]].\r\n *\r\n * Relative width will be calculated using closest measured ancestor\r\n * [[Container]].\r\n *\r\n * NOTE: `width` is an accessor, which allows setting width in pixels or\r\n * percent. It is a sort of a \"shortcut\" for the users. Actual renderer does\r\n * not ever use it. It uses either `pixelWidth` or `percentWidth`, so if\r\n * you need to add an adapter for width add it for either of the two\r\n * properties - whichever suits your requirements.\r\n *\r\n * @param value Width (numeric in pixels or relative)\r\n */\n set: function set(value) {\n var changed = this.setPercentProperty(\"width\", value, true, false, this._positionPrecision, true);\n\n if (changed) {\n this.percentWidth = undefined;\n this.relativeWidth = undefined;\n\n if (value instanceof Percent) {\n this.percentWidth = value.percent;\n\n if ($type.isNumber(this._pixelWidth)) {\n this.maxWidth = undefined;\n }\n\n this._pixelWidth = undefined;\n } else {\n this._pixelWidth = Number(value); //this._measuredWidth = this._pixelWidth;\n\n this.maxWidth = this._pixelWidth;\n }\n\n this.invalidatePosition();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"height\", {\n /**\r\n * @return height (absolute or relative)\r\n */\n get: function get() {\n return this.getPropertyValue(\"height\");\n },\n\n /**\r\n * Element's absolute or relative height.\r\n *\r\n * The height can either be absolute, set in numeric pixels, or relative, set\r\n * in [[Percent]].\r\n *\r\n * Relative height will be calculated using closest measured ancestor\r\n * [[Container]].\r\n *\r\n * NOTE: `height` is an accessor, which allows setting height in pixels or\r\n * percent. It is a sort of a \"shortcut\" for the users. Actual renderer does\r\n * not ever use it. It uses either `pixelHeight` or `percentHeight`, so if\r\n * you need to add an adapter for height add it for either of the two\r\n * properties - whichever suits your requirements.\r\n *\r\n * @param value Height (numeric in pixels or relative)\r\n */\n set: function set(value) {\n var changed = this.setPercentProperty(\"height\", value, true, false, this._positionPrecision, true);\n\n if (changed) {\n this.percentHeight = undefined;\n this._relativeHeight = undefined;\n\n if (value instanceof Percent) {\n this.percentHeight = value.percent;\n\n if ($type.isNumber(this._pixelHeight)) {\n this.maxHeight = undefined;\n }\n\n this._pixelHeight = undefined;\n } else {\n this._pixelHeight = Number(value); //this._measuredHeight = this._pixelHeight;\n\n this.maxHeight = this._pixelHeight; // yes, we reset maxWidth\n }\n\n this.invalidatePosition();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelWidth\", {\n /**\r\n * Returns element's width in pixels, if width was set. For actual width use measuredWidth property.\r\n *\r\n * @readonly\r\n * @return Width (px)\r\n */\n get: function get() {\n var width;\n\n if ($type.isNumber(this.percentWidth)) {\n width = this.maxWidth;\n } else if ($type.isNumber(this._pixelWidth)) {\n width = this._pixelWidth;\n } else {\n width = 0;\n }\n\n var minWidth = this.minWidth;\n\n if (minWidth != null && width < minWidth) {\n width = minWidth;\n }\n\n var value = $math.round(width, this._positionPrecision, true);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelWidth\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelHeight\", {\n /**\r\n * Returns element's height in pixels. For actual height use measuredHeight property.\r\n *\r\n * @readonly\r\n * @return Height (px)\r\n */\n get: function get() {\n var height;\n\n if ($type.isNumber(this.percentHeight)) {\n height = this.maxHeight;\n } else if ($type.isNumber(this._pixelHeight)) {\n height = this._pixelHeight;\n } else {\n height = 0; //this._measuredHeightSelf;\n }\n\n var minHeight = this.minHeight;\n\n if (minHeight != null && height < minHeight) {\n height = minHeight;\n }\n\n var value = $math.round(height, this._positionPrecision, true);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelHeight\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeWidth\", {\n /**\r\n * @return Relative width\r\n * @ignore\r\n */\n get: function get() {\n var relativeWidth = this._relativeWidth;\n\n if ($type.isNumber(relativeWidth)) {\n if (!this._adapterO) {\n return relativeWidth;\n } else {\n return this._adapterO.apply(\"relativeWidth\", relativeWidth);\n }\n }\n },\n\n /**\r\n * Element's relative width in [[Percent]].\r\n * @ignore\r\n *\r\n * @param value Relative width\r\n */\n set: function set(value) {\n if (this._relativeWidth != value) {\n this._relativeWidth = value; //\t\t\tthis.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeHeight\", {\n /**\r\n * @return Relative height\r\n * @ignore\r\n */\n get: function get() {\n var relativeHeight = this._relativeHeight;\n\n if ($type.isNumber(relativeHeight)) {\n if (!this._adapterO) {\n return relativeHeight;\n } else {\n return this._adapterO.apply(\"relativeHeight\", relativeHeight);\n }\n }\n },\n\n /**\r\n * Element's relative height in [[Percent]].\r\n *\r\n * @param value Relative height\r\n * @ignore\r\n */\n set: function set(value) {\n if (this._relativeHeight != value) {\n this._relativeHeight = value; //\t\t\tthis.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"measuredWidth\", {\n /**\r\n * Returns element's measured width in pixels.\r\n *\r\n * A measured width is actual width of contents plus `paddingRight` and* `paddingLeft`, relative to sprite parent, meaning that\r\n * rotation and scale is taken into account.\r\n *\r\n * @readonly\r\n * @return Width (px)\r\n */\n get: function get() {\n if (this.disabled || this.__disabled) {\n return 0;\n }\n\n if (!this._adapterO) {\n return this._measuredWidth;\n } else {\n return this._adapterO.apply(\"measuredWidth\", this._measuredWidth);\n } // it's not good to fit to min/max range as then rotations and scale won't be taken into account\n //return this.adapter.apply(\"measuredWidth\", $math.fitToRange(this._measuredWidth, this.minWidth, this.maxWidth));\n\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"measuredHeight\", {\n /**\r\n * Returns elements's measured height in pixels.\r\n *\r\n * A measured height is actual height of contents plus `paddingTop` and `paddingBottom`, relative to sprite parent, meaning that\r\n * rotation and scale taken into account.\r\n *\r\n * @readonly\r\n * @return Height (px)\r\n */\n get: function get() {\n if (this.disabled || this.__disabled) {\n return 0;\n } // it's not good to fit to min/max range as then rotations and scale won't be taken into account\n //return this.adapter.apply(\"measuredHeight\", $math.fitToRange(this._measuredHeight, this.minHeight, this.maxHeight));\n\n\n if (!this._adapterO) {\n return this._measuredHeight;\n } else {\n return this._adapterO.apply(\"measuredHeight\", this._measuredHeight);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"outerWidth\", {\n /**\r\n * Returns element's measured width plus its left and right margins in\r\n * pixels.\r\n *\r\n * @readonly\r\n * @return Outer width (px)\r\n */\n get: function get() {\n var value = this.pixelWidth + this.pixelMarginRight + this.pixelMarginLeft;\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"outerWidth\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"outerHeight\", {\n /**\r\n * Returns element's measured height plus its top and bottom margins in\r\n * pixels.\r\n *\r\n * @readonly\r\n * @return Outer height (px)\r\n */\n get: function get() {\n var value = this.pixelHeight + this.pixelMarginTop + this.pixelMarginBottom;\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"outerHeight\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"innerWidth\", {\n /**\r\n * Returns element's measured inner width in pixels.\r\n *\r\n * Inner width is actual available space for content, e.g. element's width\r\n * minus horizontal padding.\r\n *\r\n * @readonly\r\n * @return Inner width (px)\r\n */\n get: function get() {\n var value = Math.max(0, this.pixelWidth - this.pixelPaddingRight - this.pixelPaddingLeft);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"innerWidth\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"innerHeight\", {\n /**\r\n * Returns element's measured inner height in pixels.\r\n *\r\n * Inner height is actual available space for content, e.g. element's height\r\n * minus vertical padding.\r\n *\r\n * @readonly\r\n * @return Inner height (px)\r\n */\n get: function get() {\n var value = Math.max(0, this.pixelHeight - this.pixelPaddingTop - this.pixelPaddingBottom);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"innerHeight\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"globalScale\", {\n /**\r\n * Returns element's current \"global\" scale.\r\n *\r\n * Scale values accumulate over hierarchy of elements.\r\n *\r\n * E.g. if a [[Container]] has `scale = 2` and it's child has a `scale = 2`,\r\n * the child's `globalScale` will be 4. (a multitude of `2 x 2`)\r\n *\r\n * @readonly\r\n * @return Global scale\r\n */\n get: function get() {\n var scale = this.scale;\n\n if (this._parent) {\n scale = scale * this._parent.globalScale;\n }\n\n if (!this._adapterO) {\n return scale;\n } else {\n return this._adapterO.apply(\"globalScale\", scale);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"scale\", {\n /**\r\n * @return Scale (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"scale\");\n },\n\n /**\r\n * Scale of the element.\r\n *\r\n * The scale is set from 0 (element reduced to nothing) to 1 (default size).\r\n * * 2 will mean element is increased twice.\r\n * * 0.5 - reduced by 50%.\r\n *\r\n * Etc.\r\n *\r\n * @param value Scale (0-1)\r\n */\n set: function set(value) {\n value = $type.toNumber(value);\n\n if (value < 0) {\n value = 0;\n }\n\n if (value != this.getPropertyValue(\"scale\")) {\n this.setPropertyValue(\"scale\", value, false, true);\n this.handleGlobalScale();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets all four margins for the element at once.\r\n *\r\n * Margins are set in pixels.\r\n *\r\n * @param top Top margin\r\n * @param right Right margin\r\n * @param bottom Bottom margin\r\n * @param left Left margin\r\n * @return Current element\r\n */\n\n Sprite.prototype.margin = function (top, right, bottom, left) {\n this.marginTop = top;\n this.marginRight = right;\n this.marginBottom = bottom;\n this.marginLeft = left;\n return this;\n };\n\n Object.defineProperty(Sprite.prototype, \"marginLeft\", {\n /**\r\n * @return Margin value\r\n */\n get: function get() {\n return this.getPropertyValue(\"marginLeft\");\n },\n\n /**\r\n * Left margin - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Margin value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"marginLeft\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"marginRight\", {\n /**\r\n * @return Margin value\r\n */\n get: function get() {\n return this.getPropertyValue(\"marginRight\");\n },\n\n /**\r\n * Right margin - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Margin value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"marginRight\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"marginTop\", {\n /**\r\n * @return Margin value\r\n */\n get: function get() {\n return this.getPropertyValue(\"marginTop\");\n },\n\n /**\r\n * Top margin - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Margin value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"marginTop\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"marginBottom\", {\n /**\r\n * @return Margin value\r\n */\n get: function get() {\n return this.getPropertyValue(\"marginBottom\");\n },\n\n /**\r\n * Bottom margin - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Margin value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"marginBottom\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelMarginRight\", {\n /**\r\n * Returns current right margin in pixels.\r\n *\r\n * @readonly\r\n * @return Right margin (px)\r\n */\n get: function get() {\n var value = this.getPixelX(this.marginRight);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelMarginRight\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeMarginRight\", {\n /**\r\n * Returns current relative right margin.\r\n *\r\n * @readonly\r\n * @return Relative right margin\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n var value = this.getRelativeX(this.marginRight);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"relativeMarginRight\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelMarginLeft\", {\n /**\r\n * Returns current left margin in pixels.\r\n *\r\n * @readonly\r\n * @return Left margin (px)\r\n */\n get: function get() {\n var value = this.getPixelX(this.marginLeft);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelMarginLeft\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeMarginLeft\", {\n /**\r\n * Returns current relative left margin.\r\n *\r\n * @readonly\r\n * @return Relative left margin\r\n */\n get: function get() {\n //@todo Maybe use [[Percent]]?\n var value = this.getRelativeX(this.marginLeft);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"relativeMarginLeft\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelMarginTop\", {\n /**\r\n * Returns current top margin in pixels.\r\n *\r\n * @readonly\r\n * @return Top margin (px)\r\n */\n get: function get() {\n var value = this.getPixelY(this.marginTop);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelMarginTop\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeMarginTop\", {\n /**\r\n * Returns current relative top margin.\r\n *\r\n * @readonly\r\n * @return Relative top margin\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n var value = this.getRelativeY(this.marginTop);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"relativeMarginTop\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelMarginBottom\", {\n /**\r\n * Returns current bottom margin in pixels.\r\n *\r\n * @readonly\r\n * @return Bottom margin (px)\r\n */\n get: function get() {\n var value = this.getPixelY(this.marginBottom);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"pixelMarginBottom\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativeMarginBottom\", {\n /**\r\n * Returns current relative bottom margin.\r\n *\r\n * @readonly\r\n * @return Relative bottom margin\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n var value = this.getRelativeY(this.marginBottom);\n\n if (!this._adapterO) {\n return value;\n } else {\n return this._adapterO.apply(\"relativeMarginBottom\", value);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets padding for the element in pixels.\r\n *\r\n * @param top Top padding (px)\r\n * @param right Right padding (px)\r\n * @param bottom Bottom padding (px)\r\n * @param left Left padding (px)\r\n * @return Element\r\n */\n\n Sprite.prototype.padding = function (top, right, bottom, left) {\n this.paddingTop = top;\n this.paddingRight = right;\n this.paddingBottom = bottom;\n this.paddingLeft = left;\n return this;\n };\n\n Object.defineProperty(Sprite.prototype, \"paddingLeft\", {\n /**\r\n * @return Padding value\r\n */\n get: function get() {\n return this.getPropertyValue(\"paddingLeft\");\n },\n\n /**\r\n * Left padding - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Padding value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"paddingLeft\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"paddingRight\", {\n /**\r\n * @return Padding value\r\n */\n get: function get() {\n return this.getPropertyValue(\"paddingRight\");\n },\n\n /**\r\n * Right padding - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Padding value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"paddingRight\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"paddingTop\", {\n /**\r\n * @return Padding value\r\n */\n get: function get() {\n return this.getPropertyValue(\"paddingTop\");\n },\n\n /**\r\n * Top padding - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Padding value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"paddingTop\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"paddingBottom\", {\n /**\r\n * @return Padding value\r\n */\n get: function get() {\n return this.getPropertyValue(\"paddingBottom\");\n },\n\n /**\r\n * Bottom padding - absolute (px) or relative ([[Percent]]).\r\n *\r\n * @param value Padding value\r\n */\n set: function set(value) {\n this.setPercentProperty(\"paddingBottom\", value, true, true, this._positionPrecision, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelPaddingRight\", {\n /**\r\n * Returns current right padding in pixels.\r\n *\r\n * @readonly\r\n * @return Right padding (px)\r\n */\n get: function get() {\n return this.getPixelX(this.paddingRight);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativePaddingRight\", {\n /**\r\n * Returns current relative right padding.\r\n *\r\n * @readonly\r\n * @return Relative right padding\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n return this.getRelativeX(this.paddingRight);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelPaddingLeft\", {\n /**\r\n * Returns current left padding in pixels.\r\n *\r\n * @readonly\r\n * @return Left padding (px)\r\n */\n get: function get() {\n return this.getPixelX(this.paddingLeft);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativePaddingLeft\", {\n /**\r\n * Returns current relative left padding.\r\n *\r\n * @readonly\r\n * @return Relative left padding\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n return this.getRelativeX(this.paddingLeft);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelPaddingTop\", {\n /**\r\n * Returns current top padding in pixels.\r\n *\r\n * @readonly\r\n * @return Top padding (px)\r\n */\n get: function get() {\n return this.getPixelY(this.paddingTop);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativePaddingTop\", {\n /**\r\n * Returns current relative top padding.\r\n *\r\n * @readonly\r\n * @return Relative top padding\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n return this.getRelativeY(this.paddingTop);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelPaddingBottom\", {\n /**\r\n * Returns current bottom padding in pixels.\r\n *\r\n * @readonly\r\n * @return Bottom padding (px)\r\n */\n get: function get() {\n return this.getPixelY(this.paddingBottom);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"relativePaddingBottom\", {\n /**\r\n * Returns current relative bottom padding.\r\n *\r\n * @readonly\r\n * @return Relative bottom padding\r\n */\n get: function get() {\n // @todo Maybe use [[Percent]]?\n return this.getRelativeY(this.paddingBottom);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"path\", {\n /**\r\n * @return Path of a Sprite element\r\n */\n get: function get() {\n return this.getPropertyValue(\"path\");\n },\n\n /**\r\n * ==========================================================================\r\n * APPEARANCE-RELATED PROPERTIES AND RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Path of Sprite element\r\n */\n set: function set(value) {\n this.setPath(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n Sprite.prototype.setPath = function (value) {\n if (this.setPropertyValue(\"path\", value)) {\n if (this._adapterO) {\n value = this._adapterO.apply(\"path\", value);\n }\n\n if (!this._isPath) {\n if (!this.element || this.element.node && !(this.element.node instanceof SVGPathElement)) {\n this.element = this.paper.add(\"path\");\n }\n\n this._isPath = true;\n }\n\n if ($type.hasValue(value)) {\n this.element.attr({\n \"d\": value\n });\n } else {\n this.element.removeAttr(\"d\");\n }\n\n this.invalidatePosition(); // otherwise is 0x0\n\n if (!this.inited) {\n this.events.once(\"inited\", this.validatePosition, this, false);\n }\n\n return true;\n }\n\n return false;\n };\n\n Object.defineProperty(Sprite.prototype, \"fillModifier\", {\n /**\r\n * @return Fill color modifier\r\n */\n get: function get() {\n return this.getPropertyValue(\"fillModifier\");\n },\n\n /**\r\n * [[ColorModifier]] that can be used to modify color and pattern of the\r\n * element's fill, e.g. create gradients.\r\n *\r\n * @param value Fill color modifiier\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"fillModifier\", value)) {\n this.setFill(this.fill);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"strokeModifier\", {\n /**\r\n * @return Stroke color modifier\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeModifier\");\n },\n\n /**\r\n * [[ColorModifier]] that can be used to modify color and pattern of the\r\n * element's stroke (outline), e.g. create gradients.\r\n *\r\n * @param value Stroke color modifier\r\n */\n set: function set(value) {\n this.setPropertyValue(\"strokeModifier\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"fillOpacity\", {\n /**\r\n * @return Opacity (0-9)\r\n */\n get: function get() {\n return this.getPropertyValue(\"fillOpacity\");\n },\n\n /**\r\n * Element's fill opacity.\r\n *\r\n * Opacity ranges from 0 (fully transparent) to 1 (fully opaque).\r\n *\r\n * @param value Opacity (0-1)\r\n */\n set: function set(value) {\n value = $math.toNumberRange(value, 0, 1);\n\n if (this.setPropertyValue(\"fillOpacity\", value)) {\n this.setSVGAttribute({\n \"fill-opacity\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"fill\", {\n /**\r\n * @return Fill\r\n */\n get: function get() {\n return this.getPropertyValue(\"fill\");\n },\n\n /**\r\n * Element's fill color or pattern.\r\n *\r\n * @param value Fill\r\n */\n set: function set(value) {\n this.setFill(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets actual `fill` property on the SVG element, including applicable color\r\n * modifiers.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Fill\r\n */\n\n Sprite.prototype.setFill = function (value) {\n if (!$type.isObject(value) || \"r\" in value) {\n value = toColor(value);\n }\n\n if (this.setColorProperty(\"fill\", value) || this.fillModifier) {\n // this can not go into next if, as value is turned to Gradient\n if (value instanceof Color) {\n if (this.fillModifier) {\n value = this.fillModifier.modify(value);\n }\n }\n\n this.realFill = value; // todo: review this place when some Color type will be added\n\n if (value instanceof Color) {\n this.setSVGAttribute({\n \"fill\": value.toString()\n });\n } else if (!$type.hasValue(value)) {\n this.removeSVGAttribute(\"fill\");\n } else if (value instanceof Pattern || value instanceof LinearGradient || value instanceof RadialGradient) {\n var fill = value;\n fill.paper = this.paper;\n this.setSVGAttribute({\n \"fill\": \"url(\\\"\" + $utils.getBaseURI() + fill.id + \"\\\")\"\n });\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"opacity\", {\n /**\r\n * @return Opacity (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"opacity\");\n },\n\n /**\r\n * Element's opacity.\r\n *\r\n * Opacity setting can range from 0 (fully transparent) to 1 (fully opaque).\r\n *\r\n * ATTENTION: It is highly not recommended to use `opacity` directly on the\r\n * element. The charts use `opacity` to hide/show elements, so your setting\r\n * might be lost if element is hidden and then later shown.\r\n *\r\n * Instead use methods `hide()` and `show()` to completely toggle off and on\r\n * the element.\r\n *\r\n * Or, use properties `fillOpacity` and `strokeOpacity`, if you need to make\r\n * the element semi-transparent.\r\n *\r\n * @param value Opacity (0-1)\r\n */\n set: function set(value) {\n value = $math.toNumberRange(value, 0, 1);\n\n if (this.setPropertyValue(\"opacity\", value)) {\n this.setSVGAttribute({\n \"opacity\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"stroke\", {\n /**\r\n * @return Stroke setting\r\n */\n get: function get() {\n return this.getPropertyValue(\"stroke\");\n },\n\n /**\r\n * Element's stroke (outline) color or pattern.\r\n *\r\n * @param value Stroke setting\r\n */\n set: function set(value) {\n this.setStroke(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets actual `stroke` property on the SVG element, including applicable\r\n * color modifiers.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Stroke setting\r\n */\n\n Sprite.prototype.setStroke = function (value) {\n if (!$type.isObject(value) || \"r\" in value) {\n value = toColor(value);\n }\n\n if (this.setColorProperty(\"stroke\", value) || this.strokeModifier) {\n // this can not go into next if, as value is turned to Gradient\n if (value instanceof Color) {\n if (this.strokeModifier) {\n value = this.strokeModifier.modify(value);\n }\n }\n\n this.realStroke = value;\n\n if (value instanceof Color) {\n if (value.hex == \"none\") {\n this.removeSVGAttribute(\"stroke\");\n } else {\n this.setSVGAttribute({\n \"stroke\": value.toString()\n });\n }\n } else if (!$type.hasValue(value)) {\n this.removeSVGAttribute(\"stroke\");\n } else if (value instanceof Pattern || value instanceof LinearGradient || value instanceof RadialGradient) {\n var stroke = value;\n stroke.paper = this.paper;\n this.setSVGAttribute({\n \"stroke\": \"url(\\\"\" + $utils.getBaseURI() + stroke.id + \"\\\")\"\n });\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"strokeOpacity\", {\n /**\r\n * @return Opacity (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeOpacity\");\n },\n\n /**\r\n * Stroke (outline) opacity.\r\n *\r\n * The values may range from 0 (fully transparent) to 1 (fully opaque).\r\n *\r\n * @param value Opacity (0-1)\r\n */\n set: function set(value) {\n value = $math.toNumberRange(value, 0, 1);\n\n if (this.setPropertyValue(\"strokeOpacity\", value)) {\n this.setSVGAttribute({\n \"stroke-opacity\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"nonScalingStroke\", {\n /**\r\n * @return Do not scale stroke (outline)\r\n */\n get: function get() {\n return this.getPropertyValue(\"nonScalingStroke\");\n },\n\n /**\r\n * Controls if the element's stroke (outline) should remain keep constant\r\n * thicnkess and do not scale when the whole element is resized.\r\n *\r\n * @param value Do not scale stroke (outline)\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.setPropertyValue(\"nonScalingStroke\", value)) {\n this.strokeWidth = this.strokeWidth;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"nonScaling\", {\n /**\r\n * @return Is element scaleable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"nonScaling\");\n },\n\n /**\r\n * Controls if element should keep constant size and not scale even if there is\r\n * space available, or it does not fit.\r\n *\r\n * @param value Is element scaleable?\r\n */\n set: function set(value) {\n // @todo Description (review)\n value = $type.toBoolean(value);\n this.setPropertyValue(\"nonScaling\", value, false, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"strokeWidth\", {\n /**\r\n * @return Thickness (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeWidth\");\n },\n\n /**\r\n * Stroke (outline) thickness in pixels.\r\n *\r\n * @param value Thickness (px)\r\n */\n set: function set(value) {\n value = $type.toNumber(value);\n this.setPropertyValue(\"strokeWidth\", value, true);\n\n if (this.nonScalingStroke) {\n if (!$type.isNumber(value)) {\n value = 1;\n }\n\n value = value / this.globalScale;\n }\n\n this.setSVGAttribute({\n \"stroke-width\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"strokeDasharray\", {\n /**\r\n * @return `stroke-dasharray`\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeDasharray\");\n },\n\n /**\r\n * A `stroke-dasharray` for the stroke (outline).\r\n *\r\n * \"Dasharray\" allows setting rules to make lines dashed, dotted, etc.\r\n *\r\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/SVG/Attribute/stroke-dasharray} for more info on `stroke-dasharray`\r\n * @param value `stroke-dasharray`\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"strokeDasharray\", value)) {\n this.setSVGAttribute({\n \"stroke-dasharray\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"strokeDashoffset\", {\n /**\r\n * @return `stroke-dashoffset`\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeDashoffset\");\n },\n\n /**\r\n * A `stroke-dashoffset` for the stroke (outline).\r\n *\r\n * \"Dashoffset\" allows setting the start position of the dashes if\r\n * `strokeDasharray` is used.\r\n *\r\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/SVG/Attribute/stroke-dashoffset} for more info on `stroke-dashoffset`\r\n * @param value `stroke-dashoffset`\r\n */\n set: function set(value) {\n value = $type.toNumber(value);\n\n if (this.setPropertyValue(\"strokeDashoffset\", value)) {\n this.setSVGAttribute({\n \"stroke-dashoffset\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"strokeLinecap\", {\n /**\r\n * @return `stroke-linecap`\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeLinecap\");\n },\n\n /**\r\n * A `stroke-linecap` to indicate how line ends are drawn.\r\n *\r\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/SVG/Tutorial/Fills_and_Strokes#Stroke} for more info on `stroke-linecap`\r\n * @param value `stroke-linecap`\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"strokeLinecap\", value)) {\n this.setSVGAttribute({\n \"stroke-linecap\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"strokeLinejoin\", {\n /**\r\n * @return `stroke-linejoin`\r\n */\n get: function get() {\n return this.getPropertyValue(\"strokeLinejoin\");\n },\n\n /**\r\n * A `stroke-linejoin` to indicate how line ends are drawn.\r\n *\r\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/SVG/Tutorial/Fills_and_Strokes#Stroke} for more info on `stroke-linejoin`\r\n * @param value `stroke-linejoin`\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"strokeLinejoin\", value)) {\n this.setSVGAttribute({\n \"stroke-linejoin\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"shapeRendering\", {\n /**\r\n * @return 'shape-rendering' value\r\n */\n get: function get() {\n return this.getPropertyValue(\"shapeRendering\");\n },\n\n /**\r\n * An SVG-specific `shape-rendering` value.\r\n *\r\n * `shape-rendering` controls how vector graphics are drawn and rendered.\r\n *\r\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/SVG/Attribute/shape-rendering} for more information about `shape-rendering`\r\n * @default \"auto\"\r\n * @param value 'shape-rendering' value\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"shapeRendering\", value)) {\n this.setSVGAttribute({\n \"shape-rendering\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"pixelPerfect\", {\n /**\r\n * @return Use pixel perfect?\r\n */\n get: function get() {\n return this.getPropertyValue(\"pixelPerfect\");\n },\n\n /**\r\n * Controls if SVG vectors should be drawn with \"pixel\" precision, producing\r\n * perfectly crisp lines on retina displays.\r\n *\r\n * Setting this to `true` might improve visual quality, but may have a\r\n * negative effect on performance.\r\n *\r\n * Different elements use different default setting for `pixelPerfect`.\r\n *\r\n * We recommend leaving this at their default settings, unless there's a\r\n * specific need.\r\n *\r\n * @param value Use pixel perfect?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (value) {\n this._positionPrecision = options.pixelPerfectPrecision;\n } else {\n this._positionPrecision = 3;\n }\n\n this.setPropertyValue(\"pixelPerfect\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"rtl\", {\n /**\r\n * @return RTL?\r\n */\n get: function get() {\n if ($type.hasValue(this._rtl)) {\n return this._rtl;\n } else if (this._topParent) {\n return this._topParent.rtl;\n } //this.rtl = false;\n\n\n return false;\n },\n\n /**\r\n * An RTL (right-to-left) setting.\r\n *\r\n * RTL may affect alignment, text, and other visual properties.\r\n *\r\n * If you set this on a top-level chart object, it will be used for all\r\n * child elements, e.g. labels, unless they have their own `rtl` setting\r\n * set directly on them.\r\n *\r\n * @param value `true` for to use RTL\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (this.isBaseSprite) {\n this.topParent.rtl = value;\n }\n\n this._rtl = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * ==========================================================================\r\n * VISIBILITY AND ORDER PROPERTIES AND RELATED STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Reveals hidden element.\r\n *\r\n * Has no effect if element is already visible.\r\n *\r\n * If `duration` is not specified, it will use default.\r\n *\r\n * @param duration Fade in duration (ms)\r\n * @return Animation object if such object was created\r\n */\n\n Sprite.prototype.show = function (duration) {\n return this.showReal(duration);\n };\n /**\r\n * Performs actual operations to reveal this element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param duration Fade in duration (ms)\r\n * @return Fade in duration (ms)\r\n */\n\n\n Sprite.prototype.showReal = function (duration) {\n var _this = this;\n\n if (this.preventShow) {\n return;\n }\n\n var transition;\n var properties = this.defaultState.properties;\n\n if (!this.disabled && (this.isHidden || !this.visible || this.isHiding || properties.opacity != null && this.opacity < properties.opacity && !this.isShowing) && !this.isDisposed()) {\n // helps to avoid flicker, as show might change opacity or visibility but item might be at invalid state/position\n if (this.invalid) {\n this.validate();\n }\n\n if (this.positionInvalid) {\n this.validatePosition();\n }\n\n if (!$type.isNumber(duration)) {\n duration = this.defaultState.transitionDuration;\n }\n\n if (this._hideAnimation) {\n this._hideAnimation.kill();\n\n this._hideAnimation = undefined;\n } // Cancel hide handler just in case it was there\n\n\n if (this._showHideDisposer) {\n this.removeDispose(this._showHideDisposer);\n }\n\n this._isHidden = false;\n this.isHiding = false;\n this.isShowing = true; // Apply current state\n\n transition = this.applyCurrentState(duration);\n\n if (transition && !transition.isFinished()) {\n this._showHideDisposer = transition.events.on(\"animationended\", function () {\n _this.isShowing = false;\n });\n\n this._disposers.push(this._showHideDisposer);\n } else {\n this.isShowing = false;\n } // Make it visible\n\n\n var visible = this.defaultState.properties.visible;\n\n if (!$type.hasValue(visible)) {\n visible = true;\n }\n\n this.visible = visible; // Unhide from screen readers\n\n this.readerHidden = false; // Dispatch \"show\" event\n\n this.dispatchImmediately(\"shown\");\n }\n\n return transition;\n };\n /**\r\n * Initiates hiding of Sprite.\r\n * When called it will fade out the the Sprite to transparency, then make it\r\n * invisible.\r\n * @param duration Duration in millisecons\r\n */\n\n /**\r\n * Hides the element, by applying `hidden` state.\r\n *\r\n * Has no effect if element is already hidden.\r\n *\r\n * If `duration` is not specified, it will use default.\r\n *\r\n * While element is fading out, its `isHiding` property will resolve to\r\n * `true`.\r\n *\r\n * When element is hidden, its `visible` property will resolve to `false`.\r\n *\r\n * @param duration Fade out duration (ms)\r\n * @return hide Animation object if such object was created\r\n */\n\n\n Sprite.prototype.hide = function (duration) {\n return this.hideReal(duration);\n };\n /**\r\n * Hides actual SVG elements and handles hiding animations.\r\n *\r\n * @param duration Fade out duration (ms)\r\n * @return Fade out duration (ms)\r\n * @ignore\r\n */\n\n\n Sprite.prototype.hideReal = function (duration) {\n var _this = this;\n\n var transition;\n\n if (!this.isHiding && this.visible && !this.isDisposed()) {\n // added to solve 51375\n if (this.tooltip && this.tooltip.currentSprite == this) {\n this.hideTooltip(0);\n }\n\n if (this._hideAnimation) {\n this._hideAnimation.kill();\n\n this._hideAnimation = undefined;\n }\n\n this.isShowing = false; // Cancel hide handler just in case it was there\n\n if (this._showHideDisposer) {\n this.removeDispose(this._showHideDisposer);\n } // Get state\n\n\n var hiddenState_1 = this.hiddenState; // Transition to \"hidden\" state, provided Sprite has one set\n\n if (hiddenState_1) {\n // Yes, we have a \"hidden\" state\n // `setState` will return an `Animation` object which we can set\n // events on\n transition = this.setState(hiddenState_1, duration, undefined);\n\n if (transition && !transition.isFinished()) {\n this._hideAnimation = transition;\n this._showHideDisposer = transition.events.on(\"animationended\", function () {\n _this.isHiding = false;\n _this._isHidden = true;\n\n if (hiddenState_1.properties.visible == false) {\n _this.visible = false;\n }\n }, this);\n\n this._disposers.push(this._showHideDisposer); // Thrown everything into `_disposers` just in case Sprite gets\n // destroyed in the meantime\n\n\n this._disposers.push(transition);\n } else {\n this.isHiding = false;\n this._isHidden = true;\n }\n } else {\n // No hidden state, let's just set `visible` and call it a day\n this.visible = false;\n this.isHiding = false;\n this._isHidden = true;\n } // Hide from screen readers\n\n\n this.readerHidden = true; // Dispach \"hidden\" event\n\n this.dispatchImmediately(\"hidden\");\n this.invalidate(); // hide it at once to avoid flickers // validate() causes SO\n }\n\n if (!$type.isNumber(duration)) {\n duration = this.hiddenState.transitionDuration;\n }\n\n return transition;\n };\n\n Object.defineProperty(Sprite.prototype, \"visible\", {\n /**\r\n * @return Visible?\r\n */\n get: function get() {\n return this.getVisibility();\n },\n\n /**\r\n * Indicates if element is current visible (`true`) or hidden (`false`).\r\n *\r\n * @param value Visible?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n this.setVisibility(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns visibility value\r\n * @ignore\r\n */\n\n Sprite.prototype.getVisibility = function () {\n var value = this.getPropertyValue(\"visible\");\n\n if (!$type.hasValue(value)) {\n value = true;\n }\n\n return value;\n };\n /**\r\n * Sets `visibility` property:\r\n *\r\n * * `true` - visible\r\n * * `false` - hidden\r\n *\r\n * @param value true - visible, false - hidden\r\n * @return Current visibility\r\n */\n\n\n Sprite.prototype.setVisibility = function (value) {\n if (this.setPropertyValue(\"visible\", value)) {\n if (value) {\n this.group.removeAttr(\"visibility\");\n } else {\n this.group.attr({\n \"visibility\": \"hidden\"\n });\n } //this.invalidatePosition();\n\n\n if (this.events.isEnabled(\"visibilitychanged\")) {\n var event_4 = {\n type: \"visibilitychanged\",\n target: this,\n visible: value\n };\n this.events.dispatchImmediately(\"visibilitychanged\", event_4);\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"zIndex\", {\n /**\r\n * @return zIndex\r\n */\n get: function get() {\n return this.getPropertyValue(\"zIndex\");\n },\n\n /**\r\n * A \"zIndex\" of the element.\r\n *\r\n * \"zIndex\" determines the order of how elements are placed over each other.\r\n *\r\n * Higher \"zIndex\" will mean the element will be draw on top of elements\r\n * with lower \"zIndexes\".\r\n *\r\n * @param value zIndex\r\n */\n set: function set(value) {\n value = $type.toNumber(value);\n\n if (this.setPropertyValue(\"zIndex\", value)) {\n this.dispatch(\"zIndexChanged\");\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Moves the element to the very top in element order, so that it appears\r\n * in front of other elements.\r\n */\n\n Sprite.prototype.toFront = function () {\n var parent = this._parent;\n\n if (parent && parent.children.indexOf(this) != parent.children.length - 1) {\n parent.children.moveValue(this, parent.children.length - 1);\n this.dispatch(\"zIndexChanged\");\n }\n };\n /**\r\n * Moves the element to the very bottom in the element order, so that it\r\n * appears behind other elements.\r\n */\n\n\n Sprite.prototype.toBack = function () {\n var parent = this._parent;\n\n if (parent && parent.children.indexOf(this) != 0) {\n parent.children.moveValue(this, 0);\n this.dispatch(\"zIndexChanged\");\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"userClassName\", {\n /**\r\n * @return Class name\r\n */\n get: function get() {\n return this.getPropertyValue(\"userClassName\");\n },\n\n /**\r\n * A custom class name to set on the element.\r\n *\r\n * If set, the value will be added to element's `class` attribute.\r\n *\r\n * @since 4.9.11\r\n * @param value Class name\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"userClassName\", value)) {\n if (!value && this.userClassName) {\n this.group.removeClass(this.userClassName);\n }\n\n this.setClassName();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltip\", {\n /**\r\n * @return Tooltip\r\n */\n get: function get() {\n if (this._tooltip) {\n return this._tooltip;\n } else if (this.virtualParent) {\n return this.virtualParent.tooltip;\n } else if (this._parent) {\n return this._parent.tooltip;\n }\n },\n\n /**\r\n * ==========================================================================\r\n * TOOLTIP-RELATED PROPERTIES STUFF\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * A [[Tooltip]] object to be used when displayed rollover information for\r\n * the element.\r\n *\r\n * @param tooltip Tooltip\r\n */\n set: function set(tooltip) {\n if (this._tooltip) {\n //this._tooltip.dispose();\n this.removeDispose(this._tooltip);\n }\n\n this._tooltip = tooltip;\n\n if (tooltip) {\n tooltip.parent = this.tooltipContainer;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipDataItem\", {\n /**\r\n * @return Tooltip data item\r\n */\n get: function get() {\n var tooltipDataItem = this._tooltipDataItem;\n\n if (tooltipDataItem) {\n return tooltipDataItem;\n } else {\n return this.dataItem;\n }\n },\n\n /**\r\n * A [[DataItem]] to use when populating content for the element's\r\n * [[Tooltip]].\r\n *\r\n * @see {@link Tooltip}\r\n * @see {@link DataItem}\r\n * @param value Tooltip data item\r\n */\n set: function set(value) {\n // important: do not dispose tooltip dataItem, as it is some actual data item from data!\n this._tooltipDataItem = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipColorSource\", {\n /**\r\n * @return Tooltip color source\r\n */\n get: function get() {\n return this._tooltipColorSource;\n },\n\n /**\r\n * A [[Sprite]] or sprite template to use when getting colors for tooltip. If a template is set,\r\n * tooltip will look for a clone in tooltipDataItem.sprites. If no clone is found, then template colors will be used.\r\n *\r\n * @see {@link Tooltip}\r\n * @see {@link Sprite}\r\n * @param sprite Sprite\r\n */\n set: function set(sprite) {\n this._tooltipColorSource = sprite;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Shows the element's [[Tooltip]].\r\n *\r\n * A tooltip will be populated using text templates in either `tooltipHTML` or\r\n * `tooltipText` as well as data in `tooltipDataItem`.\r\n *\r\n * @see {@link Tooltip}\r\n * @param optional point (sprite-related) to which tooltip must point.\r\n * @return returns true if the tooltip was shown and false if it wasn't (no text was found)\r\n */\n\n Sprite.prototype.showTooltip = function (point) {\n if (this.showTooltipOn == \"always\" && !this._tooltip && this.tooltip) {\n this._tooltip = this.tooltip.clone();\n }\n\n if (!point && this.tooltipPosition == \"pointer\" && this.isHover) {\n point = $utils.documentPointToSvg(getInteraction().lastPointer.point, this.svgContainer.SVGContainer, this.svgContainer.cssScale);\n } // do not show if hidden\n\n\n var sprite = this;\n\n while (sprite != undefined) {\n if (!sprite.visible || sprite.disabled || sprite.__disabled) {\n if (this._tooltip && this._tooltip.visible) {\n this._tooltip.hide(0);\n }\n\n return;\n }\n\n sprite = sprite.parent;\n }\n\n if ($type.hasValue(this.tooltipText) || $type.hasValue(this.tooltipHTML)) {\n var tooltip = this.tooltip;\n var tooltipDataItem = this.tooltipDataItem;\n\n if (tooltip) {\n tooltip.targetSprite = this;\n var colorSource_1 = this;\n var tooltipColorSource_1 = this.tooltipColorSource;\n\n if ((tooltip.getStrokeFromObject || tooltip.getFillFromObject) && tooltipColorSource_1) {\n if (tooltipColorSource_1.isTemplate) {\n if (tooltipDataItem) {\n $array.eachContinue(tooltipDataItem.sprites, function (sprite) {\n if (sprite.clonedFrom == tooltipColorSource_1) {\n colorSource_1 = sprite;\n return false;\n }\n\n return true;\n });\n }\n } else {\n colorSource_1 = tooltipColorSource_1;\n }\n }\n\n if (tooltip.getStrokeFromObject) {\n var stroke = this.stroke;\n var source = colorSource_1;\n\n while (source.parent != undefined) {\n stroke = source.stroke;\n\n if (stroke == undefined) {\n source = source.parent;\n }\n\n if (stroke != undefined) {\n break;\n }\n }\n\n if (stroke instanceof Color) {\n tooltip.background.animate({\n property: \"stroke\",\n to: stroke\n }, tooltip.animationDuration);\n } else {\n tooltip.background.stroke = stroke;\n }\n } // Set data item\n\n\n tooltip.dataItem = tooltipDataItem;\n tooltip.label.populateStringFrom = this;\n\n if (tooltip.getFillFromObject) {\n var fill = this.fill;\n var source = colorSource_1;\n\n while (source.parent != undefined) {\n fill = source.fill;\n\n if (fill == undefined || fill instanceof Color && fill.rgb == undefined) {\n source = source.parent;\n } else if (fill != undefined) {\n break;\n }\n }\n\n if (fill == undefined) {\n fill = color(\"#000000\");\n }\n\n if (fill instanceof Color) {\n if (!tooltip.visible) {\n tooltip.background.fill = fill;\n } else {\n tooltip.background.animate({\n property: \"fill\",\n to: fill\n }, tooltip.animationDuration);\n }\n } else {\n tooltip.background.fill = fill;\n }\n\n if (tooltip.autoTextColor && fill instanceof Color) {\n tooltip.label.fill = fill.alternative;\n }\n } // Apply tooltip text\n\n\n var text = \"\";\n\n if (this.tooltipHTML) {\n tooltip.html = this.tooltipHTML;\n text = this.tooltipHTML;\n }\n\n if (this.tooltipText) {\n tooltip.text = this.tooltipText;\n text = this.tooltipText;\n }\n\n if (this.updateTooltipPosition(point)) {\n // Set accessibility option\n tooltip.readerDescribedBy = this.uidAttr(); // make label to render to be able to check currentText\n\n if (tooltip.label.invalid) {\n tooltip.label.validate();\n }\n\n if (text != undefined && text != \"\" && tooltip.label.currentText != \"\") {\n //@todo: think of how to solve this better\n if (tooltip && !tooltip.parent) {\n tooltip.parent = this.tooltipContainer;\n } // Reveal tooltip\n // showing it in 1 ms helps to avoid strange flickering in IE\n\n\n var duration = tooltip.defaultState.transitionDuration;\n\n if (duration <= 0) {\n duration = 1;\n }\n\n tooltip.show(duration);\n tooltip.currentSprite = this;\n return true;\n } else {\n this.hideTooltip(0);\n }\n } else {\n this.hideTooltip(0);\n }\n }\n }\n\n return false;\n };\n /**\r\n * @ignore\r\n */\n\n\n Sprite.prototype.updateTooltipPosition = function (point) {\n var _this = this;\n\n if (this.tooltipPosition == \"pointer\") {\n if (this._interactionDisposer) {\n this._interactionDisposer.dispose();\n }\n\n this._interactionDisposer = getInteraction().body.events.on(\"track\", function (ev) {\n return _this.pointTooltipTo($utils.documentPointToSvg(ev.point, _this.svgContainer.SVGContainer, _this.svgContainer.cssScale), true);\n });\n\n if (point) {\n return this.pointTooltipTo(point, true);\n }\n } else {\n // Point to the X/Y of this Sprite\n var globalPoint = $utils.spritePointToSvg({\n \"x\": this.getTooltipX(),\n \"y\": this.getTooltipY()\n }, this);\n return this.pointTooltipTo(globalPoint);\n }\n };\n /**\r\n * Sets the point the [[Tooltip]] should point to.\r\n *\r\n * @param point Coordinates to point to\r\n * @param instantly Move instantly without animation\r\n */\n\n\n Sprite.prototype.pointTooltipTo = function (point, instantly) {\n var tooltip = this.tooltip;\n\n if (tooltip && this.topParent) {\n if (tooltip.showInViewport) {\n tooltip.pointTo(point, instantly);\n return true;\n }\n\n if ($math.isInRectangle(point, {\n x: 0,\n y: 0,\n width: this.topParent.maxWidth,\n height: this.topParent.maxHeight\n })) {\n tooltip.pointTo(point, instantly);\n return true;\n }\n }\n\n return false;\n };\n /**\r\n * Hides element's [[Tooltip]].\r\n *\r\n * @see {@link Tooltip}\r\n */\n\n\n Sprite.prototype.hideTooltip = function (duration) {\n if (this.showTooltipOn == \"always\") {\n return;\n }\n\n var tooltip = this.tooltip;\n\n if (tooltip) {\n if (tooltip.targetSprite == this) {\n tooltip.targetSprite = undefined;\n }\n\n tooltip.hide(duration);\n\n if (this._interactionDisposer) {\n this._interactionDisposer.dispose();\n\n this._interactionDisposer = undefined;\n }\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"tooltipHTML\", {\n /**\r\n * @return Tooltip HTML content template\r\n */\n get: function get() {\n return this.getPropertyValue(\"tooltipHTML\");\n },\n\n /**\r\n * An HTML template to be used to populate [[Tooltip]] contents.\r\n *\r\n * If element has `tooltipDataItem` or `dataItem` set, this will be parsed\r\n * for any data values to be replaced with the values from respective data\r\n * items.\r\n *\r\n * @param value Tooltip HTML content template\r\n */\n set: function set(value) {\n value = $type.toText(value);\n this.hoverable = true;\n\n if (this.setPropertyValue(\"tooltipHTML\", value)) {\n if (this.tooltip) {\n if (this.tooltip.visible) {\n this.showTooltip();\n }\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipText\", {\n /**\r\n * @return Tooltip content template\r\n */\n get: function get() {\n return this.getPropertyValue(\"tooltipText\");\n },\n\n /**\r\n * A text template to be used to populate Tooltip's contents.\r\n *\r\n * If element has `tooltipDataItem` or `dataItem` set, this will be parsed\r\n * for any data values to be replaced with the values from respective data\r\n * items.\r\n *\r\n * This template will also be parsed for any special formatting tags.\r\n *\r\n * @param value Tooltip content template\r\n * @see {@link TextFormatter}\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (value) {\n this.hoverable = true;\n }\n\n if (this.setPropertyValue(\"tooltipText\", value)) {\n if (this.tooltip) {\n if (this.tooltip.visible) {\n this.showTooltip();\n }\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipContainer\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Container\r\n */\n get: function get() {\n if (this._tooltipContainer) {\n return this._tooltipContainer;\n } else if (this._parent) {\n return this._parent.tooltipContainer;\n }\n },\n\n /**\r\n * A container reference that should be used to place element's\r\n * [[Tooltip]] in.\r\n *\r\n * Will use parent's container if does not have one set.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Container\r\n * @todo Dispose of the old _tooltipContainer ?\r\n */\n set: function set(value) {\n this._tooltipContainer = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipX\", {\n /**\r\n * @return Tooltip X (px)\r\n */\n get: function get() {\n return this.getTooltipX();\n },\n\n /**\r\n * X coordinate the [[Tooltip]] should be shown at.\r\n *\r\n * @param value Tooltip X (px)\r\n */\n set: function set(value) {\n if (this.setPercentProperty(\"tooltipX\", value) && this.tooltip) {\n this.tooltip.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"alwaysShowTooltip\", {\n /**\r\n * @return Always show tooltip?\r\n */\n get: function get() {\n return this.getPropertyValue(\"showTooltipOn\") == \"always\";\n },\n\n /**\r\n * DEPRECATION NOTICE: This setting is deprecated in favor of a more flexible\r\n * setting: `showTooltipOn`. Please use `showTooltipOn = \"always\"` instead.\r\n *\r\n * Indicates if this element should display a tooltip permanently.\r\n *\r\n * Useful, if you want to show permanent tooltips on some items.\r\n *\r\n * @default false\r\n * @since 4.5.4\r\n * @deprecated Use `showTooltipOn = \"always\"` instead\r\n * @param value Always show tooltip?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n\n if (value) {\n this.showTooltipOn = \"always\";\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"showTooltipOn\", {\n /**\r\n * @return When to show tooltip\r\n */\n get: function get() {\n return this.getPropertyValue(\"showTooltipOn\");\n },\n\n /**\r\n * Indicates when tooltip needs to be shown on this element:\r\n *\r\n * * `\"hover\"` (default) - Tooltip will be shown when element is hovered on.\r\n * * `\"hit\"` - Tooltip will be shown when element is clicked/tapped. Tooltip will be hidden when clicked/tapped anywhere else.\r\n * * `\"always\"` - Tooltip will be shown on the element permanently.\r\n *\r\n * For example, if you would like to show tooltips on all of the columns of\r\n * a [[ColumnSeries]]:\r\n *\r\n * ```TypeScript\r\n * series.columns.template.showTooltipOn = \"always\";\r\n * ```\r\n * ```JavaScript\r\n * series.columns.template.showTooltipOn = \"always\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"series\": [{\r\n * // ...\r\n * \"columns\": {\r\n * \"showTooltipOn\": \"always\"\r\n * }\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * It can even be set to display on a selected columns via `propertyFields`:\r\n *\r\n * ```TypeScript\r\n * series.columns.template.propertyFields.showTooltipOn = \"tooltip\";\r\n * ```\r\n * ```JavaScript\r\n * series.columns.template.propertyFields.showTooltipOn = \"tooltip\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"series\": [{\r\n * // ...\r\n * \"columns\": {\r\n * \"propertyFields\": {\r\n * \"showTooltipOn\": \"tooltip\"\r\n * }\r\n * }\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @default \"hover\"\r\n * @since 4.7.9\r\n * @param value When to show tooltip\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"showTooltipOn\", value)) {\n if (value == \"hit\") {\n this.clickable = true;\n }\n\n if (this.tooltip) {\n if (value == \"always\") {\n this.showTooltip();\n } else {\n this.handleAlwaysShowTooltip();\n }\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipPosition\", {\n /**\r\n * Position\r\n */\n get: function get() {\n return this.getPropertyValue(\"tooltipPosition\");\n },\n\n /**\r\n * Specifies if [[Tooltip]] should follow the mouse or touch pointer or stay\r\n * at the fixed position.\r\n *\r\n * @param value Position\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tooltipPosition\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"tooltipY\", {\n /**\r\n * @return Tooltip Y (px)\r\n */\n get: function get() {\n return this.getTooltipY();\n },\n\n /**\r\n * Y coordinate the [[Tooltip]] should be shown at.\r\n *\r\n * @param value Tooltip Y (px)\r\n */\n set: function set(value) {\n if (this.setPercentProperty(\"tooltipY\", value) && this.tooltip) {\n this.tooltip.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns Tooltip X coordinate if it's set, or middle of the element.\r\n *\r\n * @ignore Exclude from docs\r\n * @return X (px)\r\n */\n\n Sprite.prototype.getTooltipX = function () {\n var x = this.getPropertyValue(\"tooltipX\");\n\n if (!$type.hasValue(x)) {\n x = percent(50);\n }\n\n var value;\n\n if ($type.isNumber(x)) {\n value = x;\n }\n\n if (x instanceof Percent) {\n value = this.maxLeftSelf + this._measuredWidthSelf * x.value - this.pixelPaddingLeft - this.ex; // overflow is know only for measured items, so this is not always good\n }\n\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n return value;\n };\n /**\r\n * Returns Tooltip Y coordinate if it's set, or middle of the element.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Y (px)\r\n */\n\n\n Sprite.prototype.getTooltipY = function () {\n var y = this.getPropertyValue(\"tooltipY\");\n\n if (!$type.hasValue(y)) {\n y = percent(50);\n }\n\n var value;\n\n if ($type.isNumber(y)) {\n value = y;\n }\n\n if (y instanceof Percent) {\n value = this.maxTopSelf + this._measuredHeightSelf * y.value - this.pixelPaddingTop - this.ey; // overflow is know only for measured items, so this is not always good\n }\n\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n return value;\n };\n /**\r\n * Displays a modal or console message with error, and halts any further\r\n * processing of this item.\r\n *\r\n * @ignore Exclude from docs\r\n * @param e Error\r\n * @todo Implement from applying further actions to this item\r\n */\n\n\n Sprite.prototype.raiseCriticalError = function (e, closable) {\n if (this.svgContainer) {\n if (!this._adapterO) {\n this.modal.content = e.message;\n } else {\n this.modal.content = this._adapterO.apply(\"criticalError\", e).message;\n }\n\n if (!closable) {\n this.disabled = true;\n } else {\n this.modal.closable = true;\n }\n\n if (!options.suppressErrors) {\n this.modal.open();\n }\n }\n\n if (options.verbose) {\n console.log(e);\n }\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n Sprite.prototype.processConfig = function (config) {\n if (config) {\n // Tooltip color source\n if ($type.hasValue(config.tooltipColorSource) && $type.isString(config.tooltipColorSource) && this.map.hasKey(config.tooltipColorSource)) {\n config.tooltipColorSource = this.map.getKey(config.tooltipColorSource);\n } // Cursor styles\n\n\n if ($type.hasValue(config.cursorOverStyle) && $type.isString(config.cursorOverStyle)) {\n config.cursorOverStyle = this.getCursorStyle(config.cursorOverStyle);\n }\n\n if ($type.hasValue(config.cursorDowntyle) && $type.isString(config.cursorDowntyle)) {\n config.cursorDowntyle = this.getCursorStyle(config.cursorDowntyle);\n }\n\n if ($type.hasValue(config.cursorOptions)) {\n if ($type.hasValue(config.cursorOptions.overStyle) && $type.isString(config.cursorOptions.overStyle)) {\n config.cursorOptions.overStyle = this.getCursorStyle(config.cursorOptions.overStyle);\n }\n\n if ($type.hasValue(config.cursorOptions.downStyle) && $type.isString(config.cursorOptions.downStyle)) {\n config.cursorOptions.downStyle = this.getCursorStyle(config.cursorOptions.downStyle);\n }\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n\n this.processDelayedMap();\n };\n /**\r\n * Converts string name of the cursor into actual [[MouseCursorStyle]].\r\n *\r\n * @param style Cursor type\r\n * @return Cursor definition\r\n */\n\n\n Sprite.prototype.getCursorStyle = function (style) {\n switch (style) {\n case \"grab\":\n return MouseCursorStyle.grab;\n\n case \"grabbing\":\n return MouseCursorStyle.grabbing;\n\n case \"pointer\":\n return MouseCursorStyle.pointer;\n\n case \"horizontalResize\":\n return MouseCursorStyle.horizontalResize;\n\n case \"verticalResize\":\n return MouseCursorStyle.verticalResize;\n\n default:\n return MouseCursorStyle.default;\n }\n };\n /**\r\n * This function is used to sort element's JSON config properties, so that\r\n * some properties that absolutely need to be processed last, can be put at\r\n * the end.\r\n *\r\n * @ignore Exclude from docs\r\n * @param a Element 1\r\n * @param b Element 2\r\n * @return Sorting number\r\n */\n\n\n Sprite.prototype.configOrder = function (a, b) {\n if (a == b) {\n return 0;\n } // Must come last\n else if (a == \"tooltipColorSource\") {\n return 1;\n } else if (b == \"tooltipColorSource\") {\n return -1;\n } else {\n return _super.prototype.configOrder.call(this, a, b);\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"isHidden\", {\n /**\r\n * If `sprite.hide()` is called, we set isHidden to true when sprite is hidden.\r\n * This was added becaus hidden state might have visibility set to true and so\r\n * there would not be possible to find out if a sprite is technically hidden or not.\r\n */\n get: function get() {\n if (this._isHidden) {\n return this._isHidden;\n } else if (this._parent) {\n return this._parent.isHidden;\n }\n\n return false;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"showOnInit\", {\n /**\r\n * @return Show on init?\r\n */\n get: function get() {\n return this.getPropertyValue(\"showOnInit\");\n },\n\n /**\r\n * If this is set to `true`, Sprite, when inited will be instantly hidden\r\n * (\"hidden\" state applied) and then shown (\"default\" state applied).\r\n *\r\n * If your \"default\" state's `transitionDuration > 0` this will result in\r\n * initial animation from \"hidden\" state to \"default\" state.\r\n *\r\n * If you need a Sprite which has `showOnInit = true` not to be shown\r\n * initially, set `sprite.hidden = true`. Setting `sprite.visible = false`\r\n * will not prevent the animation and the sprite will be shown.\r\n *\r\n * @param value show on init?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n this.setShowOnInit(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n Sprite.prototype.setShowOnInit = function (value) {\n if (this.setPropertyValue(\"showOnInit\", value)) {\n if (!this.isTemplate) {\n if (value && !this.inited && !this.hidden) {\n this._showOnInitDisposer = new MultiDisposer([registry.events.once(\"enterframe\", this.hideInitially, this), this.events.once(\"beforevalidated\", this.hideInitially, this, false), this.events.on(\"inited\", this.appear, this, false)]);\n\n this._disposers.push(this._showOnInitDisposer);\n } else {\n if (this._showOnInitDisposer) {\n this._showOnInitDisposer.dispose();\n }\n }\n }\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n Sprite.prototype.hideInitially = function () {\n if (!this.isDisposed()) {\n this.appeared = false; //if (!this.hidden && !this._isHidden) { // not good for series, as on enterframe it doesn't have data items yet.\n\n if (!this.inited) {\n this.hide(0);\n }\n }\n };\n /**\r\n * Hides the chart instantly and then shows it. If defaultState.transitionDuration > 0, this will result an animation in which properties of hidden state will animate to properties of visible state.\r\n */\n\n\n Sprite.prototype.appear = function () {\n var _this = this;\n\n this.appeared = false;\n\n if (!this.hidden && !this.isHidden) {\n this.hide(0);\n }\n\n if (!this.hidden) {\n var animation = this.show();\n\n if (animation && !animation.isFinished()) {\n this.addDisposer(animation.events.on(\"animationended\", function () {\n _this.appeared = true;\n\n _this.dispatch(\"appeared\");\n }));\n } else {\n this.appeared = true;\n this.dispatch(\"appeared\");\n }\n } else {\n this.appeared = true;\n this.dispatch(\"appeared\");\n }\n };\n\n Object.defineProperty(Sprite.prototype, \"hidden\", {\n /**\r\n * @return Is initially hidden?\r\n */\n get: function get() {\n return this.getPropertyValue(\"hidden\");\n },\n\n /**\r\n * If a sprite has `showOnInit = true`, it will animate from \"hidden\" to\r\n * \"default\" state when initialized. To prevent this but keep\r\n * `showOnInit = true`, you can set `sprite.hidden = true`.\r\n *\r\n * @param value initially hidden?\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n this.setPropertyValue(\"hidden\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"bbox\", {\n /**\r\n * Returns bounding box (square) for this element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n get: function get() {\n if (this.definedBBox) {\n return this.definedBBox;\n }\n\n return this._bbox;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Sprite.prototype, \"plugins\", {\n /**\r\n * A list of plugins (objects that implement [[IPlugin]] interface) attached\r\n * to this object.\r\n *\r\n * @since 4.2.2\r\n * @return List of plugins\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._plugins) {\n this._plugins = new List();\n\n this._disposers.push(this._plugins.events.on(\"inserted\", function (ev) {\n ev.newValue.target = _this;\n ev.newValue.init();\n }));\n\n this._disposers.push(new ListDisposer(this._plugins));\n }\n\n return this._plugins;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Called during the System.update method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Sprite.prototype._systemUpdate = function (skippedSprites) {\n this.validate();\n };\n /**\r\n * Called during the System.update method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype._systemCheckIfValidate = function () {\n return true;\n };\n /**\r\n * Called during the System.validatePositions method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype._systemValidatePositions = function () {\n this.validatePosition();\n };\n /**\r\n * Called during the System.validateLayouts method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Sprite.prototype._systemValidateLayouts = function () {};\n\n return Sprite;\n}(BaseObjectEvents);\n\nexport { Sprite };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Sprite\"] = Sprite;","/**\r\n * Functionality for drawing rectangles.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport * as $math from \"../utils/Math\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a rectangle.\r\n *\r\n * @see {@link IRectangleEvents} for a list of available events\r\n * @see {@link IRectangleAdapters} for a list of available Adapters\r\n */\n\nvar Rectangle =\n/** @class */\nfunction (_super) {\n __extends(Rectangle, _super);\n /**\r\n * Constructor\r\n * * Creates a `<rect>` element\r\n * * Creates default state\r\n */\n\n\n function Rectangle() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Rectangle\";\n _this.element = _this.paper.add(\"rect\"); //this.pixelPerfect = false;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Rectangle.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var precision = this._positionPrecision;\n\n if (this.pixelPerfect) {\n precision = 0;\n }\n\n var w = $math.round(this.innerWidth, precision);\n var h = $math.round(this.innerHeight, precision);\n this.element.attr({\n \"width\": w,\n \"height\": h\n });\n };\n /**\r\n * Measures the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Rectangle.prototype.measureElement = function () {};\n\n Object.defineProperty(Rectangle.prototype, \"bbox\", {\n /**\r\n * Returns bounding box (square) for this element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n get: function get() {\n if (this.definedBBox) {\n return this.definedBBox;\n }\n\n if (this.isMeasured) {\n return {\n x: 0,\n y: 0,\n width: this.innerWidth,\n height: this.innerHeight\n };\n } else {\n return {\n x: 0,\n y: 0,\n width: 0,\n height: 0\n };\n }\n },\n enumerable: true,\n configurable: true\n });\n return Rectangle;\n}(Sprite);\n\nexport { Rectangle };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Rectangle\"] = Rectangle;","/**\r\n * Container module\r\n * @todo Needs description\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"./Sprite\";\nimport { SpriteState } from \"./SpriteState\";\nimport { List } from \"./utils/List\";\nimport { MultiDisposer } from \"./utils/Disposer\";\nimport { Dictionary, DictionaryDisposer } from \"./utils/Dictionary\";\nimport { getInteraction } from \"./interaction/Interaction\";\nimport { Rectangle } from \"./elements/Rectangle\";\nimport { Percent } from \"./utils/Percent\";\nimport { registry } from \"./Registry\";\nimport { InterfaceColorSet } from \"../core/utils/InterfaceColorSet\";\nimport * as $iter from \"./utils/Iterator\";\nimport * as $array from \"./utils/Array\";\nimport * as $math from \"./utils/Math\";\nimport * as $type from \"./utils/Type\";\nimport * as $dom from \"./utils/DOM\";\nimport { system } from \"./System\";\nimport { options } from \"./Options\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Container can contain multiple sprites and arrange them in various layouts.\r\n *\r\n * @see {@link IContainerEvents} for a list of available events\r\n * @see {@link IContainerAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar Container =\n/** @class */\nfunction (_super) {\n __extends(Container, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Container() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Container children. (sorted by layout)\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n _this._childrenByLayout = [];\n /**\r\n * Container's disposers for its child elements.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._childrenDisposers = new Dictionary();\n /**\r\n * Indicates if this container contains any focused elements, including\r\n * itself.\r\n */\n\n _this.hasFocused = false;\n /**\r\n * An array of references to elements the state should be set, when it is set\r\n * on this element.\r\n */\n\n _this.setStateOnSprites = [];\n /*\r\n * @ignore\r\n */\n\n _this.layoutInvalid = false;\n _this._absoluteWidth = 0;\n _this._absoluteHeight = 0;\n /**\r\n * An array of child Sprites that should be ready before this object can\r\n * fire a \"ready\" event.\r\n */\n\n _this._shouldBeReady = [];\n /**\r\n * Enables touch tap protection.\r\n */\n\n _this._tapToActivate = false;\n /**\r\n * If `tapToActivate` is used, this setting will determine how long the chart\r\n * will stay in \"active\" mode.\r\n *\r\n * @default 3000\r\n * @since 4.4.0\r\n */\n\n _this.tapTimeout = 3000;\n _this.className = \"Container\";\n _this._element = _this.paper.addGroup(\"g\");\n\n _this.group.add(_this.element);\n\n _this.setPropertyValue(\"pixelPerfect\", false);\n\n _this.setPropertyValue(\"layout\", \"absolute\");\n\n _this.setPropertyValue(\"fixedWidthGrid\", false);\n\n _this.setPropertyValue(\"verticalCenter\", \"none\");\n\n _this.setPropertyValue(\"horizontalCenter\", \"none\");\n\n _this._positionPrecision = 4;\n\n _this._disposers.push(new DictionaryDisposer(_this._childrenDisposers));\n\n _this.children.events.on(\"inserted\", _this.handleChildAdded, _this);\n\n _this.children.events.on(\"removed\", _this.handleChildRemoved, _this);\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Handles adding of a new child into `children`. Adding new children might\r\n * affect the whole layout so it needs to be revalidated.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event object\r\n * @todo Throw an exception on adding a disposed object. Of course it's better NOT TO add disposed objects, so that what we should focus on.\r\n */\n\n\n Container.prototype.handleChildAdded = function (event) {\n this.processChild(event.newValue);\n };\n /**\r\n * @ignore\r\n */\n\n\n Container.prototype.processChild = function (child) {\n // try solves the problem when somedy adds child directly to children\n try {\n this._childrenDisposers.insertKey(child.uid, new MultiDisposer([// it's not enough to listen to POSITION_CHANGED only, as some extra redrawals will happen.\n child.events.on(\"transformed\", this.handleChildTransform, this), child.events.on(\"zIndexChanged\", this.sortAndAdd, this)]));\n } catch (err) {// void\n }\n\n if (this.element) {\n var group = this.element;\n group.add(child.group);\n }\n\n child.parent = this;\n child.paper = this.paper;\n this.dispatchImmediately(\"childadded\", {\n type: \"childadded\",\n newValue: child\n });\n this.invalidate();\n };\n /**\r\n * @ignore\r\n */\n\n\n Container.prototype.sortAndAdd = function () {\n this.sortChildren();\n this.addChildren();\n };\n /**\r\n * Handles child removal. Changing size of the child may change the\r\n * whole layout of the Container, hence layout needs to be invalidated.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event object\r\n */\n\n\n Container.prototype.handleChildRemoved = function (event) {\n var child = event.oldValue; // TODO figure out why the key sometimes doesn't exist\n\n this._childrenDisposers.removeKey(child.uid);\n\n if (this.element) {\n var group = this.element;\n group.removeElement(child.group);\n }\n\n if (child.isMeasured) {\n this.invalidateLayout();\n }\n\n this.dispatchImmediately(\"childremoved\", {\n type: \"childremoved\",\n oldValue: child\n });\n };\n /**\r\n * Handles child transformation. Changing size of the child may change the\r\n * whole layout of the Container, hence layout needs to be invalidated.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event object\r\n */\n\n\n Container.prototype.handleChildTransform = function (event) {\n var child = event.target;\n\n if (child.isMeasured) {\n // && this.layout != \"none\" && this.layout != \"absolute\") {\n this.invalidateLayout();\n }\n };\n /**\r\n * Invalidates Container's layout, causing it to be re-evaluated again.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.invalidateLayout = function () {\n if (this.layoutInvalid || this.disabled || this.isTemplate || this.layout == \"none\" || this.__disabled) {\n return;\n }\n\n this.layoutInvalid = true;\n registry.addToInvalidLayouts(this);\n system.requestFrame();\n };\n /**\r\n * Invalidates element.\r\n *\r\n * Object will be redrawn during the next update cycle.\r\n *\r\n * Please note that in most cases elements will auto-invalidate when needed. If\r\n * everything works, DO NOT use this method. Use it only if some changes do\r\n * not take otherwise.\r\n */\n\n\n Container.prototype.invalidate = function () {\n _super.prototype.invalidate.call(this);\n\n this.invalidateLayout();\n };\n /**\r\n * Invalidates the whole element, including layout AND all its child\r\n * elements.\r\n *\r\n * As this will essentially force all elements to redraw, use only if\r\n * absolutely necessary.\r\n */\n\n\n Container.prototype.deepInvalidate = function () {\n _super.prototype.invalidate.call(this); //this.sortChildren();\n\n\n $array.each(this._childrenByLayout, function (child) {\n if (child instanceof Container) {\n child.deepInvalidate();\n } else {\n child.invalidate();\n }\n });\n this.invalidateLayout();\n };\n\n Object.defineProperty(Container.prototype, \"children\", {\n /**\r\n * Returns a list of the child [[Sprite]] elements contained in this\r\n * Container.\r\n *\r\n * @return List of child elements (Sprites)\r\n */\n get: function get() {\n // @todo Review if we can add all children to disposers\n if (!this._children) {\n this._children = new List(); //this._disposers.push(new ListDisposer(this._children));\n }\n\n return this._children;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"minWidth\", {\n /**\r\n * @return Width (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minWidth\");\n },\n\n /**\r\n * Minimum width (px) for the Container. A container will not\r\n * auto-shrink beyond this value, even if child elements are smaller.\r\n *\r\n * @param value Width (px)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"minWidth\", value)) {\n this.invalidateLayout();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"minHeight\", {\n /**\r\n * @return Height (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minHeight\");\n },\n\n /**\r\n * Minimum height (px) for the Container. A container will not\r\n * auto-shrink beyond this value, even if child elements are smaller.\r\n *\r\n * @param value Height (px)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"minHeight\", value)) {\n this.invalidateLayout();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Overrides the original `removeElement` so that Container's actual element\r\n * is not removed. We do not need to remove element of a Container.\r\n *\r\n * We do this because remove element each time will fail the `getBBox`.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Container.prototype.removeElement = function () {};\n /**\r\n * Sorts Container's children: the ones with variable width and height are\r\n * put at the end of the list (depending on layout type), so that fixed-width\r\n * ones can be drawn first.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.sortChildren = function () {\n var _this = this;\n\n this._childrenByLayout = [];\n\n if (this.layout == \"none\" || this.layout == \"absolute\" || !this.layout) {\n //$iter.each(this.children.iterator(), (child) => {\n //\tthis._childrenByLayout.push(child);\n //});\n this._childrenByLayout = this.children.values;\n } else {\n // Assemble fixed-size and relative lists\n var fixed_1 = [];\n var relative_1 = [];\n $iter.each(this.children.iterator(), function (child) {\n if (_this.layout == \"horizontal\" || _this.layout == \"grid\") {\n if (!$type.isNumber(child.percentWidth)) {\n fixed_1.push(child);\n } else {\n relative_1.push(child);\n }\n } else if (_this.layout == \"vertical\") {\n if (!$type.isNumber(child.percentHeight)) {\n fixed_1.push(child);\n } else {\n relative_1.push(child);\n }\n } else {\n fixed_1.push(child);\n }\n }); // Concat everything into list\n\n this._childrenByLayout = fixed_1.concat(relative_1);\n }\n\n this.calculateRelativeSize();\n };\n /**\r\n * Calculates relative sizes for all Container's children.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Make it protected?\r\n */\n\n\n Container.prototype.calculateRelativeSize = function () {\n var _this = this;\n\n var totalRelativeWidth = 0;\n var totalRelativeHeight = 0;\n $array.each(this._childrenByLayout, function (child) {\n // if child is not measured, we do not care about it at all.\n if (child.isMeasured) {\n if ($type.isNumber(child.percentWidth)) {\n totalRelativeWidth += child.percentWidth;\n }\n\n if ($type.isNumber(child.percentHeight)) {\n totalRelativeHeight += child.percentHeight;\n }\n }\n });\n $array.each(this._childrenByLayout, function (child) {\n if (child.isMeasured) {\n if (_this.layout == \"horizontal\") {\n if ($type.isNumber(child.percentWidth)) {\n child.relativeWidth = child.percentWidth / totalRelativeWidth;\n }\n\n if ($type.isNumber(child.percentHeight)) {\n child.relativeHeight = child.percentHeight / 100;\n }\n }\n\n if (_this.layout == \"vertical\") {\n if ($type.isNumber(child.percentHeight)) {\n child.relativeHeight = child.percentHeight / totalRelativeHeight;\n }\n\n if ($type.isNumber(child.percentWidth)) {\n child.relativeWidth = child.percentWidth / 100;\n }\n }\n\n if (_this.layout == \"grid\") {\n if ($type.isNumber(child.percentHeight)) {\n child.relativeHeight = child.percentHeight / 100;\n }\n\n if ($type.isNumber(child.percentWidth)) {\n child.relativeWidth = child.percentWidth / 100;\n }\n }\n }\n\n if (_this.layout == \"absolute\" || !child.isMeasured) {\n if ($type.isNumber(child.percentWidth)) {\n child.relativeWidth = child.percentWidth / 100;\n }\n\n if ($type.isNumber(child.percentHeight)) {\n child.relativeHeight = child.percentHeight / 100;\n }\n }\n });\n };\n /**\r\n * Adds all children to Container's SVG element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.addChildren = function () {\n /*\r\n Need this check because a child might be assigned to parent even before element is created, for example a theme\r\n access scrollbar.thumb\r\n */\n if (this.element) {\n var zindexed = $array.copy(this.children.values); // not children by layout!\n\n var sortArray = zindexed.map(function (data, idx) {\n return {\n idx: idx,\n data: data\n };\n });\n sortArray.sort(function (a, b) {\n var ai = a.data.zIndex || 0;\n var bi = b.data.zIndex || 0;\n\n if (ai < bi) {\n return -1;\n }\n\n if (ai > bi) {\n return 1;\n }\n\n return a.idx - b.idx;\n });\n zindexed = sortArray.map(function (val) {\n return val.data;\n });\n var group_1 = this.element; // check, maybe the order is good already\n\n var isCorrect = true;\n\n if (group_1.node && group_1.node.childNodes) {\n for (var i = 0, len = group_1.node.childNodes.length; i < len; i++) {\n if (group_1.node.childNodes[i] != zindexed[i].group.node) {\n isCorrect = false;\n break;\n }\n }\n }\n\n if (!isCorrect) {\n $array.each(zindexed, function (child) {\n if (child.group) {\n group_1.add(child.group);\n }\n });\n\n if (this._background) {\n this.group.addToBack(this._background.group);\n }\n\n this.invalidateLayout();\n }\n }\n };\n /**\r\n * Creates a new element of specific type and assigns as a child to the\r\n * Container.\r\n *\r\n * @param Class type for the new element\r\n * @return New element\r\n */\n\n\n Container.prototype.createChild = function (classType) {\n var sprite = new classType();\n sprite.parent = this;\n return sprite;\n };\n /**\r\n * Removes all Container's children without actually destroying them.\r\n *\r\n * To destroy children use `disposeChildren()` instead.\r\n */\n\n\n Container.prototype.removeChildren = function () {\n // remove all children\n // TODO use iteration instead\n while (this.children.length > 0) {\n var child = this.children.getIndex(0);\n child.parent = undefined;\n this.children.removeValue(child);\n }\n };\n /**\r\n * Removes and destroys all Container's children.\r\n *\r\n * To remove children from Container without destroying them, use\r\n * `removeChildren()`.\r\n */\n\n\n Container.prototype.disposeChildren = function () {\n // TODO use iteration instead\n while (this.children.length > 0) {\n var child = this.children.getIndex(0);\n child.dispose();\n this.children.removeValue(child);\n }\n };\n\n Object.defineProperty(Container.prototype, \"background\", {\n /**\r\n * @return Background element\r\n */\n get: function get() {\n if (!this._background) {\n this._background = this.createBackground();\n this.processBackground();\n }\n\n return this._background;\n },\n\n /**\r\n * An element to use as container background.\r\n *\r\n * @param background Background element\r\n */\n set: function set(background) {\n if (this._background && this.background != background) {\n this.removeDispose(this._background);\n }\n\n if (background) {\n this._background = background;\n\n this._disposers.push(background);\n\n this.processBackground();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Handles the situation where parent element is resized.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Container.prototype.handleGlobalScale = function () {\n _super.prototype.handleGlobalScale.call(this);\n\n this.children.each(function (child) {\n child.handleGlobalScale();\n });\n };\n /**\r\n * Creates and returns a [[Rectangle]] to use as a background for Container.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Background Rectangle element\r\n */\n\n\n Container.prototype.createBackground = function () {\n return new Rectangle();\n };\n /**\r\n * Decorates background element with required properties.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.processBackground = function () {\n var background = this._background;\n\n if (background) {\n background.isMeasured = false;\n this._background.fill = new InterfaceColorSet().getFor(\"background\");\n background.parent = this;\n background.isMeasured = false;\n this.children.removeValue(background);\n\n this._disposers.push(background);\n\n this.group.addToBack(this._background.group);\n }\n };\n /**\r\n * Measures the size of container and informs its children of how much size\r\n * they can occupy, by setting their relative `maxWidth` and `maxHeight`\r\n * properties.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.validateLayout = function () {\n var _this = this;\n\n registry.removeFromInvalidLayouts(this);\n this.layoutInvalid = false; // prevents from drawing if topparent is 0x0\n\n /*\r\n let topParent = this.topParent;\r\n if (topParent) {\r\n if (!topParent.maxWidth || !topParent.maxHeight) {\r\n this._disposers.push(topParent.events.once(\"maxsizechanged\", this.invalidateLayout, this));\r\n }\r\n }*/\n\n this._availableWidth = this.innerWidth;\n this._availableHeight = this.innerHeight;\n var measuredWidth = 0;\n var measuredHeight = 0;\n var allValid = true;\n\n if (this.children) {\n this.sortChildren(); // we itterate through list of children, sorted by layout priority. sprites which width non-relative width/height will go first, so we will reduce available width before proceeding to sprites with relative width/height\n\n $array.each(this._childrenByLayout, function (child) {\n var maxWidth;\n var maxHeight;\n\n if ($type.isNumber(child.relativeWidth)) {\n maxWidth = $math.round(_this._availableWidth * child.relativeWidth, 2);\n\n if (_this.layout == \"horizontal\") {\n // || this.layout == \"absolute\") {\n maxWidth -= child.pixelMarginRight + child.pixelMarginLeft;\n }\n } else {\n if (_this.layout == \"horizontal\") {\n if (child.invalid) {\n child.validate();\n }\n }\n }\n\n if ($type.isNumber(child.relativeHeight)) {\n maxHeight = $math.round(_this._availableHeight * child.relativeHeight, 2);\n\n if (_this.layout == \"vertical\") {\n // || this.layout == \"absolute\") {\n maxHeight -= child.pixelMarginTop + child.pixelMarginBottom;\n }\n } else {\n if (_this.layout == \"vertical\") {\n if (child.invalid) {\n child.validate();\n }\n }\n } // if child is valid\n\n\n if (child.invalid == false) {\n if ($type.isNumber(child.relativeWidth)) {\n child.maxWidth = maxWidth;\n }\n\n if ($type.isNumber(child.relativeHeight)) {\n child.maxHeight = maxHeight;\n }\n\n if (child.isMeasured) {\n // reduce available width if this is horizontal layout\n if (_this.layout == \"horizontal\") {\n if (!$type.isNumber(child.percentWidth)) {\n if (child.measuredWidth > 0) {\n _this._availableWidth -= child.measuredWidth + child.pixelMarginLeft + child.pixelMarginRight;\n }\n }\n } // reduce available height if this is vertical layout\n\n\n if (_this.layout == \"vertical\") {\n if (!$type.isNumber(child.percentHeight)) {\n if (child.measuredHeight > 0) {\n _this._availableHeight -= child.measuredHeight + child.pixelMarginTop + child.pixelMarginBottom;\n }\n }\n }\n\n var childMeasuredWidth = child.measuredWidth;\n var childMeasuredHeight = child.measuredHeight;\n\n if (child.align != \"none\") {\n childMeasuredWidth += child.pixelMarginLeft + child.pixelMarginRight;\n }\n\n if (child.valign != \"none\") {\n childMeasuredHeight += child.pixelMarginTop + child.pixelMarginBottom;\n }\n\n measuredWidth = Math.max(measuredWidth, childMeasuredWidth);\n measuredHeight = Math.max(measuredHeight, childMeasuredHeight);\n }\n } // if child is not valid\n else {\n // tell child what maximum width/ height it can occupy\n if (child.isMeasured) {\n if ($type.isNumber(child.relativeWidth)) {\n if (child.maxWidth != maxWidth) {\n // need to check this because of allValid\n child.maxWidth = maxWidth;\n allValid = false;\n }\n }\n\n if ($type.isNumber(child.relativeHeight)) {\n if (child.maxHeight != maxHeight) {\n // need to check this because of allValid\n child.maxHeight = maxHeight;\n allValid = false;\n }\n }\n }\n }\n });\n }\n\n this._absoluteWidth = measuredWidth;\n this._absoluteHeight = measuredHeight; // arrange after measuring, only if all children are valid already\n\n if (allValid) {\n this.arrange();\n }\n };\n /**\r\n * Arranges children according to layout specs and available space / child\r\n * sizes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.arrange = function () {\n var _this = this;\n\n var children = this.children;\n /*\r\n in this method we not only arrange children but also find out the size of the container\r\n it might seem it would be easier to get container size using sprite's measure method,\r\n however it would return only actual size of the bbox. However as each child meight have\r\n margins set, we need to check each child - we do it here.\r\n This method doesn't do anything with DOM, so it's not expensive\r\n */\n\n var measuredWidth = 0;\n var measuredHeight = 0; //let innerWidth: number = this.innerWidth; //$math.max(this.innerWidth, this._measuredWidth - paddingLeft - paddingRight);\n //let innerHeight: number = this.innerHeight; //$math.max(this.innerHeight, this._measuredHeight - paddingTop - paddingBottom);\n // above is wrong, as if a w/h is not specified, it is 0 and alignment doesn't work at all.\n\n var innerWidth = $math.max(this.innerWidth, this._absoluteWidth);\n var innerHeight = $math.max(this.innerHeight, this._absoluteHeight);\n var left; // = 0;\n\n var right; // = innerWidth;\n\n var top; // = 0;\n\n var bottom; // = innerHeight;\n\n var paddingLeft = this.pixelPaddingLeft;\n var paddingRight = this.pixelPaddingRight;\n var paddingTop = this.pixelPaddingTop;\n var paddingBottom = this.pixelPaddingBottom;\n var nextX = 0;\n var nextY = 0;\n var row = 0;\n var column = 0;\n var columnWidth = [];\n var rowHeight = [];\n var maxCellWidth;\n var minCellWidth;\n var columnCount;\n var maxWidth = this.maxWidth;\n var maxHeight = this.maxHeight;\n var minWidth = this.minWidth;\n var minHeight = this.minHeight;\n var childrenCopy = $array.copy(children.values);\n\n if (this.reverseOrder) {\n childrenCopy.reverse();\n } // GRID PRECALCULATIONS\n\n\n if (this.layout == \"grid\") {\n minCellWidth = maxWidth;\n maxCellWidth = 1;\n\n for (var i = 0, len = childrenCopy.length; i < len; i++) {\n var child = childrenCopy[i];\n\n if (child.isMeasured && !child.disabled && !child.__disabled) {\n var childMeasuredWidth = child.measuredWidth;\n\n if (childMeasuredWidth < minCellWidth) {\n minCellWidth = childMeasuredWidth;\n }\n\n if (childMeasuredWidth > maxCellWidth) {\n maxCellWidth = childMeasuredWidth;\n }\n }\n }\n\n minCellWidth = $math.fitToRange(minCellWidth, 1, maxWidth);\n maxCellWidth = $math.fitToRange(maxCellWidth, 1, maxWidth);\n\n if (this.fixedWidthGrid) {\n columnCount = maxWidth / maxCellWidth;\n } else {\n columnCount = maxWidth / minCellWidth; // predicted number of columns, yes it is usually much more than real number, but we fix that later\n }\n\n columnCount = $math.max(1, Math.floor(columnCount));\n columnCount = $math.min(this.maxColumns, columnCount);\n columnWidth = this.getColumnWidth(childrenCopy, columnCount, maxCellWidth);\n }\n\n var contentLeft;\n var contentRight;\n var contentTop;\n var contentBottom; // we itterate through array of children\n // TODO use iterator instead\n\n for (var i = 0, len = childrenCopy.length; i < len; i++) {\n var child = childrenCopy[i];\n\n if (child.isMeasured && !child.disabled && !child.__disabled) {\n var x = undefined; //child.pixelX; // must reset\n\n var y = undefined; //child.pixelY; // must reset\n\n var childMarginLeft = child.pixelMarginLeft;\n var childMarginRight = child.pixelMarginRight;\n var childMarginTop = child.pixelMarginTop;\n var childMarginBottom = child.pixelMarginBottom;\n var childWidth = child.measuredWidth;\n var childHeight = child.measuredHeight;\n var childLeft = void 0;\n var childRight = void 0;\n var childTop = void 0;\n var childBottom = void 0;\n\n switch (this.layout) {\n case \"none\":\n break;\n // absolute layout\n\n case \"absolute\":\n // horizontal alignment\n switch (child.align) {\n case \"left\":\n x = childMarginLeft - child.maxLeft;\n break;\n\n case \"center\":\n x = (innerWidth - childWidth) / 2 - child.maxLeft;\n break;\n\n case \"right\":\n x = innerWidth - childMarginRight - child.maxRight;\n break;\n\n default:\n if (!(child.x instanceof Percent)) {\n x = child.pixelX;\n }\n\n break;\n } // vertical alignment\n\n\n switch (child.valign) {\n case \"top\":\n y = childMarginTop - child.maxTop;\n break;\n\n case \"middle\":\n y = (innerHeight - childHeight) / 2 - child.maxTop;\n break;\n\n case \"bottom\":\n y = innerHeight - childMarginBottom - child.maxBottom;\n break;\n\n default:\n if (!(child.y instanceof Percent)) {\n y = child.pixelY;\n }\n\n break;\n }\n\n break;\n // vertical layout\n\n case \"vertical\":\n //if ($type.isNumber(child.relativeHeight)) {\n //\tchildHeight = child.maxHeight;\n //}\n switch (child.align) {\n case \"left\":\n x = childMarginLeft - child.maxLeft;\n break;\n\n case \"center\":\n x = (innerWidth - childWidth) / 2 - child.maxLeft;\n break;\n\n case \"right\":\n x = innerWidth - childMarginRight - child.maxRight;\n break;\n\n default:\n x = child.pixelX;\n break;\n }\n\n y = nextY + childMarginTop - child.maxTop;\n nextY = y + child.maxBottom + childMarginBottom;\n break;\n // horizontal layout\n\n case \"horizontal\":\n //if ($type.isNumber(child.relativeHeight)) {\n //\tchildHeight = child.maxHeight;\n //}\n switch (child.valign) {\n case \"top\":\n y = childMarginTop - child.maxTop;\n break;\n\n case \"middle\":\n y = (innerHeight - childHeight) / 2 - child.maxTop;\n break;\n\n case \"bottom\":\n y = innerHeight - childMarginBottom - child.maxBottom;\n break;\n\n default:\n y = child.pixelY;\n break;\n }\n\n x = nextX + childMarginLeft - child.maxLeft;\n nextX = x + child.maxRight + childMarginRight;\n break;\n\n case \"grid\":\n x = nextX + childMarginLeft - child.maxLeft;\n\n switch (child.valign) {\n case \"top\":\n y = nextY + childMarginTop - child.maxTop;\n break;\n\n case \"middle\":\n y = nextY + (innerHeight - childHeight) / 2 - child.maxTop;\n break;\n\n case \"bottom\":\n y = nextY + innerHeight - childMarginBottom - child.maxBottom;\n break;\n\n default:\n y = nextY - child.maxTop;\n break;\n }\n\n nextX += columnWidth[column];\n rowHeight[row] = $math.max(rowHeight[row], childHeight);\n column++;\n var nextColumnWidth = columnWidth[column];\n\n if (!$type.isNumber(nextColumnWidth)) {\n nextColumnWidth = maxCellWidth;\n }\n\n if (nextX > $math.min(this.innerWidth, maxWidth) - nextColumnWidth + 1 && column < columnCount) {\n columnCount = column;\n nextX = 0;\n nextY = 0;\n row = 0;\n column = 0;\n columnWidth = this.getColumnWidth(childrenCopy, columnCount, maxCellWidth);\n rowHeight = [];\n i = -1;\n continue;\n }\n\n if (column >= columnCount) {\n column = 0;\n nextY += rowHeight[row];\n row++;\n nextX = 0;\n }\n\n break;\n }\n\n if (this.layout !== \"none\") {\n child.moveTo({\n x: x,\n y: y\n }); // must use moveTo, otherwise x/y set in percent won't work\n\n childLeft = x + child.maxLeft - childMarginLeft;\n childRight = x + child.maxRight + childMarginRight;\n childTop = y + child.maxTop - childMarginTop;\n childBottom = y + child.maxBottom + childMarginBottom;\n\n if (childRight > right || !$type.isNumber(right)) {\n right = childRight;\n }\n\n if (childLeft < left || !$type.isNumber(left)) {\n left = childLeft;\n }\n\n if (childTop < top || !$type.isNumber(top)) {\n top = childTop;\n }\n\n if (childBottom > bottom || !$type.isNumber(bottom)) {\n bottom = childBottom;\n }\n\n if (childRight > contentRight || !$type.isNumber(contentRight)) {\n contentRight = childRight;\n }\n\n if (childLeft < contentLeft || !$type.isNumber(contentLeft)) {\n contentLeft = childLeft;\n }\n\n if (childTop < contentTop || !$type.isNumber(contentTop)) {\n contentTop = childTop;\n }\n\n if (childBottom > contentBottom || !$type.isNumber(contentBottom)) {\n contentBottom = contentBottom;\n }\n }\n } else {\n child.validatePosition();\n }\n }\n\n if (this.layout == \"none\") {\n var noneBBox = this.bbox;\n left = noneBBox.x;\n right = noneBBox.x + noneBBox.width;\n top = noneBBox.y;\n bottom = noneBBox.y + noneBBox.height;\n }\n\n if (!$type.isNumber(left)) {\n left = 0;\n contentLeft = 0;\n }\n\n if (!$type.isNumber(right)) {\n right = this._availableWidth;\n contentRight = right;\n }\n\n if (!$type.isNumber(top)) {\n top = 0;\n contentTop = 0;\n }\n\n if (!$type.isNumber(bottom)) {\n bottom = this._availableHeight;\n contentBottom = bottom;\n }\n\n if (!$type.isNumber(contentTop)) {\n contentTop = 0;\n }\n\n if (!$type.isNumber(contentBottom)) {\n contentBottom = contentTop;\n }\n\n if (!$type.isNumber(contentLeft)) {\n contentLeft = 0;\n }\n\n if (!$type.isNumber(contentRight)) {\n contentRight = contentLeft;\n }\n\n measuredWidth = right - left;\n measuredHeight = bottom - top;\n\n if ($type.isNumber(this.relativeWidth)) {\n measuredWidth = maxWidth - paddingLeft - paddingRight;\n left = 0;\n right = measuredWidth;\n }\n\n if ($type.isNumber(this.relativeHeight)) {\n measuredHeight = maxHeight - paddingTop - paddingBottom;\n top = 0;\n bottom = measuredHeight;\n }\n\n if ($type.isNumber(this._pixelWidth)) {\n left = 0;\n measuredWidth = this._pixelWidth - paddingLeft - paddingRight;\n }\n\n if ($type.isNumber(minWidth) && measuredWidth < minWidth) {\n left = 0;\n measuredWidth = this.minWidth - paddingLeft - paddingRight;\n }\n\n if ($type.isNumber(this._pixelHeight)) {\n top = 0;\n measuredHeight = this._pixelHeight - paddingTop - paddingBottom;\n }\n\n if ($type.isNumber(minHeight) && measuredHeight < minHeight) {\n top = 0;\n measuredHeight = minHeight - paddingTop - paddingBottom;\n }\n\n var measuredContentWidth = contentRight - contentLeft;\n var measuredContentHeight = contentBottom - contentTop; /// handle content alignment\n\n if (this.layout != \"none\" && (this.contentAlign || this.contentValign) && children.length > 0) {\n var dx_1;\n var dy_1;\n var mwa = measuredWidth;\n var mha = measuredHeight;\n\n if (mwa < measuredContentWidth) {\n mwa = measuredContentWidth;\n }\n\n if (mha < measuredContentHeight) {\n mha = measuredContentHeight;\n }\n\n if (this.contentAlign == \"center\") {\n dx_1 = (mwa - measuredContentWidth) / 2;\n }\n\n if (this.contentAlign == \"right\") {\n dx_1 = mwa - measuredContentWidth;\n }\n\n if (this.contentValign == \"middle\") {\n dy_1 = (mha - measuredContentHeight) / 2;\n }\n\n if (this.contentValign == \"bottom\") {\n dy_1 = mha - measuredContentHeight;\n }\n\n if ($type.isNumber(dx_1)) {\n $iter.each(children.iterator(), function (child) {\n var childLeft = child.maxLeft;\n var ddx = dx_1;\n\n if (_this.layout == \"horizontal\") {\n child.x = child.pixelX + ddx;\n } // individual grid elements can not be aligned vertically, that's why it's different from horizontal\n\n\n if (_this.layout == \"grid\") {\n child.x = child.pixelX + ddx;\n }\n\n if (_this.layout == \"vertical\") {\n ddx += child.pixelMarginLeft;\n\n if (child.align == \"none\") {\n child.x = ddx - childLeft;\n }\n }\n\n if (_this.layout == \"absolute\") {\n ddx += child.pixelMarginLeft;\n\n if (child.align == \"none\") {\n child.x = ddx - childLeft;\n }\n }\n });\n }\n\n if ($type.isNumber(dy_1)) {\n $iter.each(children.iterator(), function (child) {\n var childTop = child.maxTop;\n var ddy = dy_1;\n\n if (_this.layout == \"horizontal\") {\n ddy += child.pixelMarginTop;\n\n if (child.valign == \"none\") {\n child.y = ddy - childTop;\n }\n } // individual grid elements can not be aligned vertically, that's why it's different from horizontal\n\n\n if (_this.layout == \"grid\") {\n ddy += child.pixelMarginTop;\n child.y = ddy - childTop;\n }\n\n if (_this.layout == \"vertical\") {\n child.y = child.pixelY + ddy;\n }\n\n if (_this.layout == \"absolute\") {\n ddy += child.pixelMarginTop;\n\n if (child.valign == \"none\") {\n child.y = ddy - childTop;\n }\n }\n });\n }\n }\n\n var oldBBox = this.bbox; // this will mess up maxw/maxh set by container layout, we need a separate min/maxwidth for users\n // this prevents invalidating layout in such cases as scrolling category axis, when labels go outside bounds and results transformed event\n // todo: need to check if this doesn't cause other problems.\n //if (this.maxWidth > 0) {\n //measuredWidth = $math.min(measuredWidth, this.maxWidth);\n //measuredWidth = $math.max(measuredWidth, this.minWidth);\n //}\n //if (this.maxHeight > 0) {\n //measuredHeight = $math.min(measuredHeight, this.maxHeight);\n //measuredHeight = $math.max(measuredHeight, this.minHeight);\n //}\n\n measuredWidth = $math.max(measuredWidth, minWidth);\n measuredHeight = $math.max(measuredHeight, minHeight);\n this.contentWidth = measuredWidth;\n this.contentHeight = measuredHeight; // new\n\n measuredWidth = $math.min(measuredWidth, maxWidth);\n measuredHeight = $math.min(measuredHeight, maxHeight);\n this._bbox = {\n x: left,\n y: top,\n width: measuredWidth,\n height: measuredHeight\n };\n var prevLeft = this.maxLeft;\n var prevTop = this.maxTop;\n var prevBotttom = this.maxBottom;\n var prevRight = this.maxRight;\n this.measure();\n\n if (prevLeft != this.maxLeft || prevRight != this.maxRight || prevTop != this.maxTop || prevBotttom != this.maxBottom) {\n if (this.events.isEnabled(\"transformed\")) {\n var event_1 = {\n type: \"transformed\",\n target: this\n };\n\n if (oldBBox) {\n event_1.dummyData = oldBBox.width + \" \" + measuredWidth + \" \" + oldBBox.height + \" \" + measuredHeight;\n }\n\n this.events.dispatchImmediately(\"transformed\", event_1);\n }\n }\n\n this.dispatchImmediately(\"layoutvalidated\");\n };\n /**\r\n * Positions element according its center settings.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.updateCenter = function () {\n _super.prototype.updateCenter.call(this);\n\n this.updateBackground();\n };\n /**\r\n * Update the background to fit into specific dimensions.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Make it protected?\r\n */\n\n\n Container.prototype.updateBackground = function () {\n var background = this._background; // accessing protected, as getter creates instance if it doesn't exist\n\n if (background) {\n background.x = this.maxLeft;\n background.y = this.maxTop;\n background.width = this.maxRight - this.maxLeft;\n background.height = this.maxBottom - this.maxTop;\n }\n };\n /**\r\n * Returns widths of all columns in a horizontal Container layout.\r\n *\r\n * @ignore Exclude from docs\r\n * @param columnCount Number of columns\r\n * @param maxCellWidth Maximum width of one grid cell\r\n * @return An array of column widths\r\n */\n\n\n Container.prototype.getColumnWidth = function (children, columnCount, maxCellWidth) {\n var _this = this;\n\n var columnWidth = [];\n var column = 0;\n $array.each(children, function (child) {\n if (child.isMeasured && !child.disabled && !child.__disabled) {\n if (_this.fixedWidthGrid) {\n columnWidth[column] = maxCellWidth;\n } else {\n columnWidth[column] = $math.max(columnWidth[column], child.measuredWidth + child.pixelMarginRight + child.pixelMarginLeft);\n }\n\n column++;\n\n if (column == columnCount) {\n column = 0;\n }\n }\n });\n return columnWidth;\n };\n\n Object.defineProperty(Container.prototype, \"layout\", {\n /**\r\n * @return Layout\r\n */\n get: function get() {\n return this.getPropertyValue(\"layout\");\n },\n\n /**\r\n * Container layout.\r\n *\r\n * Options: \"absolute\" (default), \"vertical\", \"horizontal\", \"grid\", \"none\". \"none\" is quite the same as \"absolute\" - the objects will\r\n * be positioned at their x, y coordinates, the difference is that with \"absolute\" you can still use align/valign for children and with \"none\" you can not.\r\n * Use \"none\" as much as you can as it's most cpu-saving layout.\r\n *\r\n * @default \"absolute\"\r\n * @param value Layout\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"layout\", value)) {\n this.invalidateLayout();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"contentValign\", {\n /**\r\n * @return Vertical alignment\r\n */\n get: function get() {\n return this.getPropertyValue(\"contentValign\");\n },\n\n /**\r\n * Vertical alignment of the elements for the vertical Container.\r\n *\r\n * This is used when Container is larger than the height of all its children.\r\n *\r\n * @param value vertical alignment\r\n */\n set: function set(value) {\n this.setPropertyValue(\"contentValign\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"contentAlign\", {\n /**\r\n * @return Horizontal alignment\r\n */\n get: function get() {\n return this.getPropertyValue(\"contentAlign\");\n },\n\n /**\r\n * Horizontal alignment of the elements for the horizontal Container.\r\n *\r\n * This is used when Container is larger than the height of all its children.\r\n *\r\n * @param value Horizontal alignment\r\n */\n set: function set(value) {\n this.setPropertyValue(\"contentAlign\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"fixedWidthGrid\", {\n /**\r\n * @return Should use fixed width grid?\r\n */\n get: function get() {\n return this.getPropertyValue(\"fixedWidthGrid\");\n },\n\n /**\r\n * Controls if the grid of the Container should use fixed width. Fixed width\r\n * grid will divide available space to all its columns/rows equally, without\r\n * adapting to actual child sizes or size requirements.\r\n *\r\n * @default false\r\n * @param value Should use fixed width grid?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"fixedWidthGrid\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"maxColumns\", {\n /**\r\n * @return Should use fixed width grid?\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxColumns\");\n },\n\n /**\r\n * Maximum number of columns (when using `\"grid\"` layout).\r\n *\r\n * @param value Should use fixed width grid?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"maxColumns\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"reverseOrder\", {\n /**\r\n * @return Reverse children?\r\n */\n get: function get() {\n return this.getPropertyValue(\"reverseOrder\");\n },\n\n /**\r\n * If set to `true`, the children of the container will be drawn in reverse\r\n * order.\r\n *\r\n * @default false\r\n * @param value Reverse children?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"reverseOrder\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"setStateOnChildren\", {\n /**\r\n * @return Set state on children\r\n */\n get: function get() {\n return this.getPropertyValue(\"setStateOnChildren\");\n },\n\n /**\r\n * Specifies if, when state is applied on this container, the same state\r\n * should be applied to container's children as well as `background`.\r\n *\r\n * @default false\r\n * @param value Set state on children\r\n */\n set: function set(value) {\n this.setPropertyValue(\"setStateOnChildren\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Checks if point is within bounds of a container.\r\n *\r\n * @param point A coordinate to check\r\n * @return `true` if it fits within container\r\n */\n\n Container.prototype.fitsToBounds = function (point) {\n var x = point.x;\n var y = point.y;\n var deviation = 0.5; // sometimes coordinates are rounded to numbers like .999 so we add deviation here\n\n if (x >= -deviation && x <= this.pixelWidth + deviation && y >= -deviation && y <= this.pixelHeight + deviation) {\n return true;\n } else {\n return false;\n }\n };\n /**\r\n * Copies all properties from different Container, including background\r\n * clone.\r\n *\r\n * @param source Source Container to copy from\r\n */\n\n\n Container.prototype.copyFrom = function (source) {\n var _this = this;\n\n _super.prototype.copyFrom.call(this, source);\n\n this.layout = source.layout;\n this.setStateOnChildren = source.setStateOnChildren;\n\n if (source._background) {\n this.background = source._background.clone();\n this.background.copyFrom(source._background); // won't work without this\n }\n\n $iter.each(source.children.iterator(), function (child) {\n if (child.shouldClone) {\n var clonedChild = child.clone();\n clonedChild.parent = _this;\n }\n });\n };\n\n Object.defineProperty(Container.prototype, \"preloader\", {\n /**\r\n * @return Preloader instance\r\n */\n get: function get() {\n var preloader = this._preloader;\n\n if (preloader) {\n return preloader;\n } else if (this.parent) {\n return this.parent.preloader;\n }\n },\n\n /**\r\n * A [[Preloader]] instance to be used when Container is busy.\r\n *\r\n * @param preloader Preloader instance\r\n */\n set: function set(preloader) {\n if (this._preloader) {\n this.removeDispose(this._preloader);\n }\n\n this._preloader = preloader;\n\n if (preloader) {\n preloader.parent = this.tooltipContainer;\n\n this._disposers.push(preloader);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets [[Paper]] instance to use to draw elements.\r\n * @ignore\r\n * @param paper Paper\r\n * @return true if paper was changed, false, if it's the same\r\n */\n\n Container.prototype.setPaper = function (paper) {\n var _this = this;\n\n var changed = _super.prototype.setPaper.call(this, paper);\n\n if (changed) {\n if (this._background) {\n this._background.paper = paper;\n this._background.topParent = this.topParent;\n }\n\n this.children.each(function (child) {\n child.setPaper(paper);\n child.topParent = _this.topParent;\n });\n }\n\n return changed;\n };\n /**\r\n * Removes Container from the system-wide list of invalid Containers.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.removeFromInvalids = function () {\n _super.prototype.removeFromInvalids.call(this);\n\n registry.removeFromInvalidLayouts(this);\n };\n /**\r\n * Sets a [[DataItem]] to be used as data for the Container.\r\n *\r\n * @todo Description\r\n * @param dataItem DataItem\r\n */\n\n\n Container.prototype.setDataItem = function (dataItem) {\n // this place is potentially dangerous, as if we set datItem for some dummy container, all children dataItems will be overriden\n // the main reason for doing this is that we need a setDataItem code to be called for each sprite, otherwise property fields won't be\n // applied. Also, getting dataItem from parent all the time is more expensive than saving value.\n if (this._dataItem != dataItem) {\n $iter.each(this.children.iterator(), function (child) {\n child.dataItem = dataItem;\n });\n\n if (this._background) {\n this._background.dataItem = dataItem;\n }\n }\n\n _super.prototype.setDataItem.call(this, dataItem);\n };\n /**\r\n * Measures the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype.measureElement = function () {\n if (this.disabled || this.isTemplate || this.layout == \"none\" || this.__disabled) {// void\n } else {\n this.validateLayout();\n }\n };\n\n Object.defineProperty(Container.prototype, \"fontFamily\", {\n /**\r\n * @return Font family\r\n */\n get: function get() {\n return this.getPropertyValue(\"fontFamily\");\n },\n\n /**\r\n * Font family to be used for the text.\r\n *\r\n * Parts of the text may override this setting using in-line formatting.\r\n *\r\n * @param value Font family value\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"fontFamily\", value, true)) {\n this.setSVGAttribute({\n \"font-family\": value\n });\n this.invalidateLabels();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"fontSize\", {\n /**\r\n * @return Font size\r\n */\n get: function get() {\n return this.getPropertyValue(\"fontSize\");\n },\n\n /**\r\n * Font size to be used for the text. The size can either be numeric, in\r\n * pixels, or other measurements.\r\n *\r\n * Parts of the text may override this setting using in-line formatting.\r\n *\r\n * @param value Font size value\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"fontSize\", value, true)) {\n this.setSVGAttribute({\n \"font-size\": value\n });\n this.invalidateLabels();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * When fontSize of fontFamily changes we need to hard-invalidate all Labels of this container to position them properly.\r\n */\n\n Container.prototype.invalidateLabels = function () {\n this.children.each(function (child) {\n // can't import Label because of Circular dependencies\n if (child[\"hardInvalidate\"]) {\n child[\"hardInvalidate\"](); // this fixes firefox and viewport issue\n\n child.events.once(\"validated\", child.handleValidate, child, false);\n } else if (child instanceof Container) {\n child.invalidateLabels();\n }\n });\n };\n\n Object.defineProperty(Container.prototype, \"fontWeight\", {\n /**\r\n * @return Font weight\r\n */\n get: function get() {\n return this.getPropertyValue(\"fontWeight\");\n },\n\n /**\r\n * Font weight to use for text.\r\n *\r\n * Parts of the text may override this setting using in-line formatting.\r\n *\r\n * @param value Font weight\r\n */\n set: function set(value) {\n this.setPropertyValue(\"fontWeight\", value);\n this.setSVGAttribute({\n \"font-weight\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Container.prototype, \"textDecoration\", {\n /**\r\n * @return Decoration\r\n */\n get: function get() {\n return this.getPropertyValue(\"textDecoration\");\n },\n\n /**\r\n * A text decoration to use for text.\r\n *\r\n * Parts of the text may override this setting using in-line formatting.\r\n *\r\n * @param value Decoration\r\n */\n set: function set(value) {\n this.setPropertyValue(\"textDecoration\", value);\n this.setSVGAttribute({\n \"text-decoration\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Disposes (destroys) the element and all its children.\r\n */\n\n Container.prototype.dispose = function () {\n if (this._background) {\n this._background.dispose();\n }\n\n this._shouldBeReady = [];\n this.disposeChildren();\n\n _super.prototype.dispose.call(this);\n };\n /**\r\n * Applies a [[SpriteState]] on this element.\r\n *\r\n * The first parameter can either be a name of the state or a [[SpriteState]]\r\n * instance.\r\n *\r\n * When run, this method will apply SVG properties defined in a\r\n * [[SpriteState]], but only those that are relevant to this particular\r\n * element, that is are listed in its respective `properties` array.\r\n *\r\n * @see {@link SpriteState}\r\n * @param value A state - name key or instance\r\n * @param transitionDuration Duration of the transition between current and new state\r\n * @param easing An easing function\r\n */\n\n\n Container.prototype.setState = function (value, transitionDuration, easing) {\n var stateName = value;\n\n if (value instanceof SpriteState) {\n stateName = value.name;\n }\n\n if (this.setStateOnChildren) {\n $iter.each(this.children.iterator(), function (child) {\n child.setState(stateName, transitionDuration, easing); // not good to set it in child setState\n\n if (stateName != \"active\") {\n child.isActive = false;\n }\n });\n }\n\n if (this._background) {\n this._background.setState(stateName);\n }\n\n if (this.setStateOnSprites.length) {\n $array.each(this.setStateOnSprites, function (item) {\n item.setState(stateName, transitionDuration, easing);\n });\n }\n\n return _super.prototype.setState.call(this, value, transitionDuration, easing);\n }; // otherwise isActive won't work properly with background\n\n\n Container.prototype.setActive = function (value) {\n _super.prototype.setActive.call(this, value);\n\n if (this._background) {\n this._background.isActive = value;\n }\n };\n /**\r\n * Dispatches ready event. Dispatches when all children are ready.\r\n */\n\n\n Container.prototype.dispatchReady = function () {\n var _this = this;\n\n if (!this.isReady() && !this.isDisposed()) {\n var allReady_1 = true;\n $iter.eachContinue(this.children.iterator(), function (sprite) {\n if (!sprite.__disabled && !sprite.disabled && !sprite.isReady()) {\n allReady_1 = false;\n return false;\n } else {\n return true;\n }\n });\n $array.eachContinue(this._shouldBeReady, function (sprite) {\n if (!sprite.__disabled && !sprite.disabled && !sprite.isReady()) {\n allReady_1 = false;\n return false;\n } else {\n return true;\n }\n });\n\n if (allReady_1) {\n _super.prototype.dispatchReady.call(this);\n } else {\n registry.events.once(\"exitframe\", function () {\n _this.dispatchReady();\n\n system.requestFrame();\n }, undefined, false);\n }\n }\n };\n /**\r\n * Called during the System.update method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype._systemUpdate = function (skippedSprites) {\n this.children.each(function (child) {\n if (child.invalid) {\n if (!child._systemCheckIfValidate()) {\n skippedSprites.push(child);\n } else if (child.dataItem && child.dataItem.component && child.dataItem.component.dataInvalid) {\n skippedSprites.push(child);\n } else {\n child.validate();\n }\n }\n });\n\n _super.prototype._systemUpdate.call(this, skippedSprites);\n };\n /**\r\n * Called during the System.validatePositions method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype._systemValidatePositions = function () {\n this.children.each(function (sprite) {\n if (sprite.positionInvalid) {\n sprite.validatePosition();\n }\n });\n\n _super.prototype._systemValidatePositions.call(this);\n };\n /**\r\n * Called during the System.validateLayouts method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Container.prototype._systemValidateLayouts = function () {\n if (this.layoutInvalid && !this.isDisposed()) {\n this.validateLayout();\n }\n };\n\n Object.defineProperty(Container.prototype, \"tapToActivate\", {\n /**\r\n * @return Enable touch protection?\r\n */\n get: function get() {\n return this._tapToActivate;\n },\n\n /**\r\n * If set to `true` the chart's regular touch functionality will be suspended\r\n * so that the whole page it is located in remains scrollable, even when\r\n * swiping over the chart's body.\r\n *\r\n * User will need to tap the chart in order to activate its regular touch\r\n * functionality.\r\n *\r\n * The chart will remain \"active\" as long as user keeps interacting with the\r\n * chart. After `tapTimeout` milliseconds the chart will return to its\r\n * \"protected\" mode.\r\n *\r\n * @default false\r\n * @since 4.4.0\r\n * @param value Enable touch protection?\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/touch/} For more information.\r\n */\n set: function set(value) {\n if (this._tapToActivate != value) {\n this.setTapToActivate(value);\n }\n },\n enumerable: true,\n configurable: true\n });\n\n Container.prototype.setTapToActivate = function (value) {\n var _this = this;\n\n this._tapToActivate = value;\n this.interactions.isTouchProtected = value; // setEventDisposer will also remove listeners if value == false\n\n if (value) {\n this.interactions.setEventDisposer(\"container-tapToActivate\", value, function () {\n return new MultiDisposer([_this.events.on(\"hit\", _this.handleTapToActivate, _this, false), _this.events.on(\"down\", _this.initTapTimeout, _this, false), _this.events.on(\"track\", _this.initTapTimeout, _this, false), //this.events.on(\"drag\", this.initTapTimeout, this, false),\n getInteraction().body.events.on(\"down\", function (ev) {\n if (!getInteraction().isLocalElement(ev.pointer, _this.paper.svg, _this.uid)) {\n _this.handleTapToActivateDeactivation();\n }\n }, _this, false)]);\n });\n }\n\n getInteraction();\n };\n /**\r\n * @todo Ignore on non-touch events\r\n */\n\n\n Container.prototype.handleTapToActivate = function () {\n this.interactions.isTouchProtected = false;\n this.initTapTimeout();\n };\n\n Container.prototype.handleTapToActivateDeactivation = function () {\n this.interactions.isTouchProtected = true;\n };\n\n Container.prototype.initTapTimeout = function () {\n var _this = this;\n\n if (this._tapToActivateTimeout) {\n this._tapToActivateTimeout.dispose();\n }\n\n if (this.tapToActivate && !this.interactions.isTouchProtected && this.tapTimeout) {\n this._tapToActivateTimeout = this.setTimeout(function () {\n _this.handleTapToActivateDeactivation();\n }, this.tapTimeout);\n }\n };\n /**\r\n * Moves the whole chart to other HTML container.\r\n *\r\n * `htmlElement` can either be a reference to a DOM element, or an id of\r\n * such element.\r\n *\r\n * @since 4.9.24\r\n * @param htmlElement Target element\r\n */\n\n\n Container.prototype.moveHtmlContainer = function (htmlElement) {\n var newContainer = $dom.getElement(htmlElement);\n\n if (newContainer) {\n this.htmlContainer = newContainer;\n var svgDiv = this.svgContainer;\n svgDiv.htmlElement = newContainer;\n svgDiv.htmlElement.appendChild(svgDiv.SVGContainer);\n svgDiv.initSensor();\n svgDiv.measure();\n } else if ($type.isString(htmlElement) && htmlElement != \"\") {\n system.log(\"html container '\" + htmlElement + \"' not found\"); //throw new Error(\"html container not found\");\n }\n };\n /**\r\n * @ignore\r\n * @return Has license?\r\n */\n\n\n Container.prototype.hasLicense = function () {\n if (options.commercialLicense) {\n return true;\n }\n\n for (var i = 0; i < options.licenses.length; i++) {\n if (options.licenses[i].match(/^CH.{5,}/i)) {\n return true;\n }\n }\n\n return false;\n };\n\n return Container;\n}(Sprite);\n\nexport { Container };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Container\"] = Container;","/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\nimport { registry, is } from \"./Registry\";\nimport { Container } from \"./Container\";\nimport { raf } from \"./utils/AsyncPending\";\nimport { triggerIdle } from \"./utils/AsyncPending\";\nimport * as $array from \"./utils/Array\";\nimport * as $object from \"./utils/Object\";\nimport * as $log from \"./utils/Log\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * The main class that handles system-wide tasks, like caching, heartbeats, etc.\r\n * @important\r\n */\n\nvar System =\n/** @class */\nfunction () {\n /**\r\n * Performs initialization of the System object.\r\n *\r\n * Called when the first [[Sprite]] object is created.\r\n *\r\n * @ignore Exclude from docs\r\n */\n function System() {\n /**\r\n * A flag indicating if the system is on pause.\r\n */\n this._isPaused = false;\n /**\r\n * Holds the list of currently playing animations.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n this.animations = [];\n /**\r\n * Unique ID of the object.\r\n */\n\n this.uid = registry.getUniqueId();\n /**\r\n * @todo Description\r\n * @todo Needed?\r\n * @ignore Exclude from docs\r\n */\n\n this.dummyCounter = 0;\n this._frameRequested = false;\n this.updateStepDuration = 45;\n this.time = Date.now();\n }\n /**\r\n * Reports time elapsed since timer was reset.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Needed?\r\n * @param msg Message to report in console\r\n * @param reset Reset time counter\r\n */\n\n\n System.prototype.reportTime = function (msg, reset) {\n if (this.dummyCounter < 6) {//console.log(Date.now() - this.time, msg, this.dummyCounter2);\n }\n\n if (reset) {\n this.time = Date.now();\n }\n };\n /**\r\n * Performs \"heartbeat\" operations `frameRate` number of times per second.\r\n *\r\n * When the chart element is invalidated, it is not immediately redrawn.\r\n *\r\n * Instead it waits for the next `update()` cycle to be re-validated.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Maybe should be private?\r\n */\n\n\n System.prototype.update = function () {\n var _this = this;\n\n if (this._isPaused) {\n return;\n }\n\n this._frameRequested = false;\n var time = Date.now();\n registry.dispatchImmediately(\"enterframe\"); //this.validateLayouts();\n //this.validatePositions();\n\n /*\r\n for (let key in registry.invalidLayouts) {\r\n this.validateLayouts(key);\r\n }\r\n for (let key in registry.invalidPositions) {\r\n this.validatePositions(key);\r\n }\r\n */\n\n var skippedComponents = []; // data objects first - do all calculations\n // only data is parsed in chunks, thats why we do for loop instead of a while like with other invalid items.\n // important to go backwards, as items are removed!\n // TODO use iterator instead\n\n for (var key in registry.invalidDatas) {\n if ($object.hasKey(registry.invalidDatas, key)) {\n var invalidData = registry.invalidDatas[key];\n\n while (invalidData.length > 0) {\n var component = invalidData[0];\n var dataProvider = component.dataProvider;\n\n if (!component.isDisposed()) {\n if (dataProvider && dataProvider.dataInvalid) {\n try {\n dataProvider.validateData();\n\n if (dataProvider.dataValidationProgress < 1) {\n break;\n }\n } catch (e) {\n $array.remove(invalidData, dataProvider);\n dataProvider.raiseCriticalError(e);\n }\n } else {\n try {\n component.validateData();\n\n if (component.dataValidationProgress < 1) {\n break;\n }\n } catch (e) {\n $array.remove(invalidData, component);\n component.raiseCriticalError(e);\n }\n }\n } else {\n $array.remove(invalidData, component);\n }\n }\n\n if (Date.now() - time > this.updateStepDuration) {\n break;\n }\n }\n }\n\n while (registry.invalidRawDatas.length > 0) {\n var component = registry.invalidRawDatas[0];\n\n if (!component.isDisposed()) {\n try {\n component.validateRawData();\n } catch (e) {\n $array.remove(registry.invalidRawDatas, component);\n component.raiseCriticalError(e);\n }\n } else {\n $array.remove(registry.invalidRawDatas, component);\n }\n } // TODO use iterator instead\n\n\n while (registry.invalidDataItems.length > 0) {\n var component = registry.invalidDataItems[0];\n var dataProvider = component.dataProvider; // this is needed to avoid partial value validation when data is parsed in chunks\n\n if (component.isDisposed() || component.dataInvalid || dataProvider && dataProvider.dataInvalid) {// void\n } else {\n try {\n component.validateDataItems();\n } catch (e) {\n $array.remove(registry.invalidDataItems, component);\n component.raiseCriticalError(e);\n }\n } // this might seem too much, as validateValues removes from invalidDataItems aswell, but just to be sure (in case validateData is overriden and no super is called)\n\n\n $array.remove(registry.invalidDataItems, component);\n } // TODO use iterator instead\n\n\n while (registry.invalidDataRange.length > 0) {\n var component = registry.invalidDataRange[0];\n var dataProvider = component.dataProvider;\n\n if (component.isDisposed() || component.dataInvalid || dataProvider && dataProvider.dataInvalid) {// void\n } else {\n try {\n component.validateDataRange();\n\n if (!component.skipRangeEvent) {\n component.dispatchImmediately(\"datarangechanged\");\n }\n\n component.skipRangeEvent = false;\n } catch (e) {\n $array.remove(registry.invalidDataRange, component);\n component.raiseCriticalError(e);\n }\n } // this might seem too much, as validateDataRange removes from invalidDataRange aswell, but just to be sure (in case validateData is overriden and no super is called)\n\n\n $array.remove(registry.invalidDataRange, component);\n }\n\n var skippedSprites = []; // display objects later\n // TODO use iterator instead\n\n $object.each(registry.invalidLayouts, function (key) {\n _this.validateLayouts(key);\n });\n $object.each(registry.invalidPositions, function (key) {\n _this.validatePositions(key);\n });\n var hasSkipped = false;\n time = Date.now();\n $object.each(registry.invalidSprites, function (key, invalidSprites) {\n var count = 0;\n\n while (invalidSprites.length > 0) {\n _this.validateLayouts(key);\n\n _this.validatePositions(key);\n\n count++;\n\n if (count == 5) {\n if (Date.now() - time > _this.updateStepDuration) {\n break;\n }\n\n count = 0;\n }\n\n var sprite = invalidSprites[invalidSprites.length - 1]; // we need to check this, as validateLayout might validate sprite\n\n if (sprite && !sprite.isDisposed()) {\n if (!sprite._systemCheckIfValidate()) {\n // void\n skippedSprites.push(sprite);\n } else {\n if (!_this.checkIfValidate2(sprite)) {\n // void\n skippedSprites.push(sprite);\n } else {\n try {\n sprite._systemUpdate(skippedSprites);\n } catch (e) {\n sprite.invalid = false;\n $array.remove(invalidSprites, sprite);\n sprite.raiseCriticalError(e);\n }\n }\n } // this might seem too much, but it's ok\n\n\n sprite.invalid = false;\n }\n\n $array.remove(invalidSprites, sprite);\n }\n\n registry.invalidSprites[key] = registry.invalidSprites[key].concat(skippedSprites);\n });\n $object.each(registry.invalidSprites, function (key, value) {\n if (value.length > 0) {\n hasSkipped = true;\n }\n });\n $object.each(registry.invalidDatas, function (key, value) {\n if (value.length > 0) {\n hasSkipped = true;\n }\n }); // TODO make this more efficient\n // TODO don't copy the array\n\n $array.each($array.copy(this.animations), function (x) {\n x.update();\n }); //if(!hasSkipped){\n\n $object.each(registry.invalidLayouts, function (key) {\n _this.validateLayouts(key);\n });\n $object.each(registry.invalidPositions, function (key) {\n _this.validatePositions(key);\n }); //}\n\n triggerIdle();\n $object.each(registry.invalidLayouts, function (key) {\n _this.validateLayouts(key);\n });\n $object.each(registry.invalidPositions, function (key) {\n _this.validatePositions(key);\n });\n registry.dispatchImmediately(\"exitframe\");\n\n if (hasSkipped || this.animations.length > 0 || skippedComponents.length > 0) {\n this.requestFrame();\n }\n\n if (this.updateStepDuration < 200) {\n var all0_1 = true;\n $object.each(registry.invalidDatas, function (key, value) {\n if (value.length > 0) {\n all0_1 = false;\n }\n });\n $object.each(registry.invalidSprites, function (key, value) {\n if (value.length > 0) {\n all0_1 = false;\n }\n });\n\n if (all0_1) {\n this.updateStepDuration = 200;\n }\n }\n };\n\n System.prototype.checkIfValidate2 = function (sprite) {\n if (sprite.dataItem && sprite.dataItem.component && sprite.dataItem.component.dataInvalid && !sprite.dataItem.component.isTemplate) {\n return false;\n } else {\n return true;\n }\n };\n /**\r\n * Requests new animation frame\r\n */\n\n\n System.prototype.requestFrame = function () {\n var _this = this;\n\n if (!this._frameRequested) {\n raf(function () {\n _this.update();\n });\n this._frameRequested = true;\n }\n };\n /**\r\n * Call this method if you update data or config of a chart that is in\r\n * hidden container, after revealing the container, so that labels and\r\n * possibly other elements can correctly arrange themselves.\r\n *\r\n * @since 4.7.10\r\n * @param container Target container\r\n */\n\n\n System.prototype.softInvalidate = function (container) {\n var _this = this;\n\n container.children.each(function (child) {\n if (child instanceof Container) {\n _this.softInvalidate(child);\n }\n\n if (child.measureFailed) {\n if (is(child, \"Label\")) {\n child.hardInvalidate();\n } else {\n child.invalidate();\n }\n\n child.measureFailed = false;\n }\n });\n };\n /**\r\n * Triggers position re-validation on all [[Sprite]] elements that have\r\n * invalid(ated) positions.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Maybe should be private?\r\n */\n\n\n System.prototype.validatePositions = function (id) {\n // invalid positions\n // TODO use iterator instead\n var invalidPositions = registry.invalidPositions[id];\n\n while (invalidPositions.length > 0) {\n var sprite = invalidPositions[invalidPositions.length - 1];\n\n if (!sprite.isDisposed()) {\n try {\n sprite._systemValidatePositions();\n } catch (e) {\n sprite.positionInvalid = false;\n $array.remove(invalidPositions, sprite);\n sprite.raiseCriticalError(e);\n }\n } else {\n $array.remove(invalidPositions, sprite);\n }\n }\n };\n /**\r\n * Triggers position re-validation on all [[Container]] elements that have\r\n * invalid(ated) layouts.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Maybe should be private?\r\n */\n\n\n System.prototype.validateLayouts = function (id) {\n // invalid positions\n // TODO use iterator instead\n var invalidLayouts = registry.invalidLayouts[id];\n\n while (invalidLayouts.length > 0) {\n var container = invalidLayouts[invalidLayouts.length - 1];\n\n if (!container.isDisposed()) {\n try {\n container.children.each(function (sprite) {\n sprite._systemValidateLayouts();\n });\n container.validateLayout();\n } catch (e) {\n container.layoutInvalid = false;\n $array.remove(invalidLayouts, container);\n container.raiseCriticalError(e);\n }\n } else {\n $array.remove(invalidLayouts, container);\n }\n }\n };\n /**\r\n * Outputs string to console if `verbose` is `true`.\r\n *\r\n * @param value Message to output to console\r\n */\n\n\n System.prototype.log = function (value) {\n $log.log(value);\n };\n\n Object.defineProperty(System.prototype, \"isPaused\", {\n /**\r\n * @return Is system on pause?\r\n */\n get: function get() {\n return this._isPaused;\n },\n\n /**\r\n * Pauses all the processes of all the amCharts objects on the page\r\n *\r\n * @return is paused?\r\n */\n set: function set(value) {\n this._isPaused = value;\n\n if (!value) {\n this._frameRequested = false;\n this.requestFrame();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * amCharts Version.\r\n *\r\n * This follows npm's semver specification.\r\n *\r\n * @see {@link https://docs.npmjs.com/misc/semver}\r\n */\n\n System.VERSION = \"4.10.24\";\n return System;\n}();\n\nexport { System };\n/**\r\n * A singleton global instance of [[System]].\r\n *\r\n * All code should use this, rather than instantiating their\r\n * own System objects.\r\n */\n\nexport var system = new System();","/**\r\n * Data parser module.\r\n */\n\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\nimport { DateFormatter } from \"../formatters/DateFormatter\";\nimport * as $utils from \"../utils/Utils\";\nimport * as $type from \"../utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Base class for the data parsers.\r\n */\n\nvar DataParser =\n/** @class */\nfunction () {\n function DataParser() {}\n /**\r\n * A \"placeholder\" function for real parsers to override.\r\n *\r\n * @ignore Exclude from docs\r\n * @param data Source data\r\n * @return Parsed data (empty)\r\n */\n\n\n DataParser.prototype.parse = function (data) {\n return [];\n };\n\n ;\n Object.defineProperty(DataParser.prototype, \"parsableNumbers\", {\n /**\r\n * Checks if there are any numeric fields that need to be converted to\r\n * numbers.\r\n *\r\n * @return Numeric fields?\r\n */\n get: function get() {\n return this.options.numberFields && this.options.numberFields.length > 0;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts a value to 'number' if it is in `numberFields`.\r\n *\r\n * @param field Field name\r\n * @param value Value\r\n * @return Parsed or original value\r\n */\n\n DataParser.prototype.maybeToNumber = function (field, value) {\n if (this.options.numberFields.indexOf(field) !== -1) {\n return $utils.anyToNumber(value);\n }\n\n return value;\n };\n\n Object.defineProperty(DataParser.prototype, \"parsableDates\", {\n /**\r\n * Checks if there are any date fields that need to be converted to `Date`\r\n * objects.\r\n *\r\n * @return Date fields?\r\n */\n get: function get() {\n return this.options.dateFields && this.options.dateFields.length > 0;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts a value to `Date` if it is in `dateFields`.\r\n *\r\n * @param field Field name\r\n * @param value Value\r\n * @return Parsed or original value\r\n */\n\n DataParser.prototype.maybeToDate = function (field, value) {\n if (this.options.dateFields.indexOf(field) !== -1) {\n return this.options.dateFormatter.parse(value, this.dateFormat);\n }\n\n return value;\n };\n /**\r\n * Replaces empty value with something else.\r\n *\r\n * @param value Source value\r\n * @return Source value or replacement\r\n */\n\n\n DataParser.prototype.maybeToEmpty = function (value) {\n if ((!$type.hasValue(value) || value == \"\") && $type.hasValue(this.options.emptyAs)) {\n return this.options.emptyAs;\n }\n\n return value;\n };\n\n Object.defineProperty(DataParser.prototype, \"dateFormatter\", {\n /**\r\n * [[DateFormatter]] object for date parsing.\r\n *\r\n * If there was not [[DateFormatter]] supplied in parser options, a new one\r\n * is created.\r\n *\r\n * @return Date formatter\r\n * @see {@link DateFormatter}\r\n */\n get: function get() {\n if (!this.options.dateFormatter) {\n this.options.dateFormatter = new DateFormatter();\n\n if (this.options.dateFormat) {\n this.options.dateFormat = this.options.dateFormat;\n }\n }\n\n return this.options.dateFormatter;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataParser.prototype, \"dateFormat\", {\n /**\r\n * A date format to use when parsing dates.\r\n *\r\n * @return Date format\r\n * @see {@link DateFormatter}\r\n */\n get: function get() {\n return this.options.dateFormat || this.dateFormatter.inputDateFormat;\n },\n enumerable: true,\n configurable: true\n });\n return DataParser;\n}();\n\nexport { DataParser };","/**\r\n * CSV parser.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { DataParser } from \"./DataParser\";\nimport * as $type from \"../utils/Type\";\nimport * as $array from \"../utils/Array\";\n/**\r\n * Define possible separators.\r\n */\n\nvar separators = [\",\", \";\", \"\\t\"];\n/**\r\n * A parser for CSV format.\r\n *\r\n * @important\r\n */\n\nvar CSVParser =\n/** @class */\nfunction (_super) {\n __extends(CSVParser, _super);\n\n function CSVParser() {\n var _this = _super !== null && _super.apply(this, arguments) || this;\n /**\r\n * Content-type suitable for CSV format.\r\n */\n\n\n _this.contentType = \"text/csv\";\n /**\r\n * Parser options.\r\n *\r\n * @see {@link ICSVOptions} for description of each option\r\n */\n\n _this.options = {\n delimiter: \"\",\n reverse: false,\n skipRows: 0,\n skipEmpty: true,\n useColumnNames: false\n };\n return _this;\n }\n /**\r\n * Tests if the format is CSV.\r\n *\r\n * @param data Source data\r\n * @return Is it CSV?\r\n */\n\n\n CSVParser.isCSV = function (data) {\n return CSVParser.getDelimiterFromData(data) ? true : false;\n };\n /**\r\n * Tries to determine a column separator.\r\n *\r\n * @param data Source data\r\n * @return Separator\r\n */\n\n\n CSVParser.getDelimiterFromData = function (data) {\n // We're going to take first few lines of the CSV with different\n // possible separators and check if it results in same number of columns.\n // If it does, we're going to assume it's a CSV\n var lines = data.split(\"\\n\");\n var len = lines.length;\n var separator;\n $array.each(separators, function (sep) {\n var columns = 0,\n lineColums = 0; // TODO replace with iterators\n\n for (var i = 0; i < len; ++i) {\n // Get number of columns in a line\n columns = lines[i].split(sep).length;\n\n if (columns > 1) {\n // More than one column - possible candidate\n if (lineColums === 0) {\n // First line\n lineColums = columns;\n } else if (columns != lineColums) {\n // Incorrect number of columns, give up on this separator\n lineColums = 0;\n break;\n }\n } else {\n // Not this separator\n // Not point in continuing\n lineColums = 0;\n break;\n }\n } // Check if we have a winner\n\n\n if (lineColums) {\n separator = sep;\n }\n });\n return separator;\n };\n /**\r\n * Parses and returns data.\r\n *\r\n * @param data Unparsed data\r\n * @return Parsed data\r\n */\n\n\n CSVParser.prototype.parse = function (csv) {\n // Check if we have delimiter set\n if (!this.options.delimiter) {\n this.options.delimiter = CSVParser.getDelimiterFromData(csv);\n } // Get CSV data as array\n\n\n var data = this.CSVToArray(csv, this.options.delimiter); // Do we need to cast some fields to numbers?\n\n var empty = $type.hasValue(this.options.emptyAs);\n var numbers = this.parsableNumbers;\n var dates = this.parsableDates; // Init resuling array\n\n var res = [],\n cols = [],\n col,\n i; // Skip rows\n\n for (i = 0; i < this.options.skipRows; i++) {\n data.shift();\n } // First row holds column names?\n\n\n if (this.options.useColumnNames) {\n cols = data.shift(); // Normalize column names\n\n for (var x = 0; x < cols.length; x++) {\n // trim\n col = $type.hasValue(cols[x]) ? cols[x].replace(/^\\s+|\\s+$/gm, \"\") : \"\"; // Check for empty\n\n if (\"\" === col) {\n col = \"col\" + x;\n }\n\n cols[x] = col;\n }\n } // Iterate through the result set\n\n\n var row;\n\n while (true) {\n row = this.options.reverse ? data.pop() : data.shift();\n\n if (!row) {\n break;\n }\n\n if (this.options.skipEmpty && row.length === 1 && row[0] === \"\") {\n continue;\n }\n\n var dataPoint = {};\n\n for (i = 0; i < row.length; i++) {\n col = undefined === cols[i] ? \"col\" + i : cols[i];\n dataPoint[col] = row[i] === \"\" ? this.options.emptyAs : row[i]; // Convert\n\n if (empty) {\n dataPoint[col] = this.maybeToEmpty(dataPoint[col]);\n }\n\n if (numbers) {\n dataPoint[col] = this.maybeToNumber(col, dataPoint[col]);\n }\n\n if (dates) {\n dataPoint[col] = this.maybeToDate(col, dataPoint[col]);\n }\n }\n\n res.push(dataPoint);\n }\n\n return res;\n };\n /**\r\n * Converts CSV into array.\r\n *\r\n * The functionality of this function is taken from here:\r\n * http://www.bennadel.com/blog/1504-ask-ben-parsing-csv-strings-with-javascript-exec-regular-expression-command.htm\r\n *\r\n * @param data Source data\r\n * @param delimiter Column delimiter\r\n * @return Parsed array\r\n */\n\n\n CSVParser.prototype.CSVToArray = function (data, delimiter) {\n // Check to see if the delimiter is defined. If not,\n // then default to comma.\n delimiter = delimiter || ','; // Create a regular expression to parse the CSV values.\n\n var objPattern = new RegExp( // Delimiters.\n \"(\\\\\" + delimiter + \"|\\\\r?\\\\n|\\\\r|^)\" + // Quoted fields.\n \"(?:\\\"([^\\\"]*(?:\\\"\\\"[^\\\"]*)*)\\\"|\" + // Standard fields.\n \"([^\\\"\\\\\" + delimiter + \"\\\\r\\\\n]*))\", \"gi\"); // Create an array to hold our data. Give the array\n // a default empty first row.\n\n var arrData = [[]]; // Create an array to hold our individual pattern\n // matching groups.\n\n var arrMatches = null; // Keep looping over the regular expression matches\n // until we can no longer find a match.\n\n while (true) {\n arrMatches = objPattern.exec(data);\n\n if (!arrMatches) {\n break;\n } // Get the delimiter that was found.\n\n\n var strMatchedDelimiter = arrMatches[1]; // Check to see if the given delimiter has a length\n // (is not the start of string) and if it matches\n // field delimiter. If id does not, then we know\n // that this delimiter is a row delimiter.\n\n if (strMatchedDelimiter.length && strMatchedDelimiter !== delimiter) {\n // Since we have reached a new row of data,\n // add an empty row to our data array.\n arrData.push([]);\n } // Now that we have our delimiter out of the way,\n // let's check to see which kind of value we\n // captured (quoted or unquoted).\n\n\n var strMatchedValue = void 0;\n\n if (arrMatches[2]) {\n // We found a quoted value. When we capture\n // this value, unescape any double quotes.\n strMatchedValue = arrMatches[2].replace(new RegExp(\"\\\"\\\"\", \"g\"), \"\\\"\");\n } else {\n // We found a non-quoted value.\n strMatchedValue = arrMatches[3];\n } // Now that we have our value string, let's add\n // it to the data array.\n\n\n arrData[arrData.length - 1].push(strMatchedValue);\n } // Return the parsed data.\n\n\n return arrData;\n };\n\n return CSVParser;\n}(DataParser);\n\nexport { CSVParser };","/**\r\n * JSON parser.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { DataParser } from \"./DataParser\";\nimport * as $object from \"../utils/Object\";\nimport * as $type from \"../utils/Type\";\n/**\r\n * A parser for JSON.\r\n *\r\n * @important\r\n */\n\nvar JSONParser =\n/** @class */\nfunction (_super) {\n __extends(JSONParser, _super);\n\n function JSONParser() {\n var _this = _super !== null && _super.apply(this, arguments) || this;\n /**\r\n * Content-type suitable for JSON format.\r\n */\n\n\n _this.contentType = \"application/json\";\n /**\r\n * Parser options.\r\n *\r\n * @see {@link IJSONOptions} for description of each option\r\n */\n\n _this.options = {};\n return _this;\n }\n /**\r\n * Tests if the data is valid JSON.\r\n *\r\n * @param data Source data\r\n * @return Is it JSON?\r\n */\n\n\n JSONParser.isJSON = function (data) {\n try {\n // Try parsing JSON\n JSON.parse(data); // If we got to this point it means it's a valid JSON\n\n return true;\n } catch (e) {\n return false;\n }\n };\n /**\r\n * Parses and returns data.\r\n *\r\n * @param data Unparsed data\r\n * @return Parsed data\r\n */\n\n\n JSONParser.prototype.parse = function (data) {\n var _this = this; // Init return\n\n\n var res; // Try parsing\n\n try {\n if ($type.hasValue(JSON)) {\n res = JSON.parse(data);\n }\n } catch (e) {\n return undefined;\n } // Do we need to cast some fields to numbers or dates?\n\n\n var empty = $type.hasValue(this.options.emptyAs);\n var numbers = this.parsableNumbers;\n var dates = this.parsableDates;\n\n if (Array.isArray(res) && (numbers || dates || empty)) {\n var _loop_1 = function _loop_1(i, len) {\n var row = res[i];\n $object.each(row, function (key, value) {\n if (empty) {\n row[key] = _this.maybeToEmpty(row[key]);\n }\n\n if (numbers) {\n row[key] = _this.maybeToNumber(key, row[key]);\n }\n\n if (dates) {\n row[key] = _this.maybeToDate(key, row[key]);\n }\n });\n }; // Iterate through the data and check if it needs to be converted\n\n\n for (var i = 0, len = res.length; i < len; i++) {\n _loop_1(i, len);\n }\n } // Convert to array\n //return Array.isArray(res) ? res : [res];\n\n\n return res;\n };\n\n return JSONParser;\n}(DataParser);\n\nexport { JSONParser };","/**\r\n * Data Loader is responsible for loading and parsing external data\r\n */\nimport { CSVParser } from \"./CSVParser\";\nimport { JSONParser } from \"./JSONParser\";\nimport { Adapter } from \"../utils/Adapter\";\nimport * as $net from \"../utils/Net\";\nimport * as $array from \"../utils/Array\";\n;\n/**\r\n * Data Loader is responsible for loading and parsing external data.\r\n *\r\n * There is just one instance of DataLoader per system. Unless you have a\r\n * speicific reason, do not instantiate additional instances.\r\n *\r\n * The global instance of Data Loader is accessible via:\r\n *\r\n * ```TypeScript\r\n * am4core.dataLoader;\r\n * ```\r\n * ```JavaScript\r\n * am4core.dataLoader;\r\n * ```\r\n *\r\n * A loading of specific data source is done via [[DataSource]].\r\n *\r\n Please refer to [[DataSource]] for information how to use it.\r\n *\r\n * @see {@link IDataLoaderAdapters} for a list of available Adapters\r\n */\n\nvar DataLoader =\n/** @class */\nfunction () {\n function DataLoader() {\n /**\r\n * Adapter.\r\n */\n this.adapter = new Adapter(this);\n }\n /**\r\n * Loads a supplied [[DataSource]] or an array of data sources, then calls\r\n * their respective `parse` methods.\r\n *\r\n * @param source A single data source or an array of multiple of data sources\r\n */\n\n\n DataLoader.prototype.load = function (source) {\n var sources = Array.isArray(source) ? source : [source]; // Add each Source to the list to be loaded simultaneously\n\n var promises = $array.map(sources, function (x) {\n // Dispatch events\n x.dispatchImmediately(\"started\");\n x.dispatchImmediately(\"loadstarted\");\n return $net.load(x.url, x, x.requestOptions);\n }); // Run all promises in parallel\n\n Promise.all(promises).then(function (res) {\n // Process each loaded source\n $array.each(res, function (result) {\n // Get Source\n var source = result.target; // Dispatch events\n\n source.dispatchImmediately(\"loadended\");\n\n if (result.error) {\n if (source.events.isEnabled(\"error\")) {\n source.events.dispatchImmediately(\"error\", {\n type: \"error\",\n code: result.xhr.status,\n message: source.language.translate(\"Unable to load file: %1\", null, source.url),\n target: source\n });\n }\n } else {\n // Initiate parsing of the loaded data\n source.processData(result.response, result.type);\n }\n\n source.dispatchImmediately(\"ended\");\n });\n }).catch(function (res) {\n if (res.target) {\n res.target.dispatchImmediately(\"loadended\");\n\n if (res.target.events.isEnabled(\"error\")) {\n res.target.events.dispatchImmediately(\"error\", {\n type: \"error\",\n code: res.xhr.status,\n message: res.target.language.translate(\"Unable to load file: %1\", null, res.target.url),\n target: res.target\n });\n }\n\n res.target.dispatchImmediately(\"ended\");\n }\n });\n };\n /**\r\n * Instantiates a [[DataParser]] object based on the data type.\r\n * Built-in parser types are as follows:\r\n *\r\n * * \"csv\" or \"text/csv\"\r\n * * \"json\" or \"application/json\"\r\n *\r\n * @param contentType A format type\r\n * @return A parser object\r\n */\n\n\n DataLoader.prototype.getParserByType = function (contentType) {\n // Let some plugin decide\n var parser = this.adapter.apply(\"getParserByType\", {\n parser: null,\n type: contentType\n }).parser;\n\n if (parser) {\n return parser;\n }\n\n if (contentType == \"csv\" || contentType == \"text/csv\" || contentType == \"application/vnd.ms-excel\") {\n return new CSVParser();\n }\n\n if (contentType == \"json\" || contentType == \"application/json\") {\n return new JSONParser();\n }\n\n return;\n };\n /**\r\n * Tries to determine a parser out of content type and/or actual data.\r\n *\r\n * @param data Data\r\n * @param contentType Content-type\r\n * @return Parser instance\r\n */\n\n\n DataLoader.prototype.getParserByData = function (data, contentType) {\n // Let some plugin decide\n var parser = this.adapter.apply(\"getParserByData\", {\n parser: null,\n data: data,\n type: contentType\n }).parser; // Check if we have parser from outside code\n\n if (!parser) {\n // No, let's try to figure it out\n parser = this.getParserByType(contentType);\n\n if (parser) {\n // We're able to figure out parser by content-type\n return parser;\n } else if (JSONParser.isJSON(data)) {\n return this.getParserByType(\"json\");\n } else if (CSVParser.isCSV(data)) {\n return this.getParserByType(\"csv\");\n }\n }\n\n return parser;\n };\n\n return DataLoader;\n}();\n\nexport { DataLoader };\n/**\r\n * Create instance of Data Loader\r\n */\n\nexport var dataLoader = new DataLoader();","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { dataLoader } from \"./DataLoader\";\nimport { JSONParser } from \"./JSONParser\";\nimport { CSVParser } from \"./CSVParser\";\nimport { BaseObjectEvents } from \"../Base\";\nimport { Adapter } from \"../utils/Adapter\";\nimport { Language } from \"../utils/Language\";\nimport { DateFormatter } from \"../formatters/DateFormatter\";\nimport { registry } from \"../Registry\";\nimport * as $type from \"../utils/Type\";\nimport * as $object from \"../utils/Object\";\n;\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Represents a single data source - external file with all of its settings,\r\n * such as format, data parsing, etc.\r\n *\r\n * ```TypeScript\r\n * chart.dataSource.url = \"http://www.myweb.com/data.json\";\r\n * chart.dataSource.parser = am4core.JSONParser;\r\n * ```\r\n * ```JavaScript\r\n * chart.dataSource.url = \"http://www.myweb.com/data.json\";\r\n * chart.dataSource.parser = am4core.JSONParser;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"dataSource\": {\r\n * \"url\": \"http://www.myweb.com/data.json\",\r\n * \"parser\": \"JSONParser\"\r\n * },\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @see {@link IDataSourceEvents} for a list of available events\r\n * @see {@link IDataSourceAdapters} for a list of available Adapters\r\n */\n\nvar DataSource =\n/** @class */\nfunction (_super) {\n __extends(DataSource, _super);\n /**\r\n * Constructor\r\n */\n\n\n function DataSource(url, parser) {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Adapter.\r\n */\n\n\n _this.adapter = new Adapter(_this);\n /**\r\n * Custom options for HTTP(S) request.\r\n */\n\n _this._requestOptions = {};\n /**\r\n * If set to `true`, any subsequent data loads will be considered incremental\r\n * (containing only new data points that are supposed to be added to existing\r\n * data).\r\n *\r\n * NOTE: this setting works only with element's `data` property. It won't\r\n * work with any other externally-loadable data property.\r\n *\r\n * @default false\r\n */\n\n _this._incremental = false;\n /**\r\n * A collection of key/value pairs to attach to a data source URL when making\r\n * an incremental request.\r\n */\n\n _this._incrementalParams = {};\n /**\r\n * This setting is used only when `incremental = true`. If set to `true`,\r\n * it will try to retain the same number of data items across each load.\r\n *\r\n * E.g. if incremental load yeilded 5 new records, then 5 items from the\r\n * beginning of data will be removed so that we end up with the same number\r\n * of data items.\r\n *\r\n * @default false\r\n */\n\n _this._keepCount = false;\n /**\r\n * If set to `true`, each subsequent load will be treated as an update to\r\n * currently loaded data, meaning that it will try to update values on\r\n * existing data items, not overwrite the whole data.\r\n *\r\n * This will work faster than complete update, and also will animate the\r\n * values to their new positions.\r\n *\r\n * Data sources across loads must contain the same number of data items.\r\n *\r\n * Loader will not truncate the data set if loaded data has fewer data items,\r\n * and if it is longer, the excess data items will be ignored.\r\n *\r\n * @default false\r\n * @since 4.5.5\r\n */\n\n _this._updateCurrentData = false;\n /**\r\n * Will show loading indicator when loading files.\r\n */\n\n _this.showPreloader = true;\n _this.className = \"DataSource\"; // Set defaults\n\n if (url) {\n _this.url = url;\n } // Set parser\n\n\n if (parser) {\n if (typeof parser == \"string\") {\n _this.parser = dataLoader.getParserByType(parser);\n } else {\n _this.parser = parser;\n }\n }\n\n return _this;\n }\n /**\r\n * Processes the loaded data.\r\n *\r\n * @ignore Exclude from docs\r\n * @param data Raw (unparsed) data\r\n * @param contentType Content type of the loaded data (optional)\r\n */\n\n\n DataSource.prototype.processData = function (data, contentType) {\n // Parsing started\n this.dispatchImmediately(\"parsestarted\"); // Check if parser is set\n\n if (!this.parser) {\n // Try to resolve from data\n this.parser = dataLoader.getParserByData(data, contentType);\n\n if (!this.parser) {\n // We have a problem - nobody knows what to do with the data\n // Raise error\n if (this.events.isEnabled(\"parseerror\")) {\n var event_1 = {\n type: \"parseerror\",\n message: this.language.translate(\"No parser available for file: %1\", null, this.url),\n target: this\n };\n this.events.dispatchImmediately(\"parseerror\", event_1);\n }\n\n this.dispatchImmediately(\"parseended\");\n return;\n }\n } // Apply options adapters\n\n\n this.parser.options = this.adapter.apply(\"parserOptions\", this.parser.options);\n this.parser.options.dateFields = this.adapter.apply(\"dateFields\", this.parser.options.dateFields || []);\n this.parser.options.numberFields = this.adapter.apply(\"numberFields\", this.parser.options.numberFields || []); // Check if we need to pass in date formatter\n\n if (this.parser.options.dateFields && !this.parser.options.dateFormatter) {\n this.parser.options.dateFormatter = this.dateFormatter;\n } // Parse\n\n\n this.data = this.adapter.apply(\"parsedData\", this.parser.parse(this.adapter.apply(\"unparsedData\", data))); // Check for parsing errors\n\n if (!$type.hasValue(this.data) && this.events.isEnabled(\"parseerror\")) {\n var event_2 = {\n type: \"parseerror\",\n message: this.language.translate(\"Error parsing file: %1\", null, this.url),\n target: this\n };\n this.events.dispatchImmediately(\"parseerror\", event_2);\n } // Wrap up\n\n\n this.dispatchImmediately(\"parseended\");\n\n if ($type.hasValue(this.data)) {\n this.dispatchImmediately(\"done\", {\n \"data\": this.data\n });\n } // The component is responsible for updating its own data vtriggered via\n // events.\n // Update last data load\n\n\n this.lastLoad = new Date();\n };\n\n Object.defineProperty(DataSource.prototype, \"url\", {\n /**\r\n * @return URL\r\n */\n get: function get() {\n // Get URL\n var url = this.disableCache ? this.timestampUrl(this._url) : this._url; // Add incremental params\n\n if (this.incremental && this.component.data.length) {\n url = this.addUrlParams(url, this.incrementalParams);\n }\n\n return this.adapter.apply(\"url\", url);\n },\n\n /**\r\n * URL of the data source.\r\n *\r\n * @param value URL\r\n */\n set: function set(value) {\n this._url = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"requestOptions\", {\n /**\r\n * @return Options\r\n */\n get: function get() {\n return this.adapter.apply(\"requestOptions\", this._requestOptions);\n },\n\n /**\r\n * Custom options for HTTP(S) request.\r\n *\r\n * At this moment the only option supported is: `requestHeaders`, which holds\r\n * an array of objects for custom request headers, e.g.:\r\n *\r\n * ```TypeScript\r\n * chart.dataSource.requestOptions.requestHeaders = [{\r\n * \"key\": \"x-access-token\",\r\n * \"value\": \"123456789\"\r\n * }];\r\n * ``````JavaScript\r\n * chart.dataSource.requestOptions.requestHeaders = [{\r\n * \"key\": \"x-access-token\",\r\n * \"value\": \"123456789\"\r\n * }];\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"dataSource\": {\r\n * // ...\r\n * \"requestOptions\": {\r\n * \"requestHeaders\": [{\r\n * \"key\": \"x-access-token\",\r\n * \"value\": \"123456789\"\r\n * }]\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * NOTE: setting this options on an-already loaded DataSource will not\r\n * trigger a reload.\r\n *\r\n * @param value Options\r\n */\n set: function set(value) {\n this._requestOptions = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"parser\", {\n /**\r\n * @return Data parser\r\n */\n get: function get() {\n if (!this._parser) {\n this._parser = new JSONParser();\n }\n\n return this.adapter.apply(\"parser\", this._parser);\n },\n\n /**\r\n * A parser to be used to parse data.\r\n *\r\n * ```TypeScript\r\n * chart.dataSource.url = \"http://www.myweb.com/data.json\";\r\n * chart.dataSource.parser = am4core.JSONParser;\r\n * ```\r\n * ```JavaScript\r\n * chart.dataSource.url = \"http://www.myweb.com/data.json\";\r\n * chart.dataSource.parser = am4core.JSONParser;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"dataSource\": {\r\n * \"url\": \"http://www.myweb.com/data.json\",\r\n * \"parser\": {\r\n * \"type\": \"JSONParser\"\r\n * }\r\n * },\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @default JSONParser\r\n * @param value Data parser\r\n */\n set: function set(value) {\n this._parser = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"reloadFrequency\", {\n /**\r\n * @return Reload frequency (ms)\r\n */\n get: function get() {\n return this.adapter.apply(\"reloadTimeout\", this._reloadFrequency);\n },\n\n /**\r\n * Data source reload frequency.\r\n *\r\n * If set, it will reload the same URL every X milliseconds.\r\n *\r\n * @param value Reload frequency (ms)\r\n */\n set: function set(value) {\n var _this = this;\n\n if (this._reloadFrequency != value) {\n this._reloadFrequency = value; // Should we schedule a reload?\n\n if (value) {\n if (!$type.hasValue(this._reloadDisposer)) {\n this._reloadDisposer = this.events.on(\"ended\", function (ev) {\n _this._reloadTimeout = setTimeout(function () {\n _this.load();\n }, _this.reloadFrequency);\n });\n }\n } else if ($type.hasValue(this._reloadDisposer)) {\n this._reloadDisposer.dispose();\n\n this._reloadDisposer = undefined;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"incremental\", {\n /**\r\n * @return Incremental load?\r\n */\n get: function get() {\n return this.adapter.apply(\"incremental\", this._incremental);\n },\n\n /**\r\n * Should subsequent reloads be treated as incremental?\r\n *\r\n * Incremental loads will assume that they contain only new data items\r\n * since the last load.\r\n *\r\n * If `incremental = false` the loader will replace all of the target's\r\n * data with each load.\r\n *\r\n * This setting does not have any effect trhe first time data is loaded.\r\n *\r\n * NOTE: this setting works only with element's `data` property. It won't\r\n * work with any other externally-loadable data property.\r\n *\r\n * @default false\r\n * @param Incremental load?\r\n */\n set: function set(value) {\n this._incremental = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"incrementalParams\", {\n /**\r\n * @return Incremental request parameters\r\n */\n get: function get() {\n return this.adapter.apply(\"incrementalParams\", this._incrementalParams);\n },\n\n /**\r\n * An object consisting of key/value pairs to apply to an URL when data\r\n * source is making an incremental request.\r\n *\r\n * @param value Incremental request parameters\r\n */\n set: function set(value) {\n this._incrementalParams = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"keepCount\", {\n /**\r\n * @return keepCount load?\r\n */\n get: function get() {\n return this.adapter.apply(\"keepCount\", this._keepCount);\n },\n\n /**\r\n * This setting is used only when `incremental = true`. If set to `true`,\r\n * it will try to retain the same number of data items across each load.\r\n *\r\n * E.g. if incremental load yeilded 5 new records, then 5 items from the\r\n * beginning of data will be removed so that we end up with the same number\r\n * of data items.\r\n *\r\n * @default false\r\n * @param Keep record count?\r\n */\n set: function set(value) {\n this._keepCount = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"updateCurrentData\", {\n /**\r\n * @return Update current data?\r\n */\n get: function get() {\n return this.adapter.apply(\"updateCurrentData\", this._updateCurrentData);\n },\n\n /**\r\n * If set to `true`, each subsequent load will be treated as an update to\r\n * currently loaded data, meaning that it will try to update values on\r\n * existing data items, not overwrite the whole data.\r\n *\r\n * This will work faster than complete update, and also will animate the\r\n * values to their new positions.\r\n *\r\n * Data sources across loads must contain the same number of data items.\r\n *\r\n * Loader will not truncate the data set if loaded data has fewer data items,\r\n * and if it is longer, the excess data items will be ignored.\r\n *\r\n * NOTE: this setting is ignored if `incremental = true`.\r\n *\r\n * @default false\r\n * @since 2.5.5\r\n * @param Update current data?\r\n */\n set: function set(value) {\n this._updateCurrentData = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"language\", {\n /**\r\n * @return A [[Language]] instance to be used\r\n */\n get: function get() {\n if (this._language) {\n return this._language;\n } else if (this.component) {\n this._language = this.component.language;\n return this._language;\n }\n\n this.language = new Language();\n return this.language;\n },\n\n /**\r\n * Language instance to use.\r\n *\r\n * Will inherit and use chart's language, if not set.\r\n *\r\n * @param value An instance of Language\r\n */\n set: function set(value) {\n this._language = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataSource.prototype, \"dateFormatter\", {\n /**\r\n * @return A [[DateFormatter]] instance to be used\r\n */\n get: function get() {\n if (this._dateFormatter) {\n return this._dateFormatter;\n } else if (this.component) {\n this._dateFormatter = this.component.dateFormatter;\n return this._dateFormatter;\n }\n\n this.dateFormatter = new DateFormatter();\n return this.dateFormatter;\n },\n\n /**\r\n * A [[DateFormatter]] to use when parsing dates from string formats.\r\n *\r\n * Will inherit and use chart's DateFormatter if not ser.\r\n *\r\n * @param value An instance of [[DateFormatter]]\r\n */\n set: function set(value) {\n this._dateFormatter = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Adds current timestamp to the URL.\r\n *\r\n * @param url Source URL\r\n * @return Timestamped URL\r\n */\n\n DataSource.prototype.timestampUrl = function (url) {\n var tstamp = new Date().getTime().toString();\n var params = {};\n params[tstamp] = \"\";\n return this.addUrlParams(url, params);\n };\n /**\r\n * Disposes of this object.\r\n */\n\n\n DataSource.prototype.dispose = function () {\n _super.prototype.dispose.call(this);\n\n if (this._reloadTimeout) {\n clearTimeout(this._reloadTimeout);\n }\n\n if ($type.hasValue(this._reloadDisposer)) {\n this._reloadDisposer.dispose();\n\n this._reloadDisposer = undefined;\n }\n };\n /**\r\n * Initiate the load.\r\n *\r\n * All loading in JavaScript is asynchronous. This function will trigger the\r\n * load and will exit immediately.\r\n *\r\n * Use DataSource's events to watch for loaded data and errors.\r\n */\n\n\n DataSource.prototype.load = function () {\n if (this.url) {\n if (this._reloadTimeout) {\n clearTimeout(this._reloadTimeout);\n }\n\n dataLoader.load(this);\n }\n };\n /**\r\n * Adds parameters to `url` as query strings. Will take care of proper\r\n * separators.\r\n *\r\n * @param url Source URL\r\n * @param params Parameters\r\n * @return New URL\r\n */\n\n\n DataSource.prototype.addUrlParams = function (url, params) {\n var join = url.match(/\\?/) ? \"&\" : \"?\";\n var add = [];\n $object.each(params, function (key, value) {\n if (value != \"\") {\n add.push(key + \"=\" + encodeURIComponent(value));\n } else {\n add.push(key);\n }\n });\n\n if (add.length) {\n return url + join + add.join(\"&\");\n }\n\n return url;\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n DataSource.prototype.processConfig = function (config) {\n registry.registeredClasses[\"json\"] = JSONParser;\n registry.registeredClasses[\"JSONParser\"] = JSONParser;\n registry.registeredClasses[\"csv\"] = CSVParser;\n registry.registeredClasses[\"CSVParser\"] = CSVParser;\n\n _super.prototype.processConfig.call(this, config);\n };\n\n return DataSource;\n}(BaseObjectEvents);\n\nexport { DataSource };","/**\r\n * Responsive functionality module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObjectEvents } from \"../Base\";\nimport { List } from \"../utils/List\";\nimport { Adapter } from \"../utils/Adapter\";\nimport { registry } from \"../Registry\";\nimport * as $iter from \"../utils/Iterator\";\nimport * as $array from \"../utils/Array\";\nimport * as $type from \"../utils/Type\";\nimport * as $object from \"../utils/Object\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Responsive is responsible for overriding certain properties when conditions\r\n * are met.\r\n *\r\n * This class is used to dynamically apply and change certain chart properties\r\n * based on the current values of properties.\r\n *\r\n * Mainly, this is used with [[Sprite]]'s dimensional properties, like\r\n * `pixelWidth` and `pixelHeight`. However, it can be used to dynamically\r\n * change any property, based on any other property's value.\r\n *\r\n * A default responsive rules are disabled.\r\n *\r\n * To enable, set `enabled = false`. E.g.:\r\n *\r\n * ```TypeScript\r\n * chart.responsive.enabled = true;\r\n * ```\r\n * ```JavaScript\r\n * chart.responsive.enabled = true;\r\n * ```\r\n *\r\n * @see {@link IResponsiveEvents} for a list of available events\r\n * @see {@link IResponsiveAdapters} for a list of available Adapters\r\n * @todo Add default rules\r\n * @todo Watch for rule modification\r\n * @important\r\n */\n\nvar Responsive =\n/** @class */\nfunction (_super) {\n __extends(Responsive, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Responsive() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Holds a list of responsive rules organized by object type.\r\n */\n\n\n _this._rules = new List();\n /**\r\n * Holds the list of the default responsive rules.\r\n * @deprecated\r\n */\n //protected _defaultRules = new List<IResponsiveRule>();\n\n /**\r\n * Holds the list of currently applied rules.\r\n */\n\n _this._appliedRules = {};\n /**\r\n * Used to keep track of objects that have rules applied at the moment.\r\n */\n\n _this._appliedTargets = [];\n /**\r\n * Use default rules in addition to the user-defined ones?\r\n */\n\n _this._useDefault = true;\n /**\r\n * Adapter.\r\n */\n\n _this.adapter = new Adapter(_this);\n /**\r\n * Indicates of responsive rules application is enabled.\r\n */\n\n _this._enabled = false;\n /**\r\n * Holds disposers for all events added by this class.\r\n */\n\n _this._responsiveDisposers = [];\n /**\r\n * Collection of objects and state ids that do not have any properties set.\r\n */\n\n _this._noStates = [];\n _this.className = \"Responsive\"; // Set up rules list events\n\n _this.rules.events.on(\"inserted\", function () {\n _this.checkRules();\n }, true);\n\n _this.rules.events.on(\"removed\", function () {\n _this.checkRules();\n }, true);\n\n _this._disposers.push(_this.rules.events); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Responsive.prototype, \"component\", {\n /**\r\n * @return Target object\r\n */\n get: function get() {\n return this._component;\n },\n\n /**\r\n * A target object that responsive rules will need to be applied to.\r\n *\r\n * @param value Target object\r\n */\n set: function set(value) {\n var _this = this; // Check if it's the same\n\n\n if (value == this._component) {\n return;\n } // Check if we already have a set up component and remove its events\n\n\n this.disposeResponsiveHandlers(); // Set\n\n this._component = value; // Set up resize monitoring events\n\n this._responsiveDisposers.push($type.getValue(this.component).events.on(\"sizechanged\", function () {\n _this.checkRules();\n }, this));\n\n this._responsiveDisposers.push($type.getValue(this.component).events.on(\"datavalidated\", function () {\n if (_this._component.isReady()) {\n _this.checkRules(true);\n }\n }, this)); // Enable resoponsive\n\n\n this.enabled = true;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Responsive.prototype, \"enabled\", {\n /**\r\n * @return Apply responsive rules?\r\n */\n get: function get() {\n return this.adapter.apply(\"enabled\", this._enabled);\n },\n\n /**\r\n * Should responsive rules be checked against and applied?\r\n *\r\n * @default false\r\n * @param value Apply responsive rules?\r\n */\n set: function set(value) {\n if (this._enabled != value) {\n this._enabled = value; // Run `applyRules` so that any currently applied rules can be reset\n\n this.applyRules();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Responsive.prototype, \"useDefault\", {\n /**\r\n * @return Use default rules?\r\n */\n get: function get() {\n return this.adapter.apply(\"useDefault\", this._useDefault);\n },\n\n /**\r\n * Should default responsive rules be applied in addition to user-defined\r\n * ones.\r\n *\r\n * User-defined rules will take precedence over default rules whenever they\r\n * produce conflicting settings.\r\n *\r\n * @default true\r\n * @param value Use default rules?\r\n */\n set: function set(value) {\n if (this._useDefault != value) {\n this._useDefault = value; // Run `applyRules` so that any currently applied rules can be reset\n\n this.applyRules();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Responsive.prototype, \"rules\", {\n /**\r\n * @return User-defined rules\r\n */\n get: function get() {\n return this.adapter.apply(\"rules\", this._rules);\n },\n\n /**\r\n * User-defined responsive rules.\r\n *\r\n * User-defined rules will take precedence over default rules whenever they\r\n * produce conflicting settings.\r\n *\r\n * Use `allRules` to get all applicable rules including default and\r\n * user-defined ones.\r\n *\r\n * @param value User-defined rules\r\n */\n set: function set(value) {\n this._rules = value;\n this._enabled = true;\n this.applyRules();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Responsive.prototype, \"defaultRules\", {\n /**\r\n * Default responsive rules.\r\n *\r\n * @readonly\r\n * @return List of responsive rules\r\n */\n get: function get() {\n return this.adapter.apply(\"defaultRules\", defaultRules);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Responsive.prototype, \"allRules\", {\n /**\r\n * Returns all rules: default rules (if not disabled) combined with\r\n * user-defined ones.\r\n *\r\n * @readonly\r\n * @return List of all applicable rules\r\n */\n get: function get() {\n // Create empty list\n var rules = new List(); // Add default rules if not disabled\n // A code, requesting `allRules` must ensure loading of default rules\n // by calling `loadDefaultRules()`\n\n if (this.useDefault) {\n rules.copyFrom(this.defaultRules);\n } // Add user-defined ones\n\n\n rules.copyFrom(this.rules);\n return this.adapter.apply(\"allRules\", rules);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Checks if rule by the particular id currently applied.\r\n *\r\n * @param ruleId Rule ID\r\n * @return Is currently applied?\r\n */\n\n Responsive.prototype.isApplied = function (ruleId) {\n var rule = this._appliedRules[ruleId];\n return $type.hasValue(rule) ? rule : false;\n };\n /**\r\n * Checks which responsive rules currently satisfy their conditions and\r\n * should be applied, or unapplied.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Responsive.prototype.checkRules = function (force) {\n var _this = this;\n\n if (force === void 0) {\n force = false;\n } // Check if there are any rules\n\n\n var rules = this.allRules;\n\n if (!rules || rules.length == 0) {\n return;\n } // Init a list of rules to be applied\n\n\n var rulesChanged = false;\n var component = $type.getValue(this.component); // Check which rules match\n\n $iter.each(rules.iterator(), function (rule) {\n // Check if rule has an id\n if (!rule.id) {\n rule.id = registry.getUniqueId();\n } // Init indicator if this rule should be applied\n\n\n var apply = rule.relevant(component); // Let's check if this rule needs to be applied\n\n if (apply && !_this.isApplied(rule.id) || !apply && _this.isApplied(rule.id)) {\n rulesChanged = true;\n }\n\n _this._appliedRules[rule.id] = apply;\n });\n\n if (force) {\n rulesChanged = true;\n } // Check if we need to re-apply the rules\n\n\n if (rulesChanged) {\n if (!this.component.isReady()) {\n // The chart is not yet ready (built)\n // We will hide the chart and delay application of rules\n // until \"ready\" event kicks in\n //component.hide(0);\n component.hidden = true;\n component.events.once(\"ready\", function (ev) {\n ev.target.show(0);\n\n _this.applyRules();\n });\n return;\n }\n\n this.dispatchImmediately(\"ruleschanged\");\n this.applyRules();\n }\n };\n /**\r\n * Applies current rules to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param target Target object\r\n * @todo Better type check\r\n */\n\n\n Responsive.prototype.applyRules = function (target) {\n var _this = this; // If no target supplied, we assume the top-level element\n\n\n var newTarget = $type.hasValue(target) ? target : $type.getValue(this.component); // Check each rule\n\n var defaultStateApplied = false;\n\n if (this.enabled) {\n var isApplied_1 = false;\n $iter.each(this.allRules.iterator(), function (rule) {\n // Get relevant state\n var state = _this.getState(rule, newTarget); // If there's a state, it means it needs to be applied\n\n\n if (state) {\n // Check if default state was already applied to this element.\n // We don't want to go resetting default states to ALL element,\n // if they don't have responsive states.\n if (!defaultStateApplied) {\n // Nope, reset states (instantly).\n if ($array.indexOf(_this._appliedTargets, newTarget.uid) !== -1) {\n // But only if this element has any rules applied, otherwise no\n // point in setting current state\n newTarget.setState(_this.getDefaultState(newTarget), 0);\n }\n\n defaultStateApplied = true;\n } // Is this rule currently applied?\n\n\n if (_this.isApplied($type.getValue(rule.id))) {\n // Yes. Apply the responsive state\n state.transitionDuration = 0;\n\n _this.setTargetState(newTarget, state);\n\n _this.dispatchImmediately(\"ruleapplied\", {\n rule: rule\n });\n\n isApplied_1 = true;\n }\n }\n });\n\n if (isApplied_1) {\n $array.replace(this._appliedTargets, newTarget.uid);\n } else {\n $array.remove(this._appliedTargets, newTarget.uid);\n }\n } // Apply rules to the children\n\n\n if (newTarget.children) {\n $iter.each(newTarget.children.iterator(), function (child) {\n _this.applyRules(child);\n });\n }\n };\n /**\r\n * Returns a relative state for the rule/target, or `undefined` if no state is\r\n * needed.\r\n *\r\n * @param rule [description]\r\n * @param target [description]\r\n * @return [description]\r\n */\n\n\n Responsive.prototype.getState = function (rule, target) {\n var stateId = \"responsive-\" + rule.id;\n var tmpId = target.uid + \"_\" + stateId;\n\n if ($array.indexOf(this._noStates, tmpId) !== -1) {\n return;\n } else if (!target.states.hasKey(stateId)) {\n var state = rule.state(target, stateId);\n\n if (!state) {\n this._noStates.push(tmpId);\n }\n\n return state;\n } else {\n return target.states.getKey(stateId);\n }\n };\n /**\r\n * Creates and returns default responsive rule for the target.\r\n *\r\n * This rule will be used to \"reset\" to non-responsive values.\r\n * @param target Target Sprite\r\n * @return State\r\n */\n\n\n Responsive.prototype.getDefaultState = function (target) {\n if (target.states.hasKey(\"responsive-default\")) {\n return target.states.getKey(\"responsive-default\");\n }\n\n return target.states.create(\"responsive-default\");\n };\n /**\r\n * Sets state on the target element and updates default state with the\r\n * overwritten values if needed.\r\n *\r\n * @param target Target\r\n * @param state State\r\n */\n\n\n Responsive.prototype.setTargetState = function (target, state) {\n var _this = this; // Update default state\n\n\n var defaultState = this.getDefaultState(target);\n $object.each(state.properties, function (key, val) {\n if (!$type.hasValue(defaultState.properties[key])) {\n defaultState.properties[key] = _this.getValue(target, key);\n }\n });\n target.setState(state);\n };\n /**\r\n * Gets a value from an element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param target Target object\r\n * @param property Property\r\n * @return Property value\r\n */\n\n\n Responsive.prototype.getValue = function (target, property) {\n // This is a bit hacky, first we check if the property exist.\n // If it doesn't we try accessing target's property directly\n var value = target.getPropertyValue(property);\n\n if (!$type.hasValue(value) && $type.hasValue(target[property])) {\n value = target[property];\n }\n\n return value;\n };\n /**\r\n * Disposes the object.\r\n */\n\n\n Responsive.prototype.dispose = function () {\n this.disposeResponsiveHandlers();\n\n _super.prototype.dispose.call(this);\n };\n /**\r\n * Disposes all event handlers.\r\n */\n\n\n Responsive.prototype.disposeResponsiveHandlers = function () {\n var disposer = this._responsiveDisposers.pop();\n\n while (disposer) {\n disposer.dispose();\n disposer = this._responsiveDisposers.pop();\n }\n };\n\n return Responsive;\n}(BaseObjectEvents);\n\nexport { Responsive };\n/**\r\n * [defaultRules description]\r\n *\r\n * @todo description\r\n */\n\nexport var defaultRules = new List();\ndefaultRules.events.on(\"inserted\", function (ev) {\n ev.newValue.id = registry.getUniqueId();\n});\n/**\r\n *\r\n * @todo description\r\n */\n\nvar ResponsiveBreakpoints =\n/** @class */\nfunction () {\n function ResponsiveBreakpoints() {} // Breakpoint functions (for use in `relevant` clause of the responsive rules)\n\n\n ResponsiveBreakpoints.widthXXS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XXS;\n };\n\n ResponsiveBreakpoints.widthXS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XS;\n };\n\n ResponsiveBreakpoints.widthS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.S;\n };\n\n ResponsiveBreakpoints.widthM = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.M;\n };\n\n ResponsiveBreakpoints.widthL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.L;\n };\n\n ResponsiveBreakpoints.widthXL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XL;\n };\n\n ResponsiveBreakpoints.widthXXL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XXL;\n };\n\n ResponsiveBreakpoints.heightXXS = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.XXS;\n };\n\n ResponsiveBreakpoints.heightXS = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.XS;\n };\n\n ResponsiveBreakpoints.heightS = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.S;\n };\n\n ResponsiveBreakpoints.heightM = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.M;\n };\n\n ResponsiveBreakpoints.heightL = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.L;\n };\n\n ResponsiveBreakpoints.heightXL = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.XL;\n };\n\n ResponsiveBreakpoints.heightXXL = function (container) {\n return container.pixelHeight <= ResponsiveBreakpoints.XXL;\n };\n\n ResponsiveBreakpoints.isXXS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XXS && container.pixelHeight <= ResponsiveBreakpoints.XXS;\n };\n\n ResponsiveBreakpoints.isXS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XS && container.pixelHeight <= ResponsiveBreakpoints.XS;\n };\n\n ResponsiveBreakpoints.isS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.S && container.pixelHeight <= ResponsiveBreakpoints.S;\n };\n\n ResponsiveBreakpoints.isM = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.M && container.pixelHeight <= ResponsiveBreakpoints.M;\n };\n\n ResponsiveBreakpoints.isL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.L && container.pixelHeight <= ResponsiveBreakpoints.L;\n };\n\n ResponsiveBreakpoints.isXL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XL && container.pixelHeight <= ResponsiveBreakpoints.XL;\n };\n\n ResponsiveBreakpoints.isXXL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XXL && container.pixelHeight <= ResponsiveBreakpoints.XXL;\n };\n\n ResponsiveBreakpoints.maybeXXS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XXS || container.pixelHeight <= ResponsiveBreakpoints.XXS;\n };\n\n ResponsiveBreakpoints.maybeXS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XS || container.pixelHeight <= ResponsiveBreakpoints.XS;\n };\n\n ResponsiveBreakpoints.maybeS = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.S || container.pixelHeight <= ResponsiveBreakpoints.S;\n };\n\n ResponsiveBreakpoints.maybeM = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.M || container.pixelHeight <= ResponsiveBreakpoints.M;\n };\n\n ResponsiveBreakpoints.maybeL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.L || container.pixelHeight <= ResponsiveBreakpoints.L;\n };\n\n ResponsiveBreakpoints.maybeXL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XL || container.pixelHeight <= ResponsiveBreakpoints.XL;\n };\n\n ResponsiveBreakpoints.maybeXXL = function (container) {\n return container.pixelWidth <= ResponsiveBreakpoints.XXL || container.pixelHeight <= ResponsiveBreakpoints.XXL;\n }; // Named pixel breakpoints\n\n\n ResponsiveBreakpoints.XXS = 100;\n ResponsiveBreakpoints.XS = 200;\n ResponsiveBreakpoints.S = 300;\n ResponsiveBreakpoints.M = 400;\n ResponsiveBreakpoints.L = 600;\n ResponsiveBreakpoints.XL = 800;\n ResponsiveBreakpoints.XXL = 1000;\n return ResponsiveBreakpoints;\n}();\n\nexport { ResponsiveBreakpoints };","/**\r\n * Defines functionality for \"Data Item\"\r\n *\r\n * A Data Item can be any object that can hold data. For example [[LineSeries]]\r\n * holds a number of values, that comprise a line graph. Each of those values\r\n * (data points) is a {DataItem}.\r\n *\r\n * Furthermore the [[LineSeries]] itself can be represented as a entry in the\r\n * legend. Since legend needs access to Line Series' value, a DataItem is\r\n * created for the series.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObjectEvents } from \"./Base\";\nimport { Adapter } from \"./utils/Adapter\";\nimport { Animation, AnimationDisposer } from \"./utils/Animation\";\nimport * as $utils from \"./utils/Utils\";\nimport * as $array from \"./utils/Array\"; //import * as $object from \"./utils/Object\";\n\nimport * as $type from \"./utils/Type\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * DataItem represents single element in data, for example a data point in a\r\n * Serial Chart Series, e.g. a column.\r\n *\r\n * DataItem defines relationship between structured data, required for specific\r\n * chart type or task, and raw source data.\r\n *\r\n * It also implements required calculations, updates related visual elements,\r\n * etc.\r\n *\r\n * @todo Description\r\n * @important\r\n */\n\nvar DataItem =\n/** @class */\nfunction (_super) {\n __extends(DataItem, _super);\n /**\r\n * Constructor\r\n * @todo Adding events to disposers produces errors in some cases, which means that chart is using disposed Data Items which is not right\r\n */\n\n\n function DataItem() {\n var _this = _super.call(this) || this;\n /**\r\n * This Data Item is currently disabled.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n _this._disabled = false;\n /**\r\n * Indicates whether Data Item has any properties set.\r\n *\r\n * If it does not have any, the code can use this property to check whether\r\n * they need to apply costly operation of re-applying properties, whenever\r\n * Data Item-related element is redrawn, e.g. series.\r\n */\n\n _this.hasProperties = false;\n /**\r\n * An object containing calculated values.\r\n */\n\n _this.values = {};\n /**\r\n * An object container current working values.\r\n */\n //public readonly workingValues: { [index: string]: { [index: string]: number } } = {};\n\n /**\r\n * An object containing categories.\r\n */\n\n _this.categories = {};\n /**\r\n * An object containing dates.\r\n */\n\n _this.dates = {};\n /**\r\n * An object containing locations for the Data Item.\r\n *\r\n * A location is a position within date or category, or, in some other cases,\r\n * where there is no single point but rather some period.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/series/#Data_item_locations} for info how data item locations work\r\n */\n\n _this.locations = {};\n /**\r\n * Current working locations.\r\n */\n\n _this.workingLocations = {};\n /**\r\n * An object containing Data Item specific appearance properties in key-value\r\n * pairs.\r\n *\r\n * Sometimes a single Data Item needs to apply different properties than the\r\n * rest of the data [[Series]] it is part of. E.g. a single column,\r\n * represented by a Data Item needs to be filled with a different color than\r\n * the reset of the [[ColumnSeries]] it belongs to.\r\n *\r\n * That's where Data Item's `properties` come into play.\r\n *\r\n * Please note that you should set Data Item-specific properties using\r\n * `setProperty()` method, rather than access `properties` object directly.\r\n */\n\n _this.properties = {};\n /**\r\n * A list of [[Sprite]] elements that are associated with this Data Item.\r\n *\r\n * E.g. an [[Axis]] Data Item has several separate elements associated with\r\n * it, like [[AxisTick]], [[AxisLabel]], and [[Grid]].\r\n *\r\n * Data Item keeps track of all of them, so it can toggle all related visual\r\n * elements when it itself is toggled.\r\n */\n\n _this.sprites = [];\n /**\r\n * Identifies if this object is a \"template\" and should not be treated as\r\n * real object that is drawn or actually used in the chart.\r\n */\n\n _this.isTemplate = false;\n /**\r\n * The current index within the dataItems\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._index = null;\n /**\r\n * Is Data Item currently visible?\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._visible = true;\n /**\r\n * Is Data Item currently hidden?\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._hidden = false;\n /**\r\n * Should this Data Item be used when calculating data ranges and scales?\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._ignoreMinMax = false;\n /**\r\n * Some of the Data Item's data fields may contain an array of children. This\r\n * property contains an object indicating which fields hold an array, so that\r\n * they can be processed properly.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this.hasChildren = {};\n /**\r\n * Indicates whether Data Item is currently animiting from visible to hidden\r\n * state.\r\n */\n\n _this.isHiding = false;\n /**\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._valueAnimations = {};\n /**\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._locationAnimations = {};\n _this.className = \"DataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(DataItem.prototype, \"adapter\", {\n /**\r\n * Holds Adapter.\r\n */\n get: function get() {\n if (!this._adapterO) {\n this._adapterO = new Adapter(this);\n }\n\n return this._adapterO;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"index\", {\n /**\r\n * Data Item's position index in Component's data.\r\n *\r\n * @return Index\r\n */\n get: function get() {\n if (this.component) {\n if (this._index != null) {\n return this._index;\n } else {\n return -1;\n }\n } else {\n return -1;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"animations\", {\n /**\r\n * A list of [[Animations]] objects currently mutating Data Item's values.\r\n *\r\n * @return [description]\r\n */\n get: function get() {\n if (!this._animations) {\n this._animations = [];\n\n this._disposers.push(new AnimationDisposer(this._animations));\n }\n\n return this._animations;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"visible\", {\n /**\r\n * Returns `true` if this Data Item is currently visible.\r\n *\r\n * @return Visible?\r\n */\n get: function get() {\n if (this._hidden) {\n return false;\n }\n\n return this._visible;\n },\n\n /**\r\n * Sets visibility of the Data Item.\r\n *\r\n * @param value Visible?\r\n */\n set: function set(value) {\n if (value) {\n this.hidden = false;\n }\n\n if (this._visible != value) {\n this.setVisibility(value);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"hidden\", {\n /**\r\n * Returns `true` if this Data Item is currently hidden.\r\n *\r\n * @return Hidden?\r\n */\n get: function get() {\n return this._hidden;\n },\n\n /**\r\n * Sets hidden flag for data item. Mostly used to initially hide data item.\r\n *\r\n * @param value Hidden?\r\n */\n set: function set(value) {\n if (this._hidden != value) {\n this._hidden = value;\n\n if (value) {\n this.setVisibility(false);\n } else {\n this.setVisibility(true, true);\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"__disabled\", {\n /**\r\n * Is this Data Item currently disabled?\r\n *\r\n * @ignore Exclude from docs\r\n * @param {boolean}\r\n */\n get: function get() {\n return this._disabled;\n },\n\n /**\r\n * Disables all Sprites associated with this Data Item.\r\n *\r\n * @ignore Exclude from docs\r\n * @param {boolean}\r\n */\n set: function set(value) {\n //\tif (this._disabled != value) { // not good\n this._disabled = value;\n $array.each(this.sprites, function (sprite) {\n sprite.__disabled = value;\n }); //\t}\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets visibility of the Data Item.\r\n *\r\n * @param value Data Item\r\n */\n\n DataItem.prototype.setVisibility = function (value, noChangeValues) {\n $array.each(this.sprites, function (sprite) {\n if (value) {\n sprite.visible = sprite.defaultState.properties.visible;\n } else {\n if (sprite.hiddenState) {\n sprite.visible = sprite.hiddenState.properties.visible;\n } else {\n sprite.visible = false;\n }\n }\n });\n this._visible = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"visibilitychanged\")) {\n var event_1 = {\n type: \"visibilitychanged\",\n target: this,\n visible: value\n };\n this.events.dispatchImmediately(\"visibilitychanged\", event_1);\n }\n }\n };\n /**\r\n * Shows the Data Item and related visual elements.\r\n *\r\n * @param duration Animation duration (ms)\r\n * @param delay Delay animation (ms)\r\n * @param fields A list of fields to set values of\r\n */\n\n\n DataItem.prototype.show = function (duration, delay, fields) {\n var _this = this;\n\n if (!this.hidden) {\n this.setVisibility(true, true);\n this.isHiding = false;\n\n if (this._hideDisposer) {\n this.removeDispose(this._hideDisposer);\n }\n\n var animation_1;\n\n if (fields) {\n $array.each(fields, function (field) {\n animation_1 = _this.setWorkingValue(field, _this.values[field].value, duration, delay);\n });\n }\n\n $array.each(this.sprites, function (sprite) {\n var animation = sprite.show(duration);\n\n if (animation != null && !animation.isFinished()) {\n _this._disposers.push(animation);\n\n if (delay != null && delay > 0) {\n animation.delay(delay);\n }\n }\n });\n return animation_1;\n }\n };\n /**\r\n * Destroys this object and all related data.\r\n */\n\n\n DataItem.prototype.dispose = function () {\n _super.prototype.dispose.call(this);\n\n $array.each(this.sprites, function (sprite) {\n sprite.dispose();\n });\n this.sprites = [];\n };\n /**\r\n * Hides the Data Item and related visual elements.\r\n *\r\n * @param duration Animation duration (ms)\r\n * @param delay Delay animation (ms)\r\n * @param toValue A value to set to `fields` when hiding\r\n * @param fields A list of data fields to set value to `toValue`\r\n */\n\n\n DataItem.prototype.hide = function (duration, delay, toValue, fields) {\n var _this = this;\n\n this.isHiding = true;\n $array.each(this.sprites, function (sprite) {\n var animation = sprite.hide(duration);\n\n if (animation != null && !animation.isFinished()) {\n _this._disposers.push(animation);\n\n if (delay != null && delay > 0) {\n animation.delay(delay);\n }\n }\n });\n\n if ($type.isNumber(toValue) && fields) {\n var animation_2;\n $array.each(fields, function (field) {\n var anim = _this.setWorkingValue(field, toValue, duration, delay);\n\n if (anim) {\n animation_2 = anim;\n }\n });\n\n if (animation_2 && !animation_2.isFinished()) {\n this._hideDisposer = animation_2.events.on(\"animationended\", function () {\n _this.setVisibility(false, true);\n\n _this.isHiding = false;\n });\n\n this._disposers.push(this._hideDisposer);\n\n return animation_2;\n } else {\n this.isHiding = false;\n this.setVisibility(false, true);\n }\n } else {\n this.isHiding = false;\n this.setVisibility(false);\n }\n };\n /**\r\n * Returns a duration (ms) the Data Item should take to animate from one\r\n * value to another.\r\n *\r\n * If the duration is not specified via parameter, this method will try to\r\n * request a default duration from the related `Component`.\r\n *\r\n * @param duration Default duration (ms)\r\n * @return Duration (ms)\r\n */\n\n\n DataItem.prototype.getDuration = function (duration) {\n if (!$type.isNumber(duration)) {\n var component = this.component;\n\n if (component) {\n duration = component.interpolationDuration;\n }\n }\n\n if (duration != null) {\n if (!this._adapterO) {\n return duration;\n } else {\n return this._adapterO.apply(\"duration\", duration);\n }\n }\n };\n /**\r\n * Returns a numeric value for specific data field.\r\n *\r\n * If `calculated` is not set, it will return a raw value, as it is in\r\n * source data.\r\n *\r\n * If `calculated` is set, it will return a pre-calculated specific value.\r\n *\r\n * @param name Data field name\r\n * @param calculated A calculated value name\r\n * @return Value\r\n */\n\n\n DataItem.prototype.getValue = function (name, calculated) {\n if (name && this.component) {\n if (!calculated) {\n calculated = this.component.dataFields[name + \"Show\"];\n\n if (!calculated) {\n calculated = \"value\";\n }\n }\n\n var value = this.values[name][calculated];\n\n if (this._adapterO && this._adapterO.isEnabled(\"value\")) {\n return this._adapterO.apply(\"value\", {\n value: value,\n field: name\n }).value;\n } else {\n return value;\n }\n }\n };\n /**\r\n * Returns a current working value for a specific data field.\r\n *\r\n * The actual value may differ from the one returned by `getValue()`. The\r\n * latter returns static values from the data source.\r\n *\r\n * `getWorkingValue()` returns current value, which is usually different if\r\n * Data Item is animating from one state to another.\r\n *\r\n * @param name Data field name\r\n * @return Value\r\n */\n\n\n DataItem.prototype.getWorkingValue = function (name) {\n if (name && this.component) {\n var realName = this.component.dataFields[name + \"Show\"];\n\n if (!realName) {\n realName = \"workingValue\";\n }\n\n if (this._adapterO) {\n return this._adapterO.apply(\"workingValue\", {\n workingValue: this.values[name][realName],\n field: name\n }).workingValue;\n } else {\n return this.values[name][realName];\n }\n }\n };\n /**\r\n * @ignore\r\n * @return Value\r\n */\n\n\n DataItem.prototype.getActualWorkingValue = function (name) {\n return this.values[name].workingValue;\n };\n /**\r\n * Sets a numeric value for specific data field.\r\n *\r\n * @param name Data field name\r\n * @param value Value\r\n * @param calculated Calculated data field name\r\n * @param duration Duration (ms) to animate to new value to\r\n * @param delay Delay animation (ms)\r\n */\n\n\n DataItem.prototype.setValue = function (name, value, duration, delay) {\n var currentValue = this.values[name].value;\n var newDuration = this.getDuration(duration);\n value = $type.toNumber(value);\n\n if (currentValue !== value) {\n this.values[name].value = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"valuechanged\")) {\n var event_2 = {\n type: \"valuechanged\",\n target: this,\n property: name\n };\n this.events.dispatchImmediately(\"valuechanged\", event_2);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemValueChange(this, name);\n }\n }\n\n this.setWorkingValue(name, value, newDuration, delay);\n };\n\n DataItem.prototype.setCalculatedValue = function (name, value, calculated) {\n var currentValue = this.values[name][calculated];\n\n if (currentValue !== value && $type.isNumber(value)) {\n this.values[name][calculated] = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"calculatedvaluechanged\")) {\n var event_3 = {\n type: \"calculatedvaluechanged\",\n target: this,\n property: name\n };\n this.events.dispatchImmediately(\"calculatedvaluechanged\", event_3);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemCalculatedValueChange(this, name);\n }\n }\n };\n /**\r\n * Set current working numeric value for a specific data field.\r\n *\r\n * @param name Data field name\r\n * @param value Value\r\n * @param calculated Calculated data field name\r\n * @param duration Duration (ms) to animate to new value to\r\n * @param delay Delay animation (ms)\r\n * @return An [[Animation]] object used for transition to new values\r\n */\n\n\n DataItem.prototype.setWorkingValue = function (name, value, duration, delay) {\n if ($type.isNumber(this.values[name].value)) {\n var newDuration = this.getDuration(duration);\n var workingValue = this.values[name].workingValue;\n\n if (newDuration != null && newDuration > 0 && $type.isNumber(workingValue) && this.component) {\n // sometimes NaN is passed, so only change this to != null if all cases of NaN are handled, otherwise animation won't stop\n if (workingValue != value) {\n var animation = this.animate({\n childObject: this.values[name],\n property: \"workingValue\",\n from: workingValue,\n to: value,\n dummyData: name\n }, newDuration, this.component.interpolationEasing);\n\n if (delay != null) {\n animation.delay(delay);\n }\n\n animation.events.on(\"animationstarted\", this.handleInterpolationProgress, this);\n animation.events.on(\"animationprogress\", this.handleInterpolationProgress, this);\n animation.events.on(\"animationended\", this.handleInterpolationProgress, this);\n this._valueAnimations[name] = animation;\n return animation;\n } else {\n var valueAnimation = this._valueAnimations[name];\n\n if (valueAnimation) {\n valueAnimation.stop();\n }\n\n this.values[name].workingValue = value;\n }\n } else {\n var valueAnimation = this._valueAnimations[name];\n\n if (valueAnimation) {\n valueAnimation.stop();\n }\n\n this.values[name].workingValue = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"workingvaluechanged\")) {\n var event_4 = {\n type: \"workingvaluechanged\",\n target: this,\n property: name\n };\n this.events.dispatchImmediately(\"workingvaluechanged\", event_4);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemWorkingValueChange(this, name);\n }\n }\n }\n };\n /**\r\n * Sets a relative location for a data field.\r\n *\r\n * A location is always relative on a 0 to 1 scale, with 0 being beginning,\r\n * 0.5 middle and 1 end.\r\n *\r\n * @todo Rewiew description\r\n * @param name Data field name\r\n * @param value Location (0-1)\r\n * @param duration Duration (ms) to animate to new value to\r\n * @param delay Delay animation (ms)\r\n */\n\n\n DataItem.prototype.setLocation = function (name, value, duration, delay) {\n var currentLocation = this.locations[name];\n\n if (currentLocation !== value) {\n this.locations[name] = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"locationchanged\")) {\n var event_5 = {\n type: \"locationchanged\",\n target: this,\n property: name\n };\n this.events.dispatchImmediately(\"locationchanged\", event_5);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemValueChange(this, name); // correct\n }\n\n this.setWorkingLocation(name, value, duration, delay);\n }\n };\n /**\r\n * Sets a current working location for a data field.\r\n *\r\n * @todo Rewiew description\r\n * @param name Data field name\r\n * @param value Location (0-1)\r\n * @param duration Duration (ms) to animate to new value to\r\n * @param delay Delay animation (ms)\r\n */\n\n\n DataItem.prototype.setWorkingLocation = function (name, value, duration, delay) {\n var newDuration = this.getDuration(duration);\n var workingLocation = this.workingLocations[name];\n\n if (newDuration != null && newDuration > 0 && $type.isNumber(workingLocation) && this.component) {\n // sometimes NaN is passed, so only change this to != null if all cases of NaN are handled, otherwise animation won't stop\n if (workingLocation != value) {\n var animation = this.animate({\n childObject: this.workingLocations,\n property: name,\n from: workingLocation,\n to: value,\n dummyData: name\n }, newDuration, this.component.interpolationEasing);\n\n if (delay != null) {\n animation.delay(delay);\n }\n\n animation.events.on(\"animationstarted\", this.handleInterpolationProgress, this);\n animation.events.on(\"animationprogress\", this.handleInterpolationProgress, this);\n animation.events.on(\"animationended\", this.handleInterpolationProgress, this);\n this._locationAnimations[name] = animation;\n return animation;\n } else {\n var locationAnimation = this._locationAnimations[name];\n\n if (locationAnimation) {\n locationAnimation.stop();\n }\n\n this.workingLocations[name] = value;\n }\n } else {\n var locationAnimation = this._locationAnimations[name];\n\n if (locationAnimation) {\n locationAnimation.stop();\n }\n\n this.workingLocations[name] = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"workinglocationchanged\")) {\n var event_6 = {\n type: \"workinglocationchanged\",\n target: this,\n property: name\n };\n this.events.dispatchImmediately(\"workinglocationchanged\", event_6);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemWorkingLocationChange(this, name);\n }\n }\n };\n /**\r\n * Sets Date value to a data field.\r\n *\r\n * @param name Data field name\r\n * @param date Date object\r\n * @param duration Duration (ms) to animate to new value to\r\n */\n\n\n DataItem.prototype.setDate = function (name, date, duration) {\n if (!$type.isDate(date) && this.component) {\n date = this.component.dateFormatter.parse(date);\n }\n\n var currentDate = this.dates[name];\n\n if (currentDate !== date) {\n this.dates[name] = date;\n this.setValue(name, date.getTime(), duration);\n }\n };\n /**\r\n * Returns a Date value of the data field.\r\n *\r\n * @param name Data field name\r\n * @return Date object\r\n */\n\n\n DataItem.prototype.getDate = function (name) {\n if (this._adapterO) {\n return this._adapterO.apply(\"date\", {\n date: this.dates[name],\n field: name\n }).date;\n } else {\n return this.dates[name];\n }\n };\n /**\r\n * Sets a Data Item-specific visual properties to apply to related elements.\r\n *\r\n * @param name Property name\r\n * @param value Property value\r\n */\n\n\n DataItem.prototype.setProperty = function (name, value) {\n if (this.properties[name] !== value) {\n this.hasProperties = true;\n this.properties[name] = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"propertychanged\")) {\n var event_7 = {\n type: \"propertychanged\",\n target: this,\n property: name,\n value: value\n };\n this.events.dispatchImmediately(\"propertychanged\", event_7);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemPropertyChange(this, name);\n }\n }\n };\n /**\r\n * Sets a related category for this Data Item.\r\n *\r\n * @todo Review description\r\n * @param name Data field name\r\n * @param value Category\r\n */\n\n\n DataItem.prototype.setCategory = function (name, value) {\n if (!$type.isString(value)) {\n value = $type.castString(value);\n }\n\n if (this.categories[name] !== value) {\n this.categories[name] = value;\n }\n };\n /**\r\n * Clones the Data Item, including all related data.\r\n *\r\n * @return New Data Item clone\r\n */\n //public clone(cloneId?: string): this {\n //\tlet dataItem: this = super.clone(cloneId);\n //\tdataItem.copyFrom(this);\n //\treturn dataItem;\n //}\n\n /**\r\n * Copies all properties and related data from different data item.\r\n *\r\n * @param object Source data item\r\n */\n\n\n DataItem.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n if (source.dataContext) {\n this.dataContext = $utils.copy(source.dataContext, {});\n }\n\n $utils.copyProperties(source.locations, this.locations);\n /*\r\n $utils.copyProperties(source.properties, this.properties);\r\n $utils.copyProperties(source.categories, this.categories);\r\n $utils.copyProperties(source.values, this.values);\r\n $utils.copyProperties(source.dates, this.dates);\r\n $object.each(source.values, (name, value) => {\r\n this.values[name] = $object.copy(value);\r\n });*/\n\n if (source._adapterO) {\n this.adapter.copyFrom(source._adapterO);\n } //this.events.copyFrom(source.events); // because copied in Base\n\n\n this.component = source.component;\n };\n\n Object.defineProperty(DataItem.prototype, \"opacity\", {\n /**\r\n * Sets opacity for all Data Item's related elements (Sprites).\r\n *\r\n * @param value Opacity (0-1)\r\n */\n set: function set(value) {\n $array.each(this.sprites, function (sprite) {\n sprite.opacity = value;\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"ignoreMinMax\", {\n /**\r\n * Exclude from min/max calculations?\r\n * @return Exclude from min/max calculations?\r\n */\n get: function get() {\n return this._ignoreMinMax;\n },\n\n /**\r\n * Sets whether this data point should not be included in the scale and\r\n * minimum/maximum calculations.\r\n *\r\n * E.g. some we may want to exclude a particular data point from influencing\r\n * [[ValueAxis]] scale.\r\n *\r\n * @param value Exclude from min/max calculations?\r\n */\n set: function set(value) {\n this._ignoreMinMax = value;\n\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"propertychanged\")) {\n var event_8 = {\n type: \"propertychanged\",\n target: this,\n property: \"ignoreMinMax\",\n value: value\n };\n this.events.dispatchImmediately(\"propertychanged\", event_8);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemPropertyChange(this, \"ignoreMinMax\");\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates and starts an [[Animation]] to interpolate (morph) Data Item's\r\n * properties and/or values.\r\n *\r\n * @see {@link Animation}\r\n * @param animationOptions Animation options\r\n * @param duration Animation duration (ms)\r\n * @param easing Easing function\r\n * @return Animation\r\n */\n\n DataItem.prototype.animate = function (animationOptions, duration, easing) {\n return new Animation(this, animationOptions, duration, easing).start();\n };\n /**\r\n * Handles intermediate steps when Data Item is interpolating (morphing) from\r\n * one value to another.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event object\r\n */\n\n\n DataItem.prototype.handleInterpolationProgress = function (event) {\n var animation = event.target; // it's always only one options, no need cycle\n\n var animationOptions = animation.animationOptions[0];\n\n if (animationOptions) {\n if (this._eventDispatcher && !this.__disabled) {\n if (this.events.isEnabled(\"workingvaluechanged\")) {\n var event_9 = {\n type: \"workingvaluechanged\",\n target: this,\n property: animationOptions.dummyData\n };\n this.events.dispatchImmediately(\"workingvaluechanged\", event_9);\n }\n }\n\n if (this.component) {\n this.component.handleDataItemWorkingValueChange(this, animationOptions.dummyData);\n }\n }\n };\n /**\r\n * Checks whether Data Item has values set for all of the data fields,\r\n * supplied via argument.\r\n *\r\n * @ignore Exclude from docs\r\n * @param fields Field list to check\r\n * @return Has values for all fields?\r\n */\n\n\n DataItem.prototype.hasValue = function (fields) {\n // todo: what about categories?\n for (var i = 0, len = fields.length; i < len; i++) {\n var values = this.values[fields[i]];\n\n if (!values || !$type.hasValue(values.value)) {\n return false;\n }\n }\n\n return true;\n };\n\n Object.defineProperty(DataItem.prototype, \"depth\", {\n /**\r\n * Depth of the Data Item.\r\n *\r\n * In nested data structures, like TreeMap, this indicates the level this\r\n * data point is at, in relation to the parent Data Item.\r\n *\r\n * @return Depth\r\n */\n get: function get() {\n if (!this.parent) {\n return 0;\n } else {\n return this.parent.depth + 1;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DataItem.prototype, \"dataContext\", {\n /**\r\n * Sets to a reference to an original object from Component's data.\r\n *\r\n * @return [description]\r\n */\n get: function get() {\n return this._dataContext;\n },\n\n /**\r\n * A reference to an original object in Component's data, that this Data Item\r\n * is derived from.\r\n *\r\n * @param value Original data object\r\n */\n set: function set(value) {\n this._dataContext = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * adds a sprite to dataItem.sprites array\r\n * @ignore\r\n */\n\n DataItem.prototype.addSprite = function (sprite) {\n if (sprite.dataItem && sprite.dataItem != this) {\n $array.remove(sprite.dataItem.sprites, sprite);\n }\n\n if (!this.visible) {\n sprite.hide(0);\n }\n\n if (this.isHiding) {\n sprite.hide();\n }\n\n this.sprites.push(sprite);\n sprite.dataItem = this;\n };\n\n return DataItem;\n}(BaseObjectEvents);\n\nexport { DataItem };","function _typeof(obj) { \"@babel/helpers - typeof\"; return _typeof = \"function\" == typeof Symbol && \"symbol\" == typeof Symbol.iterator ? function (obj) { return typeof obj; } : function (obj) { return obj && \"function\" == typeof Symbol && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }, _typeof(obj); }\n\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"./Container\";\nimport { List, ListDisposer } from \"./utils/List\";\nimport { OrderedListTemplate } from \"./utils/SortedList\";\nimport { Dictionary } from \"./utils/Dictionary\";\nimport { Disposer, MultiDisposer } from \"./utils/Disposer\";\nimport { DataSource } from \"./data/DataSource\";\nimport { Responsive } from \"./utils/Responsive\";\nimport { system } from \"./System\";\nimport { DataItem } from \"./DataItem\";\nimport { registry } from \"./Registry\";\nimport * as $math from \"./utils/Math\";\nimport * as $array from \"./utils/Array\";\nimport * as $ease from \"./utils/Ease\";\nimport * as $utils from \"./utils/Utils\";\nimport * as $iter from \"./utils/Iterator\";\nimport * as $object from \"./utils/Object\";\nimport * as $type from \"./utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A Component represents an independent functional element or control, that\r\n * can have it's own behavior, children, data, etc.\r\n *\r\n * A few examples of a Component: [[Legend]], [[Series]], [[Scrollbar]].\r\n *\r\n * @see {@link IComponentEvents} for a list of available events\r\n * @see {@link IComponentAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar Component =\n/** @class */\nfunction (_super) {\n __extends(Component, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Component() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Holds data field names.\r\n *\r\n * Data fields define connection beween [[DataItem]] and actual properties\r\n * in raw data.\r\n */\n\n\n _this.dataFields = {};\n /**\r\n * A list of [[DataSource]] definitions of external data source.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._dataSources = {};\n /**\r\n * This is used when only new data is invalidated (if added using `addData`\r\n * method).\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._parseDataFrom = 0;\n /**\r\n * Holds the disposers for the dataItems and dataUsers\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._dataDisposers = [];\n /**\r\n * Currently selected \"data set\".\r\n *\r\n * If it's set to `\"\"`, main data set (unaggregated data) is used.\r\n */\n\n _this._currentDataSetId = \"\";\n /**\r\n * [_start description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._start = 0;\n /**\r\n * [_end description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this._end = 1;\n /**\r\n * If set to `true`, changing data range in element will not trigger\r\n * `daterangechanged` event.\r\n */\n\n _this.skipRangeEvent = false;\n /**\r\n * Whenever selected scope changes (chart is zoomed or panned), for example\r\n * by interaction from a Scrollbar, or API, a chart needs to reposition\r\n * its contents.\r\n *\r\n * `rangeChangeDuration` influences how this is performed.\r\n *\r\n * If set to zero (0), the change will happen instantenously.\r\n *\r\n * If set to non-zero value, the chart will gradually animate into new\r\n * position for the set amount of milliseconds.\r\n *\r\n * @default 0\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/animations/} for more info about animations\r\n */\n\n _this.rangeChangeDuration = 0;\n /**\r\n * An easing function to use for range change animation.\r\n *\r\n * @see {@link Ease}\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/animations/} for more info about animations\r\n */\n\n _this.rangeChangeEasing = $ease.cubicOut;\n /**\r\n * A duration (ms) of each data parsing step. A Component parses its data in\r\n * chunks in order to avoid completely freezing the machine when large data\r\n * sets are used. This setting will control how many milliseconds should pass\r\n * when parsing data until parser stops for a brief moment to let other\r\n * processes catch up.\r\n */\n\n _this.parsingStepDuration = 50;\n /**\r\n * [dataInvalid description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n _this.dataInvalid = false;\n /**\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this.rawDataInvalid = false;\n /**\r\n * [dataRangeInvalid description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n _this.dataRangeInvalid = false;\n /**\r\n * [dataItemsInvalid description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n _this.dataItemsInvalid = false;\n /**\r\n * If set to a non-zero number the element will \"animate\" data values of its\r\n * children.\r\n *\r\n * This will happen on first load and whenever data values change.\r\n *\r\n * Enabling interpolation will mean that elements will transit smoothly into\r\n * new values rather than updating instantly.\r\n *\r\n * @default 0\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/animations/} for more info about animations\r\n */\n\n _this.interpolationDuration = 0;\n /**\r\n * An easing function to use for interpolating values when transiting from\r\n * one source value to another.\r\n *\r\n * @default cubicOut\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/animations/} for more info about animations\r\n * @see {@link Ease}\r\n */\n\n _this.interpolationEasing = $ease.cubicOut;\n /**\r\n * Indicates whether transition between data item's values should start and\r\n * play out all at once, or with a small delay (as defined by\r\n * `sequencedInterpolationDelay`) for each subsequent data item.\r\n *\r\n * @default true\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/animations/} for more info about animations\r\n */\n\n _this.sequencedInterpolation = true;\n /**\r\n * A delay (ms) to wait between animating each subsequent data item's\r\n * interpolation animation.\r\n *\r\n * Relative only if `sequencedInterpolation = true`.\r\n *\r\n * @default 0\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/animations/} for more info about animations\r\n */\n\n _this.sequencedInterpolationDelay = 0;\n /**\r\n * A progress (0-1) for the data validation process.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n _this.dataValidationProgress = 0;\n _this._addAllDataItems = true;\n _this._usesData = true;\n _this.className = \"Component\";\n _this.minZoomCount = 1;\n _this.maxZoomCount = 0;\n _this._dataItems = new OrderedListTemplate(_this.createDataItem());\n\n _this._dataItems.events.on(\"inserted\", _this.handleDataItemAdded, _this, false);\n\n _this._dataItems.events.on(\"removed\", _this.handleDataItemRemoved, _this, false);\n\n _this._disposers.push(new ListDisposer(_this._dataItems));\n\n _this._disposers.push(_this._dataItems.template);\n\n _this.invalidateData(); // TODO what about remove ?\n\n\n _this.dataUsers.events.on(\"inserted\", _this.handleDataUserAdded, _this, false); // Set up disposers\n\n\n _this._disposers.push(new MultiDisposer(_this._dataDisposers));\n\n _this._start = 0;\n _this._end = 1;\n _this.maxZoomDeclination = 1; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n Component.prototype.createDataItem = function () {\n return new DataItem();\n };\n /**\r\n * [handleDataUserAdded description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param event Event object\r\n */\n\n\n Component.prototype.handleDataUserAdded = function (event) {\n var dataUser = event.newValue;\n dataUser.dataProvider = this;\n };\n /**\r\n * [handleDataItemValueChange description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Component.prototype.handleDataItemValueChange = function (dataItem, name) {\n if (!this.dataItemsInvalid) {\n this.invalidateDataItems();\n }\n };\n /**\r\n * [handleDataItemWorkingValueChange description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.handleDataItemWorkingValueChange = function (dataItem, name) {};\n /**\r\n * [handleDataItemWorkingLocationChange description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.handleDataItemWorkingLocationChange = function (dataItem, name) {};\n /**\r\n * [handleDataItemCalculatedValueChange description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.handleDataItemCalculatedValueChange = function (dataItem, name) {};\n /**\r\n * [handleDataItemPropertyChange description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.handleDataItemPropertyChange = function (dataItem, name) {};\n /**\r\n * Populates a [[DataItem]] width data from data source.\r\n *\r\n * Loops through all the fields and if such a field is found in raw data\r\n * object, a corresponding value on passed in `dataItem` is set.\r\n *\r\n * @ignore Exclude from docs\r\n * @param item\r\n */\n\n\n Component.prototype.processDataItem = function (dataItem, dataContext) {\n var _this = this;\n\n if (dataItem) {\n if (!dataContext) {\n dataContext = {};\n } // store reference to original data item\n\n\n dataItem.dataContext = dataContext;\n var hasSomeValues_1 = false;\n $object.each(this.dataFields, function (key, fieldValue) {\n var fieldName = key;\n var value = dataContext[fieldValue]; // Apply adapters to a retrieved value\n\n if (_this._adapterO) {\n if (_this._adapterO.isEnabled(\"dataContextValue\")) {\n value = _this._adapterO.apply(\"dataContextValue\", {\n field: fieldName,\n value: value,\n dataItem: dataItem\n }).value;\n }\n }\n\n if ($type.hasValue(value)) {\n hasSomeValues_1 = true;\n\n if (dataItem.hasChildren[fieldName]) {\n var template = _this.createDataItem();\n\n template.copyFrom(_this.mainDataSet.template);\n var children = new OrderedListTemplate(template);\n children.events.on(\"inserted\", _this.handleDataItemAdded, _this, false);\n children.events.on(\"removed\", _this.handleDataItemRemoved, _this, false);\n\n _this._dataDisposers.push(new ListDisposer(children));\n\n var count = value.length;\n\n for (var i = 0; i < count; i++) {\n var rawDataItem = value[i];\n var childDataItem = children.create();\n childDataItem.parent = dataItem;\n\n _this.processDataItem(childDataItem, rawDataItem);\n }\n\n var anyDataItem = dataItem;\n anyDataItem[fieldName] = children;\n } else {\n // data is converted to numbers/dates in each dataItem\n dataItem[fieldName] = value;\n }\n }\n });\n $object.each(this.propertyFields, function (key, fieldValue) {\n var f = key;\n var value = dataContext[fieldValue];\n\n if ($type.hasValue(value)) {\n hasSomeValues_1 = true;\n dataItem.setProperty(f, value);\n }\n }); // @todo we might need some flag which would tell whether we should create empty data items or not.\n\n if (!this._addAllDataItems && !hasSomeValues_1) {\n this.mainDataSet.remove(dataItem);\n }\n }\n };\n /**\r\n *\r\n * When validating raw data, instead of processing data item, we update it\r\n *\r\n * @ignore Exclude from docs\r\n * @param item\r\n */\n\n\n Component.prototype.updateDataItem = function (dataItem) {\n var _this = this;\n\n if (dataItem) {\n var dataContext_1 = dataItem.dataContext;\n $object.each(this.dataFields, function (key, fieldValue) {\n var fieldName = key;\n var value = dataContext_1[fieldValue]; // Apply adapters to a retrieved value\n\n if (_this._adapterO) {\n value = _this._adapterO.apply(\"dataContextValue\", {\n field: fieldName,\n value: value,\n dataItem: dataItem\n }).value;\n }\n\n if ($type.hasValue(value)) {\n if (dataItem.hasChildren[fieldName]) {\n var anyDataItem = dataItem;\n var children = anyDataItem[fieldName];\n children.each(function (child) {\n _this.updateDataItem(child);\n });\n } else {\n // data is converted to numbers/dates in each dataItem\t\t\t\t\t\n dataItem[fieldName] = value;\n }\n }\n });\n $object.each(this.propertyFields, function (key, fieldValue) {\n var f = key;\n var value = dataContext_1[fieldValue];\n\n if ($type.hasValue(value)) {\n dataItem.setProperty(f, value);\n }\n });\n }\n };\n /**\r\n * [validateDataElements description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Component.prototype.validateDataElements = function () {\n var count = this.endIndex;\n\n for (var i = this.startIndex; i < count; i++) {\n var dataItem = this.dataItems.getIndex(i); // TODO is this correct\n\n if (dataItem) {\n this.validateDataElement(dataItem);\n }\n }\n };\n /**\r\n * Validates this element and its related elements.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.validate = function () {\n this.validateDataElements();\n\n _super.prototype.validate.call(this);\n };\n /**\r\n * [validateDataElement description]\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem [description]\r\n */\n\n\n Component.prototype.validateDataElement = function (dataItem) {};\n /**\r\n * Adds one or several (array) of data items to the existing data.\r\n *\r\n * @param rawDataItem One or many raw data item objects\r\n */\n\n\n Component.prototype.addData = function (rawDataItem, removeCount, skipRaw) {\n var _this = this; // need to check if data is invalid, as addData might be called multiple times\n\n\n if (!this.dataInvalid && this.inited) {\n this._parseDataFrom = this.data.length; // save length of parsed data\n }\n\n if (!skipRaw) {\n if (rawDataItem instanceof Array) {\n // can't use concat because new array is returned\n $array.each(rawDataItem, function (dataItem) {\n _this.data.push(dataItem);\n });\n } else {\n this.data.push(rawDataItem); // add to raw data array\n }\n }\n\n if (this.inited) {\n this.removeData(removeCount, skipRaw);\n } else {\n if ($type.isNumber(removeCount)) {\n while (removeCount > 0) {\n this.data.shift();\n removeCount--;\n }\n }\n }\n\n this.invalidateData();\n };\n /**\r\n * Removes elements from the beginning of data\r\n *\r\n * @param count number of elements to remove\r\n */\n\n\n Component.prototype.removeData = function (count, skipRaw) {\n if ($type.isNumber(count) && count > 0) {\n while (count > 0) {\n var dataItem = this.mainDataSet.getIndex(0);\n\n if (dataItem) {\n this.mainDataSet.remove(dataItem);\n }\n\n this.dataUsers.each(function (dataUser) {\n if (!dataUser.data || dataUser.data.length == 0) {\n var dataItem_1 = dataUser.mainDataSet.getIndex(0);\n\n if (dataItem_1) {\n dataUser.mainDataSet.remove(dataItem_1);\n }\n }\n });\n\n if (!skipRaw) {\n this.data.shift();\n }\n\n if (this._parseDataFrom > 0) {\n this._parseDataFrom--;\n }\n\n count--;\n } // changed from invalidateData since 4.7.19 to solve #51551\n\n\n this.invalidateDataItems();\n }\n };\n /**\r\n * Triggers a data (re)parsing.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.invalidateData = function () {\n if (this.disabled || this.isTemplate) {\n return;\n } //if(!this.dataInvalid){\n\n\n registry.addToInvalidComponents(this);\n system.requestFrame();\n this.dataInvalid = true;\n $iter.each(this.dataUsers.iterator(), function (x) {\n x.invalidateDataItems();\n }); //}\n };\n /**\r\n * [invalidateDataUsers description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Component.prototype.invalidateDataUsers = function () {\n $iter.each(this.dataUsers.iterator(), function (x) {\n x.invalidate();\n });\n };\n /**\r\n * Invalidates data values. When data array is not changed, but values within\r\n * it changes, we invalidate data so that component would process changes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.invalidateDataItems = function () {\n if (this.disabled || this.isTemplate) {\n return;\n } //if(!this.dataItemsInvalid){\n\n\n $array.move(registry.invalidDataItems, this);\n system.requestFrame();\n this.dataItemsInvalid = true;\n $iter.each(this.dataUsers.iterator(), function (x) {\n x.invalidateDataItems();\n }); //}\n };\n /**\r\n * Invalidates data range. This is done when data which must be shown\r\n * changes (chart is zoomed for example).\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.invalidateDataRange = function () {\n if (this.disabled || this.isTemplate) {\n return;\n } //if(!this.dataRangeInvalid){\n\n\n this.dataRangeInvalid = true;\n $array.move(registry.invalidDataRange, this);\n system.requestFrame(); //}\n };\n /**\r\n * Processes data range.\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.validateDataRange = function () {\n $array.remove(registry.invalidDataRange, this);\n this.dataRangeInvalid = false;\n\n if (this.startIndex != this._prevStartIndex || this.endIndex != this._prevEndIndex) {\n this.rangeChangeUpdate();\n this.appendDataItems();\n this.invalidate();\n this.dispatchImmediately(\"datarangechanged\");\n }\n };\n /**\r\n * [sliceData description]\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.sliceData = function () {\n this._workingStartIndex = this.startIndex;\n this._workingEndIndex = this.endIndex;\n };\n /**\r\n * [rangeChangeUpdate description]\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.rangeChangeUpdate = function () {\n this.sliceData();\n this._prevStartIndex = this.startIndex;\n this._prevEndIndex = this.endIndex;\n };\n /**\r\n * [appendDataItems description]\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.appendDataItems = function () {\n // TODO use an iterator instead\n var count = this.endIndex;\n\n for (var i = this.startIndex; i < count; i++) {\n // data item\n var dataItem = this.dataItems.getIndex(i);\n\n if (dataItem) {\n dataItem.__disabled = false;\n }\n }\n\n for (var i = 0; i < this.startIndex; i++) {\n var dataItem = this.dataItems.getIndex(i);\n\n if (dataItem) {\n dataItem.__disabled = true;\n }\n }\n\n for (var i = this.endIndex; i < this.dataItems.length; i++) {\n var dataItem = this.dataItems.getIndex(i);\n\n if (dataItem) {\n dataItem.__disabled = true;\n }\n }\n };\n /**\r\n * If you want to have a smooth transition from one data values to another, you change your raw data and then you must call this method.\r\n * then instead of redrawing everything, the chart will check raw data and smoothly transit from previous to new data\r\n */\n\n\n Component.prototype.invalidateRawData = function () {\n if (this.disabled || this.isTemplate) {\n return;\n } //if(!this.rawDataInvalid){\n\n\n $array.move(registry.invalidRawDatas, this);\n system.requestFrame();\n this.rawDataInvalid = true;\n $iter.each(this.dataUsers.iterator(), function (x) {\n x.invalidateRawData();\n }); //}\n };\n /**\r\n * @ignore\r\n */\n\n\n Component.prototype.validateRawData = function () {\n var _this = this;\n\n $array.remove(registry.invalidRawDatas, this);\n $iter.each(this.mainDataSet.iterator(), function (dataItem) {\n if (dataItem) {\n _this.updateDataItem(dataItem);\n }\n });\n };\n /**\r\n * Destroys this object and all related data.\r\n */\n\n\n Component.prototype.dispose = function () {\n var _this = this;\n\n this.mainDataSet.template.clones.clear();\n $object.each(this._dataSources, function (key, source) {\n _this.removeDispose(source);\n });\n this.disposeData();\n\n _super.prototype.dispose.call(this);\n };\n /**\r\n * @ignore\r\n */\n\n\n Component.prototype.disposeData = function () {\n this.mainDataSet.template.clones.clear();\n $array.each(this._dataDisposers, function (x) {\n x.dispose();\n }); // and for all components\n\n $iter.each(this.dataUsers.iterator(), function (dataUser) {\n dataUser.disposeData();\n });\n this._dataDisposers.length = 0;\n this._startIndex = undefined;\n this._endIndex = undefined; // dispose old\n\n this.mainDataSet.clear();\n this.mainDataSet.template.clones.clear();\n\n if (this._dataSets) {\n this._dataSets.clear();\n }\n };\n\n Component.prototype.getDataItem = function (dataContext) {\n return this.mainDataSet.create();\n };\n /**\r\n * Validates (processes) data.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.validateData = function () {\n this.dispatchImmediately(\"beforedatavalidated\");\n this.dataInvalid = false;\n registry.removeFromInvalidComponents(this);\n\n if (this.__disabled) {\n return;\n }\n\n this.dataValidationProgress = 0; // need this to slice new data\n\n this._prevStartIndex = undefined;\n this._prevEndIndex = undefined; // todo: this needs some overthinking, maybe some extra settings like zoomOotonDataupdate like in v3 or so. some charts like pie chart probably should act like this always\n\n this._startIndex = undefined;\n this._endIndex = undefined;\n\n if (this.dataFields.data && this.dataItem) {\n var dataContext = this.dataItem.dataContext;\n this._data = dataContext[this.dataFields.data];\n } // data items array is reset only if all data is validated, if _parseDataFrom is not 0, we append new data only\n // check heatmap demo if uncommented\n // fixed both issues by adding && this.data.length > 0\n // check adding series example if changed\n\n\n if (this._parseDataFrom === 0 && this.data.length > 0) {\n this.disposeData();\n }\n\n if (this.data.length > 0) {\n var preloader = this.preloader; // and for all components\n\n $iter.each(this.dataUsers.iterator(), function (dataUser) {\n // todo: this needs some overthinking, maybe some extra settings like zoomOUtonDataupdate like in v3 or so. some charts like pie chart probably should act like this always\n dataUser._startIndex = undefined;\n dataUser._endIndex = undefined;\n });\n var counter = 0;\n var startTime = Date.now(); // parse data\n\n var i = this._parseDataFrom;\n var n = this.data.length;\n\n var _loop_1 = function _loop_1() {\n var rawDataItem = this_1.data[i];\n\n if (this_1._usesData) {\n var dataItem = this_1.getDataItem(rawDataItem);\n this_1.processDataItem(dataItem, rawDataItem);\n }\n\n this_1.dataUsers.each(function (dataUser) {\n if (dataUser.data.length == 0) {\n // checking if data is not set directly\n var dataUserDataItem = dataUser.getDataItem(rawDataItem);\n dataUser.processDataItem(dataUserDataItem, rawDataItem);\n }\n });\n counter++; // show preloader if this takes too many time\n\n if (counter == 100) {\n // no need to check it on each data item\n counter = 0;\n var elapsed = Date.now() - startTime;\n\n if (elapsed > this_1.parsingStepDuration) {\n if (i < this_1.data.length - 10) {\n this_1._parseDataFrom = i + 1; // update preloader\n\n if (preloader) {\n if (i / this_1.data.length > 0.5 && !preloader.visible) {// do not start showing\n } else {\n preloader.progress = i / this_1.data.length;\n }\n }\n\n this_1.dataValidationProgress = i / this_1.data.length;\n i = this_1.data.length; // stops cycle\n\n this_1.invalidateData();\n return {\n value: void 0\n };\n }\n }\n }\n };\n\n var this_1 = this;\n\n for (i; i < n; i++) {\n var state_1 = _loop_1();\n\n if (_typeof(state_1) === \"object\") return state_1.value;\n }\n\n if (preloader) {\n preloader.progress = 1;\n }\n\n this.dataUsers.each(function (dataUser) {\n if (dataUser.hidden) {\n dataUser.hide(0);\n }\n });\n }\n\n this.dataValidationProgress = 1;\n this._parseDataFrom = 0; // reset this index, it is set to dataItems.length if addData() method was used.\n\n this.invalidateDataItems();\n\n if (!this._internalDefaultsApplied) {\n this.applyInternalDefaults();\n }\n\n this.dispatch(\"datavalidated\"); // can't zoom chart if dispatched immediately\n };\n /**\r\n * Validates (processes) data items.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.validateDataItems = function () {\n $array.remove(registry.invalidDataItems, this);\n this.dataItemsInvalid = false;\n this.invalidateDataRange();\n this.invalidate();\n this.dispatch(\"dataitemsvalidated\");\n };\n\n Object.defineProperty(Component.prototype, \"data\", {\n /**\r\n * Returns element's source (raw) data.\r\n *\r\n * @return Data\r\n */\n get: function get() {\n if (!this._data) {\n this._data = [];\n }\n\n if (!this._adapterO) {\n return this._data;\n } else {\n return this._adapterO.apply(\"data\", this._data);\n }\n },\n\n /**\r\n * Sets source (raw) data for the element. The \"data\" is always an `Array`\r\n * of objects.\r\n *\r\n * IMPORTANT: The order of data items in `data` array is important as it\r\n * might affect chart look and behavior. [More details](https://www.amcharts.com/docs/v4/concepts/data/#Order_of_data_items).\r\n *\r\n * @param value Data\r\n */\n set: function set(value) {\n this.setData(value);\n },\n enumerable: true,\n configurable: true\n });\n\n Component.prototype.setData = function (value) {\n // array might be the same, but there might be items added\n // todo: check if array changed, toString maybe?\n if (!this.isDisposed()) {\n this._parseDataFrom = 0;\n this.disposeData();\n this._data = value;\n\n if (value && value.length > 0) {\n this.invalidateData();\n } else {\n this.dispatchImmediately(\"beforedatavalidated\");\n this.dispatch(\"datavalidated\");\n }\n }\n };\n /**\r\n * Returns (creates if necessary) a [[DataSource]] bound to any specific\r\n * property.\r\n *\r\n * For example if I want to bind `data` to an external JSON file, I'd create\r\n * a DataSource for it.\r\n *\r\n * @param property Property to bind external data to\r\n * @return A DataSource for property\r\n */\n\n\n Component.prototype.getDataSource = function (property) {\n var _this = this;\n\n if (!$type.hasValue(this._dataSources[property])) {\n this._dataSources[property] = new DataSource();\n this._dataSources[property].component = this;\n this.setDataSourceEvents(this._dataSources[property], property);\n\n this._dataSources[property].adapter.add(\"dateFields\", function (val) {\n return _this.dataSourceDateFields(val);\n });\n\n this._dataSources[property].adapter.add(\"numberFields\", function (val) {\n return _this.dataSourceNumberFields(val);\n });\n\n this.events.on(\"inited\", function () {\n _this.loadData(property);\n }, this, false);\n }\n\n return this._dataSources[property];\n };\n\n Object.defineProperty(Component.prototype, \"dataSource\", {\n /**\r\n * @return Data source\r\n */\n get: function get() {\n if (!this._dataSources[\"data\"]) {\n this.getDataSource(\"data\");\n }\n\n return this._dataSources[\"data\"];\n },\n\n /**\r\n *A [[DataSource]] to be used for loading Component's data.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/loading-external-data/} for more on loading external data\r\n * @param value Data source\r\n */\n set: function set(value) {\n var _this = this;\n\n if (this._dataSources[\"data\"]) {\n this.removeDispose(this._dataSources[\"data\"]);\n }\n\n this._dataSources[\"data\"] = value;\n this._dataSources[\"data\"].component = this;\n this.events.on(\"inited\", function () {\n _this.loadData(\"data\");\n }, this, false);\n this.setDataSourceEvents(value, \"data\");\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Initiates loading of the external data via [[DataSource]].\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Component.prototype.loadData = function (property) {\n this._dataSources[property].load();\n };\n /**\r\n * This function is called by the [[DataSource]]'s `dateFields` adapater\r\n * so that particular chart types can popuplate this setting with their\r\n * own type-specific data fields so they are parsed properly.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Array of date fields\r\n * @return Array of date fields populated with chart's date fields\r\n */\n\n\n Component.prototype.dataSourceDateFields = function (value) {\n return value;\n };\n /**\r\n * This function is called by the [[DataSource]]'s `numberFields` adapater\r\n * so that particular chart types can popuplate this setting with their\r\n * own type-specific data fields so they are parsed properly.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Array of number fields\r\n * @return Array of number fields populated with chart's number fields\r\n */\n\n\n Component.prototype.dataSourceNumberFields = function (value) {\n return value;\n };\n /**\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param list [description]\r\n * @param dataFields [description]\r\n * @param targetList [description]\r\n * @return [description]\r\n */\n\n\n Component.prototype.populateDataSourceFields = function (list, dataFields, targetList) {\n $array.each(targetList, function (value) {\n if (dataFields[value] && $array.indexOf(list, dataFields[value]) === -1) {\n list.push(dataFields[value]);\n }\n });\n return list;\n };\n /**\r\n * Sets events on a [[DataSource]].\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.setDataSourceEvents = function (ds, property) {\n var _this = this;\n\n ds.events.on(\"started\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 0; //preloader.label.text = this.language.translate(\"Loading\");\n }\n }, undefined, false);\n ds.events.on(\"loadstarted\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 0.25;\n }\n }, undefined, false);\n ds.events.on(\"loadended\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 0.5;\n }\n }, undefined, false);\n ds.events.on(\"parseended\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 0.75;\n }\n }, undefined, false);\n ds.events.on(\"ended\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 1;\n }\n }, undefined, false);\n ds.events.on(\"error\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 1;\n }\n\n _this.openModal(ev.message);\n }, undefined, false);\n\n if (property) {\n ds.events.on(\"done\", function (ev) {\n var preloader = _this.preloader;\n\n if (preloader) {\n preloader.progress = 1;\n }\n\n if (property == \"data\" && !$type.isArray(ev.data)) {\n ev.data = [ev.data];\n }\n\n if (ds.incremental && property == \"data\" && _this.data.length) {\n _this.addData(ev.data, ds.keepCount ? ev.data.length : 0);\n } else if (ds.updateCurrentData && property == \"data\" && _this.data.length) {\n // cycle through existing data items\n $array.each(_this.data, function (item, index) {\n if ($type.hasValue(ev.data[index])) {\n $object.each(item, function (key, val) {\n if ($type.hasValue(ev.data[index][key])) {\n item[key] = ev.data[index][key];\n }\n });\n }\n });\n\n _this.invalidateRawData();\n } else {\n _this[property] = ev.data;\n }\n });\n }\n };\n\n Object.defineProperty(Component.prototype, \"responsive\", {\n /**\r\n * @return Responsive rules handler\r\n */\n get: function get() {\n if (!this._responsive) {\n this._responsive = new Responsive();\n this._responsive.component = this;\n }\n\n return this._responsive;\n },\n\n /**\r\n * A [[Responsive]] instance to be used when applying conditional\r\n * property values.\r\n *\r\n * NOTE: Responsive features are currently in development and may not work\r\n * as expected, if at all.\r\n *\r\n * @param value Responsive rules handler\r\n */\n set: function set(value) {\n this._responsive = value;\n this._responsive.component = this;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets current zoom.\r\n *\r\n * The range uses relative values from 0 to 1, with 0 marking beginning and 1\r\n * marking end of the available data range.\r\n *\r\n * This method will not have any effect when called on a chart object.\r\n * Since the chart can have a number of axes and series, each with its own\r\n * data, the meaning of \"range\" is very ambiguous.\r\n *\r\n * To zoom the chart use `zoom*` methods on its respective axes.\r\n *\r\n * @param range Range\r\n * @param skipRangeEvent Should rangechanged event not be triggered?\r\n * @param instantly Do not animate?\r\n * @return Actual modidied range (taking `maxZoomFactor` into account)\r\n */\n\n Component.prototype.zoom = function (range, skipRangeEvent, instantly, declination) {\n var _this = this;\n\n if (skipRangeEvent === void 0) {\n skipRangeEvent = false;\n }\n\n if (instantly === void 0) {\n instantly = false;\n }\n\n var start = range.start;\n var end = range.end;\n var priority = range.priority;\n\n if (range.start == range.end) {\n range.start = range.start - 0.5 / this.maxZoomFactor;\n range.end = range.end + 0.5 / this.maxZoomFactor;\n }\n\n if (priority == \"end\" && end == 1 && start != 0) {\n if (start < this.start) {\n priority = \"start\";\n }\n }\n\n if (priority == \"start\" && start == 0) {\n if (end > this.end) {\n priority = \"end\";\n }\n }\n\n if (!$type.isNumber(declination)) {\n declination = this.maxZoomDeclination;\n }\n\n if (!$type.isNumber(start) || !$type.isNumber(end)) {\n return {\n start: this.start,\n end: this.end\n };\n }\n\n if (this._finalStart != start || this._finalEnd != end) {\n var maxZoomFactor = this.maxZoomFactor / this.minZoomCount;\n var minZoomFactor = this.maxZoomFactor / this.maxZoomCount; // most likely we are dragging left scrollbar grip here, so we tend to modify end\n\n if (priority == \"start\") {\n if (this.maxZoomCount > 0) {\n // add to the end\n if (1 / (end - start) < minZoomFactor) {\n end = start + 1 / minZoomFactor;\n }\n } // add to the end\n\n\n if (1 / (end - start) > maxZoomFactor) {\n end = start + 1 / maxZoomFactor;\n } //unless end is > 0\n\n\n if (end > 1 && end - start < 1 / maxZoomFactor) {\n //end = 1;\n start = end - 1 / maxZoomFactor;\n }\n } // most likely we are dragging right, so we modify left\n else {\n if (this.maxZoomCount > 0) {\n // add to the end\n if (1 / (end - start) < minZoomFactor) {\n start = end - 1 / minZoomFactor;\n }\n } // remove from start\n\n\n if (1 / (end - start) > maxZoomFactor) {\n start = end - 1 / maxZoomFactor;\n }\n\n if (start < 0 && end - start < 1 / maxZoomFactor) {\n //start = 0;\n end = start + 1 / maxZoomFactor;\n }\n }\n\n if (start < -declination) {\n start = -declination;\n }\n\n if (1 / (end - start) > maxZoomFactor) {\n end = start + 1 / maxZoomFactor;\n }\n\n if (end > 1 + declination) {\n end = 1 + declination;\n }\n\n if (1 / (end - start) > maxZoomFactor) {\n start = end - 1 / maxZoomFactor;\n }\n\n this._finalEnd = end;\n this._finalStart = start;\n this.skipRangeEvent = skipRangeEvent;\n this.dispatchImmediately(\"rangechangestarted\");\n\n if (this.rangeChangeDuration > 0 && !instantly) {\n // todo: maybe move this to Animation\n var rangeChangeAnimation = this.rangeChangeAnimation;\n\n if (rangeChangeAnimation && rangeChangeAnimation.progress < 1) {\n var options = rangeChangeAnimation.animationOptions;\n\n if (options.length > 1) {\n if (options[0].to == start && options[1].to == end) {\n return {\n start: start,\n end: end\n };\n } else {\n if (!rangeChangeAnimation.isDisposed()) {\n rangeChangeAnimation.stop();\n }\n }\n }\n }\n\n if (this.rangeChangeAnimation) {\n this.rangeChangeAnimation.kill();\n }\n\n rangeChangeAnimation = this.animate([{\n property: \"start\",\n to: start\n }, {\n property: \"end\",\n to: end\n }], this.rangeChangeDuration, this.rangeChangeEasing);\n this.rangeChangeAnimation = rangeChangeAnimation;\n\n if (rangeChangeAnimation && !rangeChangeAnimation.isFinished()) {\n rangeChangeAnimation.events.on(\"animationended\", function () {\n _this.dispatchImmediately(\"rangechangeended\");\n });\n } else {\n this.dispatchImmediately(\"rangechangeended\");\n }\n } else {\n this.start = start;\n this.end = end;\n this.dispatch(\"rangechangeended\");\n }\n }\n\n return {\n start: start,\n end: end\n };\n };\n /**\r\n * Zooms to specific data items using their index in data.\r\n *\r\n * This method will not have any effect when called on a chart object.\r\n * Since the chart can have a number of axes and series, each with its own\r\n * data, the meaning of \"index\" is very ambiguous.\r\n *\r\n * To zoom the chart use `zoom*` methods on its respective axes.\r\n *\r\n * @param startIndex Index of the starting data item\r\n * @param endIndex Index of the ending data item\r\n * @param skipRangeEvent Should rangechanged event not be triggered?\r\n * @param instantly Do not animate?\r\n */\n\n\n Component.prototype.zoomToIndexes = function (startIndex, endIndex, skipRangeEvent, instantly) {\n if (!$type.isNumber(startIndex) || !$type.isNumber(endIndex)) {\n return;\n }\n\n var start = startIndex / this.dataItems.length;\n var end = endIndex / this.dataItems.length;\n this.zoom({\n start: start,\n end: end\n }, skipRangeEvent, instantly);\n };\n\n Object.defineProperty(Component.prototype, \"zoomFactor\", {\n /**\r\n * A current zoom factor (0-1). 1 meaning fully zoomed out. (showing all of\r\n * the available data)\r\n *\r\n * @return Zoom factor\r\n */\n get: function get() {\n return $math.fitToRange(1 / (this.end - this.start), 1, this.maxZoomFactor);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"maxZoomFactor\", {\n /**\r\n * @return Maximum zoomFactor\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxZoomFactor\");\n },\n\n /**\r\n * Max available `zoomFactor`.\r\n *\r\n * The element will not allow zoom to occur beyond this factor.\r\n *\r\n * [[DateAxis]] and [[CategoryAxis]] calculate this atutomatically so that\r\n * category axis could be zoomed to one category and date axis allows to be\r\n * zoomed up to one base interval.\r\n *\r\n * In case you want to restrict category or date axis to be zoomed to more\r\n * than one category or more than one base interval, use `minZoomCount`\r\n * property (set it to `> 1`).\r\n *\r\n * Default value of [[ValueAxis]]'s `maxZoomFactor` is `1000`.\r\n *\r\n * Feel free to modify it to allow bigger zoom or to restrict zooming.\r\n *\r\n * @param value Maximum zoomFactor\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"maxZoomFactor\", value)) {\n if (value == 1) {\n this.maxZoomDeclination = 0;\n }\n\n this.invalidateDataRange();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"maxZoomDeclination\", {\n /**\r\n * @ignore\r\n * @return Maximum zoom declination\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxZoomDeclination\");\n },\n\n /**\r\n * Max zoom declination.\r\n *\r\n * @ignore\r\n * @default 1\r\n * @param value Maximum zoom declination\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"maxZoomDeclination\", value)) {\n this.invalidateDataRange();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"startIndex\", {\n /**\r\n * Current starting index.\r\n *\r\n * @return Start index\r\n */\n get: function get() {\n if (!$type.isNumber(this._startIndex)) {\n this._startIndex = 0;\n }\n\n return this._startIndex;\n },\n\n /**\r\n * Sets current starting index.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Start index\r\n */\n set: function set(value) {\n this._startIndex = $math.fitToRange(Math.round(value), 0, this.dataItems.length); //this._workingStartIndex = this._startIndex; // not good, breaks adjusted working start index of line series\n\n this.start = this.indexToPosition(this._startIndex);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n * @todo:review description\r\n * returns item's relative position by the index of the item\r\n * @param index\r\n */\n\n Component.prototype.indexToPosition = function (index) {\n return index / this.dataItems.length;\n };\n\n Object.defineProperty(Component.prototype, \"endIndex\", {\n /**\r\n * Current ending index.\r\n *\r\n * @return End index\r\n */\n get: function get() {\n var count = this.dataItems.length;\n\n if (!$type.isNumber(this._endIndex) || this._endIndex > count) {\n this._endIndex = count;\n }\n\n return this._endIndex;\n },\n\n /**\r\n * Sets current ending index.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value End index\r\n */\n set: function set(value) {\n this._endIndex = $math.fitToRange(Math.round(value), 0, this.dataItems.length); //this._workingEndIndex = this._endIndex; // not good, breaks adjusted workingend index of line series\n\n this.end = this.indexToPosition(this._endIndex);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"start\", {\n /**\r\n * @return Start (0-1)\r\n */\n get: function get() {\n if (!this._adapterO) {\n return this._start;\n } else {\n return this._adapterO.apply(\"start\", this._start);\n }\n },\n\n /**\r\n * Start of the current data range (zoom).\r\n *\r\n * These are relative values from 0 (beginning) to 1 (end).\r\n *\r\n * @param value Start (0-1)\r\n */\n set: function set(value) {\n // value = $math.round(value, 10); not good\n //if (1 / (this.end - value) > this.maxZoomFactor) {\n //\tvalue = this.end - 1 / this.maxZoomFactor;\n //}\n if (this._start != value) {\n this._start = value;\n var startIndex = Math.max(0, Math.floor(this.dataItems.length * value) || 0);\n this._startIndex = Math.min(startIndex, this.dataItems.length);\n this.invalidateDataRange();\n this.invalidate();\n this.dispatchImmediately(\"startchanged\");\n this.dispatch(\"startendchanged\");\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"end\", {\n /**\r\n * @return End (0-1)\r\n */\n get: function get() {\n if (!this._adapterO) {\n return this._end;\n } else {\n return this._adapterO.apply(\"end\", this._end);\n }\n },\n\n /**\r\n * End of the current data range (zoom).\r\n *\r\n * These are relative values from 0 (beginning) to 1 (end).\r\n *\r\n * @param value End (0-1)\r\n */\n set: function set(value) {\n // value = $math.round(value, 10); // not good\n //if (1 / (value - this.start) > this.maxZoomFactor) {\n //\tvalue = 1 / this.maxZoomFactor + this.start;\n //}\n if (this._end != value) {\n this._end = value;\n this._endIndex = Math.min(this.dataItems.length, Math.ceil(this.dataItems.length * value) || 0);\n this.invalidateDataRange();\n this.invalidate();\n this.dispatchImmediately(\"endchanged\");\n this.dispatch(\"startendchanged\");\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * [removeFromInvalids description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n Component.prototype.removeFromInvalids = function () {\n _super.prototype.removeFromInvalids.call(this);\n\n registry.removeFromInvalidComponents(this);\n $array.remove(registry.invalidDataItems, this);\n $array.remove(registry.invalidDataRange, this);\n $array.remove(registry.invalidRawDatas, this);\n };\n\n Object.defineProperty(Component.prototype, \"dataItems\", {\n /**\r\n * Returns a list of source [[DataItem]] objects currently used in the chart.\r\n *\r\n * @return List of data items\r\n */\n get: function get() {\n if (this._currentDataSetId != \"\") {\n var dataItems = this.dataSets.getKey(this._currentDataSetId);\n\n if (dataItems) {\n return dataItems;\n }\n }\n\n return this._dataItems;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"dataSets\", {\n /**\r\n * Holds data items for data sets (usually aggregated data).\r\n *\r\n * @ignore\r\n * @since 4.7.0\r\n * @return Data sets\r\n */\n get: function get() {\n if (!this._dataSets) {\n this._dataSets = new Dictionary();\n }\n\n return this._dataSets;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Makes the chart use particular data set.\r\n *\r\n * If `id` is not provided or there is no such data set, main data will be\r\n * used.\r\n *\r\n * @ignore\r\n * @since 4.7.0\r\n * @param id Data set id\r\n */\n\n Component.prototype.setDataSet = function (id) {\n if (this._currentDataSetId != id) {\n var dataSet = this.dataSets.getKey(id);\n\n if (!dataSet) {\n if (this._currentDataSetId != \"\") {\n this.dataItems.each(function (dataItem) {\n dataItem.__disabled = true;\n });\n this._currentDataSetId = \"\";\n this.invalidateDataRange();\n this._prevStartIndex = undefined;\n this.dataItems.each(function (dataItem) {\n dataItem.__disabled = false;\n });\n return true;\n }\n } else {\n this.dataItems.each(function (dataItem) {\n dataItem.__disabled = true;\n });\n this._currentDataSetId = id;\n this.invalidateDataRange();\n this._prevStartIndex = undefined;\n this.dataItems.each(function (dataItem) {\n dataItem.__disabled = false;\n });\n return true;\n }\n }\n\n return false;\n };\n\n Object.defineProperty(Component.prototype, \"currentDataSetId\", {\n /**\r\n * Returns id of the currently used data set, or `undefined` if main data set\r\n * is in use.\r\n *\r\n * @since 4.7.0\r\n * @return Current data set id\r\n */\n get: function get() {\n return this._currentDataSetId;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"mainDataSet\", {\n /**\r\n * Returns reference to \"main\" data set (unaggregated data as it was supplied\r\n * in `data`).\r\n *\r\n * @since 4.7.0\r\n * @return Main data set\r\n */\n get: function get() {\n return this._dataItems;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates the indexes for the dataItems\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Component.prototype._updateDataItemIndexes = function (startIndex) {\n var dataItems = this.mainDataSet.values;\n var length = dataItems.length;\n\n for (var i = startIndex; i < length; ++i) {\n dataItems[i]._index = i;\n }\n };\n /**\r\n * Processes newly added [[DataItem]] as well as triggers data re-validation.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event [description]\r\n */\n\n\n Component.prototype.handleDataItemAdded = function (event) {\n event.newValue.component = this;\n\n this._updateDataItemIndexes(event.index);\n\n if (!this.dataItemsInvalid) {\n this.invalidateDataItems();\n }\n };\n /**\r\n * removes [[DataItem]] as well as triggers data re-validation.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event [description]\r\n */\n\n\n Component.prototype.handleDataItemRemoved = function (event) {\n //\t\tevent.oldValue.component = undefined; // not good, as some items might be not removed from component lists\n this._updateDataItemIndexes(event.index);\n\n if (!this.dataItemsInvalid) {\n this.invalidateDataItems();\n }\n };\n /**\r\n * Binds a data element's field to a specific field in raw data.\r\n * For example, for the very basic column chart you'd want to bind a `value`\r\n * field to a field in data, such as `price`.\r\n *\r\n * Some more advanced Components, like [[CandlestickSeries]] need several\r\n * data fields bound to data, such as ones for open, high, low and close\r\n * values.\r\n *\r\n * @todo Example\r\n * @param field Field name\r\n * @param value Field name in data\r\n */\n\n\n Component.prototype.bindDataField = function (field, value) {\n this.dataFields[field] = value;\n this.invalidateDataRange();\n };\n /**\r\n * Invalidates processed data.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Component.prototype.invalidateProcessedData = function () {\n this.resetProcessedRange();\n this.invalidateDataRange();\n };\n /**\r\n * [resetProcessedRange description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Component.prototype.resetProcessedRange = function () {\n this._prevEndIndex = null;\n this._prevStartIndex = null;\n };\n\n Object.defineProperty(Component.prototype, \"dataUsers\", {\n /**\r\n * Returns all other [[Component]] objects that are using this element's\r\n * data.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @return [description]\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._dataUsers) {\n this._dataUsers = new List(); //this._disposers.push(new ListDisposer(this._dataUsers));\n // TODO better way of handling this? e.g. move into another module ?\n\n this._disposers.push(new Disposer(function () {\n // TODO clear the list ?\n $iter.each(_this._dataUsers.iterator(), function (x) {\n x.dispose();\n });\n }));\n }\n\n return this._dataUsers;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a clone of this element.\r\n *\r\n * @return Clone\r\n */\n\n Component.prototype.clone = function () {\n var component = _super.prototype.clone.call(this);\n\n component.dataFields = $utils.copyProperties(this.dataFields, {});\n return component;\n };\n /**\r\n * Copies all parameters from another [[Component]].\r\n *\r\n * @param source Source Component\r\n */\n\n\n Component.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.data = source.data;\n this.sequencedInterpolation = source.sequencedInterpolation;\n this.sequencedInterpolationDelay = source.sequencedInterpolationDelay;\n this.interpolationDuration = source.interpolationDuration;\n this.interpolationEasing = source.interpolationEasing;\n };\n /**\r\n * Invalidates the whole element, including all its children, causing\r\n * complete re-parsing of data and redraw.\r\n *\r\n * Use sparingly!\r\n */\n\n\n Component.prototype.reinit = function () {\n this._inited = false;\n this.deepInvalidate();\n };\n /**\r\n * Add an adapter for data.\r\n *\r\n * @return Exporting\r\n */\n\n\n Component.prototype.getExporting = function () {\n var _export = _super.prototype.getExporting.call(this);\n\n if (!_export.adapter.has(\"data\", this._exportData, -1, this)) {\n _export.adapter.add(\"data\", this._exportData, -1, this);\n\n this.events.on(\"datavalidated\", function (ev) {\n _export.handleDataUpdated();\n });\n }\n\n return _export;\n };\n\n Component.prototype._exportData = function (arg) {\n arg.data = this.data;\n return arg;\n };\n\n Component.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (changed) {\n this.invalidateData();\n }\n\n return changed;\n };\n /**\r\n * @ignore\r\n */\n\n\n Component.prototype.setShowOnInit = function (value) {\n if (value != this.getPropertyValue(\"showOnInit\")) {\n if (value && !this.inited && !this.hidden) {\n this._showOnInitDisposer2 = this.events.once(\"dataitemsvalidated\", this.hideInitially, this, false);\n\n this._disposers.push(this._showOnInitDisposer2);\n } else {\n if (this._showOnInitDisposer2) {\n this.removeDispose(this._showOnInitDisposer2);\n }\n }\n } // important order here\n\n\n _super.prototype.setShowOnInit.call(this, value);\n };\n\n Component.prototype.setBaseId = function (value) {\n if (value != this._baseId) {\n if (this.dataInvalid) {\n this.dataInvalid = false;\n registry.removeFromInvalidComponents(this);\n this._baseId = value;\n this.invalidateData();\n }\n }\n\n _super.prototype.setBaseId.call(this, value);\n };\n\n Object.defineProperty(Component.prototype, \"minZoomCount\", {\n /**\r\n * @return Min zoom count\r\n */\n get: function get() {\n return this.getPropertyValue(\"minZoomCount\");\n },\n\n /**\r\n * Use this for [[CategoryAxis]] or [[DateAxis]].\r\n *\r\n * Allows restricting zoom in beyond certain number of categories or base\r\n * intervals.\r\n *\r\n * @default 1\r\n * @param value Min zoom count\r\n */\n set: function set(value) {\n this.setPropertyValue(\"minZoomCount\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Component.prototype, \"maxZoomCount\", {\n /**\r\n * @return Max zoom count\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxZoomCount\");\n },\n\n /**\r\n * Use this for [[CategoryAxis]] or [[DateAxis]].\r\n *\r\n * Limits how many categories or base intervals can be shown at the same\r\n * time.\r\n *\r\n * If there are more items in the chart, the chart will auto-zoom.\r\n *\r\n * @default 0 (no limit)\r\n * @since 4.6.2\r\n * @param value Max zoom count\r\n */\n set: function set(value) {\n this.setPropertyValue(\"maxZoomCount\", value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Called during the System.update method\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Component.prototype._systemCheckIfValidate = function () {\n if (this.dataInvalid || this.dataProvider && this.dataProvider.dataInvalid) {\n return false;\n } else {\n return true;\n }\n };\n /**\r\n * Adds easing functions to \"function\" fields.\r\n *\r\n * @param field Field name\r\n * @return Assign as function?\r\n */\n\n\n Component.prototype.asFunction = function (field) {\n return field == \"interpolationEasing\" || field == \"rangeChangeEasing\" || _super.prototype.asIs.call(this, field);\n };\n\n return Component;\n}(Container);\n\nexport { Component };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Component\"] = Component;","/**\r\n * Text class deals with all text placed on chart.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { registry } from \"../Registry\";\nimport { getTextFormatter } from \"../formatters/TextFormatter\";\nimport { MultiDisposer } from \"../utils/Disposer\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport * as $math from \"../utils/Math\";\nimport * as $utils from \"../utils/Utils\";\nimport * as $type from \"../utils/Type\";\nimport * as $dom from \"../utils/DOM\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../utils/Responsive\";\nimport { options } from \"../Options\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Text is used to display highly configurable, data-enabled textual elements.\r\n *\r\n * ## Data Binding\r\n *\r\n * A Text element can dynamically parse and populate its contents with values\r\n * from a [[DataItem]].\r\n *\r\n * To activate such binding, set element's `dataItem` property.\r\n *\r\n * When activated, text contents will be parsed for special tags, e.g.:\r\n *\r\n * ```TypeScript\r\n * label.dataItem = myDataItem;\r\n * label.text = \"The title is: {title}\";\r\n * ```\r\n * ```JavaScript\r\n * label.dataItem = myDataItem;\r\n * label.text = \"The title is: {title}\";\r\n * ```\r\n *\r\n * The above will automatically replace \"{title}\" in the string with the\r\n * actual data value from `myDataItem`.\r\n *\r\n * Note, that most often dataItem is set by the Component.\r\n *\r\n *\r\n * @see {@link ILabelEvents} for a list of available events\r\n * @see {@link ILabelAdapters} for a list of available Adapters\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/formatters/formatting-strings/} for info on string formatting and data binding\r\n * @todo Vertical align\r\n * @important\r\n */\n\nvar Label =\n/** @class */\nfunction (_super) {\n __extends(Label, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Label() {\n var _this = // Execute super's constructor\n _super.call(this) || this;\n /**\r\n * Indicates if the whole text does not fit into max dimenstions set for it.\r\n */\n\n\n _this.isOversized = false; // Set this class name\n\n _this.className = \"Label\";\n _this.fill = new InterfaceColorSet().getFor(\"text\"); // not good to set this, as then these will appear on each label and values set on container won't be applied.\n //this.textDecoration = \"none\";\n //this.fontWeight = \"normal\";\n // Set defaults\n\n _this.wrap = false;\n _this.truncate = false;\n _this.fullWords = true;\n _this.ellipsis = \"…\";\n _this.textAlign = \"start\";\n _this.textValign = \"top\";\n _this.layout = \"absolute\";\n _this.baseLineRatio = -0.27; //this.pixelPerfect = true;\n\n _this._positionPrecision = 1; // Add events to watch for maxWidth/maxHeight changes so that we can\n // invalidate this\n\n _this.events.on(\"maxsizechanged\", function () {\n if (_this.inited) {\n _this.handleMaxSize();\n }\n }, _this, false); // this solves strange bug when text just added to svg is 0x0\n\n\n _this.events.once(\"validated\", _this.handleValidate, _this, false); // Aply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * A placeholder method that is called **after** element finishes drawing\r\n * itself.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Label.prototype.afterDraw = function () {\n // since we removed validatePosition from sprite, we still need it here to handle rotated text\n _super.prototype.afterDraw.call(this);\n\n this.validatePosition();\n };\n /**\r\n * Sets [[Paper]] instance to use to draw elements.\r\n * @ignore\r\n * @param paper Paper\r\n * @return true if paper was changed, false, if it's the same\r\n */\n\n\n Label.prototype.setPaper = function (paper) {\n var changed = _super.prototype.setPaper.call(this, paper);\n\n if (changed) {\n this.hardInvalidate();\n }\n\n return changed;\n };\n /**\r\n * @ignore\r\n */\n\n\n Label.prototype.handleValidate = function () {\n if ((this.currentText || this.text) && (this.bbox.width == 0 || this.bbox.height == 0)) {\n registry.events.once(\"exitframe\", this.hardInvalidate, this);\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n Label.prototype.handleMaxSize = function () {\n if (this.bbox.width > this.availableWidth || this.bbox.width < this.availableWidth && (this.isOversized || this.truncate) || this.bbox.height > this.availableHeight || this.bbox.height < this.availableHeight && this.isOversized) {\n this.invalidate();\n } else {//this.alignSVGText();\n }\n };\n /**\r\n * [arrange description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Label.prototype.arrange = function () {};\n /**\r\n * Updates current text according to data item and supported features.\r\n * Returns `true` if current text has changed.\r\n *\r\n * @return Text changed?\r\n */\n\n\n Label.prototype.updateCurrentText = function () {\n // Determine output format\n var output, text;\n\n if ($utils.isNotEmpty(this.html) && this.paper.supportsForeignObject()) {\n // We favor HTML text if it's set and browser supports `foreignObject`\n output = \"html\";\n text = this.html;\n } else {\n output = \"svg\";\n text = this.text;\n } // Need to toString source?\n\n\n if ($type.isObject(text)) {\n text = text.toString();\n } // Need to format text all the time\n\n\n if ($type.hasValue(text) && text !== \"\") {\n text = this.populateString(text, this.dataItem);\n }\n\n if (output == \"html\") {\n if (this._adapterO) {\n text = this._adapterO.apply(\"htmlOutput\", text);\n }\n } else {\n if (this._adapterO) {\n text = this._adapterO.apply(\"textOutput\", text);\n }\n } // Update the text\n\n\n var changed = text != this.currentText || output != this._currentFormat;\n this.currentText = text;\n this._currentFormat = output;\n return changed;\n };\n /**\r\n * Hard invalidate means the text will be redrawn even if it hasn't changed.\r\n * This is used when we change `fontSize`, `fontFamily`, or for some other\r\n * reasons.\r\n */\n\n\n Label.prototype.hardInvalidate = function () {\n this._prevStatus = \"\";\n this.invalidate();\n };\n /**\r\n * Gets line bbox, uses caching to save cpu\r\n * @ignore\r\n */\n\n\n Label.prototype.getLineBBox = function (lineInfo) {\n //let cacheKey = lineInfo.text + lineInfo.style;\n //let lineBBox = this.getCache(cacheKey);\n //if (!lineBBox) {\n //lineBBox = lineInfo.element.getBBox();\n //if (lineBBox.width != 0 && lineBBox.height != 0) {\n //\tthis.setCache(cacheKey, lineBBox, 5000);\n //}\n //}\n var element = lineInfo && lineInfo.element;\n var node = element && element.node; // Check for the parent Node to avoid FF from throwing errors\n\n if (node && node.parentNode) {\n lineInfo.bbox = element.getBBox();\n }\n };\n /**\r\n * Draws the textual label.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Label.prototype.draw = function () {\n // Draw super\n _super.prototype.draw.call(this);\n\n var oldW = this.bbox.width;\n var oldH = this.bbox.height;\n var topParent = this.topParent;\n\n if (topParent) {\n if (!topParent.maxWidth || !topParent.maxHeight) {\n topParent.events.once(\"maxsizechanged\", this.hardInvalidate, this, false);\n return;\n }\n } // Calculate max width and height\n\n\n var maxWidth = $math.max(this.availableWidth - this.pixelPaddingLeft - this.pixelPaddingRight, 0);\n var maxHeight = $math.max(this.availableHeight - this.pixelPaddingTop - this.pixelPaddingBottom, 0); // save\n\n var status = maxHeight + \",\" + maxWidth + this.wrap + this.truncate + this.fullWords + this.rtl + this.ellipsis; // Update text\n\n if (!this.updateCurrentText() && this.inited && this._prevStatus == status) {\n return;\n }\n\n this._measuredWidth = 0;\n this._measuredHeight = 0; // Reset\n\n this.isOversized = false; // Determine output format\n\n var output = this._currentFormat;\n var text = this.currentText; // Empty string\n\n if (!$type.hasValue(text) || text == \"\") {\n this.element.attr({\n display: \"none\"\n });\n return;\n } // Chop up text into lines\n // We're still processing SVG and HTML in the same way for now\n\n\n var lines = text.split(\"\\n\"); // Do we need to go through the trouble of measuring lines\n //let measure: boolean = true;// (lines.length > 1) || this.wrap;\n\n this._prevStatus = status;\n this.textAlign = this.textAlign; // need this to measure\n\n var display = this.group.getAttr(\"display\");\n\n if (display == \"none\") {\n this.group.removeAttr(\"display\");\n }\n\n if (this.textPathElement) {\n this.textPathElement.removeChildren();\n } // SVG or HTML?\n\n\n if (output === \"svg\") {\n /**\r\n * SVG\r\n */\n this.element.removeAttr(\"display\"); // Clear the element\n\n var group = this.element;\n this.resetBBox(); // Init state variables\n\n var currentHeight = 0;\n var currentFormat = \"\"; // Process each line\n\n for (var i = 0; i < lines.length; i++) {\n // Get line\n var line = lines[i]; // Check if line is empty\n\n if (line == \"\") {\n // It is, let's just update currentHeight and go to the next one\n // If it's the first line, we'll have to use arbirary line height,\n // since there's nothing to measure. For subsequent lines we can take\n // previous line's height\n var tempElement = this.getSVGLineElement(\"\", 0);\n tempElement.add(this.getSvgElement(\".\", getTextFormatter().translateStyleShortcuts(currentFormat)));\n group.add(tempElement);\n var offset = Math.ceil(tempElement.getBBox().height);\n\n if (offset > 0) {\n currentHeight += offset;\n }\n\n group.removeElement(tempElement); // Clear cache if necessary\n\n var lineInfo_1 = this.getLineInfo(i);\n\n if (lineInfo_1) {\n lineInfo_1.text = \"\";\n lineInfo_1.element.textContent = \"\";\n }\n\n continue;\n } // Chunk up the line and process each chunk\n\n\n var chunks = getTextFormatter().chunk(line, null, this.ignoreFormatting);\n var currentLineHeight = 0;\n var firstChunk = true;\n var skipTextChunks = false; // Create line element or grab it from cache\n\n var lineInfo = this.getLineInfo(i);\n\n if (lineInfo) {\n // Empty line\n lineInfo.text = \"\";\n lineInfo.element.textContent = \"\";\n } else {\n // Init new line info\n lineInfo = {\n \"text\": \"\",\n \"element\": this.getSVGLineElement(\"\", 0),\n \"complex\": false\n }; // Create the line element\n //lineInfo.element = this.getSVGLineElement(\"\", 0);\n //lineElement = this.getSVGLineElement(\"\", 0);\n\n group.add(lineInfo.element);\n }\n\n lineInfo.element.removeAttr(\"display\");\n lineInfo.element.removeChildren(); // memory leak without this\n\n if (this.textPathElement) {\n lineInfo.element.add(this.textPathElement);\n }\n /*// @todo not needed anymore\r\n if (this.rtl) {\r\n chunks.reverse();\r\n }*/\n // Process each chunk\n\n\n for (var x = 0; x < chunks.length; x++) {\n // If there's more than one chunk, means the line is \"complex\"\n if (x) {\n lineInfo.complex = true;\n } // Get chunk\n\n\n var chunk = chunks[x]; // Is this chunk format or text?\n\n if (chunk.type === \"format\") {\n // Log current format, so that we can apply it to multiple lines if\n // necessary\n currentFormat = chunk.text;\n } else {\n // It's text block\n // Need to skip?\n // We do this when truncating. We can't just simply go ahead and\n // abandon chunk processing as they might have formatting\n // instructions in them that are relevant for subsequent lines\n if (skipTextChunks) {\n continue;\n } // Add chunk to the current element\n //lineInfo.element.content += $utils.trim(getTextFormatter().format(currentFormat + chunk.text, output));\n\n\n lineInfo.text = chunk.text;\n lineInfo.style = getTextFormatter().translateStyleShortcuts(currentFormat);\n\n if (this.textPathElement) {\n this.getSvgElement(lineInfo.text, lineInfo.style, this.textPathElement);\n } else {\n this.getSvgElement(lineInfo.text, lineInfo.style, lineInfo.element);\n }\n\n this.getLineBBox(lineInfo);\n lineInfo.bbox.width = Math.ceil(lineInfo.bbox.width); // Updated current line height\n\n if (currentLineHeight < lineInfo.bbox.height) {\n currentLineHeight = lineInfo.bbox.height;\n } // Wrapping?\n\n\n if ((this.wrap || this.truncate) && lineInfo.bbox.width > maxWidth) {\n // Set oversized\n this.isOversized = true; // Take temporary measurements\n\n var lineText = lineInfo.element.textContent;\n var avgCharWidth = lineInfo.bbox.width / lineText.length; // * .9;\n // Calculate average number of symbols / width\n\n var excessChars = $math.min(Math.ceil((lineInfo.bbox.width - maxWidth) / avgCharWidth), lineText.length); // Are we truncating or auto-wrapping text?\n\n if (this.truncate) {\n /**\r\n * Processing line truncation\r\n * With the addition of each text chunk we measure if current\r\n * line does not exceed maxWidth. If it does, we will stop\r\n * addition of further chunks as well as try to truncate\r\n * current or any number of previous chunks with an added\r\n * ellipsis\r\n */\n // Indicator whether we need to add ellipsis to the current\n // element, even if it fits. This is needed to indicate\n // whether we have already removed some subsequent chunks in\n // which case we need to add ellipsis.\n var addEllipsis = false; // Process each child in the temporary line, until the whole\n // line fits, preferably with an ellipsis\n // TODO use iterator instead\n\n var node_1 = lineInfo.element.node;\n\n if (node_1 && node_1.childNodes) {\n for (var e = lineInfo.element.node.childNodes.length - 1; e >= 0; e--) {\n // Get current element\n var node_2 = lineInfo.element.node.childNodes[e]; // Add ellipsis only if previous chunk was removed in full\n // and this chunk already fits\n //if (addEllipsis && (bbox.width <= maxWidth)) {\n\n if (addEllipsis && lineInfo.bbox.width <= maxWidth) {\n // Add ellipsis\n node_2.textContent += \" \" + this.ellipsis; // Measure again (we need to make sure ellipsis fits)\n\n lineInfo.bbox = lineInfo.element.getBBox();\n lineInfo.bbox.width = Math.floor(lineInfo.bbox.width); // If it fits, we're done here\n // If it doesn't we continue rolling\n\n if (lineInfo.bbox.width <= maxWidth) {\n break;\n }\n }\n\n addEllipsis = false; // Get element text\n\n var elementText = node_2.textContent; // Calculate average number of symbols / width\n\n lineText = lineInfo.element.textContent;\n excessChars = $math.min(Math.ceil((lineInfo.bbox.width - maxWidth) / avgCharWidth), lineText.length); // Do this until we fit\n\n while (lineInfo.bbox.width > maxWidth && excessChars <= lineText.length && excessChars > 0) {\n // Calculate max available chars\n var maxChars = $math.max(lineText.length - excessChars - this.ellipsis.length, 1); // Is there anything left?\n\n if (maxChars <= 1) {\n // Nope, let's jump to the previous item\n // Set excess characters to zero so that this loop does\n // not repeat when it over\n excessChars = 0; // Add ellipsis to previous item\n // Subsequent iterations will check if the ellipsis fits\n\n if (e > 0) {\n // Indicating to add ellipsis to previous item\n addEllipsis = true; // Removing this node\n\n lineInfo.element.node.removeChild(node_2);\n }\n } // Truncate the text\n\n\n elementText = $utils.truncateWithEllipsis(elementText, maxChars, this.ellipsis, this.fullWords, this.rtl);\n\n if (elementText.length > maxChars && this.fullWords) {\n // Still too long?\n // Let's try truncating breaking words anyway\n elementText = $utils.truncateWithEllipsis(elementText, maxChars, this.ellipsis, false, this.rtl);\n } // Set truncated text\n\n\n node_2.textContent = elementText; // Measure again\n\n lineInfo.bbox = lineInfo.element.getBBox();\n lineInfo.bbox.width = Math.floor(lineInfo.bbox.width); // Increase excess characters count, just in case it still\n // doesn't fit and we have to go at it again\n\n excessChars = Math.ceil(excessChars * 1.1);\n } // Do not process further chunks\n\n\n skipTextChunks = true;\n }\n }\n } else {\n /**\r\n * Processign auto-wrap\r\n * In this case we're going to be adding text chunks until\r\n * they don't fit into current line. Once that happens we will\r\n * inject the rest of the chunks to the next line\r\n */\n // Get last node added and measure it\n var node_3 = lineInfo.element.node;\n\n if (node_3) {\n var lastNode = lineInfo.element.node.lastChild; // Init split lines\n\n var splitLines = void 0;\n\n while (lineInfo.bbox.width > maxWidth && excessChars <= lineText.length && excessChars > 0) {\n // Calculate max available chars\n var maxChars = $math.max(chunk.text.length - excessChars, 1); // Don't split the words mid-word if it's not the first chunk\n // in the line\n\n if (firstChunk) {\n // Split mid-word if necessary\n splitLines = $utils.splitTextByCharCount(chunk.text, maxChars, true, this.rtl);\n } else {\n // Don't split mid-word\n splitLines = $utils.splitTextByCharCount(chunk.text, maxChars, true, this.rtl, false); // Check if the first word is too long\n\n if (splitLines[0].length > maxChars || maxChars === 1) {\n // Yes - move the whole chunk to the next line\n // Remove the element we just added\n lineInfo.element.node.removeChild(lastNode); // Break out of the while on next cycle\n\n excessChars = 0;\n }\n } // Use the first line to update last item\n\n\n if (excessChars > 0) {\n var lineText_1 = splitLines.shift();\n\n if (firstChunk) {\n lineText_1 = $utils.trim(lineText_1);\n }\n\n lastNode.textContent = getTextFormatter().cleanUp(lineText_1);\n } // Measure again, just in case\n\n\n lineInfo.bbox = lineInfo.element.getBBox();\n lineInfo.bbox.width = Math.floor(lineInfo.bbox.width); // Increase excess characters count, just in case it still\n // doesn't fit and we have to go at it again\n //excessChars = Math.ceil(excessChars * 1.05);\n\n excessChars++;\n } // Construct the rest of the line\n\n\n if (splitLines.length > 0) {\n var restOfLine = \"\"; // Add leftovers from splitting the current chunk\n\n if ($type.hasValue(splitLines)) {\n if (this.rtl) {\n restOfLine += splitLines.join(\"\") + currentFormat;\n } else {\n restOfLine += currentFormat + splitLines.join(\"\").replace(/([\\[\\]]{1})/g, \"$1$1\");\n }\n } // Add the rest of the chunks\n\n\n for (var c = x + 1; c < chunks.length; c++) {\n if (chunks[c].type == \"value\") {\n // We're escaping single square brackets that were\n // cleaned up by chunk() back to double square brackets\n // so that they are not being treated as format on\n // next pass.\n restOfLine += chunks[c].text.replace(/([\\[\\]]{1})/g, \"$1$1\");\n } else {\n restOfLine += chunks[c].text;\n }\n } // Inject the rest of the lines as chunks for subsequent\n\n\n lines.splice(i + 1, 0, restOfLine);\n } // Skip processing the rest of the chunks\n\n\n skipTextChunks = true;\n }\n }\n } // Let's update the text's bbox with the line's one\n\n\n if (this.bbox.width < lineInfo.bbox.width) {\n this.bbox.width = lineInfo.bbox.width;\n } // commented to avoid bug (seen on sankey link) where text is incorrectly aligned\n //if (this.bbox.x > lineInfo.bbox.x) {\n //this.bbox.x = lineInfo.bbox.x;\n //}\n\n\n this.bbox.height = currentHeight + currentLineHeight; // Position current line\n\n if (!this.textPathElement) {\n lineInfo.element.attr({\n \"x\": \"0\",\n \"y\": currentHeight + currentLineHeight,\n \"dy\": $math.round(this.baseLineRatio * currentLineHeight, 3).toString()\n });\n } else {\n lineInfo.element.attr({\n \"dy\": -this.paddingBottom.toString()\n });\n }\n\n firstChunk = false;\n }\n } // Trim the last item\n\n\n var node = lineInfo.element.node;\n\n if (node) {\n var lastNode = node.lastChild;\n\n if (lastNode) {\n lastNode.textContent = this.rtl ? $utils.ltrim(lastNode.textContent) : $utils.rtrim(lastNode.textContent);\n }\n } // Increment collective height\n\n\n currentHeight += currentLineHeight; // Save line cache\n\n this.addLineInfo(lineInfo, i);\n } // Check if maybe we need to hide the whole label if it doesn't fit\n\n\n this.maybeHideOversized();\n this.measureFailed = false;\n\n if (this.bbox.width == 0 || this.bbox.height == 0) {\n this.measureFailed = true;\n } // Updated measured dims\n\n\n this._measuredWidth = $math.round($math.max(this.bbox.width, this.pixelWidth - this.pixelPaddingLeft - this.pixelPaddingRight));\n this._measuredHeight = $math.round($math.max(this.bbox.height, this.pixelHeight - this.pixelPaddingTop - this.pixelPaddingBottom)); // Align the lines\n\n this.alignSVGText();\n this.bbox.width = this._measuredWidth;\n this.bbox.height = this._measuredHeight;\n\n if (oldH != this._measuredHeight || oldW != this._measuredWidth) {\n this.dispatch(\"transformed\");\n }\n\n this.hideUnused(lines.length);\n } else {\n /**\r\n * HTML\r\n */\n this.element.removeAttr(\"display\");\n this.resetBBox(); // Clear the element\n\n var group = this.element;\n group.removeChildren(); // Create a ForeignObject to use as HTML container\n\n var fo = this.paper.foreignObject();\n group.add(fo); // Set widths on foreignObject so that autosizing measurements work\n // This will bet reset to actual content width/height\n\n if (this.maxWidth) {\n fo.attr({\n width: this.maxWidth - this.pixelPaddingLeft - this.pixelPaddingRight\n });\n }\n\n if (this.maxHeight) {\n fo.attr({\n height: this.maxHeight - this.pixelPaddingTop - this.pixelPaddingBottom\n });\n } // Create line element\n //let lineElement: HTMLElement = this.getHTMLLineElement(getTextFormatter().format(this.html, output));\n\n\n var lineElement = this.getHTMLLineElement(text);\n fo.node.appendChild(lineElement); // Temporarily set to inline-block so we can measure real width and height\n\n lineElement.style.display = \"inline-block\";\n var clientWidth = lineElement.clientWidth;\n var clientHeight = lineElement.clientHeight;\n lineElement.style.display = \"block\";\n this._bbox = {\n x: 0,\n y: 0,\n width: clientWidth,\n height: clientHeight\n }; // Set exact dimensions of foreignObject so it is sized exactly as\n // the content within (add one pixel to width so it does not wrap)\n\n fo.attr({\n width: clientWidth + 1,\n height: clientHeight\n }); // Check if maybe we need to hide the whole label if it doesn't fit\n\n this.maybeHideOversized(); // Set measurements and update bbox\n\n this._measuredWidth = $math.max(this.bbox.width, this.pixelWidth - this.pixelPaddingLeft - this.pixelPaddingRight);\n this._measuredHeight = $math.max(this.bbox.height, this.pixelHeight - this.pixelPaddingTop - this.pixelPaddingBottom);\n this.bbox.width = this._measuredWidth;\n this.bbox.height = this._measuredHeight; // Don't let labels bleed out of the alotted area\n\n if (this.truncate) {\n lineElement.style.overflow = \"hidden\";\n }\n\n if (clientWidth > maxWidth || clientHeight > maxHeight) {\n this.isOversized = true;\n }\n } // Set applicable styles\n\n\n this.setStyles();\n this.updateCenter();\n this.updateBackground();\n\n if (display == \"none\") {\n this.group.attr({\n display: \"none\"\n });\n }\n\n if (this.pathElement) {\n this.paper.appendDef(this.pathElement);\n }\n };\n /**\r\n * Hides element if it does not fit into available space\r\n */\n\n\n Label.prototype.maybeHideOversized = function () {\n if (this.hideOversized) {\n if (this.availableWidth < this.bbox.width || this.availableHeight < this.bbox.height) {\n this.element.attr({\n display: \"none\"\n });\n this.isOversized = true;\n } else {\n this.element.removeAttr(\"display\");\n this.isOversized = false;\n }\n }\n };\n /**\r\n * Aligns the lines horizontally and vertically, based on properties.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Label.prototype.alignSVGText = function () {\n // Get Group\n var group = this.element;\n var children = group.node.children || group.node.childNodes; // Is there anything to align?\n\n if (!children || children && children.length == 0) {\n return;\n }\n\n var width = this._measuredWidth;\n var height = this._measuredHeight; // TODO maybe these aren't needed ?\n\n $utils.used(this.pixelPaddingLeft);\n $utils.used(this.pixelPaddingRight);\n $utils.used(this.pixelPaddingTop);\n $utils.used(this.pixelPaddingBottom);\n\n if (this.rtl) {\n group.attr({\n \"direction\": \"rtl\"\n });\n } else {\n group.removeAttr(\"direction\");\n } // Process each line\n //$iter.each(group.children.backwards().iterator(), (element) => {\n\n\n for (var i = children.length - 1; i >= 0; i--) {\n // Align horizontally\n // Since we are using `text-anchor` for horizontal alignment, all we need\n // to do here is move the `x` position\n var node = children[i];\n node.setAttribute(\"text-anchor\", this.textAlign);\n\n if (this.textPathElement) {\n node.removeAttribute(\"x\");\n node.removeAttribute(\"y\");\n } else {\n switch (this.textAlign) {\n case \"middle\":\n node.setAttribute(\"x\", (width / 2).toString() + \"px\");\n break;\n\n case \"end\":\n if (this.rtl) {} else {\n node.setAttribute(\"x\", width.toString());\n }\n\n break;\n\n default:\n if (this.rtl) {\n node.setAttribute(\"x\", width.toString());\n } else {\n node.removeAttribute(\"text-anchor\");\n }\n\n break;\n }\n\n var y = $type.toNumber(node.getAttribute(\"y\"));\n\n switch (this.textValign) {\n case \"middle\":\n node.setAttribute(\"y\", ((y || 0) + (height - this.bbox.height) / 2).toString());\n break;\n\n case \"bottom\":\n node.setAttribute(\"y\", ((y || 0) + height - this.bbox.height).toString());\n break;\n\n default:\n node.setAttribute(\"y\", (y || 0).toString());\n break;\n }\n }\n }\n };\n /**\r\n * Produces an SVG line element with formatted text.\r\n *\r\n * @ignore Exclude from docs\r\n * @param text Text to wrap into line\r\n * @param y Current line vertical position\r\n * @return A DOM element\r\n * @todo Implement HTML support\r\n */\n\n\n Label.prototype.getSVGLineElement = function (text, y) {\n // Create a <text> node and set text\n var element = this.paper.addGroup(\"text\");\n element.textContent = text; // Set parameters\n\n element.attr({\n \"x\": \"0\" //\"alignment-baseline\": \"hanging\",\n //\"baseline-shift\": \"-20%\",\n //\"text-anchor\": \"center\"\n\n }); // Set `y` position\n\n if ($type.hasValue(y)) {\n element.attr({\n \"y\": y.toString()\n });\n } // Don't let labels blled out of the alotted area\n\n\n if (this.truncate || this.wrap) {\n element.attr({\n \"overflow\": \"hidden\"\n });\n } // Add RTL?\n // This has now been moved to this.alignSVGText()\n // if (this.rtl) {\n // \telement.attr({\n // \t\t\"direction\": \"rtl\",\n // \t\t//\"unicode-bidi\": \"bidi-override\"\n // \t});\n // }\n\n\n return element;\n };\n\n Object.defineProperty(Label.prototype, \"rtl\", {\n /**\r\n * @return RTL?\r\n */\n get: function get() {\n if ($type.hasValue(this._rtl)) {\n return this._rtl;\n } else if (this._topParent) {\n return this._topParent.rtl;\n }\n\n return false;\n },\n\n /**\r\n * An RTL (right-to-left) setting.\r\n *\r\n * RTL may affect alignment, text, and other visual properties.\r\n *\r\n * If you set this on a top-level chart object, it will be used for all\r\n * child elements, e.g. labels, unless they have their own `rtl` setting\r\n * set directly on them.\r\n *\r\n * @param value `true` for to use RTL\r\n */\n set: function set(value) {\n value = $type.toBoolean(value);\n this._rtl = value;\n\n if (this.element) {\n this.alignSVGText();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Resets cached BBox.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Label.prototype.resetBBox = function () {\n this._bbox = {\n x: 0,\n y: 0,\n width: 0,\n height: 0\n };\n };\n /**\r\n * Creates and returns an HTML line element (`<div>`).\r\n *\r\n * @ignore Exclude from docs\r\n * @param text Text to add\r\n * @return `<div>` element reference\r\n */\n\n\n Label.prototype.getHTMLLineElement = function (text) {\n // Create the <div> element\n var div = document.createElement(\"div\");\n div.innerHTML = text; // Set text alignment\n\n switch (this.textAlign) {\n case \"middle\":\n div.style.textAlign = \"center\";\n break;\n\n case \"end\":\n div.style.textAlign = \"right\";\n break;\n } // Disable or enable wrapping\n\n\n if (this.wrap) {\n div.style.wordWrap = \"break-word\";\n } else {\n div.style.whiteSpace = \"nowrap\";\n } // Don't let labels bleed out of the alotted area\n // Moved to `draw()` because setting \"hidden\" kills all measuring\n\n /*if (this.truncate) {\r\n div.style.overflow = \"hidden\";\r\n }*/\n // Set RTL-related styles\n\n\n if (this.rtl) {\n div.style.direction = \"rtl\"; //div.style.unicodeBidi = \"bidi-override\";\n } // Translate some of the SVG styles into CSS\n\n\n if ($type.hasValue(this.fill)) {\n div.style.color = this.fill.toString();\n }\n\n return div;\n };\n /**\r\n * Applies specific styles to text to make it not selectable, unless it is\r\n * explicitly set as `selectable`.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Set styles via AMElement\r\n */\n\n\n Label.prototype.setStyles = function () {\n var group = this.element;\n\n if (!this.selectable || this.draggable || this.resizable || this.swipeable) {\n group.addStyle({\n \"webkitUserSelect\": \"none\",\n \"msUserSelect\": \"none\"\n });\n } else if (this.selectable) {\n group.removeStyle(\"webkitUserSelect\");\n group.removeStyle(\"msUserSelect\");\n }\n };\n /**\r\n * Hides unused lines\r\n */\n\n\n Label.prototype.hideUnused = function (index) {\n this.initLineCache();\n var lines = this.getCache(\"lineInfo\");\n\n if (lines.length >= index) {\n for (var i = index; i < lines.length; i++) {\n var line = lines[i];\n\n if (line && line.element) {\n line.element.attr({\n \"display\": \"none\"\n });\n }\n }\n }\n };\n\n Object.defineProperty(Label.prototype, \"text\", {\n /**\r\n * @return SVG text\r\n */\n get: function get() {\n return this.getPropertyValue(\"text\");\n },\n\n /**\r\n * An SVG text.\r\n *\r\n * Please note that setting `html` will override this setting if browser\r\n * supports `foreignObject` in SGV, such as most modern browsers excluding\r\n * IEs.\r\n *\r\n * @param value SVG Text\r\n */\n set: function set(value) {\n //this.setPropertyValue(\"html\", undefined);\n this.setPropertyValue(\"text\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"path\", {\n /**\r\n * @return Path\r\n */\n get: function get() {\n return this.getPropertyValue(\"path\");\n },\n\n /**\r\n * An SVG path string to position text along. If set, the text will follow\r\n * the curvature of the path.\r\n *\r\n * Location along the path can be set using `locationOnPath`.\r\n *\r\n * IMPORTANT: Only SVG text can be put on path. If you are using HTML text\r\n * this setting will be ignored.\r\n *\r\n * @since 4.1.2\r\n * @param value Path\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"path\", value, true)) {\n if (this.pathElement) {\n this.pathElement.dispose();\n }\n\n if (this.textPathElement) {\n this.textPathElement.dispose();\n }\n\n this.pathElement = this.paper.add(\"path\");\n this.pathElement.attr({\n \"d\": value\n });\n this.pathElement.attr({\n \"id\": \"text-path-\" + this.uid\n });\n\n this._disposers.push(this.pathElement);\n\n this.textPathElement = this.paper.addGroup(\"textPath\");\n this.textPathElement.attrNS($dom.XLINK, \"xlink:href\", \"#text-path-\" + this.uid); // TODO remove after https://bugzilla.mozilla.org/show_bug.cgi?id=455986 is fixed\n\n this.textPathElement.attr({\n \"path\": value\n });\n\n this._disposers.push(this.textPathElement);\n\n this.hardInvalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"locationOnPath\", {\n /**\r\n * @return Relatvie location on path\r\n */\n get: function get() {\n return this.getPropertyValue(\"locationOnPath\");\n },\n\n /**\r\n * Relative label location on `path`. Value range is from 0 (beginning)\r\n * to 1 (end).\r\n *\r\n * Works only if you set `path` setting to an SVG path.\r\n *\r\n * @since 4.1.2\r\n * @default 0\r\n * @param value Relatvie location on path\r\n */\n set: function set(value) {\n this.setPropertyValue(\"locationOnPath\", value);\n\n if (this.textPathElement) {\n this.textPathElement.attr({\n \"startOffset\": value * 100 + \"%\"\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"baseLineRatio\", {\n /**\r\n * @return Base line ratio\r\n */\n get: function get() {\n return this.getPropertyValue(\"baseLineRatio\");\n },\n\n /**\r\n * A ratio to calculate text baseline. Ralative distance from the bottom of\r\n * the label.\r\n *\r\n * @since 4.4.2\r\n * @default -0.27\r\n * @param value Base line ratio\r\n */\n set: function set(value) {\n this.setPropertyValue(\"baseLineRatio\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"wrap\", {\n /**\r\n * @return Auto-wrap enabled or not\r\n */\n get: function get() {\n return this.getPropertyValue(\"wrap\");\n },\n\n /**\r\n * Enables or disables autowrapping of text.\r\n *\r\n * @param value Auto-wrapping enabled\r\n */\n set: function set(value) {\n this.resetBBox();\n this.setPropertyValue(\"wrap\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"truncate\", {\n /**\r\n * @return Truncate text?\r\n */\n get: function get() {\n return this.getPropertyValue(\"truncate\");\n },\n\n /**\r\n * Indicates if text lines need to be truncated if they do not fit, using\r\n * configurable `ellipsis` string.\r\n *\r\n * `truncate` overrides `wrap` if both are set to `true`.\r\n *\r\n * NOTE: For HTML text, this setting **won't** trigger a parser and actual\r\n * line truncation with ellipsis. It will just hide everything that goes\r\n * outside the label.\r\n *\r\n * @param value trincate text?\r\n */\n set: function set(value) {\n this.resetBBox();\n this.setPropertyValue(\"truncate\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"fullWords\", {\n /**\r\n * @return Truncate on full words?\r\n */\n get: function get() {\n return this.getPropertyValue(\"fullWords\");\n },\n\n /**\r\n * If `truncate` is enabled, should Label try to break only on full words\r\n * (`true`), or whenever needed, including middle of the word. (`false`)\r\n *\r\n * @default true\r\n * @param value Truncate on full words?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"fullWords\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"ellipsis\", {\n /**\r\n * @return Ellipsis string\r\n */\n get: function get() {\n return this.getPropertyValue(\"ellipsis\");\n },\n\n /**\r\n * Ellipsis character to use if `truncate` is enabled.\r\n *\r\n * @param value Ellipsis string\r\n * @default \"...\"\r\n */\n set: function set(value) {\n this.setPropertyValue(\"ellipsis\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"selectable\", {\n /**\r\n * @return Text selectable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"selectable\");\n },\n\n /**\r\n * Forces the text to be selectable. This setting will be ignored if the\r\n * object has some kind of interaction attached to it, such as it is\r\n * `draggable`, `swipeable`, `resizable`.\r\n *\r\n * @param value Text selectable?\r\n * @default false\r\n */\n set: function set(value) {\n this.setPropertyValue(\"selectable\", value, true);\n this.setStyles();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"textAlign\", {\n /**\r\n * @return Alignment\r\n */\n get: function get() {\n return this.getPropertyValue(\"textAlign\");\n },\n\n /**\r\n * Horizontal text alignment.\r\n *\r\n * Available choices:\r\n * * \"start\"\r\n * * \"middle\"\r\n * * \"end\"\r\n *\r\n * @param value Alignment\r\n */\n set: function set(value) {\n this.setPropertyValue(\"textAlign\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"textValign\", {\n /**\r\n * @ignore Exclude from docs (not used)\r\n * @return Alignment\r\n * @deprecated\r\n */\n get: function get() {\n return this.getPropertyValue(\"textValign\");\n },\n\n /**\r\n * Vertical text alignment.\r\n *\r\n * @ignore Exclude from docs (not used)\r\n * @param value Alignment\r\n * @deprecated\r\n */\n set: function set(value) {\n this.setPropertyValue(\"textValign\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"html\", {\n /**\r\n * @return HTML content\r\n */\n get: function get() {\n return this.getPropertyValue(\"html\");\n },\n\n /**\r\n * Raw HTML to be used as text.\r\n *\r\n * NOTE: HTML text is subject to browser support. It relies on browsers\r\n * supporting SVG `foreignObject` nodes. Some browsers (read IEs) do not\r\n * support it. On those browsers, the text will fall back to basic SVG text,\r\n * striping out all HTML markup and styling that goes with it.\r\n *\r\n * For more information about `foreignObject` and its browser compatibility\r\n * refer to [this page](https://developer.mozilla.org/en/docs/Web/SVG/Element/foreignObject#Browser_compatibility).\r\n *\r\n * @param value HTML text\r\n */\n set: function set(value) {\n this.setPropertyValue(\"html\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"hideOversized\", {\n /**\r\n * @return Hide if text does not fit?\r\n */\n get: function get() {\n return this.getPropertyValue(\"hideOversized\");\n },\n\n /**\r\n * Indicates whether the whole text should be hidden if it does not fit into\r\n * its allotted space.\r\n *\r\n * @param value Hide if text does not fit?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"hideOversized\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"ignoreFormatting\", {\n /**\r\n * @return Ignore formatting?\r\n */\n get: function get() {\n return this.getPropertyValue(\"ignoreFormatting\");\n },\n\n /**\r\n * If set to `true` square-bracket formatting blocks will be treated as\r\n * regular text.\r\n *\r\n * @default false\r\n * @param value Ignore formatting?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"ignoreFormatting\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Override `mesaureElement` so it does not get measure again, because\r\n * internal `_bbox` is being updated by measuring routines in Text itself.\r\n */\n\n Label.prototype.measureElement = function () {};\n /**\r\n * Returns information about a line element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param index Line index\r\n * @return Line info object\r\n */\n\n\n Label.prototype.getLineInfo = function (index) {\n this.initLineCache();\n var lines = this.getCache(\"lineInfo\");\n return lines.length > index ? lines[index] : undefined;\n };\n /**\r\n * Adds a line to line info cache.\r\n *\r\n * @ignore Exclude from docs\r\n * @param line Line info object\r\n * @param index Insert at specified index\r\n */\n\n\n Label.prototype.addLineInfo = function (line, index) {\n this.initLineCache();\n this.getCache(\"lineInfo\")[index] = line;\n };\n /**\r\n * Checks if line cache is initialized and initializes it.\r\n */\n\n\n Label.prototype.initLineCache = function () {\n if (!$type.hasValue(this.getCache(\"lineInfo\"))) {\n this.setCache(\"lineInfo\", [], 0);\n }\n };\n /**\r\n * Sets a [[DataItem]] to use for populating dynamic sections of the text.\r\n *\r\n * Check the description for [[Text]] class, for data binding.\r\n *\r\n * @param dataItem Data item\r\n */\n\n\n Label.prototype.setDataItem = function (dataItem) {\n if (this._sourceDataItemEvents) {\n this._sourceDataItemEvents.dispose();\n }\n\n if (dataItem) {\n this._sourceDataItemEvents = new MultiDisposer([dataItem.events.on(\"valuechanged\", this.invalidate, this, false), dataItem.events.on(\"workingvaluechanged\", this.invalidate, this, false), dataItem.events.on(\"calculatedvaluechanged\", this.invalidate, this, false), dataItem.events.on(\"propertychanged\", this.invalidate, this, false)]);\n }\n\n _super.prototype.setDataItem.call(this, dataItem);\n };\n\n Object.defineProperty(Label.prototype, \"availableWidth\", {\n /**\r\n * Returns available horizontal space.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Available width (px)\r\n */\n get: function get() {\n return $type.hasValue(this.maxWidth) ? this.maxWidth : this.pixelWidth;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Label.prototype, \"availableHeight\", {\n /**\r\n * Returns available vertical space.\r\n *\r\n * @return Available height (px)\r\n */\n get: function get() {\n return $type.hasValue(this.maxHeight) ? this.maxHeight : this.pixelHeight;\n },\n enumerable: true,\n configurable: true\n }); // temp, replacing textFormatter method\n\n Label.prototype.getSvgElement = function (text, style, parent) {\n var element = this.paper.add(\"tspan\");\n element.textContent = text;\n\n if (style) {\n if (options.nonce && parent) {\n //element.node.setAttribute(\"nonce\", \"test123\");\n var classid = \"amcharts_element_style_\" + btoa(style).replace(/[^\\w]*/g, \"\");\n element.node.setAttribute(\"class\", classid);\n var defs = document.createElementNS($dom.SVGNS, \"defs\");\n parent.node.appendChild(defs);\n var e = document.createElement(\"style\");\n e.type = \"text/css\";\n e.innerHTML = \".\" + classid + \" { \" + style + \"}\";\n e.setAttribute(\"nonce\", options.nonce);\n defs.appendChild(e);\n } else {\n element.node.setAttribute(\"style\", style);\n }\n }\n\n if (parent) {\n parent.add(element);\n }\n\n return element;\n };\n /**\r\n * Invalidates the whole element, including layout AND all its child\r\n * elements.\r\n */\n\n\n Label.prototype.deepInvalidate = function () {\n _super.prototype.deepInvalidate.call(this);\n\n this.hardInvalidate();\n };\n\n Object.defineProperty(Label.prototype, \"readerTitle\", {\n /**\r\n * @return Title\r\n */\n get: function get() {\n var title = this.getPropertyValue(\"readerTitle\");\n\n if (!title) {\n title = this.populateString($utils.plainText($utils.isNotEmpty(this.html) ? this.html : this.text));\n } else if (this.dataItem) {\n title = this.populateString(title);\n }\n\n return title;\n },\n\n /**\r\n * Screen reader title of the element.\r\n *\r\n * @param value Title\r\n */\n set: function set(value) {\n value = $type.toText(value);\n\n if (this.setPropertyValue(\"readerTitle\", value)) {\n this.applyAccessibility();\n }\n },\n enumerable: true,\n configurable: true\n });\n return Label;\n}(Container);\n\nexport { Label };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Label\"] = Label;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Hide labels added directly to chart, like titles if chart is short.\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.heightXS,\n state: function state(target, stateId) {\n if (target instanceof Label && target.parent && target.parent.isBaseSprite) {\n var state = target.states.create(stateId);\n state.properties.disabled = true;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * Rounded rectangle module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport * as $math from \"../utils/Math\";\nimport * as $type from \"../utils/Type\";\nimport * as $utils from \"../utils/Utils\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a rectangle with rounded corners.\r\n *\r\n * @see {@link IRoundedRectangleEvents} for a list of available events\r\n * @see {@link IRoundedRectangleAdapters} for a list of available Adapters\r\n */\n\nvar RoundedRectangle =\n/** @class */\nfunction (_super) {\n __extends(RoundedRectangle, _super);\n /**\r\n * Constructor\r\n */\n\n\n function RoundedRectangle() {\n var _this = _super.call(this) || this;\n\n _this.className = \"RoundedRectangle\";\n _this.element = _this.paper.add(\"path\");\n\n _this.cornerRadius(3, 3, 3, 3);\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n RoundedRectangle.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var w = this.innerWidth;\n var h = this.innerHeight;\n\n if ($type.isNumber(w) && $type.isNumber(h)) {\n var minSide = $math.min(w, h) / 2;\n var cornerRadiusTopLeft = $utils.relativeToValue(this.cornerRadiusTopLeft, minSide);\n var cornerRadiusTopRight = $utils.relativeToValue(this.cornerRadiusTopRight, minSide);\n var cornerRadiusBottomRight = $utils.relativeToValue(this.cornerRadiusBottomRight, minSide);\n var cornerRadiusBottomLeft = $utils.relativeToValue(this.cornerRadiusBottomLeft, minSide);\n var maxcr = $math.min(Math.abs(w / 2), Math.abs(h / 2));\n var crtl = $math.fitToRange(cornerRadiusTopLeft, 0, maxcr);\n var crtr = $math.fitToRange(cornerRadiusTopRight, 0, maxcr);\n var crbr = $math.fitToRange(cornerRadiusBottomRight, 0, maxcr);\n var crbl = $math.fitToRange(cornerRadiusBottomLeft, 0, maxcr);\n var lineT = \"M\" + crtl + \",0 L\" + (w - crtr) + \",0\";\n var lineB = \" L\" + crbl + \",\" + h;\n var lineL = \" L0,\" + crtl;\n var lineR = \" L\" + w + \",\" + (h - crbr);\n var arcTR = \" a\" + crtr + \",\" + crtr + \" 0 0 1 \" + crtr + \",\" + crtr;\n var arcBR = \" a\" + crbr + \",\" + crbr + \" 0 0 1 -\" + crbr + \",\" + crbr;\n var arcBL = \" a\" + crbl + \",\" + crbl + \" 0 0 1 -\" + crbl + \",-\" + crbl;\n var arcTL = \" a\" + crtl + \",\" + crtl + \" 0 0 1 \" + crtl + \",-\" + crtl;\n var path = lineT + arcTR + lineR + arcBR + lineB + arcBL + lineL + arcTL + \" Z\";\n this.path = path;\n }\n };\n /**\r\n * Sets radius for all four corners at ones.\r\n *\r\n * All numbers are in pixels.\r\n *\r\n * @param tl Top-left corner\r\n * @param tr Top-right corner\r\n * @param bl Bottom-left corner\r\n * @param br Bottom-right corner\r\n */\n\n\n RoundedRectangle.prototype.cornerRadius = function (tl, tr, bl, br) {\n this.cornerRadiusTopLeft = tl;\n this.cornerRadiusTopRight = tr;\n this.cornerRadiusBottomLeft = bl;\n this.cornerRadiusBottomRight = br;\n };\n\n Object.defineProperty(RoundedRectangle.prototype, \"cornerRadiusTopLeft\", {\n /**\r\n * @return Radius (px or Percent)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cornerRadiusTopLeft\");\n },\n\n /**\r\n * Radius of the top-left corner in pixels.\r\n *\r\n * @default 3\r\n * @param value Radius (px or Percent)\r\n */\n set: function set(value) {\n this.setPercentProperty(\"cornerRadiusTopLeft\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RoundedRectangle.prototype, \"cornerRadiusTopRight\", {\n /**\r\n * @return Radius (px or Percent)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cornerRadiusTopRight\");\n },\n\n /**\r\n * Radius of the top-right corner in pixels.\r\n *\r\n * @default 3\r\n * @param value Radius (px or Percent)\r\n */\n set: function set(value) {\n this.setPercentProperty(\"cornerRadiusTopRight\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RoundedRectangle.prototype, \"cornerRadiusBottomRight\", {\n /**\r\n * @return Radius (px or Percent)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cornerRadiusBottomRight\");\n },\n\n /**\r\n * Radius of the bottom-right corner in pixels.\r\n *\r\n * @default 3\r\n * @param value Radius (px or Percent)\r\n */\n set: function set(value) {\n this.setPercentProperty(\"cornerRadiusBottomRight\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RoundedRectangle.prototype, \"cornerRadiusBottomLeft\", {\n /**\r\n * @return Radius (px or Percent)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cornerRadiusBottomLeft\");\n },\n\n /**\r\n * Radius of the bottom-left corner in pixels.\r\n *\r\n * @default 3\r\n * @param value Radius (px or Percent)\r\n */\n set: function set(value) {\n this.setPercentProperty(\"cornerRadiusBottomLeft\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Measures the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n RoundedRectangle.prototype.measureElement = function () {};\n\n Object.defineProperty(RoundedRectangle.prototype, \"bbox\", {\n /**\r\n * Returns bounding box (square) for this element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n get: function get() {\n if (this.definedBBox) {\n return this.definedBBox;\n }\n\n if (this.isMeasured) {\n return {\n x: 0,\n y: 0,\n width: this.innerWidth,\n height: this.innerHeight\n };\n } else {\n return {\n x: 0,\n y: 0,\n width: 0,\n height: 0\n };\n }\n },\n enumerable: true,\n configurable: true\n });\n return RoundedRectangle;\n}(Sprite);\n\nexport { RoundedRectangle };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"RoundedRectangle\"] = RoundedRectangle;","/**\r\n * Functionality for drawing simple buttons.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { Label } from \"./Label\";\nimport { RoundedRectangle } from \"../elements/RoundedRectangle\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { registry } from \"../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Button class is capable of drawing a simple rectangular button with\r\n * optionally rounded corners and an icon in it.\r\n *\r\n * @see {@link IButtonEvents} for a list of available events\r\n * @see {@link IButtonAdapters} for a list of available Adapters\r\n */\n\nvar Button =\n/** @class */\nfunction (_super) {\n __extends(Button, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Button() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"Button\";\n _this.tooltipY = 0; // Set defaults\n\n _this.iconPosition = \"left\";\n _this.layout = \"horizontal\";\n _this.contentAlign = \"center\";\n _this.contentValign = \"middle\";\n\n _this.padding(8, 16, 8, 16);\n\n _this.setStateOnChildren = true;\n var interfaceColors = new InterfaceColorSet(); // Create background\n\n var background = _this.background;\n background.fill = interfaceColors.getFor(\"secondaryButton\");\n background.stroke = interfaceColors.getFor(\"secondaryButtonStroke\");\n background.fillOpacity = 1;\n background.strokeOpacity = 1;\n background.cornerRadius(3, 3, 3, 3); // Create the label element\n\n _this.label = new Label();\n _this.label.fill = interfaceColors.getFor(\"secondaryButtonText\");\n ;\n _this.label.shouldClone = false; // Create default states\n\n var hoverState = background.states.create(\"hover\");\n hoverState.properties.fillOpacity = 1;\n hoverState.properties.fill = interfaceColors.getFor(\"secondaryButtonHover\");\n var downState = background.states.create(\"down\");\n downState.transitionDuration = 100;\n downState.properties.fill = interfaceColors.getFor(\"secondaryButtonDown\");\n downState.properties.fillOpacity = 1; // Set up accessibility\n // A button should be always focusable\n\n _this.role = \"button\";\n _this.focusable = true; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Button.prototype, \"icon\", {\n /**\r\n * @return Icon Sprite\r\n */\n get: function get() {\n return this._icon;\n },\n\n /**\r\n * A [[Sprite]] to be used as an icon on button.\r\n *\r\n * @param icon Icon Sprite\r\n */\n set: function set(icon) {\n var currentIcon = this._icon;\n\n if (currentIcon) {\n //this._icon.dispose();\n //this.removeDispose(currentIcon);\n currentIcon.parent = undefined;\n }\n\n if (icon) {\n this._icon = icon;\n icon.parent = this;\n icon.interactionsEnabled = false;\n icon.shouldClone = false;\n this.iconPosition = this.iconPosition;\n\n this._disposers.push(icon);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Button.prototype, \"iconPosition\", {\n /**\r\n * @return Icon position\r\n */\n get: function get() {\n return this.getPropertyValue(\"iconPosition\");\n },\n\n /**\r\n * Icon position: \"left\" or \"right\".\r\n *\r\n * @default \"left\"\r\n * @param position Icon position\r\n */\n set: function set(position) {\n this.setPropertyValue(\"iconPosition\", position);\n\n if (this.icon) {\n if (position == \"left\") {\n this.icon.toBack();\n } else {\n this.icon.toFront();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Button.prototype, \"label\", {\n /**\r\n * @return Label element\r\n */\n get: function get() {\n return this._label;\n },\n\n /**\r\n * [[Label]] element to be used for text.\r\n *\r\n * @param label element\r\n */\n set: function set(label) {\n if (this._label) {\n //this._label.dispose();\n this.removeDispose(this._label);\n }\n\n this._label = label;\n\n if (label) {\n label.parent = this;\n label.interactionsEnabled = false;\n\n this._disposers.push(this._label);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates a background element for the button.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Background element\r\n */\n\n Button.prototype.createBackground = function () {\n return new RoundedRectangle();\n };\n /**\r\n * Copies properties and other attributes.\r\n *\r\n * @param source Source\r\n */\n\n\n Button.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n if (source.label) {\n this.label.copyFrom(source.label);\n }\n\n if (source.icon) {\n this.icon = source.icon.clone();\n }\n };\n\n return Button;\n}(Container);\n\nexport { Button };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Button\"] = Button;","/**\r\n * Functionality for drawing circles.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { percent } from \"../utils/Percent\";\nimport { registry } from \"../Registry\";\nimport * as $utils from \"../utils/Utils\";\nimport * as $math from \"../utils/Math\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to create a circle\r\n * @see {@link ICircleEvents} for a list of available events\r\n * @see {@link ICircleAdapters} for a list of available Adapters\r\n */\n\nvar Circle =\n/** @class */\nfunction (_super) {\n __extends(Circle, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Circle() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Circle\";\n _this.element = _this.paper.add(\"circle\");\n\n _this.setPercentProperty(\"radius\", percent(100));\n\n _this.setPropertyValue(\"horizontalCenter\", \"middle\");\n\n _this.setPropertyValue(\"verticalCenter\", \"middle\");\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the circle.\r\n */\n\n\n Circle.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n this.element.attr({\n \"r\": this.pixelRadius\n });\n };\n\n Object.defineProperty(Circle.prototype, \"radius\", {\n /**\r\n * @return Radius\r\n */\n get: function get() {\n return this.getPropertyValue(\"radius\");\n },\n\n /**\r\n * Radius of the circle.\r\n *\r\n * Can be either absolute (pixels) or relative ([Percent]).\r\n *\r\n * @param value Radius\r\n */\n set: function set(value) {\n this.setPercentProperty(\"radius\", value, true, false, 10, false);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Circle.prototype, \"pixelRadius\", {\n /**\r\n * Radius of the circle in pixels.\r\n *\r\n * This is a read-only property. To set radius in pixels, use `radius`\r\n * property.\r\n *\r\n * @readonly\r\n * @return Radius (px)\r\n */\n get: function get() {\n return $utils.relativeToValue(this.radius, $math.min(this.innerWidth / 2, this.innerHeight / 2));\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates bounding box.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Circle.prototype.measureElement = function () {\n var pixelRadius = this.pixelRadius;\n this._bbox = {\n x: -pixelRadius,\n y: -pixelRadius,\n width: pixelRadius * 2,\n height: pixelRadius * 2\n };\n };\n\n return Circle;\n}(Sprite);\n\nexport { Circle };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Circle\"] = Circle;","/**\r\n * Ellipse module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Circle } from \"./Circle\";\nimport { registry } from \"../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws an ellipse\r\n * @see {@link IEllipseEvents} for a list of available events\r\n * @see {@link IEllipseAdapters} for a list of available Adapters\r\n */\n\nvar Ellipse =\n/** @class */\nfunction (_super) {\n __extends(Ellipse, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Ellipse() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Ellipse\";\n _this.element = _this.paper.add(\"ellipse\");\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the ellipsis.\r\n */\n\n\n Ellipse.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n this.element.attr({\n \"rx\": this.radius\n });\n this.element.attr({\n \"ry\": this.radiusY\n });\n };\n\n Object.defineProperty(Ellipse.prototype, \"radiusY\", {\n /**\r\n * @return Vertical radius\r\n */\n get: function get() {\n return this.innerHeight / 2;\n },\n\n /**\r\n * Vertical radius.\r\n *\r\n * It's a relative size to the `radius`.\r\n *\r\n * E.g. 0.8 will mean the height of the ellipsis will be 80% of it's\r\n * horizontal radius.\r\n *\r\n * @param value Vertical radius\r\n */\n set: function set(value) {\n this.height = value * 2;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Ellipse.prototype, \"radius\", {\n /**\r\n * @return Horizontal radius\r\n */\n get: function get() {\n return this.innerWidth / 2;\n },\n\n /**\r\n * Horizontal radius.\r\n *\r\n * @param value Horizontal radius\r\n */\n set: function set(value) {\n this.width = value * 2;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return Ellipse;\n}(Circle);\n\nexport { Ellipse };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Ellipse\"] = Ellipse;","/**\r\n * Functionality for adding images in SVG tree.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport * as $dom from \"../utils/DOM\";\nimport * as $type from \"../utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to add `<image>` elements to SVG.\r\n *\r\n * @see {@link IImageEvents} for a list of available events\r\n * @see {@link IImageAdapters} for a list of available Adapters\r\n */\n\nvar Image =\n/** @class */\nfunction (_super) {\n __extends(Image, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Image() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Image\";\n _this.element = _this.paper.add(\"image\");\n\n _this.applyTheme();\n\n _this.width = 50;\n _this.height = 50;\n return _this;\n }\n /**\r\n * Draws an `<image>` element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Image.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (this.href) {\n var width = this.innerWidth;\n var height = this.innerHeight;\n\n if ($type.isNumber(this.widthRatio)) {\n width = height * this.widthRatio;\n this.width = width;\n }\n\n if ($type.isNumber(this.heightRatio)) {\n height = width * this.heightRatio;\n this.height = height;\n }\n\n this.element.attr({\n \"width\": width,\n \"height\": height\n });\n this.element.attrNS($dom.XLINK, \"xlink:href\", this.href);\n }\n };\n\n Object.defineProperty(Image.prototype, \"href\", {\n /**\r\n * @return Image URI\r\n */\n get: function get() {\n return this.getPropertyValue(\"href\");\n },\n\n /**\r\n * An image URI.\r\n *\r\n * @param value Image URI\r\n */\n set: function set(value) {\n this.setPropertyValue(\"href\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Image.prototype, \"widthRatio\", {\n /**\r\n * @return Ratio\r\n */\n get: function get() {\n return this.getPropertyValue(\"widthRatio\");\n },\n\n /**\r\n * Sets image `width` relatively to its `height`.\r\n *\r\n * If image's `height = 100` and `widthRatio = 0.5` the actual width will be\r\n * `50`.\r\n *\r\n * @param value Ratio\r\n */\n set: function set(value) {\n this.setPropertyValue(\"widthRatio\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Image.prototype, \"heightRatio\", {\n /**\r\n * @return Ratio\r\n */\n get: function get() {\n return this.getPropertyValue(\"heightRatio\");\n },\n\n /**\r\n * Sets image `height` relatively to its `width`.\r\n *\r\n * If image's `width = 100` and `heightRatio = 0.5` the actual height will be\r\n * `50`.\r\n *\r\n * @param value Ratio\r\n */\n set: function set(value) {\n this.setPropertyValue(\"heightRatio\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Image.prototype, \"bbox\", {\n /**\r\n * Returns bounding box (square) for this element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n get: function get() {\n return {\n x: 0,\n y: 0,\n width: this.pixelWidth,\n height: this.pixelHeight\n };\n },\n enumerable: true,\n configurable: true\n });\n return Image;\n}(Sprite);\n\nexport { Image };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Image\"] = Image;","/**\r\n * Line drawing functionality.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { color } from \"../utils/Color\";\nimport { LinearGradient } from \"../rendering/fills/LinearGradient\";\nimport { registry } from \"../Registry\";\nimport * as $type from \"../utils/Type\";\nimport * as $math from \"../utils/Math\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a line.\r\n *\r\n * @see {@link ILineEvents} for a list of available events\r\n * @see {@link ILineAdapters} for a list of available Adapters\r\n */\n\nvar Line =\n/** @class */\nfunction (_super) {\n __extends(Line, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Line() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Line\";\n _this.element = _this.paper.add(\"line\");\n _this.fill = color(); //\"none\";\n\n _this.x1 = 0;\n _this.y1 = 0;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the line.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Line.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (this.x1 == this.x2 || this.y1 == this.y2) {\n this.pixelPerfect = true;\n } else {\n this.pixelPerfect = false;\n }\n\n this.x1 = this.x1;\n this.x2 = this.x2;\n this.y1 = this.y1;\n this.y2 = this.y2;\n };\n\n Object.defineProperty(Line.prototype, \"x1\", {\n /**\r\n * @return X\r\n */\n get: function get() {\n return this.getPropertyValue(\"x1\");\n },\n\n /**\r\n * X coordinate of first end.\r\n *\r\n * @param value X\r\n */\n set: function set(value) {\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n var delta = 0;\n\n if (this.pixelPerfect && this.stroke instanceof LinearGradient) {\n delta = 0.00001;\n }\n\n this.setPropertyValue(\"x1\", value, true);\n this.element.attr({\n \"x1\": value + delta\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Line.prototype, \"x2\", {\n /**\r\n * @return X\r\n */\n get: function get() {\n var value = this.getPropertyValue(\"x2\");\n\n if (!$type.isNumber(value)) {\n value = this.pixelWidth;\n }\n\n return value;\n },\n\n /**\r\n * X coordinate of second end.\r\n *\r\n * @param value X\r\n */\n set: function set(value) {\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n this.setPropertyValue(\"x2\", value, true);\n this.element.attr({\n \"x2\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Line.prototype, \"y1\", {\n /**\r\n * @return Y\r\n */\n get: function get() {\n return this.getPropertyValue(\"y1\");\n },\n\n /**\r\n * Y coordinate of first end.\r\n *\r\n * @param value Y\r\n */\n set: function set(value) {\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n var delta = 0;\n\n if (this.pixelPerfect && this.stroke instanceof LinearGradient) {\n delta = 0.00001;\n }\n\n this.setPropertyValue(\"y1\", value, true);\n this.element.attr({\n \"y1\": value + delta\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Line.prototype, \"y2\", {\n /**\r\n * @return Y\r\n */\n get: function get() {\n var value = this.getPropertyValue(\"y2\");\n\n if (!$type.isNumber(value)) {\n value = this.pixelHeight;\n }\n\n return value;\n },\n\n /**\r\n * Y coordinate of second end.\r\n *\r\n * @param value Y\r\n */\n set: function set(value) {\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n this.setPropertyValue(\"y2\", value, true);\n this.element.attr({\n \"y2\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts relative position along the line (0-1) into pixel coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinates\r\n */\n\n Line.prototype.positionToPoint = function (position) {\n var point1 = {\n x: this.x1,\n y: this.y1\n };\n var point2 = {\n x: this.x2,\n y: this.y2\n };\n var point = $math.getMidPoint(point1, point2, position);\n var angle = $math.getAngle(point1, point2);\n return {\n x: point.x,\n y: point.y,\n angle: angle\n };\n };\n\n return Line;\n}(Sprite);\n\nexport { Line };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Line\"] = Line;","/**\r\n * Pointed shape module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport * as $type from \"../utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a shape with a pointer.\r\n *\r\n * @see {@link IPointedShapeEvents} for a list of available events\r\n * @see {@link IPointedShapeAdapters} for a list of available Adapters\r\n */\n\nvar PointedShape =\n/** @class */\nfunction (_super) {\n __extends(PointedShape, _super);\n /**\r\n * Constructor\r\n */\n\n\n function PointedShape() {\n var _this = _super.call(this) || this;\n\n _this.className = \"PointedShape\";\n _this.pointerBaseWidth = 15;\n _this.pointerLength = 10;\n _this.pointerY = 0;\n _this.pointerX = 0;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n PointedShape.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (!$type.isNumber(this.pointerX)) {\n this.pointerX = this.pixelWidth / 2;\n }\n\n if (!$type.isNumber(this.pointerY)) {\n this.pointerY = this.pixelHeight + 10;\n }\n };\n\n Object.defineProperty(PointedShape.prototype, \"pointerBaseWidth\", {\n /**\r\n * @return Width (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"pointerBaseWidth\");\n },\n\n /**\r\n * A width of the pinter's (stem's) thick end (base) in pixels.\r\n *\r\n * @default 15\r\n * @param value Width (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"pointerBaseWidth\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(PointedShape.prototype, \"pointerLength\", {\n /**\r\n * @return Length (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"pointerLength\");\n },\n\n /**\r\n * A length of the pinter (stem) in pixels.\r\n *\r\n * @default 10\r\n * @param value Length (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"pointerLength\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(PointedShape.prototype, \"pointerX\", {\n /**\r\n * @return X\r\n */\n get: function get() {\n return this.getPropertyValue(\"pointerX\");\n },\n\n /**\r\n * X coordinate the shape is pointing to.\r\n *\r\n * @param value X\r\n */\n set: function set(value) {\n this.setPropertyValue(\"pointerX\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(PointedShape.prototype, \"pointerY\", {\n /**\r\n * @return Y\r\n */\n get: function get() {\n return this.getPropertyValue(\"pointerY\");\n },\n\n /**\r\n * Y coordinate the shape is pointing to.\r\n *\r\n * @param value Y\r\n */\n set: function set(value) {\n this.setPropertyValue(\"pointerY\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return PointedShape;\n}(Sprite);\n\nexport { PointedShape };","/**\r\n * Pointed rectangle module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { PointedShape } from \"./PointedShape\";\nimport * as $math from \"../utils/Math\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a rectangle with a pointer.\r\n *\r\n * @see {@link IPointedRectangleEvents} for a list of available events\r\n * @see {@link IPointedRectangleAdapters} for a list of available Adapters\r\n */\n\nvar PointedRectangle =\n/** @class */\nfunction (_super) {\n __extends(PointedRectangle, _super);\n /**\r\n * Constructor\r\n */\n\n\n function PointedRectangle() {\n var _this = _super.call(this) || this;\n\n _this.className = \"PointedRectangle\";\n _this.element = _this.paper.add(\"path\");\n _this.cornerRadius = 6;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n PointedRectangle.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var cr = this.cornerRadius;\n var w = this.innerWidth;\n var h = this.innerHeight;\n\n if (w > 0 && h > 0) {\n var x = this.pointerX;\n var y = this.pointerY;\n var bwh = this.pointerBaseWidth / 2;\n var maxcr = $math.min(w / 2, h / 2);\n var crtl = $math.fitToRange(cr, 0, maxcr);\n var crtr = $math.fitToRange(cr, 0, maxcr);\n var crbr = $math.fitToRange(cr, 0, maxcr);\n var crbl = $math.fitToRange(cr, 0, maxcr); // corner coordinates\n // top left\n\n var xtl = 0;\n var ytl = 0; // top right\n\n var xtr = w;\n var ytr = 0; // bottom right\n\n var xbr = w;\n var ybr = h; // bottom left\n\n var xbl = 0;\n var ybl = h;\n var lineT = void 0;\n var lineR = void 0;\n var lineB = void 0;\n var lineL = void 0; // find stem base side: http://$math.stackexchange.com/questions/274712/calculate-on-which-side-of-straign-line-is-dot-located\n // d=(x−x1)(y2−y1)−(y−y1)(x2−x1)\n\n var d1 = (x - xtl) * (ybr - ytl) - (y - ytl) * (xbr - xtl);\n var d2 = (x - xbl) * (ytr - ybl) - (y - ybl) * (xtr - xbl); // top\n\n if (d1 > 0 && d2 > 0) {\n var stemX = $math.fitToRange(x, crtl + bwh, w - bwh - crtr);\n y = $math.fitToRange(y, -Infinity, 0);\n lineT = \"M\" + crtl + \",0 L\" + (stemX - bwh) + \",0 L\" + x + \",\" + y + \" L\" + (stemX + bwh) + \",0 L\" + (w - crtr) + \",0\";\n } else {\n lineT = \"M\" + crtl + \",0 L\" + (w - crtr) + \",0\";\n } // bottom\n\n\n if (d1 < 0 && d2 < 0) {\n var stemX = $math.fitToRange(x, crbl + bwh, w - bwh - crbr);\n y = $math.fitToRange(y, h, Infinity);\n lineB = \" L\" + (w - crbr) + \",\" + h + \" L\" + (stemX + bwh) + \",\" + h + \" L\" + x + \",\" + y + \" L\" + (stemX - bwh) + \",\" + h + \" L\" + crbl + \",\" + h;\n } else {\n lineB = \" L\" + crbl + \",\" + h;\n } // left\n\n\n if (d1 < 0 && d2 > 0) {\n var stemY = $math.fitToRange(y, crtl + bwh, h - crbl - bwh);\n x = $math.fitToRange(x, -Infinity, 0);\n lineL = \" L0,\" + (h - crbl) + \" L0,\" + (stemY + bwh) + \" L\" + x + \",\" + y + \" L0,\" + (stemY - bwh) + \" L0,\" + crtl;\n } else {\n lineL = \" L0,\" + crtl;\n } // right\n\n\n if (d1 > 0 && d2 < 0) {\n var stemY = $math.fitToRange(y, crtr + bwh, h - bwh - crbr);\n x = $math.fitToRange(x, w, Infinity);\n lineR = \" L\" + w + \",\" + crtr + \" L\" + w + \",\" + (stemY - bwh) + \" L\" + x + \",\" + y + \" L\" + w + \",\" + (stemY + bwh) + \" L\" + w + \",\" + (h - crbr);\n } else {\n lineR = \" L\" + w + \",\" + (h - crbr);\n }\n\n var arcTR = \" a\" + crtr + \",\" + crtr + \" 0 0 1 \" + crtr + \",\" + crtr;\n var arcBR = \" a\" + crbr + \",\" + crbr + \" 0 0 1 -\" + crbr + \",\" + crbr;\n var arcBL = \" a\" + crbl + \",\" + crbl + \" 0 0 1 -\" + crbl + \",-\" + crbl;\n var arcTL = \" a\" + crtl + \",\" + crtl + \" 0 0 1 \" + crtl + \",-\" + crtl;\n this.path = lineT + arcTR + lineR + arcBR + lineB + arcBL + lineL + arcTL;\n }\n };\n\n Object.defineProperty(PointedRectangle.prototype, \"cornerRadius\", {\n /**\r\n * @return Corner radius (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cornerRadius\");\n },\n\n /**\r\n * Radius of rectangle's border in pixels.\r\n *\r\n * @default 0\r\n * @param value Corner radius (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"cornerRadius\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return PointedRectangle;\n}(PointedShape);\n\nexport { PointedRectangle };","/**\r\n * A collection of functions that deals with path calculations.\r\n */\nimport * as $math from \"../utils/Math\";\nimport * as $type from \"../utils/Type\";\nimport { getGhostPaper } from \"../rendering/Paper\";\nimport { options } from \"../Options\";\n/**\r\n * ============================================================================\r\n * PATH FUNCTIONS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Returns an SVG path from a number of points.\r\n *\r\n * @ignore Exclude from docs\r\n * @param points An array of line elbow points\r\n * @return SVG path\r\n */\n\nexport function polyline(points) {\n var path = lineTo(points[0]);\n var prevPoint = {\n x: 0,\n y: 0\n };\n var minStep = options.minPolylineStep;\n\n if (!$type.isNumber(minStep)) {\n minStep = 0.5;\n }\n\n for (var i = 0, len = points.length; i < len; i++) {\n var point = points[i];\n\n if ($math.getDistance(point, prevPoint) > minStep) {\n path += lineTo(point);\n prevPoint = point;\n }\n }\n\n return path;\n}\n/**\r\n * Returns a starting point of an SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @param point Starting point\r\n * @return SVG path\r\n */\n\nexport function moveTo(point) {\n return \" M\" + $math.round(point.x, 4) + \",\" + $math.round(point.y, 4) + \" \";\n}\n/**\r\n * Returns a line part of SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @param point SVG path\r\n * @return SVG path\r\n */\n\nexport function lineTo(point) {\n return \" L\" + $math.round(point.x, 4) + \",\" + $math.round(point.y, 4) + \" \";\n}\n/**\r\n * Returns a quadratic curve part of an SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @param point End point of the curve\r\n * @param controlPoint Control point\r\n * @return SVG path\r\n */\n\nexport function quadraticCurveTo(point, controlPoint) {\n return \" Q\" + $math.round(controlPoint.x, 4) + \",\" + $math.round(controlPoint.y, 4) + \" \" + $math.round(point.x, 4) + \",\" + $math.round(point.y, 4);\n}\n/**\r\n * Returns a cubic curve part of an SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @param point End point of the curve\r\n * @param controlPointA Control point A\r\n * @param controlPointB Control point B\r\n * @return SVG path\r\n */\n\nexport function cubicCurveTo(point, controlPointA, controlPointB) {\n return \" C\" + $math.round(controlPointA.x, 4) + \",\" + $math.round(controlPointA.y, 4) + \" \" + $math.round(controlPointB.x, 4) + \",\" + $math.round(controlPointB.y, 4) + \" \" + $math.round(point.x, 4) + \",\" + $math.round(point.y, 4);\n}\n/**\r\n * Returns a terminator for an SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @return SVG path\r\n */\n\nexport function closePath() {\n return \" Z\";\n}\n/**\r\n * Returns an arc part of an SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Better parameter descriptions\r\n * @param startAngle Starting angle\r\n * @param arc Arc\r\n * @param radius Radius\r\n * @param radiusY Vertical radius\r\n * @return SVG path\r\n */\n\nexport function arcTo(startAngle, arc, radius, radiusY) {\n if (arc == 0) {\n return \"\";\n }\n\n if (!$type.isNumber(radiusY)) {\n radiusY = radius;\n }\n\n var path = \"\";\n var c = \",\";\n var segments = Math.ceil(Math.abs(arc) / 180);\n var l = 1;\n\n if (arc < 0) {\n l = 0;\n } // previous, as we use a not A\n\n\n var pax = 0;\n var pay = 0; // center\n\n var cx = -$math.cos(startAngle) * radius;\n var cy = -$math.sin(startAngle) * radiusY; // foir very short angles and big radius, solves artefacts\n\n if (arc < 0.5 && radius > 3000) {\n var endAngle = startAngle + arc;\n var ax = $math.round($math.cos(endAngle) * radius, 4);\n var ay = $math.round($math.sin(endAngle) * radiusY, 4);\n return lineTo({\n x: ax,\n y: ay\n });\n }\n\n for (var i = 0; i < segments; i++) {\n var endAngle = startAngle + arc / segments * (i + 1);\n var ax = $math.round($math.cos(endAngle) * radius + cx - pax, 4);\n var ay = $math.round($math.sin(endAngle) * radiusY + cy - pay, 4);\n path += \" a\" + radius + c + radiusY + c + 0 + c + 0 + c + l + c + ax + c + ay;\n pax = ax;\n pay = ay;\n }\n\n return path;\n}\n/**\r\n * Creates an arc path.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param startAngle [description]\r\n * @param arc [description]\r\n * @param radius [description]\r\n * @param innerRadius [description]\r\n * @param radiusY [description]\r\n * @param cornerRadius [description]\r\n * @param innerCornerRadius [description]\r\n * @return SVG path\r\n */\n\nexport function arc(startAngle, arc, radius, innerRadius, radiusY, cornerRadius, innerCornerRadius) {\n if (arc == 0) {\n return \"\";\n }\n\n if (!$type.isNumber(innerRadius)) {\n innerRadius = 0;\n }\n\n if (radius == 0 && innerRadius <= 0) {\n return \"\";\n }\n\n if (radius < innerRadius) {\n var temp = radius;\n radius = innerRadius;\n innerRadius = temp;\n\n if ($type.isNumber(radiusY)) {\n radiusY = radiusY / innerRadius * radius;\n }\n }\n\n arc = $math.min(arc, 360);\n\n if (arc == 360) {\n cornerRadius = 0;\n innerCornerRadius = 0;\n }\n\n var endAngle = startAngle + arc;\n var crSin = $math.sin($math.min(arc, 45) / 2);\n radiusY = $type.isNumber(radiusY) ? radiusY : radius;\n cornerRadius = cornerRadius || 0;\n innerCornerRadius = $type.isNumber(innerCornerRadius) ? innerCornerRadius : cornerRadius;\n var innerRadiusY = radiusY / radius * innerRadius;\n var cornerRadiusY = radiusY / radius * cornerRadius;\n var innerCornerRadiusY = radiusY / radius * innerCornerRadius;\n cornerRadius = $math.fitToRange(cornerRadius, 0, (radius - innerRadius) / 2);\n cornerRadiusY = $math.fitToRange(cornerRadiusY, 0, (radiusY - innerRadiusY) / 2);\n innerCornerRadius = $math.fitToRange(innerCornerRadius, 0, (radius - innerRadius) / 2);\n innerCornerRadiusY = $math.fitToRange(innerCornerRadiusY, 0, (radiusY - innerRadiusY) / 2);\n cornerRadius = $math.round($math.fitToRange(cornerRadius, 0, radius * crSin), 4);\n cornerRadiusY = $math.round($math.fitToRange(cornerRadiusY, 0, radiusY * crSin), 4);\n innerCornerRadius = $math.round($math.fitToRange(innerCornerRadius, 0, innerRadius * crSin), 4);\n innerCornerRadiusY = $math.round($math.fitToRange(innerCornerRadiusY, 0, innerRadiusY * crSin), 4);\n var crAngle = Math.asin(cornerRadius / radius / 2) * $math.DEGREES * 2;\n var crAngleY = Math.asin(cornerRadiusY / radiusY / 2) * $math.DEGREES * 2;\n\n if (innerRadius < innerCornerRadius) {\n innerRadius = innerCornerRadius;\n }\n\n if (innerRadiusY < innerCornerRadiusY) {\n innerRadiusY = innerCornerRadiusY;\n }\n\n var crInnerAngle = Math.asin(innerCornerRadius / innerRadius / 2) * $math.DEGREES * 2;\n var crInnerAngleY = Math.asin(innerCornerRadiusY / innerRadiusY / 2) * $math.DEGREES * 2;\n\n if (!$type.isNumber(crInnerAngle)) {\n crInnerAngle = 0;\n }\n\n if (!$type.isNumber(crInnerAngleY)) {\n crInnerAngleY = 0;\n }\n\n var middleAngle = startAngle + arc / 2;\n var mPoint = {\n x: $math.round($math.cos(middleAngle) * innerRadius, 4),\n y: $math.sin(middleAngle) * innerRadiusY\n };\n var a0 = {\n x: $math.cos(startAngle) * (innerRadius + innerCornerRadius),\n y: $math.sin(startAngle) * (innerRadiusY + innerCornerRadiusY)\n };\n var b0 = {\n x: $math.cos(startAngle) * (radius - cornerRadius),\n y: $math.sin(startAngle) * (radiusY - cornerRadiusY)\n };\n var c0 = {\n x: $math.cos(endAngle) * (radius - cornerRadius),\n y: $math.sin(endAngle) * (radiusY - cornerRadiusY)\n };\n var d0 = {\n x: $math.cos(endAngle) * (innerRadius + innerCornerRadius),\n y: $math.sin(endAngle) * (innerRadiusY + innerCornerRadiusY)\n };\n var b1 = {\n x: $math.cos(startAngle + crAngle) * radius,\n y: $math.sin(startAngle + crAngleY) * radiusY\n };\n var d1 = {\n x: $math.cos(endAngle - crInnerAngle) * innerRadius,\n y: $math.sin(endAngle - crInnerAngleY) * innerRadiusY\n }; // some magic math\n\n innerCornerRadius += innerCornerRadius * $math.sin(crInnerAngle / 2);\n innerCornerRadiusY += innerCornerRadiusY * $math.sin(crInnerAngleY / 2);\n\n if (crInnerAngle > (endAngle - startAngle) / 2) {\n d1 = mPoint;\n }\n\n var path = \"\"; // start from b if this is full circle\n\n if (arc == 360) {\n path = moveTo(b0);\n } // otherwise start from a\n else {\n path = moveTo(a0);\n path += lineTo(b0);\n path += arcToPoint(b1, cornerRadius, cornerRadiusY, true);\n } // draw arc\n\n\n path += arcTo(startAngle + crAngle, arc - 2 * crAngle, radius, radiusY); // draw inner arc\n\n if ($type.isNumber(innerRadius) && innerRadius != 0) {\n // move to B if this is full circle\n if (arc == 360 && cornerRadius == 0) {\n path += moveTo(d0);\n } // draw line otherwise\n else {\n path += arcToPoint(c0, cornerRadius, cornerRadiusY, true);\n path += lineTo(d0);\n path += arcToPoint(d1, innerCornerRadius, innerCornerRadiusY, true);\n }\n\n path += arcTo(endAngle - crInnerAngle, -(arc - 2 * crInnerAngle), innerRadius, innerRadiusY);\n\n if (arc < 360 || cornerRadius > 0) {\n path += arcToPoint(a0, innerCornerRadius, innerCornerRadiusY, true);\n }\n\n path += lineTo(a0);\n } else {\n path += arcToPoint(c0, cornerRadius, cornerRadiusY, true);\n\n if (arc < 360) {\n path += lineTo(a0);\n }\n }\n\n return path;\n}\n/**\r\n * Creates a path for an arc to specific coordinate.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param point Reference point\r\n * @param radius Radius\r\n * @param radiusY Vertical radius (for skewed arcs)\r\n * @param sweepFlag [description]\r\n * @param largeArcFlag [description]\r\n * @param xAxisRotation [description]\r\n * @return Arc path\r\n */\n\nexport function arcToPoint(point, radius, radiusY, sweepFlag, largeArcFlag, xAxisRotation) {\n if (radius == 0) {\n return \"\";\n }\n\n xAxisRotation = xAxisRotation || 0;\n largeArcFlag = Boolean(largeArcFlag);\n sweepFlag = Boolean(sweepFlag);\n var c = \",\";\n var sweepFlagValue = +sweepFlag; // converts to 1 or 0\n\n var largeArcFlagValue = +largeArcFlag; // converts to 1 or 0\n\n return \" A\" + radius + c + radiusY + c + xAxisRotation + c + largeArcFlagValue + c + sweepFlagValue + c + $math.round(point.x, 4) + c + $math.round(point.y, 4);\n}\n/**\r\n * Creates a new rectangle.\r\n *\r\n * @ignore Exclude from docs\r\n * @param width Width (px)\r\n * @param height Height (px)\r\n * @param x X position\r\n * @param y Y position\r\n * @return Rectangle\r\n */\n\nexport function rectangle(width, height, x, y) {\n if (!$type.isNumber(x)) {\n x = 0;\n }\n\n if (!$type.isNumber(y)) {\n y = 0;\n }\n\n return moveTo({\n x: x,\n y: y\n }) + lineTo({\n x: x + width,\n y: y\n }) + lineTo({\n x: x + width,\n y: y + height\n }) + lineTo({\n x: x,\n y: y + height\n }) + closePath();\n}\n/**\r\n * Converts a rectangle to an SVG path.\r\n *\r\n * @ignore Exclude from docs\r\n * @param rect Rectangle\r\n * @param ccw Counter-clockwise?\r\n * @return SVG path\r\n */\n\nexport function rectToPath(rect, ccw) {\n var c = \",\";\n var L = \" L\";\n\n if (ccw) {\n return \"M\" + rect.x + c + rect.y + L + rect.x + c + (rect.y + rect.height) + L + (rect.x + rect.width) + c + (rect.y + rect.height) + L + (rect.x + rect.width) + c + rect.y + L + rect.x + c + rect.y;\n } else {\n return \"M\" + rect.x + c + rect.y + L + (rect.x + rect.width) + c + rect.y + L + (rect.x + rect.width) + c + (rect.y + rect.height) + L + rect.x + c + (rect.y + rect.height) + L + rect.x + c + rect.y;\n }\n}\n/**\r\n * Converts SVG path to array of points.\r\n *\r\n * Note, this is experimental feature based on method which is deprecated\r\n * on some browsers and some browsers do not support it at all.\r\n *\r\n * You can save the output of this function, but not rely on it completely.\r\n */\n\nexport function pathToPoints(path, pointCount) {\n var paper = getGhostPaper();\n var svgPath = paper.add(\"path\").node;\n svgPath.setAttribute(\"d\", path);\n\n if (svgPath.getPointAtLength && svgPath.getTotalLength) {\n var length_1 = svgPath.getTotalLength();\n var toPoints = [];\n\n for (var i = 0; i < pointCount; i++) {\n var point = svgPath.getPointAtLength(i / pointCount * length_1);\n toPoints.push({\n x: point.x,\n y: point.y\n });\n }\n\n return toPoints;\n }\n\n svgPath.remove();\n}\nexport function spiralPoints(cx, cy, radius, radiusY, innerRadius, step, radiusStep, startAngle, endAngle) {\n if (!$type.isNumber(startAngle)) {\n startAngle = 0;\n }\n\n if (!$type.isNumber(startAngle)) {\n endAngle = startAngle;\n }\n\n var r = innerRadius + 0.01;\n var angle = startAngle * $math.RADIANS;\n var points = [];\n\n while (r < radius + radiusStep) {\n var stepSize = step;\n\n if (stepSize / 2 > r) {\n stepSize = 2 * r;\n }\n\n angle += 2 * Math.asin(stepSize / 2 / r);\n\n if (angle * $math.DEGREES > endAngle + (radius - innerRadius) / radiusStep * 360) {\n break;\n }\n\n var degrees = angle * $math.DEGREES;\n var point = {\n x: cx + r * Math.cos(angle),\n y: cy + r * radiusY / radius * Math.sin(angle)\n };\n points.push(point);\n r = innerRadius + degrees / 360 * radiusStep;\n }\n\n points.shift();\n return points;\n}\nexport function pointsToPath(points) {\n if (!points || points.length == 0) {\n return \"\";\n }\n\n var path = moveTo(points[0]);\n\n if (points && points.length > 0) {\n for (var i = 1; i < points.length; i++) {\n path += lineTo(points[i]);\n }\n }\n\n return path;\n}","/**\r\n * Polyline module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { color } from \"../utils/Color\";\nimport { registry } from \"../Registry\";\nimport * as $path from \"../rendering/Path\";\nimport * as $math from \"../utils/Math\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a polyline.\r\n *\r\n * @see {@link IPolylineEvents} for a list of available events\r\n * @see {@link IPolylineAdapters} for a list of available Adapters\r\n */\n\nvar Polyline =\n/** @class */\nfunction (_super) {\n __extends(Polyline, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Polyline() {\n var _this = _super.call(this) || this;\n /**\r\n * [_distance description]\r\n *\r\n * @todo Description\r\n */\n\n\n _this._distance = 0;\n _this.className = \"Polyline\";\n _this.element = _this.paper.add(\"path\");\n _this.shapeRendering = \"auto\";\n _this.fill = color();\n _this.strokeOpacity = 1;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Creats and adds an SVG path for the arc.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Polyline.prototype.makePath = function () {\n this._distance = 0;\n var segments = this.segments;\n\n if (segments && segments.length > 0) {\n var path = \"\";\n\n for (var i = 0, len = segments.length; i < len; i++) {\n var points = segments[i];\n\n if (points.length > 0) {\n path += $path.moveTo(points[0]);\n\n for (var p = 1; p < points.length; p++) {\n var point = points[p];\n path += $path.lineTo(point);\n this._distance += $math.getDistance(points[p - 1], point);\n }\n }\n }\n\n this.path = path;\n }\n\n this._realSegments = segments;\n };\n\n Object.defineProperty(Polyline.prototype, \"segments\", {\n /**\r\n * @return Segments\r\n */\n get: function get() {\n return this.getPropertyValue(\"segments\");\n },\n\n /**\r\n * A list of segment coordinates for the multi-part line.\r\n *\r\n * @todo Example\r\n * @param segments Segments\r\n */\n set: function set(segments) {\n this.setPropertyValue(\"segments\", segments);\n this.makePath();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Polyline.prototype, \"distance\", {\n /**\r\n * [distance description]\r\n *\r\n * @todo Description\r\n * @return [description]\r\n */\n get: function get() {\n return this._distance;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts relative position along the line (0-1) into pixel coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinates\r\n */\n\n Polyline.prototype.positionToPoint = function (position) {\n var deltaAngle = 0;\n\n if (position < 0) {\n position = Math.abs(position);\n deltaAngle = 180;\n }\n\n var segments = this._realSegments;\n\n if (segments) {\n var totalDistance = this.distance;\n var currentDistance = 0;\n var distanceAB = void 0;\n var positionA = 0;\n var positionB = 0;\n var pointA = void 0;\n var pointB = void 0;\n\n for (var s = 0; s < segments.length; s++) {\n var points = segments[s];\n\n if (points.length > 1) {\n for (var p = 1; p < points.length; p++) {\n pointA = points[p - 1];\n pointB = points[p];\n positionA = currentDistance / totalDistance;\n distanceAB = $math.getDistance(pointA, pointB);\n currentDistance += distanceAB;\n positionB = currentDistance / totalDistance;\n\n if (positionA <= position && positionB > position) {\n s = segments.length;\n break;\n }\n }\n } else if (points.length == 1) {\n pointA = points[0];\n pointB = points[0];\n positionA = 0;\n positionB = 1;\n }\n }\n\n if (pointA && pointB) {\n var positionAB = (position - positionA) / (positionB - positionA);\n var midPoint = $math.getMidPoint(pointA, pointB, positionAB);\n return {\n x: midPoint.x,\n y: midPoint.y,\n angle: deltaAngle + $math.getAngle(pointA, pointB)\n };\n }\n }\n\n return {\n x: 0,\n y: 0,\n angle: 0\n };\n };\n\n Object.defineProperty(Polyline.prototype, \"realSegments\", {\n /**\r\n * @ignore\r\n */\n get: function get() {\n return this._realSegments;\n },\n enumerable: true,\n configurable: true\n });\n return Polyline;\n}(Sprite);\n\nexport { Polyline };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Polyline\"] = Polyline;","/**\r\n * Module for a multi-part arched line.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Polyline } from \"./Polyline\";\nimport { registry } from \"../Registry\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $path from \"../../core/rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a multi-part arched line.\r\n *\r\n * @see {@link IPolyarcEvents} for a list of available events\r\n * @see {@link IPolyarcAdapters} for a list of available Adapters\r\n */\n\nvar Polyarc =\n/** @class */\nfunction (_super) {\n __extends(Polyarc, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Polyarc() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Polyarc\";\n _this.controlPointDistance = 0.5;\n _this.controlPointPosition = 0.5;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Creats and adds an SVG path for the arc.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Polyarc.prototype.makePath = function () {\n this._distance = 0;\n var segments = this.segments;\n\n if (segments && segments.length > 0) {\n var path = \"\";\n this._realSegments = [];\n\n for (var i = 0, len = segments.length; i < len; i++) {\n var points = segments[i];\n var realPoints = [];\n\n this._realSegments.push(realPoints);\n\n if (points.length > 0) {\n path += $path.moveTo(points[0]);\n\n for (var p = 1; p < points.length; p++) {\n var pointA = points[p - 1];\n var pointB = points[p];\n var distanceAB = $math.getDistance(pointB, pointA);\n var cpDistance = distanceAB * this.controlPointDistance;\n var controlPointPosition = this.controlPointPosition;\n var angle = -$math.getAngle(pointA, pointB);\n var cpx = pointA.x + (pointB.x - pointA.x) * controlPointPosition * 0.5 - cpDistance * $math.sin(angle);\n var cpy = pointA.y + (pointB.y - pointA.y) * controlPointPosition * 0.5 - cpDistance * $math.cos(angle);\n var controlPoint1 = {\n x: cpx,\n y: cpy\n };\n var cpx2 = pointA.x + (pointB.x - pointA.x) * controlPointPosition * 1.5 - cpDistance * $math.sin(angle);\n var cpy2 = pointA.y + (pointB.y - pointA.y) * controlPointPosition * 1.5 - cpDistance * $math.cos(angle);\n var controlPoint2 = {\n x: cpx2,\n y: cpy2\n };\n path += $path.cubicCurveTo(pointB, controlPoint1, controlPoint2); // we add a lot of points in order to get the position/angle later\n\n var stepCount = Math.ceil(distanceAB);\n var prevPoint = pointA;\n\n if (stepCount > 0) {\n for (var i_1 = 0; i_1 <= stepCount; i_1++) {\n var point = $math.getPointOnCubicCurve(pointA, pointB, controlPoint1, controlPoint2, i_1 / stepCount);\n realPoints.push(point);\n this._distance += $math.getDistance(prevPoint, point);\n prevPoint = point;\n }\n } else {\n realPoints.push(pointA);\n }\n }\n }\n }\n\n this.path = path;\n }\n };\n\n Object.defineProperty(Polyarc.prototype, \"controlPointPosition\", {\n /**\r\n * @return Position (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"controlPointPosition\");\n },\n\n /**\r\n * Relative position along the line the control point is. (0-1)\r\n *\r\n * @default 0.5\r\n * @param value Position (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"controlPointPosition\", value);\n this.makePath();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Polyarc.prototype, \"controlPointDistance\", {\n /**\r\n * @return Distance (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"controlPointDistance\");\n },\n\n /**\r\n * Relative distance of the control point. (0-1)\r\n *\r\n * Default is half the length of the line. (0.5)\r\n *\r\n * @default 0.5\r\n * @param value Distance (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"controlPointDistance\", value);\n this.makePath();\n },\n enumerable: true,\n configurable: true\n });\n return Polyarc;\n}(Polyline);\n\nexport { Polyarc };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Polyarc\"] = Polyarc;","/**\r\n * Morpher module contains functionality that allows morphing one polygon to\r\n * another.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObject } from \"../Base\";\nimport { Animation, AnimationDisposer } from \"../utils/Animation\";\nimport * as $math from \"../utils/Math\";\nimport * as $ease from \"../utils/Ease\";\nimport * as $type from \"../utils/Type\";\n/**\r\n * Morpher can be used to morph one polygon to some other polygon.\r\n */\n\nvar Morpher =\n/** @class */\nfunction (_super) {\n __extends(Morpher, _super);\n /**\r\n * Constructor.\r\n *\r\n * @param morphable An object to morph\r\n */\n\n\n function Morpher(morphable) {\n var _this = _super.call(this) || this;\n /**\r\n * A storage for measurements.\r\n */\n\n\n _this._bboxes = [];\n /**\r\n * Duration of the morphing animation in milliseconds.\r\n */\n\n _this.morphDuration = 800;\n /**\r\n * An easing function to use for morphing animation.\r\n *\r\n * @see {@link Ease}\r\n */\n\n _this.morphEasing = $ease.cubicOut;\n /**\r\n * If set to `true`, all separate parts of the multi-part polygon will\r\n * morph into a single circle or polygon when using built-in methods\r\n * `morphToCircle()` or `morphToPolygon()`.\r\n *\r\n * Otherwise each separate part of polygon will morph to individual target\r\n * circle or polgyon.\r\n */\n\n _this.morphToSingle = true;\n /**\r\n * A ratio to scale morphed object in relation to the source object.\r\n */\n\n _this.scaleRatio = 1;\n _this.className = \"Morpher\";\n _this.morphable = morphable;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Morphs a polygon to another polygon.\r\n *\r\n * @param toPoints Corner points of the target shape\r\n * @param duration Duration in milliseconds\r\n * @param easing Easing function\r\n * @return Animation\r\n */\n\n\n Morpher.prototype.morphToPolygon = function (toPoints, duration, easing) {\n var points = this.morphable.currentPoints;\n\n if (points && toPoints) {\n this.sortPoints(points);\n this.sortPoints(toPoints);\n this._morphFromPointsReal = [];\n this._morphToPointsReal = [];\n\n if (!$type.hasValue(duration)) {\n duration = this.morphDuration;\n }\n\n if (!$type.hasValue(easing)) {\n easing = this.morphEasing;\n }\n\n this._morphFromPointsReal = this.normalizePoints(toPoints, points);\n this._morphToPointsReal = this.normalizePoints(points, toPoints);\n this.morphable.currentPoints = this._morphFromPointsReal;\n var animation = new Animation(this, {\n property: \"morphProgress\",\n from: 0,\n to: 1\n }, duration, easing);\n\n this._disposers.push(animation);\n\n animation.start();\n return animation;\n }\n };\n /**\r\n * [normalizePoints description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param pointsA Point A\r\n * @param pointsB Point B\r\n * @return Normalized points\r\n */\n\n\n Morpher.prototype.normalizePoints = function (pointsA, pointsB) {\n for (var i = 0, len = pointsA.length; i < len; i++) {\n var surfaceA = pointsA[i][0];\n var holeA = pointsA[i][1];\n var bboxA = $type.getValue($math.getBBox(surfaceA));\n var middleX = bboxA.x + bboxA.width;\n var middleY = bboxA.y + bboxA.height; // check if we have the same in PointsB\n\n if (!pointsB[i]) {\n pointsB[i] = [];\n } // check if we have surface in pointsB\n\n\n if (surfaceA && !pointsB[i][0]) {\n pointsB[i][0] = [{\n x: middleX,\n y: middleY\n }, {\n x: middleX,\n y: middleY\n }];\n }\n\n if (pointsB[i][0]) {\n pointsB[i][0] = this.addPoints(pointsB[i][0], surfaceA.length);\n var distance = Infinity;\n var splitAt = 0;\n\n for (var a = 0; a < pointsB[i][0].length; a++) {\n var newDistance = $math.getDistance(pointsB[i][0][a], surfaceA[0]);\n\n if (newDistance < distance) {\n splitAt = a;\n distance = newDistance;\n }\n }\n\n var partA = pointsB[i][0].slice(0, splitAt);\n var partB = pointsB[i][0].slice(splitAt);\n pointsB[i][0] = partB.concat(partA);\n }\n\n if (holeA) {\n if (!pointsB[i][1]) {\n pointsB[i][1] = [{\n x: middleX,\n y: middleY\n }, {\n x: middleX,\n y: middleY\n }];\n }\n\n pointsB[i][1] = this.addPoints(pointsB[i][1], holeA.length);\n }\n }\n\n return pointsB;\n };\n /**\r\n * [sortPoints description]\r\n *\r\n * @ignore Exclude from doc\r\n * @todo Description\r\n * @param points [description]\r\n * @return common bbox of points\r\n */\n\n\n Morpher.prototype.sortPoints = function (points) {\n points.sort(function (a, b) {\n var bbox1 = $type.getValue($math.getBBox(a[0]));\n var bbox2 = $type.getValue($math.getBBox(b[0]));\n\n if (bbox1.width * bbox1.height > bbox2.width * bbox2.height) {\n return -1;\n } else {\n return 1;\n }\n });\n var bboxes = [];\n\n for (var i = 0, len = points.length; i < len; i++) {\n var surface = points[i][0];\n\n if (surface) {\n bboxes.push($type.getValue($math.getBBox(surface)));\n }\n }\n\n return $math.getCommonRectangle(bboxes);\n };\n /**\r\n * Morphs polygon to a circle (it is actually a polygon which makes a circle).\r\n *\r\n * @param radius Target circle radius (px)\r\n * @param duration Duration (ms)\r\n * @param easing Easing function\r\n * @return Animation\r\n */\n\n\n Morpher.prototype.morphToCircle = function (radius, duration, easing) {\n var points = this.morphable.points;\n var commonBBox = this.sortPoints(points);\n this._morphFromPointsReal = [];\n this._morphToPointsReal = [];\n\n if (!$type.hasValue(duration)) {\n duration = this.morphDuration;\n }\n\n if (!$type.hasValue(easing)) {\n easing = this.morphEasing;\n } // surface\n\n\n for (var i = 0, len = points.length; i < len; i++) {\n var surface = points[i][0];\n var hole = points[i][1];\n this._morphFromPointsReal[i] = [];\n this._morphToPointsReal[i] = [];\n\n if (surface) {\n var toPoints = surface;\n var fromPoints = surface;\n var bbox = $type.getValue($math.getBBox(fromPoints)); // this._bboxes[i];\n\n if (this.morphToSingle) {\n bbox = $type.getValue(commonBBox);\n }\n\n var middleX = bbox.x + bbox.width / 2;\n var middleY = bbox.y + bbox.height / 2;\n var realRadius = radius;\n\n if (!$type.isNumber(realRadius)) {\n realRadius = Math.min(bbox.width / 2, bbox.height / 2);\n }\n\n toPoints = []; // find angle for the first point\n\n var startAngle = $math.getAngle({\n x: middleX,\n y: middleY\n }, surface[0]);\n var count = 100;\n\n if (surface.length > count) {\n count = surface.length;\n }\n\n fromPoints = this.addPoints(surface, count);\n count = fromPoints.length; // add Points might increase number a bit\n\n var angle = 360 / (count - 1);\n\n for (var a = 0; a < count; a++) {\n var realAngle = angle * a + startAngle;\n var pointOnCircle = {\n x: middleX + realRadius * $math.cos(realAngle),\n y: middleY + realRadius * $math.sin(realAngle)\n };\n toPoints[a] = pointOnCircle;\n }\n\n if (hole && hole.length > 0) {\n for (var i_1 = 0, hlen = hole.length; i_1 < hlen; i_1++) {\n toPoints.push({\n x: middleX,\n y: middleY\n });\n }\n }\n\n this._morphFromPointsReal[i][0] = fromPoints;\n this._morphToPointsReal[i][0] = toPoints;\n }\n }\n\n this.morphable.currentPoints = this._morphFromPointsReal;\n var animation = new Animation(this, {\n property: \"morphProgress\",\n from: 0,\n to: 1\n }, duration, easing);\n\n this._disposers.push(animation);\n\n animation.start();\n return animation;\n };\n /**\r\n * [addPoints description]\r\n *\r\n * @ignore Exclude from doc\r\n * @todo Description\r\n * @param points [description]\r\n * @param mustHaveCount [description]\r\n * @return [description]\r\n */\n\n\n Morpher.prototype.addPoints = function (points, mustHaveCount) {\n var addToSegmentCount = Math.round(mustHaveCount / points.length);\n var newPoints = [];\n\n for (var i = 0, len = points.length; i < len; i++) {\n var point0 = points[i];\n var point1 = void 0;\n\n if (i == points.length - 1) {\n point1 = points[0];\n } else {\n point1 = points[i + 1];\n }\n\n newPoints.push(point0);\n\n for (var p = 1; p < addToSegmentCount; p++) {\n var percent = p / addToSegmentCount;\n var extraPoint = {\n x: point0.x + (point1.x - point0.x) * percent,\n y: point0.y + (point1.y - point0.y) * percent\n };\n newPoints.push(extraPoint);\n } // stop adding in case we already added more than left in original\n\n\n if (newPoints.length + points.length - i == mustHaveCount) {\n addToSegmentCount = 0;\n }\n }\n\n if (newPoints.length < mustHaveCount && points.length > 0) {\n var lastPoint = points[points.length - 1];\n\n for (var p = newPoints.length; p < mustHaveCount; p++) {\n // add same as last\n newPoints.push({\n x: lastPoint.x,\n y: lastPoint.y\n });\n }\n }\n\n return newPoints;\n };\n /**\r\n * Morphs polygon into a rectangular polygon.\r\n *\r\n * @param width Width of the target rectangle (px)\r\n * @param height Height of the target rectangle (px)\r\n * @param duration Duration (ms)\r\n * @param easing Easing function\r\n * @return Animation\r\n */\n\n\n Morpher.prototype.morphToRectangle = function (width, height, duration, easing) {\n var points = this.morphable.points;\n this.sortPoints(points);\n this._morphFromPointsReal = [];\n this._morphToPointsReal = [];\n\n if (!$type.hasValue(duration)) {\n duration = this.morphDuration;\n }\n\n if (!$type.hasValue(easing)) {\n easing = this.morphEasing;\n } //\t\tlet biggestBBox: IRectangle = this._bboxes[this._biggestIndex];\n // surface\n\n\n for (var i = 0, len = points.length; i < len; i++) {\n var surface = points[i][0];\n var hole = points[i][1];\n this._morphFromPointsReal[i] = [];\n this._morphToPointsReal[i] = [];\n\n if (surface) {\n var toPoints = surface;\n var fromPoints = surface;\n var bbox = this._bboxes[i]; // we only work with first area. TODO: maybe we should find the biggest one?\n\n if (this.morphToSingle) {//if (i != this._biggestIndex) {\n //\tbbox = { x: biggestBBox.x + biggestBBox.width / 2, y: biggestBBox.y + biggestBBox.height / 2, width: 0, height: 0 };\n //}\n }\n\n var x = bbox.x;\n var y = bbox.y;\n var realWidth = width;\n var realHeight = height;\n\n if (!$type.isNumber(realWidth)) {\n realWidth = bbox.width;\n }\n\n if (!$type.isNumber(realHeight)) {\n realHeight = bbox.height;\n }\n\n toPoints = [{\n x: x,\n y: y\n }, {\n x: x + realWidth,\n y: y\n }, {\n x: x + realWidth,\n y: y + realHeight\n }, {\n x: x,\n y: y + realHeight\n }];\n toPoints = this.addPoints(toPoints, surface.length); // if polygon has less points then count, add\n\n if (surface.length < 4) {\n for (var i_2 = surface.length; i_2 < 4; i_2++) {\n toPoints.push({\n x: surface[i_2].x,\n y: surface[i_2].y\n });\n }\n }\n\n if (hole && hole.length > 0) {\n var middleX = bbox.x + bbox.width / 2;\n var middleY = bbox.y + bbox.height / 2;\n\n for (var i_3 = 0, hlen = hole.length; i_3 < hlen; i_3++) {\n toPoints.push({\n x: middleX,\n y: middleY\n });\n }\n }\n\n this._morphFromPointsReal[i][0] = fromPoints;\n this._morphToPointsReal[i][0] = toPoints;\n }\n }\n\n this.morphable.currentPoints = this._morphFromPointsReal;\n var animation = new Animation(this, {\n property: \"morphProgress\",\n from: 0,\n to: 1\n }, duration, easing);\n\n this._disposers.push(animation);\n\n animation.start();\n return animation;\n };\n\n Object.defineProperty(Morpher.prototype, \"morphProgress\", {\n /**\r\n * Returns the progress of morph transition.\r\n *\r\n * @return Progress (0-1)\r\n */\n get: function get() {\n return this._morphProgress;\n },\n\n /**\r\n * Progress of the morph transition.\r\n *\r\n * Setting this will also trigger actual transformation.\r\n *\r\n * @param value Progress (0-1)\r\n */\n set: function set(value) {\n this._morphProgress = value;\n var currentPoints = [];\n\n if (value != null) {\n var fromPoints = this._morphFromPointsReal;\n var toPoints = this._morphToPointsReal;\n\n if (fromPoints != null && toPoints != null) {\n for (var i = 0, len = fromPoints.length; i < len; i++) {\n var currentArea = [];\n currentPoints.push(currentArea);\n var surfaceFrom = fromPoints[i][0];\n var holeFrom = fromPoints[i][1];\n var surfaceTo = toPoints[i][0];\n var holeTo = toPoints[i][1];\n\n if (surfaceFrom && surfaceFrom.length > 0 && surfaceTo && surfaceTo.length > 0) {\n var currentSurface = [];\n\n for (var i_4 = 0, slen = surfaceFrom.length; i_4 < slen; i_4++) {\n var point0 = surfaceFrom[i_4];\n var point1 = surfaceTo[i_4];\n var currentPoint = {\n x: point0.x + (point1.x * this.scaleRatio - point0.x) * value,\n y: point0.y + (point1.y * this.scaleRatio - point0.y) * value\n };\n currentSurface.push(currentPoint);\n }\n\n currentArea[0] = currentSurface;\n }\n\n if (holeFrom && holeFrom.length > 0 && holeTo && holeTo.length > 0) {\n var currentHole = [];\n\n for (var i_5 = 0, hlen = holeFrom.length; i_5 < hlen; i_5++) {\n var point0 = holeFrom[i_5];\n var point1 = holeTo[i_5];\n var currentPoint = {\n x: point0.x + (point1.x * this.scaleRatio - point0.x) * value,\n y: point0.y + (point1.y * this.scaleRatio - point0.y) * value\n };\n currentHole.push(currentPoint);\n }\n\n currentArea[1] = currentHole;\n }\n }\n }\n }\n\n this.morphable.currentPoints = currentPoints;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Restores the polygon to its original appearance.\r\n *\r\n * @param duration Duration (ms)\r\n * @param easing Easing function\r\n * @return Animation\r\n */\n\n Morpher.prototype.morphBack = function (duration, easing) {\n this._morphToPointsReal = this._morphFromPointsReal;\n this._morphFromPointsReal = this.morphable.currentPoints;\n\n if (!$type.hasValue(duration)) {\n duration = this.morphDuration;\n }\n\n if (!$type.hasValue(easing)) {\n easing = this.morphEasing;\n }\n\n var animation = new Animation(this, {\n property: \"morphProgress\",\n from: 0,\n to: 1\n }, duration, easing);\n\n this._disposers.push(animation);\n\n animation.start();\n return animation;\n };\n\n Object.defineProperty(Morpher.prototype, \"animations\", {\n /**\r\n * Returns a list of morph animations currently being played.\r\n *\r\n * @return List of animations\r\n */\n get: function get() {\n if (!this._animations) {\n this._animations = [];\n\n this._disposers.push(new AnimationDisposer(this._animations));\n }\n\n return this._animations;\n },\n enumerable: true,\n configurable: true\n });\n return Morpher;\n}(BaseObject);\n\nexport { Morpher };","/**\r\n * Polygon module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { Morpher } from \"../utils/Morpher\";\nimport { registry } from \"../Registry\";\nimport * as $path from \"../rendering/Path\";\nimport * as $type from \"../utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a polygon.\r\n *\r\n * @see {@link IPolygonEvents} for a list of available events\r\n * @see {@link IPolygonAdapters} for a list of available Adapters\r\n */\n\nvar Polygon =\n/** @class */\nfunction (_super) {\n __extends(Polygon, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Polygon() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Polygon\";\n _this.element = _this.paper.add(\"path\");\n _this.shapeRendering = \"auto\";\n _this._currentPoints = [];\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Polygon.prototype, \"points\", {\n /**\r\n * @return Polygon points\r\n */\n get: function get() {\n var points = this.getPropertyValue(\"points\");\n var path = this.path;\n\n if (path && (!points || points.length == 0)) {\n var valueStr = path.slice(1, path.length - 1);\n var segments = valueStr.split(\"ZM\");\n\n for (var s = 0; s < segments.length; s++) {\n var segment = segments[s];\n\n if (segment.length > 0) {\n var areaHole = segment.split(\"M\");\n var areaArr = areaHole[0];\n var holeArr = areaHole[1];\n\n if (areaArr && areaArr.length > 0) {\n var pointsArr = areaArr.split(\"L\");\n\n if (pointsArr.length > 0) {\n var area = [];\n var areaAndHole = [area];\n points.push(areaAndHole);\n\n for (var p = 0; p < pointsArr.length; p++) {\n var coords = pointsArr[p].split(\",\");\n area.push({\n x: +coords[0],\n y: +coords[1]\n });\n }\n\n if (holeArr && holeArr.length > 0) {\n var pointsArr_1 = holeArr.split(\"L\");\n\n if (pointsArr_1.length > 0) {\n var hole = [];\n areaAndHole.push(hole);\n\n for (var p = pointsArr_1.length - 1; p >= 0; p--) {\n var coords = pointsArr_1[p].split(\",\");\n hole.push({\n x: +coords[0],\n y: +coords[1]\n });\n }\n }\n }\n }\n }\n }\n }\n\n this.setPropertyValue(\"points\", points);\n this._currentPoints = points;\n }\n\n return points;\n },\n\n /**\r\n * An array of X/Y coordinates for each elbow of the polygon.\r\n *\r\n * @todo Example\r\n * @param points Polygon points\r\n */\n set: function set(points) {\n this.setPropertyValue(\"points\", points, true);\n this._currentPoints = points;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Polygon.prototype, \"currentPoints\", {\n /**\r\n * @return Polygon points\r\n */\n get: function get() {\n if ((!this._currentPoints || this._currentPoints.length == 0) && this.path) {\n this._currentPoints = this.points;\n }\n\n return this._currentPoints;\n },\n\n /**\r\n * Current points. Used when morphing the element, so that original `points`\r\n * are not overwritten.\r\n *\r\n * @param points Polygon points\r\n */\n set: function set(points) {\n if (this._currentPoints != points) {\n this._currentPoints = points;\n this.draw();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Polygon.prototype.draw = function () {\n var path = \"\";\n var points = this._currentPoints;\n var left;\n var right;\n var top;\n var bottom;\n\n if (points.length > 0) {\n // separate areas\n for (var i = 0, len = points.length; i < len; i++) {\n // surface\n var surface = points[i][0];\n var hole = points[i][1];\n\n if (surface && surface.length > 0) {\n var point = surface[0];\n path += $path.moveTo(point);\n\n for (var s = 0; s < surface.length; s++) {\n point = surface[s];\n path += $path.lineTo(point);\n\n if (!$type.isNumber(right) || right < point.x) {\n right = point.x;\n }\n\n if (!$type.isNumber(left) || left > point.x) {\n left = point.x;\n }\n\n if (!$type.isNumber(top) || top > point.y) {\n top = point.y;\n }\n\n if (!$type.isNumber(bottom) || bottom < point.y) {\n bottom = point.y;\n }\n }\n } // hole\n\n\n if (hole && hole.length > 0) {\n var point = hole[0];\n path += $path.moveTo(point);\n\n for (var h = 0, hlen = hole.length; h < hlen; h++) {\n point = hole[h];\n path += $path.lineTo(point);\n }\n }\n }\n\n if (path) {\n path += $path.closePath();\n }\n\n this.bbox.x = left;\n this.bbox.y = top;\n this.bbox.width = right - left;\n this.bbox.height = bottom - top;\n\n _super.prototype.setPath.call(this, path);\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n Polygon.prototype.setPath = function (value) {\n if (_super.prototype.setPath.call(this, value)) {\n this.points = [];\n this._bbox = this.group.getBBox();\n return true;\n }\n\n return false;\n };\n /**\r\n * Measures element\r\n */\n\n\n Polygon.prototype.measureElement = function () {// Overriding to avoid extra measurement.\n };\n\n Object.defineProperty(Polygon.prototype, \"centerPoint\", {\n /**\r\n * A calculated center point for the shape.\r\n *\r\n * @readonly\r\n * @return Center\r\n */\n get: function get() {\n return {\n x: this.bbox.x + this.bbox.width / 2,\n y: this.bbox.y + this.bbox.height / 2\n };\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Polygon.prototype, \"morpher\", {\n /**\r\n * A [[Morpher]] instance that is used to morph polygon into some other\r\n * shape.\r\n *\r\n * @readonly\r\n * @return Morpher instance\r\n */\n get: function get() {\n if (!this._morpher) {\n this._morpher = new Morpher(this);\n\n this._disposers.push(this._morpher);\n }\n\n return this._morpher;\n },\n enumerable: true,\n configurable: true\n });\n return Polygon;\n}(Sprite);\n\nexport { Polygon };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Polygon\"] = Polygon;","/**\r\n * Polyspline (smoothed line) module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Polyline } from \"./Polyline\";\nimport { registry } from \"../Registry\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $path from \"../../core/rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a polysline. (smoothed multi-sigment line)\r\n *\r\n * @see {@link IPolysplineEvents} for a list of available events\r\n * @see {@link IPolysplineAdapters} for a list of available Adapters\r\n */\n\nvar Polyspline =\n/** @class */\nfunction (_super) {\n __extends(Polyspline, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Polyspline() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Polyspline\";\n _this.tensionX = 0.5;\n _this.tensionY = 0.5;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Creats and adds an SVG path for the arc.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Polyspline.prototype.makePath = function () {\n this._distance = 0;\n var segments = this.segments;\n var tensionX = this.tensionX;\n var tensionY = this.tensionY;\n this.allPoints = [];\n\n if (segments && segments.length > 0) {\n var path = \"\";\n this._realSegments = [];\n\n for (var i = 0, len = segments.length; i < len; i++) {\n var points = segments[i];\n var realPoints = [];\n\n this._realSegments.push(realPoints);\n\n if (points.length > 0) {\n var first = points[0];\n var last = points[points.length - 1];\n var closed_1 = false;\n\n if ($math.round(first.x, 3) == $math.round(last.x) && $math.round(first.y) == $math.round(last.y)) {\n closed_1 = true;\n }\n\n path += $path.moveTo(points[0]);\n\n for (var p = 0; p < points.length - 1; p++) {\n var p0 = points[p - 1];\n var p1 = points[p];\n var p2 = points[p + 1];\n var p3 = points[p + 2];\n\n if (p === 0) {\n p0 = points[p];\n } else if (p == points.length - 2) {\n p3 = points[p + 1];\n }\n\n if (!p3) {\n p3 = p2;\n }\n\n if (p === 0) {\n if (closed_1) {\n p0 = points[points.length - 2];\n } else {\n p0 = points[i];\n }\n } else if (p == points.length - 2) {\n if (closed_1) {\n p3 = points[1];\n } else {\n p3 = points[p + 1];\n }\n }\n\n var controlPointA = $math.getCubicControlPointA(p0, p1, p2, p3, tensionX, tensionY);\n var controlPointB = $math.getCubicControlPointB(p0, p1, p2, p3, tensionX, tensionY);\n path += $path.cubicCurveTo(p2, controlPointA, controlPointB); // now split to small segments so that we could have positionToPoint later\n\n var stepCount = Math.ceil($math.getCubicCurveDistance(p1, p2, controlPointA, controlPointB, 20)) * 1.2;\n var prevPoint = p1;\n\n if (stepCount > 0) {\n // not good for curved charts\n //this.allPoints[0] = { x: points[0].x, y: points[0].y, angle: $math.getAngle(points[0], points[1]) };\n //realPoints.push(this.allPoints[0]);\n for (var s = 0; s <= stepCount; s++) {\n var point = $math.getPointOnCubicCurve(p1, p2, controlPointA, controlPointB, s / stepCount);\n\n if (point.x == prevPoint.x && point.y == prevPoint.y) {\n continue;\n }\n\n realPoints.push(point);\n var angle = $math.round($math.getAngle(prevPoint, point), 5); //this.allPoints.push({ x: point.x, y: point.y, angle: angle });\n\n this._distance += $math.getDistance(prevPoint, point);\n this.allPoints[Math.floor(this._distance)] = {\n x: point.x,\n y: point.y,\n angle: angle\n };\n prevPoint = point;\n }\n } else {\n realPoints.push(p0);\n }\n }\n }\n\n var allPoints = this.allPoints;\n\n if (allPoints.length > 1) {\n for (var i_1 = 0; i_1 < allPoints.length; i_1++) {\n if (!allPoints[i_1]) {\n if (i_1 > 1) {\n allPoints[i_1] = allPoints[i_1 - 1];\n } else {\n for (var k = 1; k < allPoints.length; k++) {\n if (allPoints[k]) {\n allPoints[i_1] = allPoints[k];\n break;\n }\n }\n }\n }\n }\n }\n }\n\n this.path = path;\n }\n };\n /**\r\n * Returns an index of the point that is closest to specified coordinates.\r\n *\r\n * @param point Reference point\r\n * @return Index\r\n */\n\n\n Polyspline.prototype.getClosestPointIndex = function (point) {\n var points = this.allPoints;\n var index;\n var closest = Infinity;\n\n if (points.length > 1) {\n for (var p = 1; p < points.length; p++) {\n var distance = $math.getDistance(point, points[p]);\n\n if (distance < closest) {\n index = p;\n closest = distance;\n }\n }\n }\n\n return index;\n };\n\n Object.defineProperty(Polyspline.prototype, \"tensionX\", {\n /**\r\n * @return Tension\r\n */\n get: function get() {\n return this.getPropertyValue(\"tensionX\");\n },\n\n /**\r\n * Horizontal tension for the spline.\r\n *\r\n * Used by the line smoothing algorithm.\r\n *\r\n * @default 0.5\r\n * @param value Tension\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tensionX\", value);\n this.makePath();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Polyspline.prototype, \"tensionY\", {\n /**\r\n * @return Tension\r\n */\n get: function get() {\n return this.getPropertyValue(\"tensionY\");\n },\n\n /**\r\n * Vertical tension for the spline.\r\n *\r\n * Used by the line smoothing algorithm.\r\n *\r\n * @default 0.5\r\n * @param value Tensions\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tensionY\", value, true);\n this.makePath();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts relative position along the line (0-1) into pixel coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinates\r\n */\n\n Polyspline.prototype.positionToPoint = function (position, extend) {\n var deltaAngle = 0;\n var allPoints = this.allPoints;\n var len = allPoints.length;\n\n if (!$type.isNumber(position)) {\n position = 0;\n }\n\n if (len > 1) {\n if (extend && len > 3) {\n if (position < 0) {\n if (position < -0.01) {\n position = -0.01;\n }\n\n var f0 = allPoints[0];\n var f1 = allPoints[1];\n var x = f0.x - (f0.x - f1.x) * len * position;\n var y = f0.y - (f0.y - f1.y) * len * position;\n return {\n x: x,\n y: y,\n angle: $math.getAngle(f0, f1)\n };\n } else if (position > 1) {\n if (position > 1.01) {\n position = 1.01;\n }\n\n var f0 = allPoints[allPoints.length - 2];\n var f1 = allPoints[allPoints.length - 3];\n var x = f0.x + (f0.x - f1.x) * len * (position - 1);\n var y = f0.y + (f0.y - f1.y) * len * (position - 1);\n return {\n x: x,\n y: y,\n angle: $math.getAngle(f0, {\n x: x,\n y: y\n })\n };\n } else if (position == 1) {\n var point_1 = allPoints[allPoints.length - 1];\n return {\n x: point_1.x,\n y: point_1.y,\n angle: point_1.angle\n };\n }\n } else {\n if (position < 0) {\n position = Math.abs(position);\n deltaAngle = 180;\n }\n\n if (position >= 1) {\n position = 0.9999999999999;\n }\n }\n\n var point = allPoints[Math.floor(position * len)];\n return {\n x: point.x,\n y: point.y,\n angle: point.angle + deltaAngle\n };\n } else if (len == 1) {\n var point = allPoints[0];\n return {\n x: point.x,\n y: point.y,\n angle: point.angle\n };\n } else {\n return {\n x: 0,\n y: 0,\n angle: 0\n };\n }\n };\n\n return Polyspline;\n}(Polyline);\n\nexport { Polyspline };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Polyspline\"] = Polyspline;","/**\r\n * Slice module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport * as $math from \"../utils/Math\";\nimport * as $path from \"../rendering/Path\";\nimport * as $type from \"../utils/Type\";\nimport * as $utils from \"../utils/Utils\";\nimport { Percent } from \"../utils/Percent\";\nimport { RadialGradient } from \"../rendering/fills/RadialGradient\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a wedged semi-circle - slice. Usually used for Pie/Donut charts.\r\n *\r\n * @see {@link ISliceEvents} for a list of available events\r\n * @see {@link ISliceAdapters} for a list of available Adapters\r\n */\n\nvar Slice =\n/** @class */\nfunction (_super) {\n __extends(Slice, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Slice() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"Slice\"; // Set defaults\n\n _this.setPropertyValue(\"cornerRadius\", 0);\n\n _this.setPropertyValue(\"startAngle\", 0);\n\n _this.setPercentProperty(\"innerRadius\", 0);\n\n _this.setPercentProperty(\"radius\", 0);\n\n _this.setPropertyValue(\"arc\", 0);\n\n _this.setPropertyValue(\"shiftRadius\", 0);\n\n _this.strokeOpacity = 1;\n\n _this.setPropertyValue(\"layout\", \"none\"); // Create a slice wedge element\n\n\n _this.slice = _this.createChild(Sprite);\n _this.slice.isMeasured = false;\n\n _this._disposers.push(_this.slice); //this.element.attr({ \"stroke-linejoin\": \"round\" });\n //this.element.attr({ \"stroke-linecap\": \"round\" });\n // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Slice.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var radiusY = this.radiusY;\n\n if (this.radius > 0 && radiusY == 0) {\n radiusY = 0.01;\n }\n\n this.slice.path = $path.arc(this.startAngle, this.arc, this.radius, this.pixelInnerRadius, radiusY, this.cornerRadius, this.innerCornerRadius);\n this.slice.invalidate();\n this.shiftRadius = this.shiftRadius;\n\n if (this.realFill instanceof RadialGradient) {\n this.updateGradient(this.realFill);\n }\n\n if (this.realStroke instanceof RadialGradient) {\n this.updateGradient(this.realStroke);\n }\n };\n\n Slice.prototype.updateGradient = function (gradient) {\n gradient.element.attr({\n \"gradientUnits\": \"userSpaceOnUse\"\n });\n gradient.element.attr({\n \"r\": this.radius\n });\n gradient.cx = 0;\n gradient.cy = 0;\n gradient.element.attr({\n radius: this.radius\n });\n };\n\n Object.defineProperty(Slice.prototype, \"bbox\", {\n /**\r\n * Returns bounding box (square) for this element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n get: function get() {\n if (this.definedBBox) {\n return this.definedBBox;\n }\n\n if (this.isMeasured) {\n var innerRect = $math.getArcRect(this.startAngle, this.startAngle + this.arc, this.pixelInnerRadius);\n var outerRect = $math.getArcRect(this.startAngle, this.startAngle + this.arc, this.radius);\n return $math.getCommonRectangle([innerRect, outerRect]);\n } else {\n return {\n x: 0,\n y: 0,\n width: 0,\n height: 0\n };\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"startAngle\", {\n /**\r\n * @return Angle (0-360)\r\n */\n get: function get() {\n return this.getPropertyValue(\"startAngle\");\n },\n\n /**\r\n * The angle at which left edge of the slice is drawn. (0-360)\r\n *\r\n * 0 is to the right of the center.\r\n *\r\n * @param value Angle (0-360)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"startAngle\", $math.normalizeAngle(value), true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"arc\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this.getPropertyValue(\"arc\");\n },\n\n /**\r\n * [arc description]\r\n *\r\n * @todo Description\r\n * @param value [description]\r\n */\n set: function set(value) {\n if (!$type.isNumber(value)) {\n value = 0;\n }\n\n this.setPropertyValue(\"arc\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"radius\", {\n /**\r\n * @return Radius (px)\r\n */\n get: function get() {\n var radius = this.getPropertyValue(\"radius\");\n\n if (!$type.isNumber(radius)) {\n radius = 0;\n }\n\n return radius;\n },\n\n /**\r\n * Radius of the slice in pixels.\r\n *\r\n * @param value Radius (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"radius\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"radiusY\", {\n /**\r\n * @return Vertical radius (0-1)\r\n */\n get: function get() {\n var value = this.getPropertyValue(\"radiusY\");\n\n if (!$type.isNumber(value)) {\n value = this.radius;\n }\n\n return value;\n },\n\n /**\r\n * Vertical radius for creating skewed slices.\r\n *\r\n * This is relevant to `radius`, e.g. 0.5 will set vertical radius to half\r\n * the `radius`.\r\n *\r\n * @param value Vertical radius (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"radiusY\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"innerRadius\", {\n /**\r\n * @return Radius (px or %)\r\n */\n get: function get() {\n return this.getPropertyValue(\"innerRadius\");\n },\n\n /**\r\n * Inner radius of the slice for creating cut out (donut) slices.\r\n *\r\n * @default 0\r\n * @param value Radius (px or %)\r\n */\n set: function set(value) {\n this.setPercentProperty(\"innerRadius\", value, true, false, 10, false);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"pixelInnerRadius\", {\n /**\r\n * @return Radius px\r\n */\n get: function get() {\n return $utils.relativeToValue(this.innerRadius, this.radius);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"cornerRadius\", {\n /**\r\n * @return Radius (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cornerRadius\");\n },\n\n /**\r\n * Radius of slice's outer corners in pixels.\r\n *\r\n * @default 0\r\n * @param value Radius (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"cornerRadius\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"innerCornerRadius\", {\n /**\r\n * @return Radius (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"innerCornerRadius\");\n },\n\n /**\r\n * Radius of slice's inner corners in pixels.\r\n *\r\n * @default 0\r\n * @param value Radius (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"innerCornerRadius\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"shiftRadius\", {\n /**\r\n * @return Radius shift\r\n */\n get: function get() {\n return this.getPropertyValue(\"shiftRadius\");\n },\n\n /**\r\n * Indicates how far (relatively to center) a slice should be moved.\r\n *\r\n * The value is relative to the radius of the slice. Meaning 0 no shift,\r\n * 1 - slice shifted outside by whole of its radius.\r\n *\r\n * @param value Radius shift\r\n */\n set: function set(value) {\n this.setPropertyValue(\"shiftRadius\", value);\n value = this.getPropertyValue(\"shiftRadius\");\n this.dx = value * this.radius * this.ix;\n this.dy = value * this.radiusY * this.iy;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"ix\", {\n /**\r\n * [ix description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @return [description]\r\n */\n get: function get() {\n return $math.cos(this.middleAngle);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"iy\", {\n /**\r\n * [iy description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @return [description]\r\n */\n get: function get() {\n return $math.sin(this.middleAngle);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice.prototype, \"middleAngle\", {\n /**\r\n * An angle of the slice's middle.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Angle\r\n */\n get: function get() {\n return this.startAngle + this.arc / 2;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * X coordinate for the slice tooltip.\r\n *\r\n * @return X\r\n */\n\n Slice.prototype.getTooltipX = function () {\n var value = this.getPropertyValue(\"tooltipX\");\n\n if ($type.isNumber(value)) {\n return value;\n }\n\n var p = 0.5;\n\n if (value instanceof Percent) {\n p = value.value;\n }\n\n var innerRadius = $utils.relativeToValue(this.innerRadius, this.radius);\n return this.ix * (innerRadius + (this.radius - innerRadius) * p);\n };\n /**\r\n * Y coordinate for the slice tooltip.\r\n *\r\n * @return Y\r\n */\n\n\n Slice.prototype.getTooltipY = function () {\n var value = this.getPropertyValue(\"tooltipY\");\n\n if ($type.isNumber(value)) {\n return value;\n }\n\n var p = 0.5;\n\n if (value instanceof Percent) {\n p = value.value;\n }\n\n var innerRadius = $utils.relativeToValue(this.innerRadius, this.radius);\n return this.iy * (innerRadius + (this.radius - innerRadius) * p) + this.slice.dy;\n };\n\n return Slice;\n}(Container);\n\nexport { Slice };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Slice\"] = Slice;","/**\r\n * Preloader module.\r\n *\r\n * Preloader is a progress indicator.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { Slice } from \"./Slice\";\nimport { Label } from \"./Label\";\nimport { registry } from \"../Registry\";\nimport { percent } from \"../../core/utils/Percent\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A class used to draw and display progress indicator.\r\n *\r\n * @see {@link IPreloaderEvents} for a list of available events\r\n * @see {@link IPreloaderAdapters} for a list of available Adapters\r\n */\n\nvar Preloader =\n/** @class */\nfunction (_super) {\n __extends(Preloader, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Preloader() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"Preloader\"; // Set dimensions\n\n _this.width = percent(100);\n _this.height = percent(100);\n var interfaceColors = new InterfaceColorSet(); // Create main container\n\n var sliceContainer = _this.createChild(Container);\n\n sliceContainer.shouldClone = false; // Add background (100%) slice\n\n var backgroundSlice = sliceContainer.createChild(Slice);\n backgroundSlice.shouldClone = false;\n backgroundSlice.radius = 53;\n backgroundSlice.arc = 360;\n backgroundSlice.fill = interfaceColors.getFor(\"fill\");\n backgroundSlice.fillOpacity = 0.8;\n backgroundSlice.innerRadius = 42;\n backgroundSlice.isMeasured = false;\n _this.backgroundSlice = backgroundSlice; // Add progress slice\n\n var progressSlice = sliceContainer.createChild(Slice);\n progressSlice.shouldClone = false;\n progressSlice.radius = 50;\n progressSlice.innerRadius = 45;\n progressSlice.fill = interfaceColors.getFor(\"alternativeBackground\");\n progressSlice.fillOpacity = 0.2;\n progressSlice.isMeasured = false;\n _this.progressSlice = progressSlice; // Add text label element\n\n var label = sliceContainer.createChild(Label);\n label.shouldClone = false;\n label.horizontalCenter = \"middle\";\n label.verticalCenter = \"middle\";\n label.isMeasured = false;\n label.fill = interfaceColors.getFor(\"text\");\n label.align = \"center\";\n label.valign = \"middle\";\n label.textAlign = \"middle\";\n label.fillOpacity = 0.4;\n _this.label = label; // Set defaults\n\n _this.background.opacity = 1;\n _this.background.fill = interfaceColors.getFor(\"background\");\n _this.contentAlign = \"center\";\n _this.contentValign = \"middle\";\n _this.delay = 300; // Create hidden state\n\n var hiddenState = _this.states.create(\"hidden\");\n\n hiddenState.properties.opacity = 0; // Hide by default\n\n _this.visible = false;\n\n _this.hide(0);\n\n _this.__disabled = true; // Make it disposable\n // @todo Maybe it's enough to just dispose `sliceContainer`?\n\n _this._disposers.push(_this.backgroundSlice);\n\n _this._disposers.push(_this.progressSlice);\n\n _this._disposers.push(_this.label);\n\n _this._disposers.push(sliceContainer);\n\n return _this;\n }\n\n Object.defineProperty(Preloader.prototype, \"progress\", {\n /**\r\n * @return Progress (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"progress\");\n },\n\n /**\r\n * Current preload progress. (0-1)\r\n *\r\n * * 0 - 0%\r\n * * 0.5 - 50%\r\n * * 1 - 100%\r\n *\r\n * Setting this to a value less than 1, will automatically reveal the\r\n * preloader, while setting it to 1 (100%) will hide it.\r\n *\r\n * @param value Progress (0-1)\r\n */\n set: function set(value) {\n var _this = this;\n\n this.__disabled = false;\n this.validateLayout(); // show not in center without this\n\n this.setPropertyValue(\"progress\", value);\n /*if (!this.visible && value == 1) {\r\n return;\r\n }*/\n\n this.progressSlice.arc = 360 * value;\n\n if (this.label) {\n this.label.text = Math.round(value * 100) + \"%\";\n }\n\n if (value >= 1) {\n // Cancel the timeout\n if (this._started) {\n this._started = undefined;\n } // TODO remove closure ?\n\n\n registry.events.once(\"enterframe\", function () {\n var animation = _this.hide();\n\n if (animation && !animation.isFinished()) {\n animation.events.once(\"animationended\", function () {\n _this.__disabled = true;\n });\n } else {\n _this.__disabled = true;\n }\n });\n this.interactionsEnabled = false;\n this.setPropertyValue(\"progress\", 0);\n } else if (value > 0) {\n if (this.delay) {\n if (!this._started) {\n this._started = new Date().getTime();\n } else if (this._started + this.delay <= new Date().getTime()) {\n this.__disabled = false;\n this.show();\n this.interactionsEnabled = true;\n }\n } else {\n this.__disabled = false;\n this.show();\n this.interactionsEnabled = true;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Preloader.prototype, \"delay\", {\n /**\r\n * @return Delay (ms)\r\n */\n get: function get() {\n return this.getPropertyValue(\"delay\");\n },\n\n /**\r\n * Delay display of preloader by X milliseconds.\r\n *\r\n * When loading starts (`progress` is set to <1) and finishes (`progress` is\r\n * set to 1) before `delay` ms, the loader is never shown.\r\n *\r\n * This is used to avoid brief flashing of the preload for very quick loads.\r\n *\r\n * @default 1000\r\n * @param value Delay (ms)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"delay\", value);\n },\n enumerable: true,\n configurable: true\n });\n return Preloader;\n}(Container);\n\nexport { Preloader };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Preloader\"] = Preloader;","/**\r\n * Resize button module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Button } from \"./Button\";\nimport { Sprite } from \"../Sprite\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { registry } from \"../Registry\";\nimport * as $path from \"../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a draggable resize/grip button.\r\n *\r\n * @see {@link IResizeButtonEvents} for a list of available events\r\n * @see {@link IResizeButtonAdapters} for a list of available Adapters\r\n */\n\nvar ResizeButton =\n/** @class */\nfunction (_super) {\n __extends(ResizeButton, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ResizeButton() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"ResizeButton\"; // Set defaults\n\n _this.orientation = \"horizontal\";\n _this.layout = \"absolute\";\n _this.horizontalCenter = \"middle\";\n _this.verticalCenter = \"middle\";\n _this.draggable = true;\n\n _this.padding(8, 8, 8, 8);\n\n _this.background.cornerRadius(20, 20, 20, 20); // Create an icon\n\n\n var icon = new Sprite();\n icon.element = _this.paper.add(\"path\");\n var path = $path.moveTo({\n x: -2,\n y: -6\n });\n path += $path.lineTo({\n x: -2,\n y: 6\n });\n path += $path.moveTo({\n x: 2,\n y: -6\n });\n path += $path.lineTo({\n x: 2,\n y: 6\n });\n icon.path = path;\n icon.pixelPerfect = true;\n icon.padding(0, 4, 0, 4);\n icon.stroke = new InterfaceColorSet().getFor(\"alternativeText\");\n icon.strokeOpacity = 0.7; //icon.align = \"center\";\n //icon.valign = \"middle\";\n\n _this.icon = icon;\n\n _this.label.dispose();\n\n _this.label = undefined; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(ResizeButton.prototype, \"orientation\", {\n /**\r\n * Use for setting of direction (orientation) of the resize button.\r\n *\r\n * Available options: \"horizontal\", \"vertical\".\r\n *\r\n * @param value Orientation\r\n */\n set: function set(value) {\n var icon = this.icon;\n\n if (icon) {\n if (value == \"horizontal\") {\n icon.rotation = 0;\n } else {\n icon.rotation = -90;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n return ResizeButton;\n}(Button);\n\nexport { ResizeButton };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ResizeButton\"] = ResizeButton;","/**\r\n * Zoom out button functionality.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Button } from \"./Button\";\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport * as $path from \"../rendering/Path\";\nimport * as $type from \"../../core/utils/Type\";\nimport { MouseCursorStyle } from \"../../core/interaction/Mouse\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a zoom out button.\r\n *\r\n * @see {@link ICloseButtonEvents} for a list of available events\r\n * @see {@link ICloseButtonAdapters} for a list of available Adapters\r\n */\n\nvar CloseButton =\n/** @class */\nfunction (_super) {\n __extends(CloseButton, _super);\n /**\r\n * Constructor\r\n */\n\n\n function CloseButton() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"CloseButton\";\n\n _this.padding(8, 8, 8, 8);\n\n _this.showSystemTooltip = true;\n _this.width = 30;\n _this.height = 30;\n var interfaceColors = new InterfaceColorSet();\n _this.cursorOverStyle = MouseCursorStyle.pointer;\n var background = _this.background;\n background.cornerRadius(20, 20, 20, 20);\n var bgc = interfaceColors.getFor(\"background\");\n background.fill = bgc;\n background.stroke = interfaceColors.getFor(\"primaryButton\");\n background.strokeOpacity = 1;\n background.strokeWidth = 1;\n var downColor = interfaceColors.getFor(\"primaryButtonActive\");\n var bhs = background.states.getKey(\"hover\");\n bhs.properties.strokeWidth = 3;\n bhs.properties.fill = bgc;\n var bds = background.states.getKey(\"down\");\n bds.properties.stroke = downColor;\n bds.properties.fill = bgc; // Create an icon\n\n var icon = new Sprite();\n icon.element = _this.paper.add(\"path\");\n icon.stroke = background.stroke;\n _this.icon = icon; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n CloseButton.prototype.validate = function () {\n _super.prototype.validate.call(this);\n\n var w = this.pixelWidth / 3;\n var h = this.pixelHeight / 3;\n var path = $path.moveTo({\n x: -w / 2,\n y: -h / 2\n });\n path += $path.lineTo({\n x: w / 2,\n y: h / 2\n });\n path += $path.moveTo({\n x: w / 2,\n y: -h / 2\n });\n path += $path.lineTo({\n x: -w / 2,\n y: h / 2\n });\n this.icon.path = path;\n this.invalidateLayout();\n };\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n CloseButton.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this);\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Close\");\n }\n };\n\n return CloseButton;\n}(Button);\n\nexport { CloseButton };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"CloseButton\"] = CloseButton;","/**\r\n * Functionality for drawing simple SwitchButtons.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { Label } from \"./Label\";\nimport { Button } from \"../elements/Button\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { Circle } from \"../../core/elements/Circle\";\nimport { percent } from \"../../core/utils/Percent\";\nimport { registry } from \"../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * SwitchButton class is capable of drawing a simple rectangular SwitchButton with\r\n * optionally rounded corners and an icon in it.\r\n *\r\n * @see {@link ISwitchButtonEvents} for a list of available events\r\n * @see {@link ISwitchButtonAdapters} for a list of available Adapters\r\n */\n\nvar SwitchButton =\n/** @class */\nfunction (_super) {\n __extends(SwitchButton, _super);\n /**\r\n * Constructor\r\n */\n\n\n function SwitchButton() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"SwitchButton\";\n _this.tooltipY = 0; // Set defaults\n\n _this.layout = \"horizontal\";\n _this.contentAlign = \"center\";\n _this.contentValign = \"middle\";\n\n _this.padding(8, 16, 8, 16);\n\n _this.setStateOnChildren = true;\n\n _this.states.create(\"active\");\n\n var interfaceColors = new InterfaceColorSet(); // Create the label element\n\n var leftLabel = new Label();\n leftLabel.fillOpacity = 0.3;\n var llas = leftLabel.states.create(\"active\");\n llas.properties.fillOpacity = 1;\n leftLabel.isActive = true;\n _this.leftLabel = leftLabel;\n var button = new Button();\n var circle = new Circle();\n button.contentValign = \"none\";\n button.padding(0, 0, 0, 0);\n circle.radius = 10;\n button.icon = circle;\n button.icon.valign = \"middle\";\n button.label = undefined;\n var p100 = percent(100);\n button.background.cornerRadius(p100, p100, p100, p100);\n button.width = circle.radius * 3.5;\n button.height = circle.radius * 2.1;\n button.marginLeft = 8;\n button.marginRight = 8;\n button.togglable = true;\n circle.dx = -circle.radius * 0.7;\n circle.fill = interfaceColors.getFor(\"primaryButton\");\n var hs = circle.states.create(\"hover\");\n hs.properties.fill = interfaceColors.getFor(\"primaryButtonHover\");\n var as = circle.states.create(\"active\");\n as.properties.fill = interfaceColors.getFor(\"primaryButtonActive\");\n as.properties.dx = circle.radius * 0.7;\n _this.switchButton = button;\n\n _this.events.on(\"toggled\", function () {\n _this.leftLabel.isActive = !_this.isActive;\n _this.rightLabel.isActive = _this.isActive;\n }); // Create the label element\n\n\n var rightLabel = new Label();\n rightLabel.fillOpacity = 0.3;\n var rlas = rightLabel.states.create(\"active\");\n rlas.properties.fillOpacity = 1;\n _this.rightLabel = rightLabel; // Set up accessibility\n // A Button should be always focusable\n\n _this.role = \"button\";\n _this.focusable = true;\n rightLabel.valign = \"middle\";\n leftLabel.valign = \"middle\";\n button.valign = \"middle\"; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(SwitchButton.prototype, \"leftLabel\", {\n /**\r\n * @return Left label element\r\n */\n get: function get() {\n return this._leftLabel;\n },\n\n /**\r\n * [[Label]] element to be used for left text.\r\n *\r\n * @param left label element\r\n */\n set: function set(label) {\n if (this._leftLabel) {\n this.removeDispose(this._leftLabel);\n }\n\n this._leftLabel = label;\n\n if (label) {\n label.parent = this;\n label.interactionsEnabled = false;\n label.shouldClone = false;\n\n this._disposers.push(this._leftLabel);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SwitchButton.prototype, \"rightLabel\", {\n /**\r\n * @return Rigth label element\r\n */\n get: function get() {\n return this._rightLabel;\n },\n\n /**\r\n * [[Label]] element to be used for left text.\r\n *\r\n * @param rigth label element\r\n */\n set: function set(label) {\n if (this._rightLabel) {\n this.removeDispose(this._rightLabel);\n }\n\n this._rightLabel = label;\n\n if (label) {\n label.parent = this;\n label.interactionsEnabled = false;\n label.shouldClone = false;\n\n this._disposers.push(this._rightLabel);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SwitchButton.prototype, \"switch\", {\n /**\r\n * @ignore\r\n * @deprecated Use `switchButton` instead\r\n */\n get: function get() {\n return this._switchButton;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SwitchButton.prototype, \"switchButton\", {\n /**\r\n * @return Button\r\n */\n get: function get() {\n return this._switchButton;\n },\n\n /**\r\n * A [[Button]] element for switch.\r\n *\r\n * @param Button\r\n */\n set: function set(button) {\n if (this._switchButton) {\n this.removeDispose(this._switchButton);\n }\n\n this._switchButton = button;\n\n if (button) {\n button.parent = this;\n button.shouldClone = false;\n\n this._disposers.push(this._switchButton);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies properties and other attributes.\r\n *\r\n * @param source Source\r\n */\n\n SwitchButton.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n if (source.leftLabel) {\n this.leftLabel.copyFrom(source.leftLabel);\n }\n\n if (source.rightLabel) {\n this.rightLabel.copyFrom(source.rightLabel);\n }\n\n if (source.switchButton) {\n this.switchButton.copyFrom(source.switchButton);\n }\n };\n\n return SwitchButton;\n}(Container);\n\nexport { SwitchButton };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"SwitchButton\"] = SwitchButton;","/**\r\n * Provides functionality used to build scrollbars.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { ResizeButton } from \"../elements/ResizeButton\";\nimport { Button } from \"../elements/Button\";\nimport { getInteraction } from \"../interaction/Interaction\";\nimport { MouseCursorStyle } from \"../interaction/Mouse\";\nimport { RoundedRectangle } from \"../elements/RoundedRectangle\";\nimport { registry } from \"../Registry\";\nimport { keyboard } from \"../utils/Keyboard\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { percent, Percent } from \"../utils/Percent\";\nimport * as $math from \"../utils/Math\";\nimport * as $ease from \"../utils/Ease\";\nimport * as $type from \"../utils/Type\";\nimport * as $utils from \"../utils/Utils\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Scrollbar is a generic control allowing to select a range of values or pan\r\n * the selection.\r\n *\r\n * @see {@link IScrollbarEvents} for a list of available events\r\n * @see {@link IScrollbarAdapters} for a list of available Adapters\r\n */\n\nvar Scrollbar =\n/** @class */\nfunction (_super) {\n __extends(Scrollbar, _super);\n /**\r\n * Construtor\r\n */\n\n\n function Scrollbar() {\n var _this = _super.call(this) || this;\n /**\r\n * Previously selected lower (start) value.\r\n */\n\n\n _this._previousStart = 0;\n /**\r\n * Previously selected upper (end) value.\r\n */\n\n _this._previousEnd = 1;\n /**\r\n * A value of previously selected lower value, used for doubleclick function.\r\n */\n\n _this._prevStart = 0;\n /**\r\n * A value of previously selected upper value, used for doubleclick function.\r\n */\n\n _this._prevEnd = 1;\n /**\r\n * Indicates if the Scrollbar is currently \"busy\" (animating and or\r\n * performing zoom by user interaction).\r\n */\n\n _this._isBusy = false;\n /**\r\n * [_skipRangeEvents description]\r\n *\r\n * @todo Description\r\n */\n\n _this._skipRangeEvents = false;\n /**\r\n * Update the selection when dragging the grips.\r\n *\r\n * If set to `false` selection will be updated only when the grip is\r\n * released.\r\n *\r\n * @default true\r\n */\n\n _this.updateWhileMoving = true;\n _this.className = \"Scrollbar\";\n _this.minHeight = 12;\n _this.minWidth = 12;\n _this.animationDuration = 0;\n _this.animationEasing = $ease.cubicOut;\n\n _this.margin(10, 10, 10, 10);\n\n var interfaceColors = new InterfaceColorSet(); // background is also container as it might contain graphs, grid, etc\n\n var background = _this.background;\n background.cornerRadius(10, 10, 10, 10);\n background.fill = interfaceColors.getFor(\"fill\");\n background.fillOpacity = 0.5; // Make system tooltips appear by default\n\n _this.showSystemTooltip = true;\n _this.startGrip = new ResizeButton();\n _this.endGrip = new ResizeButton(); // Default orientation...\n // ... is set in `applyInternalDefaults()` because it accesses `language`\n // and should only be started to access when parent is set\n // Set events\n\n _this.events.on(\"transformed\", function () {\n _this.updateThumb();\n }, _this, false); // Initial positions\n\n\n _this.start = 0;\n _this.end = 1; // Set roles\n\n _this.role = \"scrollbar\";\n _this.thumb.role = \"slider\";\n _this.thumb.readerLive = \"polite\";\n _this.startGrip.role = \"slider\";\n _this.endGrip.role = \"slider\"; // otherwise range changed won't be registered\n\n _this.events.once(\"inited\", function () {\n _this._previousStart = undefined;\n\n _this.dispatchRangeChange();\n }, undefined, false);\n\n _this.hideGrips = false;\n _this.orientation = \"horizontal\"; // Min/max values for accessibility\n\n _this.setSVGAttribute({\n \"aria-valuemin\": \"0\"\n });\n\n _this.setSVGAttribute({\n \"aria-valuemax\": \"100\"\n });\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n Scrollbar.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this); // Set screen reader tetxt accordingly\n\n\n if (this.orientation === \"horizontal\") {\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Use TAB to select grip buttons or left and right arrows to change selection\");\n }\n\n if (!$type.hasValue(this.thumb.readerDescription)) {\n this.thumb.readerDescription = this.language.translate(\"Use left and right arrows to move selection\");\n }\n\n if (!$type.hasValue(this.startGrip.readerDescription)) {\n this.startGrip.readerDescription = this.language.translate(\"Use left and right arrows to move left selection\");\n }\n\n if (!$type.hasValue(this.endGrip.readerDescription)) {\n this.endGrip.readerDescription = this.language.translate(\"Use left and right arrows to move right selection\");\n }\n\n this.readerOrientation = \"horizontal\";\n } else {\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Use TAB select grip buttons or up and down arrows to change selection\");\n }\n\n if (!$type.hasValue(this.thumb.readerDescription)) {\n this.thumb.readerDescription = this.language.translate(\"Use up and down arrows to move selection\");\n }\n\n if (!$type.hasValue(this.startGrip.readerDescription)) {\n this.startGrip.readerDescription = this.language.translate(\"Use up and down arrows to move upper selection\");\n }\n\n if (!$type.hasValue(this.endGrip.readerDescription)) {\n this.endGrip.readerDescription = this.language.translate(\"Use up and down arrows to move lower selection\");\n }\n\n this.readerOrientation = \"vertical\";\n }\n\n this.readerControls = this.baseSprite.uidAttr();\n };\n /**\r\n * Validates the layout of the scrollbar's elements.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.validateLayout = function () {\n this.updateSize();\n\n _super.prototype.validateLayout.call(this); // when size changes, need to update extremes\n\n\n this.updateExtremes();\n };\n /**\r\n * Update background for the scrollbar.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.processBackground = function () {\n _super.prototype.processBackground.call(this);\n\n var background = this.background;\n background.clickable = true;\n background.events.on(\"hit\", this.handleBgHit, this, undefined);\n };\n /**\r\n * Zooms to the particular place when clicked/tapped on the scrollbar\r\n * background.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n Scrollbar.prototype.handleBgHit = function (event) {\n this.makeBusy();\n var point = event.spritePoint;\n point = $utils.spritePointToSprite(point, this.background, this);\n var thumb = this.thumb;\n\n if (this.orientation == \"horizontal\") {\n var thumbX = point.x - thumb.pixelWidth / 2;\n thumbX = $math.fitToRange(thumbX, 0, this.innerWidth - thumb.pixelWidth);\n this._thumbAnimation = thumb.animate({\n property: \"x\",\n to: thumbX\n }, this.animationDuration, this.animationEasing);\n } else {\n var thumbY = point.y - thumb.pixelHeight / 2;\n thumbY = $math.fitToRange(thumbY, 0, this.innerHeight - thumb.pixelHeight);\n this._thumbAnimation = thumb.animate({\n property: \"y\",\n to: thumbY\n }, this.animationDuration, this.animationEasing);\n }\n\n if (this.animationDuration > 0) {\n this._thumbAnimation.events.on(\"animationended\", this.makeUnbusy, this, false);\n } else {\n this._thumb.validate();\n\n this.makeUnbusy();\n }\n };\n /**\r\n * Set scrollbar as busy. (currently zooming)\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.makeBusy = function () {\n this._isBusy = true;\n this._skipRangeEvents = false;\n\n if (this._unbusyTimeout) {\n this.removeDispose(this._unbusyTimeout);\n }\n\n this._unbusyTimeout = undefined;\n this.stopAnimations();\n };\n /**\r\n * Stops all animations, currently playing for the scrollbar.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.stopAnimations = function () {\n if (this._thumbAnimation) {\n this._thumbAnimation.stop(true);\n }\n\n if (this._zoomAnimation) {\n this._zoomAnimation.stop(true);\n }\n };\n /**\r\n * Cancels \"busy\" status of the Scrollbar.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.makeUnbusy = function () {\n /**\r\n * We cannot make Scrollbar not busy right after release, because then axes\r\n * will take over controll and Scrollbar will start to animate.\r\n * Theorethically, it's not right to set timeout by `animationDuration`,\r\n * however we can not know all the durations of elements we scroll, so we\r\n * assume that animation duration will be the same as\r\n * `interpolationDuration` or `rangeChange` duration.\r\n */\n this._unbusyTimeout = this.setTimeout(this.makeUnbusyReal.bind(this), this.animationDuration * 1.1);\n };\n /**\r\n * [makeUnbusyReal description]\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.makeUnbusyReal = function () {\n this._usingGrip = undefined;\n this._isBusy = false;\n\n if (!this.updateWhileMoving) {\n this.dispatchRangeChange();\n }\n };\n /**\r\n * Disptatches rangechanged event if it really changed\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.dispatchRangeChange = function () {\n if (this._previousEnd != this.end || this._previousStart != this.start) {\n this._previousStart = this.start;\n this._previousEnd = this.end;\n this.dispatch(\"rangechanged\");\n }\n };\n /**\r\n * Updates the \"thumb\" element. A draggable element between the grips.\r\n * @ignore\r\n */\n\n\n Scrollbar.prototype.updateThumb = function (dispatchEvents) {\n if (dispatchEvents === void 0) {\n dispatchEvents = true;\n }\n\n if (!this.parent) {\n return;\n }\n\n var thumb = this.thumb;\n var start = this.start;\n var end = this.end;\n var startGrip = this.startGrip;\n var endGrip = this.endGrip;\n\n if (this.orientation == \"horizontal\") {\n var innerWidth_1 = this.innerWidth;\n thumb.width = innerWidth_1 * (end - start);\n thumb.maxX = innerWidth_1 - thumb.pixelWidth;\n thumb.x = start * innerWidth_1;\n startGrip.moveTo({\n x: thumb.pixelX,\n y: 0\n }, undefined, undefined, true); // overrides dragging\n\n endGrip.moveTo({\n x: thumb.pixelX + thumb.pixelWidth,\n y: 0\n }, undefined, undefined, true);\n startGrip.readerTitle = this.language.translate(\"From %1\", undefined, this.adapter.apply(\"positionValue\", {\n value: Math.round(start * 100) + \"%\",\n position: start\n }).value);\n startGrip.readerValueNow = \"\" + Math.round(start * 100);\n startGrip.readerValueText = startGrip.readerTitle;\n endGrip.readerTitle = this.language.translate(\"To %1\", undefined, this.adapter.apply(\"positionValue\", {\n value: Math.round(end * 100) + \"%\",\n position: end\n }).value);\n endGrip.readerValueNow = \"\" + Math.round(end * 100);\n endGrip.readerValueText = endGrip.readerTitle;\n } else {\n var innerHeight_1 = this.innerHeight;\n thumb.height = innerHeight_1 * (end - start);\n thumb.maxY = innerHeight_1 - thumb.pixelHeight;\n thumb.y = (1 - end) * innerHeight_1;\n startGrip.moveTo({\n x: 0,\n y: thumb.pixelY + thumb.pixelHeight\n }, undefined, undefined, true);\n endGrip.moveTo({\n x: 0,\n y: thumb.pixelY\n }, undefined, undefined, true);\n startGrip.readerTitle = this.language.translate(\"To %1\", undefined, this.adapter.apply(\"positionValue\", {\n value: Math.round((1 - start) * 100) + \"%\",\n position: 1 - start\n }).value);\n startGrip.readerValueNow = \"\" + Math.round(start * 100);\n startGrip.readerValueText = startGrip.readerTitle;\n endGrip.readerTitle = this.language.translate(\"From %1\", undefined, this.adapter.apply(\"positionValue\", {\n value: Math.round((1 - end) * 100) + \"%\",\n position: 1 - end\n }).value);\n endGrip.readerValueNow = \"\" + Math.round(end * 100);\n endGrip.readerValueText = endGrip.readerTitle;\n } // Add accessibility\n\n\n thumb.readerTitle = this.language.translate(\"From %1 to %2\", undefined, this.adapter.apply(\"positionValue\", {\n value: Math.round(start * 100) + \"%\",\n position: start\n }).value, this.adapter.apply(\"positionValue\", {\n value: Math.round(end * 100) + \"%\",\n position: end\n }).value);\n thumb.readerValueNow = \"\" + Math.round(start * 100);\n thumb.readerValueText = thumb.readerTitle;\n this.readerValueNow = \"\" + Math.round(start * 100);\n this.readerValueText = thumb.readerTitle;\n\n if (!this._skipRangeEvents && this.updateWhileMoving && dispatchEvents) {\n this.dispatchRangeChange();\n }\n };\n /**\r\n * Updates extremes of the scrollbar.\r\n */\n\n\n Scrollbar.prototype.updateExtremes = function () {\n var orientation = this.orientation;\n var minX = 0;\n var minY = 0;\n var maxX = 0;\n var maxY = 0;\n\n if (orientation == \"horizontal\") {\n maxX = this.innerWidth;\n minY = maxY = this.innerHeight / 2;\n } else {\n maxY = this.innerHeight;\n minX = maxX = this.innerWidth / 2;\n }\n\n var startGrip = this.startGrip;\n startGrip.minX = minX;\n startGrip.maxX = maxX;\n startGrip.minY = minY;\n startGrip.maxY = maxY;\n var endGrip = this.endGrip;\n endGrip.minX = minX;\n endGrip.maxX = maxX;\n endGrip.minY = minY;\n endGrip.maxY = maxY;\n var thumb = this.thumb;\n thumb.minX = minX;\n thumb.maxX = maxX;\n thumb.minY = minY;\n thumb.maxY = maxY;\n };\n /**\r\n * Updates size of the scrollbar.\r\n */\n\n\n Scrollbar.prototype.updateSize = function () {\n var orientation = this.orientation;\n var startGrip = this.startGrip;\n\n if (startGrip) {\n startGrip.orientation = orientation;\n }\n\n if (this.endGrip) {\n this.endGrip.orientation = orientation;\n }\n\n var thumb = this.thumb;\n\n if (thumb) {\n if (orientation == \"horizontal\") {\n if (!$type.isNumber(this._pixelWidth)) {\n if (!(this.width instanceof Percent)) {\n this.width = percent(100);\n }\n } // this teorethically might be wrong, if user indeed sets height of a horizontal scrollbar in percent\n // however without this height might be equal to 100% if previous orientation was set to horizontal\n // so this is ok solution, in case user really wants to have scrollbar height set in percent,\n // he should do this after orientation.\n\n\n if ($type.hasValue(this.percentHeight)) {\n this.height = this.minHeight;\n }\n\n thumb.height = this.innerHeight;\n thumb.verticalCenter = \"middle\";\n thumb.horizontalCenter = \"left\";\n } else {\n if (!$type.isNumber(this._pixelHeight)) {\n if (!(this.height instanceof Percent)) {\n this.height = percent(100);\n }\n } // same as above with percentHeight\n\n\n if ($type.hasValue(this.percentWidth)) {\n this.width = this.minWidth;\n }\n\n thumb.width = this.innerWidth;\n thumb.verticalCenter = \"top\";\n thumb.horizontalCenter = \"middle\";\n }\n }\n };\n\n Object.defineProperty(Scrollbar.prototype, \"isBusy\", {\n /**\r\n * Indicates if the Scrollbar is currently \"busy\" (animating and or\r\n * performing zoom by user interaction).\r\n * @return boolean\r\n */\n get: function get() {\n return this._isBusy;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"start\", {\n /**\r\n * @return Position (0-1)\r\n */\n get: function get() {\n return Math.min(this.getPosition(this._start), this.getPosition(this._end));\n },\n\n /**\r\n * ==========================================================================\r\n * POSITIONS\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Relative position (0-1) of the start grip.\r\n *\r\n * @param position Position (0-1)\r\n */\n set: function set(position) {\n if (!this._isBusy) {\n this.__start = position;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"__start\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this._start;\n },\n\n /**\r\n * [__start description]\r\n *\r\n * @todo Description\r\n * @param position [description]\r\n */\n set: function set(position) {\n this._start = this.getPosition(position);\n this.updateThumb();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"end\", {\n /**\r\n * @return Position (0-1)\r\n */\n get: function get() {\n return Math.max(this.getPosition(this._start), this.getPosition(this._end));\n },\n\n /**\r\n * Relative position (0-1) of the end grip.\r\n *\r\n * @param position Position (0-1)\r\n */\n set: function set(position) {\n if (!this._isBusy) {\n this.__end = position;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"__end\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this._end;\n },\n\n /**\r\n * [__end description]\r\n *\r\n * @todo Description\r\n * @param position [description]\r\n */\n set: function set(position) {\n this._end = this.getPosition(position);\n this.updateThumb();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"range\", {\n /**\r\n * Current selection range.\r\n *\r\n * @readonly\r\n * @return Range\r\n */\n get: function get() {\n return {\n start: this.start,\n end: this.end,\n priority: this._usingGrip\n };\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Disables range change events.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Scrollbar.prototype.skipRangeEvents = function () {\n if (!this._isBusy) {\n this._skipRangeEvents = true;\n }\n };\n /**\r\n * [fixRange description]\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n * @param range Range\r\n */\n\n\n Scrollbar.prototype.fixRange = function (range) {\n if (range.start != $math.round(this._start, 2) || range.end != $math.round(this._end, 2)) {\n this._start = range.start;\n this._end = range.end;\n this._skipRangeEvents = true;\n this.updateThumb();\n this._skipRangeEvents = false;\n this.thumb.validate();\n this.thumb.background.validate();\n }\n };\n /**\r\n * [getPosition description]\r\n *\r\n * @todo Description\r\n * @param position [description]\r\n * @return [description]\r\n */\n\n\n Scrollbar.prototype.getPosition = function (position) {\n return $math.fitToRange($math.round(position, 4), 0, 1);\n };\n\n Object.defineProperty(Scrollbar.prototype, \"orientation\", {\n /**\r\n * @return Orientation\r\n */\n get: function get() {\n return this.getPropertyValue(\"orientation\");\n },\n\n /**\r\n * ==========================================================================\r\n * MISC\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Orientation of the scrollbar.\r\n *\r\n * Available options: \"horizontal\" (default) and \"vertical\".\r\n *\r\n * @default \"horizontal\"\r\n * @param value Orientation\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"orientation\", value)) {\n // Set mouse cursors and screen reader tetxt accordingly\n if (value === \"horizontal\") {\n // Mouse styles\n this.startGrip.cursorOverStyle = MouseCursorStyle.horizontalResize;\n this.endGrip.cursorOverStyle = MouseCursorStyle.horizontalResize; // Reader text\n\n /*this.readerTitle = this.language.translate(\"Use TAB to select grip buttons or left and right arrows to change selection\");\r\n this.thumb.readerDescription = this.language.translate(\"Use left and right arrows to move selection\");\r\n this.startGrip.readerDescription = this.language.translate(\"Use left and right arrows to move left selection\");\r\n this.endGrip.readerDescription = this.language.translate(\"Use left and right arrows to move right selection\");*/\n } else {\n // Mouse styles\n this.startGrip.cursorOverStyle = MouseCursorStyle.verticalResize;\n this.endGrip.cursorOverStyle = MouseCursorStyle.verticalResize; // Reader text\n\n /*this.readerTitle = this.language.translate(\"Use TAB select grip buttons or up and down arrows to change selection\");\r\n this.thumb.readerDescription = this.language.translate(\"Use up and down arrows to move selection\");\r\n this.startGrip.readerDescription = this.language.translate(\"Use up and down arrows to move upper selection\");\r\n this.endGrip.readerDescription = this.language.translate(\"Use up and down arrows to move lower selection\");*/\n }\n\n this.updateByOrientation();\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n Scrollbar.prototype.updateByOrientation = function () {};\n\n Object.defineProperty(Scrollbar.prototype, \"startGrip\", {\n /**\r\n * @return Grip element\r\n */\n get: function get() {\n return this._startGrip;\n },\n\n /**\r\n * ==========================================================================\r\n * GRIPS\r\n * ==========================================================================\r\n * @hidden\r\n */\n\n /**\r\n * Start grip element. (button)\r\n *\r\n * @param button Grip element\r\n */\n set: function set(button) {\n if (this._startGrip) {\n this.removeDispose(this._startGrip);\n }\n\n this._startGrip = button;\n this.processGrip(button);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"endGrip\", {\n /**\r\n * @return Grip element\r\n */\n get: function get() {\n return this._endGrip;\n },\n\n /**\r\n * End grip element. (button)\r\n *\r\n * @param button Grip element\r\n */\n set: function set(button) {\n if (this._endGrip) {\n this.removeDispose(this._endGrip);\n }\n\n this._endGrip = button;\n this.processGrip(button);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Decorates the grip button with properties and events.\r\n *\r\n * @ignore Exclude from docs\r\n * @param button Grip button\r\n */\n\n Scrollbar.prototype.processGrip = function (button) {\n button.parent = this;\n button.isMeasured = false;\n button.focusable = true;\n button.shouldClone = false; // Set button defaults\n //button.showSystemTooltip = true; // setting this here is not right because we break inheritance\n\n button.zIndex = 100;\n button.events.on(\"drag\", this.handleGripDrag, this, false);\n button.events.on(\"dragstop\", this.makeUnbusy, this, false);\n button.events.on(\"down\", this.makeBusy, this, false);\n button.events.on(\"up\", this.makeUnbusy, this, false);\n\n this._disposers.push(button);\n };\n /**\r\n * Updates positions of related elements after grip element is dragged.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n Scrollbar.prototype.handleGripDrag = function (event) {\n this.makeBusy();\n\n if (event.target === this._startGrip) {\n this._usingGrip = \"start\";\n } else {\n this._usingGrip = \"end\";\n }\n\n if (this.orientation == \"horizontal\") {\n this._start = this.startGrip.pixelX / this.innerWidth;\n this._end = this.endGrip.pixelX / this.innerWidth;\n } else {\n this._start = 1 - this.startGrip.pixelY / this.innerHeight;\n this._end = 1 - this.endGrip.pixelY / this.innerHeight;\n }\n\n this.updateThumb();\n };\n\n Object.defineProperty(Scrollbar.prototype, \"thumb\", {\n /**\r\n * @return Thumb element\r\n */\n get: function get() {\n if (!this._thumb) {\n // Create scrollbar controls (setters will handle adding disposers)\n var thumb = new Button();\n thumb.background.cornerRadius(10, 10, 10, 10);\n thumb.padding(0, 0, 0, 0);\n this.thumb = thumb;\n }\n\n return this._thumb;\n },\n\n /**\r\n * A \"thumb\" element.\r\n *\r\n * It's a draggable square space between the grips, that can be used to\r\n * pan the selection.\r\n *\r\n * @param thumb Thumb element\r\n */\n set: function set(thumb) {\n var _this = this;\n\n if (thumb) {\n if (this._thumb) {\n this.removeDispose(this._thumb);\n }\n\n this._thumb = thumb;\n thumb.parent = this;\n thumb.isMeasured = false;\n thumb.inert = true;\n thumb.draggable = true;\n thumb.clickable = true;\n thumb.hoverable = true;\n thumb.focusable = true;\n thumb.shouldClone = false;\n thumb.zIndex = 0; // TODO remove closures ?\n // Add events\n // Add cursor styles to thumb\n\n thumb.cursorOverStyle = MouseCursorStyle.grab;\n thumb.cursorDownStyle = MouseCursorStyle.grabbing;\n thumb.events.on(\"dragstart\", this.makeBusy, this, false);\n thumb.events.on(\"dragstop\", this.makeUnbusy, this, false);\n thumb.events.on(\"positionchanged\", this.handleThumbPosition, this, false);\n thumb.events.on(\"sizechanged\", this.handleThumbPosition, this, false);\n thumb.events.on(\"doublehit\", this.handleDoubleClick, this, false); // Add event for space and ENTER to toggle full zoom out and back\n // (same as doubleclick)\n\n this._disposers.push(getInteraction().body.events.on(\"keyup\", function (ev) {\n if (keyboard.isKey(ev.event, [\"space\", \"enter\"]) && _this.thumb.isFocused) {\n ev.event.preventDefault();\n\n _this.handleDoubleClick();\n }\n }));\n\n this._disposers.push(this._thumb);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Zooms-in and out the selection on double-click of the thumb.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Scrollbar.prototype.handleDoubleClick = function () {\n this.makeBusy();\n var newStart = 0;\n var newEnd = 1;\n\n if (this.start != 0 || this.end != 1) {\n this._prevStart = this.start;\n this._prevEnd = this.end;\n } else {\n newStart = this._prevStart;\n newEnd = this._prevEnd;\n }\n\n var zoomAnimation = this.animate([{\n property: \"__start\",\n to: newStart\n }, {\n property: \"__end\",\n to: newEnd\n }], this.animationDuration, this.animationEasing);\n\n if (zoomAnimation && !zoomAnimation.isFinished()) {\n zoomAnimation.events.on(\"animationended\", this.makeUnbusy, this, false);\n this._zoomAnimation = zoomAnimation;\n } else {\n this.makeUnbusy();\n }\n };\n /**\r\n * Updates positions of other elements when thumb is moved.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Scrollbar.prototype.handleThumbPosition = function () {\n var thumb = this.thumb;\n\n if (this.orientation == \"horizontal\") {\n var innerWidth_2 = this.innerWidth;\n var w = thumb.innerWidth;\n var x = thumb.pixelX;\n this._start = x / innerWidth_2;\n this._end = (x + w) / innerWidth_2;\n this.updateThumb();\n } else {\n var innerHeight_2 = this.innerHeight;\n var h = thumb.innerHeight;\n var y = thumb.pixelY;\n this._start = 1 - (y + h) / innerHeight_2;\n this._end = 1 - y / innerHeight_2;\n this.updateThumb();\n }\n };\n /**\r\n * Creates a background element for the scrollbar.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Background\r\n */\n\n\n Scrollbar.prototype.createBackground = function () {\n return new RoundedRectangle();\n };\n\n Object.defineProperty(Scrollbar.prototype, \"hideGrips\", {\n /**\r\n * @return Show only on hover?\r\n */\n get: function get() {\n return this._hideGrips;\n },\n\n /**\r\n * Use this property to set whether grips should be always visible (`false`),\r\n * or they should just appear on scrollbar hover (`true`).\r\n *\r\n * @param value Show only on hover?\r\n */\n set: function set(value) {\n var _this = this;\n\n this._hideGrips = value;\n\n if (this._overDisposer) {\n this.removeDispose(this._overDisposer);\n }\n\n if (this._outDisposer) {\n this.removeDispose(this._outDisposer);\n }\n\n if (value) {\n this._overDisposer = this.events.on(\"over\", function () {\n _this.startGrip.show();\n\n _this.endGrip.show();\n }, undefined, false);\n this._outDisposer = this.events.on(\"out\", function () {\n _this.startGrip.hide();\n\n _this.endGrip.hide();\n }, undefined, false);\n this.startGrip.hide();\n this.endGrip.hide();\n } else {\n this.startGrip.show();\n this.endGrip.show();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"animationDuration\", {\n /**\r\n * @return Orientation\r\n */\n get: function get() {\n return this.getPropertyValue(\"animationDuration\");\n },\n\n /**\r\n * Duration in milliseconds of scrollbar animation (happens when user clicks on a background of a scrollbar)\r\n * @default 0\r\n * @param value number\r\n */\n set: function set(value) {\n this.setPropertyValue(\"animationDuration\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Scrollbar.prototype, \"animationEasing\", {\n /**\r\n * @return {Function}\r\n */\n get: function get() {\n return this.getPropertyValue(\"animationEasing\");\n },\n\n /**\r\n * Animation easing function.\r\n * @todo: review description and default\r\n * @default $ease.cubicOut\r\n * @param value (value: number) => number\r\n */\n set: function set(value) {\n this.setPropertyValue(\"animationEasing\", value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Adds easing functions to \"function\" fields.\r\n *\r\n * @param field Field name\r\n * @return Assign as function?\r\n */\n\n Scrollbar.prototype.asFunction = function (field) {\n return field == \"animationEasing\" || _super.prototype.asIs.call(this, field);\n };\n\n return Scrollbar;\n}(Container);\n\nexport { Scrollbar };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Scrollbar\"] = Scrollbar;","/**\r\n * Slider is a scrollbar with just one selection grip.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Scrollbar } from \"../../core/elements/Scrollbar\";\nimport { registry } from \"../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a slider - a version of scrollbar with just one grip.\r\n *\r\n * @see {@link ISliderEvents} for a list of available events\r\n * @see {@link ISliderAdapters} for a list of available Adapters\r\n */\n\nvar Slider =\n/** @class */\nfunction (_super) {\n __extends(Slider, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Slider() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Slider\";\n _this.thumb.opacity = 0;\n _this.thumb.interactionsEnabled = false;\n _this.endGrip.opacity = 0;\n _this.endGrip.interactionsEnabled = false;\n\n _this.startGrip.events.on(\"drag\", function () {\n _this.endGrip.x = _this.startGrip.x;\n _this.endGrip.y = _this.startGrip.y;\n });\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Slider.prototype, \"__end\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this._start;\n },\n set: function set(value) {},\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slider.prototype, \"end\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this._start;\n },\n\n /**\r\n * Relative position (0-1) of the end grip.\r\n *\r\n * @param position Position (0-1)\r\n */\n set: function set(position) {},\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slider.prototype, \"start\", {\n /**\r\n * @return Position (0-1)\r\n */\n get: function get() {\n return this._start;\n },\n\n /**\r\n * Relative position (0-1) of the start grip.\r\n *\r\n * @param position Position (0-1)\r\n */\n set: function set(position) {\n if (!this._isBusy) {\n this.__start = position;\n }\n },\n enumerable: true,\n configurable: true\n });\n return Slider;\n}(Scrollbar);\n\nexport { Slider };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Slider\"] = Slider;","/**\r\n * A module that defines Text element used to indicate links.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Label } from \"../../core/elements/Label\";\nimport { MouseCursorStyle } from \"../../core/interaction/Mouse\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { registry } from \"../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a text element with a link.\r\n *\r\n * @see {@link ITextLinkEvents} for a list of available events\r\n * @see {@link ITextLinkAdapters} for a list of available Adapters\r\n */\n\nvar TextLink =\n/** @class */\nfunction (_super) {\n __extends(TextLink, _super);\n /**\r\n * Constructor\r\n */\n\n\n function TextLink() {\n var _this = _super.call(this) || this;\n\n _this.className = \"TextLink\";\n _this.selectable = true;\n var interfaceColors = new InterfaceColorSet();\n _this.fill = interfaceColors.getFor(\"primaryButton\").brighten(0.3);\n\n var hoverState = _this.states.create(\"hover\");\n\n hoverState.properties.fill = interfaceColors.getFor(\"primaryButtonHover\").brighten(0.3);\n\n var downState = _this.states.create(\"down\");\n\n downState.properties.fill = interfaceColors.getFor(\"primaryButtonDown\").brighten(0.3);\n _this.cursorOverStyle = MouseCursorStyle.pointer;\n\n _this.applyTheme();\n\n return _this;\n }\n\n return TextLink;\n}(Label);\n\nexport { TextLink };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"TextLink\"] = TextLink;","/**\r\n * This module contains a base class for an SVG filter.\r\n *\r\n * Filters can be used to decorate, change and transform just about any DOM\r\n * element.\r\n *\r\n * A Filter works by applying one or more effects (primitives) to SVG element.\r\n *\r\n * For more information on how SVG filters work, refer to\r\n * [this MDN tutorial](https://developer.mozilla.org/en-US/docs/Web/SVG/Tutorial/SVG_Filters_Tutorial).\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObject } from \"../../Base\";\nimport { getGhostPaper } from \"../Paper\";\nimport { Animation, AnimationDisposer } from \"../../utils/Animation\";\nimport { List } from \"../../utils/List\";\nimport * as $object from \"../../utils/Object\";\nimport * as $iter from \"../../utils/Iterator\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Base filter class.\r\n *\r\n * This class while can be instantiated will not do anything. It is just a base\r\n * functionality for any other \"real\" filters to extend.\r\n *\r\n * Filters can be used to decorate, change and transform just about any DOM\r\n * element.\r\n *\r\n * A Filter works by applying one or more effects (primitives) to SVG element.\r\n *\r\n * For more information on how SVG filters work, refer to\r\n * [this MDN tutorial](https://developer.mozilla.org/en-US/docs/Web/SVG/Tutorial/SVG_Filters_Tutorial).\r\n *\r\n * @todo Example\r\n */\n\nvar Filter =\n/** @class */\nfunction (_super) {\n __extends(Filter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Filter() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * A storage for Filter property/value pairs.\r\n *\r\n * @ignore Exclude from docs\r\n * @see {@link FilterProperties}\r\n */\n\n\n _this.properties = {};\n /**\r\n * Identifies if this object is a \"template\" and should not be treated as\r\n * real object that is drawn or actually used in the chart.\r\n */\n\n _this.isTemplate = false;\n /**\r\n * [_scale description]\r\n *\r\n * @todo Description\r\n */\n\n _this._scale = 1;\n /**\r\n * [_nonScaling description]\r\n *\r\n * @todo Description\r\n */\n\n _this._nonScaling = true;\n _this.className = \"Filter\"; // Create a list to hold primitives (effect elements)\n\n _this.filterPrimitives = new List();\n _this.properties.filterUnits = \"objectBoundingBox\"; // Automatically add added primitives to `_disposers` so they are discarded\n // when Filter object is destroyed (disposed)\n\n _this.filterPrimitives.events.on(\"inserted\", function (ev) {\n _this._disposers.push(ev.newValue);\n }); // Set default dimensions\n\n\n _this.width = 120;\n _this.height = 120; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Appends actual filter elements to the filter group.\r\n *\r\n * @ignore Exclude from docs\r\n * @param filterElement An SVG `<group>` element to add filter element to\r\n */\n\n\n Filter.prototype.appendPrimitives = function (filterElement) {\n $iter.each(this.filterPrimitives.iterator(), function (filterPrimitive) {\n filterElement.add(filterPrimitive);\n });\n };\n /**\r\n * Uses Transitions filter's values from current to target. This is used to\r\n * smoothly appear filter, rather than it pop into effect.\r\n *\r\n * @ignore Exclude from docs\r\n * @param animationOptions Animation options\r\n * @param duration Duration in milliseconds\r\n * @param easing Easing function\r\n * @return Animation instance\r\n */\n\n\n Filter.prototype.animate = function (animationOptions, duration, easing) {\n var animation = new Animation(this, animationOptions, duration, easing).start();\n return animation;\n };\n\n Object.defineProperty(Filter.prototype, \"width\", {\n /**\r\n * @return Width (%)\r\n */\n get: function get() {\n return this.properties[\"width\"];\n },\n\n /**\r\n * Width of the filter element in percent.\r\n *\r\n * If the filter is designed to \"bleed out\" of the original target element,\r\n * like for example a shadow, you need this bigger than 100, or the\r\n * non-fitting parts will be clipped.\r\n *\r\n * @default 120\r\n * @param value Width (px)\r\n */\n set: function set(value) {\n this.properties[\"width\"] = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Filter.prototype, \"height\", {\n /**\r\n * @return Height\r\n */\n get: function get() {\n return this.properties[\"height\"];\n },\n\n /**\r\n * Height of the filter element in percent.\r\n *\r\n * If the filter is designed to \"bleed out\" of the original target element,\r\n * like for example a shadow, you need this bigger than 100, or the\r\n * non-fitting parts will be clipped.\r\n *\r\n * @default 120\r\n * @param value Height (%)\r\n */\n set: function set(value) {\n this.properties[\"height\"] = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies properties from another [[Filter]] object.\r\n *\r\n * @param filter Source [[Filter]] object\r\n */\n\n Filter.prototype.copyFrom = function (filter) {\n var _this = this;\n\n _super.prototype.copyFrom.call(this, filter);\n\n $object.each(filter.properties, function (key, value) {\n _this[key] = value;\n });\n };\n\n Object.defineProperty(Filter.prototype, \"paper\", {\n /**\r\n * @return Paper\r\n */\n get: function get() {\n if (this._paper) {\n return this._paper;\n }\n\n return getGhostPaper();\n },\n\n /**\r\n * Sets [[Paper]] instance to create filter's elements in.\r\n *\r\n * @ignore Exclude from docs\r\n * @param paper Paper\r\n */\n set: function set(paper) {\n if (this._paper != paper) {\n this._paper = paper;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Filter.prototype, \"animations\", {\n /**\r\n * All animations currently in play.\r\n *\r\n * @ignore Exclude from docs\r\n * @return List of animations\r\n */\n get: function get() {\n if (!this._animations) {\n this._animations = [];\n\n this._disposers.push(new AnimationDisposer(this._animations));\n }\n\n return this._animations;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Filter.prototype, \"scale\", {\n /**\r\n * @ignore Exclude from docs\r\n */\n get: function get() {\n return this._scale;\n },\n\n /**\r\n * [[Sprite]] uses this method to inform filter about it's scale.\r\n *\r\n * @ignore Exclude from docs\r\n */\n set: function set(value) {\n this._scale = value;\n this.updateScale();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates filter properties which depend on scale.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Filter.prototype.updateScale = function () {// Dummy method for extending classes to override.\n };\n\n Object.defineProperty(Filter.prototype, \"filterUnits\", {\n /**\r\n * @return Filter units\r\n */\n get: function get() {\n return this.properties.filterUnits;\n },\n\n /**\r\n * Which units are used when drawing filter.\r\n *\r\n * Use `\"userSpaceOnUse\"` when applying filters on a perfectly straight line.\r\n *\r\n * @since 4.9.17\r\n * @default objectBoundingBox\r\n * @param value Filter units\r\n */\n set: function set(value) {\n this.properties.filterUnits = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Filter.prototype, \"nonScaling\", {\n /**\r\n * @return Non scaling?\r\n */\n get: function get() {\n return this._nonScaling;\n },\n\n /**\r\n * If a filter is non scaling, it will look the same even if the sprite is\r\n * scaled, otherwise filter will scale together with a [[Sprite]].\r\n *\r\n * @default false\r\n * @param value Non scaling?\r\n */\n set: function set(value) {\n this._nonScaling = value;\n\n if (!value) {\n this._scale = 1;\n }\n\n this.updateScale();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Filter.prototype, \"sprite\", {\n /**\r\n * A target element this filter is currently attached to.\r\n *\r\n * We need to keep track of it because one filter can be used for just one\r\n * element, so we have to remove it from the old \"parent\" when attaching to\r\n * the new one.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Target element\r\n */\n set: function set(value) {\n this.setSprite(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets filter's target element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Element filter is being attached to\r\n */\n\n Filter.prototype.setSprite = function (value) {\n if (this._sprite && this._sprite != value) {\n this._sprite.filters.removeValue(this);\n }\n\n this._sprite = value;\n };\n\n return Filter;\n}(BaseObject);\n\nexport { Filter };","/**\r\n * Module for \"Drop Shadow\" filter.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Filter } from \"./Filter\";\nimport { color } from \"../../utils/Color\";\nimport { registry } from \"../../Registry\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creats a \"Drop Shadow\" filter.\r\n */\n\nvar DropShadowFilter =\n/** @class */\nfunction (_super) {\n __extends(DropShadowFilter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function DropShadowFilter() {\n var _this = _super.call(this) || this;\n\n _this.className = \"DropShadowFilter\"; // Create elements\n // NOTE: we do not need to add each individual element to `_disposers`\n // because `filterPrimitives` has an event handler which automatically adds\n // anything added to it to `_disposers`\n\n _this.color = color(\"#000\");\n _this.feGaussianBlur = _this.paper.add(\"feGaussianBlur\");\n\n _this.feGaussianBlur.attr({\n \"result\": \"blurOut\",\n \"in\": \"SourceGraphic\"\n });\n\n _this.filterPrimitives.push(_this.feGaussianBlur);\n\n _this.feOffset = _this.paper.add(\"feOffset\");\n\n _this.feOffset.attr({\n \"result\": \"offsetBlur\"\n });\n\n _this.filterPrimitives.push(_this.feOffset);\n\n _this.feFlood = _this.paper.add(\"feFlood\");\n\n _this.feFlood.attr({\n \"flood-color\": _this.color\n });\n\n _this.filterPrimitives.push(_this.feFlood);\n\n _this.feComposite = _this.paper.add(\"feComposite\");\n\n _this.feComposite.attr({\n \"in2\": \"offsetBlur\",\n operator: \"in\"\n });\n\n _this.filterPrimitives.push(_this.feComposite);\n\n _this.feMerge = _this.paper.addGroup(\"feMerge\");\n\n _this.feMerge.add(_this.paper.add(\"feMergeNode\"));\n\n _this.feMerge.add(_this.paper.add(\"feMergeNode\").attr({\n \"in\": \"SourceGraphic\"\n }));\n\n _this.filterPrimitives.push(_this.feMerge); // Set default properties\n\n\n _this.width = 200;\n _this.height = 200;\n _this.blur = 1.5;\n _this.dx = 3;\n _this.dy = 3;\n _this.opacity = 0.5;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(DropShadowFilter.prototype, \"color\", {\n /**\r\n * @return Color\r\n */\n get: function get() {\n return this.properties.color;\n },\n\n /**\r\n * Shadow color.\r\n *\r\n * @param value Color\r\n */\n set: function set(value) {\n this.properties.color = value;\n\n if (this.feFlood) {\n this.feFlood.attr({\n \"flood-color\": value\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DropShadowFilter.prototype, \"opacity\", {\n /**\r\n * @return Opacity (0-1)\r\n */\n get: function get() {\n return this.properties.opacity;\n },\n\n /**\r\n * Opacity of the shadow. (0-1)\r\n *\r\n * @param value Opacity (0-1)\r\n */\n set: function set(value) {\n this.properties.opacity = value;\n this.feFlood.attr({\n \"flood-opacity\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DropShadowFilter.prototype, \"dx\", {\n /**\r\n * @return Horizontal offset (px)\r\n */\n get: function get() {\n return this.properties.dx;\n },\n\n /**\r\n * Horizontal offset in pixels.\r\n *\r\n * @param value Horizontal offset (px)\r\n */\n set: function set(value) {\n this.properties.dx = value;\n this.feOffset.attr({\n \"dx\": value / this.scale\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DropShadowFilter.prototype, \"dy\", {\n /**\r\n * @return Vertical offset (px)\r\n */\n get: function get() {\n return this.properties.dy;\n },\n\n /**\r\n * Vertical offset in pixels.\r\n *\r\n * @param value Vertical offset (px)\r\n */\n set: function set(value) {\n this.properties.dy = value;\n this.feOffset.attr({\n \"dy\": value / this.scale\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DropShadowFilter.prototype, \"blur\", {\n /**\r\n * @return Blur\r\n */\n get: function get() {\n return this.properties.blur;\n },\n\n /**\r\n * Blur.\r\n *\r\n * @param value Blur\r\n */\n set: function set(value) {\n this.properties.blur = value;\n this.feGaussianBlur.attr({\n \"stdDeviation\": value / this.scale\n });\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * [updateScale description]\r\n *\r\n * @todo Description\r\n */\n\n DropShadowFilter.prototype.updateScale = function () {\n this.dx = this.dx;\n this.dy = this.dy;\n this.blur = this.blur;\n };\n\n return DropShadowFilter;\n}(Filter);\n\nexport { DropShadowFilter };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"DropShadowFilter\"] = DropShadowFilter;","/**\r\n * Provides functionality used to creating and showing tooltips (balloons).\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { registry } from \"../../core/Registry\";\nimport { PointedRectangle } from \"./PointedRectangle\";\nimport { Label } from \"../elements/Label\";\nimport { Animation } from \"../utils/Animation\";\nimport { color } from \"../utils/Color\";\nimport { DropShadowFilter } from \"../rendering/filters/DropShadowFilter\";\nimport * as $math from \"../utils/Math\";\nimport * as $ease from \"../utils/Ease\";\nimport * as $utils from \"../utils/Utils\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Tooltip displays text and/or multimedia information in a balloon over chart\r\n * area.\r\n * @see {@link ITooltipEvents} for a list of available events\r\n * @see {@link ITooltipAdapters} for a list of available Adapters\r\n */\n\nvar Tooltip =\n/** @class */\nfunction (_super) {\n __extends(Tooltip, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Tooltip() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Holds numeric boundary values. Calculated from the `boundingContainer`.\r\n * @ignore\r\n */\n\n\n _this._boundingRect = {\n x: -40000,\n y: -40000,\n width: 80000,\n height: 80000\n };\n /**\r\n * Coordinates tooltip's pointer (stem) should point to.\r\n */\n\n _this._pointTo = {\n x: 0,\n y: 0\n };\n /**\r\n * If set to `true` the pointer/stem of the Tooltip will not go outside\r\n * Tooltip's width or height depending on pointer's orientation.\r\n *\r\n * @default false\r\n */\n\n _this.fitPointerToBounds = false;\n /**\r\n * If `tooltipOrientation` is vertical, it can be drawn below or above point\r\n * We need to know this when solving overlapping.\r\n */\n\n _this._verticalOrientation = \"up\";\n /**\r\n * @ignore\r\n */\n\n _this.fixDoc = true;\n _this.className = \"Tooltip\";\n _this.isMeasured = false;\n _this.getFillFromObject = true;\n\n _this.margin(5, 5, 5, 5);\n\n _this.defaultState.transitionDuration = 1;\n _this.hiddenState.transitionDuration = 1; // Create chrome/background\n\n var background = _this.background;\n background.interactionsEnabled = false;\n background.fillOpacity = 0.9;\n background.strokeWidth = 1;\n background.strokeOpacity = 1;\n background.stroke = color(\"#ffffff\");\n background.cornerRadius = 3;\n background.pointerLength = 6;\n background.pointerBaseWidth = 10;\n var dropShadow = new DropShadowFilter();\n dropShadow.dy = 1;\n dropShadow.dx = 1;\n dropShadow.opacity = 0.5;\n background.filters.push(dropShadow);\n _this.autoTextColor = true; // Create text element\n\n var label = _this.createChild(Label);\n\n label.shouldClone = false;\n _this.label = label;\n label.padding(7, 12, 4, 12);\n label.interactionsEnabled = false;\n label.horizontalCenter = \"middle\";\n label.fill = color(\"#ffffff\");\n\n _this._disposers.push(label);\n\n _this.label.events.on(\"sizechanged\", _this.drawBackground, _this);\n\n _this.label.zIndex = 1; // @todo remove this line when bg sorting is solved\n // Set defaults\n\n _this.pointerOrientation = \"vertical\";\n _this.animationDuration = 0;\n _this.animationEasing = $ease.cubicOut;\n\n _this.setPropertyValue(\"showInViewport\", false); // Set accessibility options\n\n\n _this.role = \"tooltip\";\n _this.visible = false;\n _this.opacity = 0;\n _this.x = 0;\n _this.y = 0;\n\n _this.events.on(\"visibilitychanged\", _this.handleVisibility, _this); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n\n Tooltip.prototype.handleVisibility = function () {\n if (this.visible) {\n this.label.invalidate();\n }\n };\n\n Object.defineProperty(Tooltip.prototype, \"getStrokeFromObject\", {\n /**\r\n * Specifies if tooltip background should get stroke color from the sprite it is pointing to.\r\n *\r\n * @return {boolean}\r\n * @default false\r\n */\n get: function get() {\n return this.getPropertyValue(\"getStrokeFromObject\");\n },\n\n /**\r\n * Specifies if tooltip background should get stroke color from the sprite it is pointing to.\r\n *\r\n * @param value boolean\r\n */\n set: function set(value) {\n this.setPropertyValue(\"getStrokeFromObject\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"autoTextColor\", {\n /**\r\n * @return {boolean}\r\n */\n get: function get() {\n return this.getPropertyValue(\"autoTextColor\");\n },\n\n /**\r\n * Specifies if text color should be chosen automatically for a better\r\n * readability.\r\n *\r\n * IMPORTANT: this feature is generally ignored, if `getFillFromObject = false`.\r\n *\r\n * If inheriting of `fill` color from object tooltip is displayed for is\r\n * disabled, this feature will not work. If you are explicitly setting a\r\n * color for tooltip background, you may set a color for its label as well\r\n * using `tooltip.label.fill` property.\r\n *\r\n *\r\n * @param value boolean\r\n */\n set: function set(value) {\n this.setPropertyValue(\"autoTextColor\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"keepTargetHover\", {\n /**\r\n * @return Keep target hovered?\r\n */\n get: function get() {\n return this.getPropertyValue(\"keepTargetHover\");\n },\n\n /**\r\n * If this tooltip is displayed on hover on some other object, keep that\r\n * element hovered if hovering on the tooltip.\r\n *\r\n * @default false\r\n * @since 4.1.13\r\n * @param value Keep target hovered?\r\n */\n set: function set(value) {\n var _this = this;\n\n if (this.setPropertyValue(\"keepTargetHover\", value, true)) {\n if (value) {\n this.hoverable = true;\n this.background.interactionsEnabled = true;\n\n this._disposers.push(this.events.on(\"over\", function (ev) {\n if (_this.targetSprite && _this.targetSprite.hoverable) {\n _this.targetSprite.isHover = true;\n }\n }));\n\n this._disposers.push(this.events.on(\"out\", function (ev) {\n if (_this.targetSprite && _this.targetSprite.hoverable) {\n //this.hideTooltip();\n //this.targetSprite.handleOut();\n _this.targetSprite.isHover = false;\n }\n }));\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"showInViewport\", {\n /**\r\n * @return Force showing tooltip?\r\n */\n get: function get() {\n return this.getPropertyValue(\"showInViewport\");\n },\n\n /**\r\n * Normally, a tooltip will hide itself if it is pointing to a coordinate\r\n * that is outside viewport.\r\n *\r\n * Setting this setting to `true` will override that and make tooltip\r\n * appear next to the viewport edge closest to the target point.\r\n *\r\n * @default false\r\n * @since 4.5.7\r\n * @param value Force showing tooltip?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"showInViewport\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"getFillFromObject\", {\n /**\r\n * Specifies if tooltip background should get fill color from the sprite it is pointing to.\r\n *\r\n * @return {boolean}\r\n * @default true\r\n */\n get: function get() {\n return this.getPropertyValue(\"getFillFromObject\");\n },\n\n /**\r\n * @param value boolean\r\n */\n set: function set(value) {\n this.setPropertyValue(\"getFillFromObject\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates and returns a background element.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Background\r\n */\n\n Tooltip.prototype.createBackground = function () {\n return new PointedRectangle();\n };\n\n Object.defineProperty(Tooltip.prototype, \"pointerOrientation\", {\n /**\r\n * @return Orientation\r\n */\n get: function get() {\n return this.getPropertyValue(\"pointerOrientation\");\n },\n\n /**\r\n * Pointer orientation: `\"horizontal\"`, `\"vertical\"`, `\"up\"`, `\"down\"`,\r\n * `\"right\"`, or `\"left\"`.\r\n *\r\n * Options`\"horizontal\"` or `\"vertical\"` are location-aware, meaning they\r\n * will change position of the Tooltip based on the target point's position\r\n * in relation to chart center.\r\n *\r\n * Options `\"up\"`, `\"down\"`, `\"right\"`, `\"left\"` are static and will point\r\n * in the specified direction regardless of the position, even if that means\r\n * going out of chart/screen bounds.\r\n *\r\n * IMPORTANT: in some situations, like having multiple tooltips stacked for\r\n * multiple series, the `\"up\"` and `\"down\"` values might be ignored in order\r\n * to make tooltip overlap algorithm work.\r\n *\r\n * @default \"vertical\"\r\n * @param value Orientation\r\n */\n set: function set(value) {\n this.setPropertyValue(\"pointerOrientation\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"animationDuration\", {\n /**\r\n * @return Orientation\r\n */\n get: function get() {\n return this.getPropertyValue(\"animationDuration\");\n },\n\n /**\r\n * Duration in milliseconds for the animation to take place when the tooltip\r\n * is moving from one place to another.\r\n *\r\n * @default 0\r\n * @param value number\r\n */\n set: function set(value) {\n this.setPropertyValue(\"animationDuration\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"animationEasing\", {\n /**\r\n * @return {Function}\r\n */\n get: function get() {\n return this.getPropertyValue(\"animationEasing\");\n },\n\n /**\r\n * Tooltip animation (moving from one place to another) easing function.\r\n *\r\n * @default $ease.cubicOut\r\n * @param value (value: number) => number\r\n */\n set: function set(value) {\n this.setPropertyValue(\"animationEasing\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"html\", {\n /**\r\n * @return HTML content\r\n */\n get: function get() {\n return this.label.html;\n },\n\n /**\r\n * HTML content for the Tooltip.\r\n *\r\n * Provided value will be used as is, without applying any further\r\n * formatting to it.\r\n *\r\n * @param value HTML content\r\n */\n set: function set(value) {\n if (this.label.html != value) {\n this.label.html = value;\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"text\", {\n /**\r\n * @return SVG text\r\n */\n get: function get() {\n return this.label.text;\n },\n\n /**\r\n * SVG text content for the Tooltip.\r\n *\r\n * Text can have a number of formatting options supported by\r\n * [[TextFormatter]].\r\n *\r\n * @param value SVG text\r\n */\n set: function set(value) {\n if (this.label.text != value) {\n this.label.text = value;\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates the Tooltip.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Tooltip.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var label = this.label;\n\n if (label.invalid) {\n label.validate();\n }\n\n var x = this._pointTo.x;\n var y = this._pointTo.y;\n var boundingRect = this._boundingRect;\n var textW = label.measuredWidth;\n var textH = label.measuredHeight;\n var pointerLength = this.background.pointerLength;\n var textX;\n var textY;\n\n if (this.ignoreBounds) {\n boundingRect = undefined;\n } // try to handle if text is wider than br\n\n\n if (boundingRect && this.fixDoc && textW > boundingRect.width) {\n // TODO maybe this isn't needed ?\n $utils.spritePointToDocument({\n x: boundingRect.x,\n y: boundingRect.y\n }, this.parent);\n var p1 = $utils.spritePointToDocument({\n x: boundingRect.x + boundingRect.width,\n y: boundingRect.y + boundingRect.height\n }, this.parent);\n var documentWidth = document.body.offsetWidth; // TODO maybe this isn't needed ?\n\n $utils.used(document.body.offsetHeight);\n\n if (p1.x > documentWidth / 2) {\n boundingRect.x = boundingRect.width - textW;\n } else {\n boundingRect.width = boundingRect.x + textW;\n }\n }\n\n var pointerOrientation = this.pointerOrientation; // horizontal\n\n if (pointerOrientation == \"horizontal\" || pointerOrientation == \"left\" || pointerOrientation == \"right\") {\n textY = -textH / 2;\n\n if (pointerOrientation == \"horizontal\") {\n if (boundingRect && x > boundingRect.x + boundingRect.width / 2) {\n textX = -textW / 2 - pointerLength;\n } else {\n textX = textW / 2 + pointerLength;\n }\n } else if (pointerOrientation == \"left\") {\n textX = textW / 2 + pointerLength;\n } else {\n textX = -textW / 2 - pointerLength;\n }\n } // vertical pointer\n else {\n if (boundingRect) {\n textX = $math.fitToRange(0, boundingRect.x - x + textW / 2, boundingRect.x - x + boundingRect.width - textW / 2);\n }\n\n if (pointerOrientation == \"vertical\") {\n if (boundingRect && y > boundingRect.y + textH + pointerLength) {\n textY = -textH - pointerLength;\n this._verticalOrientation = \"up\";\n } else {\n textY = pointerLength;\n this._verticalOrientation = \"down\";\n }\n } else if (pointerOrientation == \"down\") {\n textY = -textH - pointerLength;\n this._verticalOrientation = \"up\";\n } else {\n textY = pointerLength;\n this._verticalOrientation = \"down\";\n }\n }\n\n if (boundingRect) {\n textY = $math.fitToRange(textY, boundingRect.y - y, boundingRect.y + boundingRect.height - textH - y);\n }\n\n label.x = textX;\n label.y = textY;\n this.drawBackground();\n };\n /**\r\n * Overrides functionality from the superclass.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Tooltip.prototype.updateBackground = function () {\n this.group.addToBack(this.background.group);\n };\n /**\r\n * Draws Tooltip background (chrome, background and pointer/stem).\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Tooltip.prototype.drawBackground = function () {\n var label = this.label;\n var background = this.background;\n var textWidth = label.measuredWidth;\n var textHeight = label.measuredHeight;\n var boundingRect = this._boundingRect;\n var bgWidth = textWidth;\n var bgX = label.pixelX - textWidth / 2;\n var bgHeight = textHeight;\n var bgY = label.pixelY;\n var x = this._pointTo.x;\n var y = this._pointTo.y;\n var boundX1 = boundingRect.x - x;\n var boundX2 = boundX1 + boundingRect.width;\n var boundY1 = boundingRect.y - y;\n var boundY2 = boundY1 + boundingRect.height;\n background.x = bgX;\n background.y = bgY;\n background.width = bgWidth;\n background.height = bgHeight;\n\n if (this.fitPointerToBounds) {\n background.pointerX = $math.fitToRange(-background.x, boundX1 - background.x, boundX2 - background.x);\n background.pointerY = $math.fitToRange(-background.y, boundY1 - background.y, boundY2 - background.y);\n } else {\n background.pointerX = -background.x;\n background.pointerY = -background.y;\n }\n\n background.validate();\n };\n /**\r\n *\r\n */\n\n\n Tooltip.prototype.delayedPointTo = function (point, instantly) {\n var _this = this;\n\n if (this._pointToDisposer) {\n this._pointToDisposer.dispose();\n }\n\n this._pointToDisposer = registry.events.once(\"exitframe\", function () {\n _this.pointTo(point, instantly);\n });\n this.addDisposer(this._pointToDisposer);\n };\n /**\r\n * Set nes tooltip's anchor point and moves whole tooltip.\r\n *\r\n * @param x X coordinate\r\n * @param y Y coordinate\r\n */\n\n\n Tooltip.prototype.pointTo = function (point, instantly) {\n if (this._pointTo.x != point.x || this._pointTo.y != point.y) {\n this._pointTo = point;\n this.invalidate(); // this helps to avoid strange animation from nowhere on initial show or when balloon was hidden already\n\n if (!this.visible || instantly) {\n this.moveTo(this._pointTo);\n\n if (this._animation) {\n this._animation.kill();\n }\n } else {\n // helps to avoid flicker on top/left corner\n if (this.pixelX == 0 && this.pixelY == 0) {\n this.moveTo(this._pointTo);\n } else {\n if (this._animation) {\n this._animation.kill();\n }\n\n this._animation = new Animation(this, [{\n property: \"x\",\n to: point.x,\n from: this.pixelX\n }, {\n property: \"y\",\n to: point.y,\n from: this.pixelY\n }], this.animationDuration, this.animationEasing).start();\n }\n }\n }\n };\n /**\r\n * Sets numeric boundaries Tooltip needs to obey (so it does not go outside\r\n * specific area).\r\n *\r\n * @ignore Exclude from docs\r\n * @param rectangle Boundary rectangle\r\n */\n\n\n Tooltip.prototype.setBounds = function (rectangle) {\n var oldRect = this._boundingRect;\n\n if (oldRect.x != rectangle.x || oldRect.y != rectangle.y || oldRect.width != rectangle.width || oldRect.height != rectangle.height) {\n this._boundingRect = rectangle;\n this.invalidate();\n }\n };\n\n Object.defineProperty(Tooltip.prototype, \"boundingContainer\", {\n /**\r\n * Sets a [[Container]] instance to be used when calculating numeric\r\n * boundaries for the Tooltip.\r\n *\r\n * @ignore Exclude from docs\r\n * @param container Boundary container\r\n */\n set: function set(container) {\n this._boundingContainer = container; // TODO remove closures ?\n\n container.events.on(\"sizechanged\", this.updateBounds, this);\n container.events.on(\"positionchanged\", this.updateBounds, this);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates numeric boundaries for the Tooltip, based on the\r\n * `boundingCountrainer`.\r\n */\n\n Tooltip.prototype.updateBounds = function () {\n var boundingContainer = this._boundingContainer; // to global\n\n var rect = $utils.spriteRectToSvg({\n x: boundingContainer.pixelX,\n y: boundingContainer.pixelY,\n width: boundingContainer.maxWidth,\n height: boundingContainer.maxHeight\n }, boundingContainer);\n this.setBounds(rect);\n };\n\n Object.defineProperty(Tooltip.prototype, \"ignoreBounds\", {\n /**\r\n * @return Ignore chart bounds?\r\n */\n get: function get() {\n return this.getPropertyValue(\"ignoreBounds\");\n },\n\n /**\r\n * Normally, a tooltip's position will be adjusted so it always fits into\r\n * chart's coundaries.\r\n *\r\n * Setting this to `false` will disable such checks and will allow tooltip\r\n * to \"bleed over\" the edge of the chart.\r\n *\r\n * @default false\r\n * @since 4.10.8\r\n * @param value Ignore chart bounds?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"ignoreBounds\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"verticalOrientation\", {\n /**\r\n * If tooltipOrientation is vertical, it can be drawn below or above point.\r\n * We need to know this when solving overlapping.\r\n *\r\n * @ignore Exclude from docs\r\n * @return \"up\" | \"down\"\r\n */\n get: function get() {\n return this._verticalOrientation;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Tooltip.prototype, \"tooltip\", {\n /**\r\n * To avoid stackoverflow\r\n * @ignore\r\n */\n get: function get() {\n return undefined;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies properties and other attributes.\r\n *\r\n * @param source Source\r\n */\n\n Tooltip.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.label.copyFrom(source.label);\n\n if (source._boundingRect) {\n this._boundingRect = source._boundingRect;\n }\n };\n /**\r\n * Adds easing functions to \"function\" fields.\r\n *\r\n * @param field Field name\r\n * @return Assign as function?\r\n */\n\n\n Tooltip.prototype.asFunction = function (field) {\n return field == \"animationEasing\" || _super.prototype.asIs.call(this, field);\n };\n\n return Tooltip;\n}(Container);\n\nexport { Tooltip };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Tooltip\"] = Tooltip;","/**\r\n * Functionality for drawing a trapezoid.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { percent } from \"../../core/utils/Percent\";\nimport { registry } from \"../Registry\";\nimport * as $utils from \"../utils/Utils\";\nimport * as $type from \"../utils/Type\";\nimport * as $path from \"../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a Trapezoid.\r\n *\r\n * @see {@link ITrapezoidEvents} for a list of available events\r\n * @see {@link ITrapezoidAdapters} for a list of available Adapters\r\n */\n\nvar Trapezoid =\n/** @class */\nfunction (_super) {\n __extends(Trapezoid, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Trapezoid() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Trapezoid\";\n _this.element = _this.paper.add(\"path\");\n _this.topSide = percent(100);\n _this.bottomSide = percent(100);\n _this.leftSide = percent(100);\n _this.rightSide = percent(100);\n _this.isMeasured = false; // todo: add measureElement\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Trapezoid.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var w = this.pixelWidth;\n var h = this.pixelHeight;\n var ts = $utils.relativeToValue(this.topSide, w);\n var bs = $utils.relativeToValue(this.bottomSide, w);\n var ls = $utils.relativeToValue(this.leftSide, h);\n var rs = $utils.relativeToValue(this.rightSide, h); // 1----2\n // | |\n // 4----3\n\n var x0 = (w - ts) / 2;\n var y0 = (h - ls) / 2;\n var x1 = w - (w - ts) / 2;\n var y1 = (h - rs) / 2;\n var x2 = w - (w - bs) / 2;\n var y2 = h - (h - rs) / 2;\n var x3 = (w - bs) / 2;\n var y3 = h - (h - ls) / 2;\n var mt = \"\";\n var mr = \"\";\n var mb = \"\";\n var ml = \"\";\n\n if ($type.hasValue(this.horizontalNeck)) {\n var hn = this.horizontalNeck.value;\n mt = $path.lineTo({\n x: w * hn,\n y: Math.max(y0, y1)\n });\n mb = $path.lineTo({\n x: w * hn,\n y: Math.min(y2, y3)\n });\n }\n\n if ($type.hasValue(this.verticalNeck)) {\n var vn = this.verticalNeck.value;\n mr = $path.lineTo({\n x: Math.min(x1, x2),\n y: h * vn\n });\n ml = $path.lineTo({\n x: Math.max(x0, x3),\n y: h * vn\n });\n }\n\n var path = $path.moveTo({\n x: x0,\n y: y0\n }) + mt + $path.lineTo({\n x: x1,\n y: y1\n }) + mr + $path.lineTo({\n x: x2,\n y: y2\n }) + mb + $path.lineTo({\n x: x3,\n y: y3\n }) + ml;\n this.path = path;\n };\n\n Object.defineProperty(Trapezoid.prototype, \"topSide\", {\n /**\r\n * @return Width\r\n */\n get: function get() {\n return this.getPropertyValue(\"topSide\");\n },\n\n /**\r\n * Wdith of the top side. Absolute (px) or relative ([[Percent]]).\r\n *\r\n * @default Percent(100)\r\n * @param value Width\r\n */\n set: function set(value) {\n this.setPercentProperty(\"topSide\", value, true, false, 10, false);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Trapezoid.prototype, \"bottomSide\", {\n /**\r\n * @return Width\r\n */\n get: function get() {\n return this.getPropertyValue(\"bottomSide\");\n },\n\n /**\r\n * Wdith of the bottom side. Absolute (px) or relative ([[Percent]]).\r\n *\r\n * @default Percent(100)\r\n * @param value Width\r\n */\n set: function set(value) {\n this.setPercentProperty(\"bottomSide\", value, true, false, 10, false);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Trapezoid.prototype, \"leftSide\", {\n /**\r\n * @return Height\r\n */\n get: function get() {\n return this.getPropertyValue(\"leftSide\");\n },\n\n /**\r\n * Height of the left side. Absolute (px) or relative ([[Percent]]).\r\n *\r\n * @default Percent(100)\r\n * @param value Height\r\n */\n set: function set(value) {\n this.setPercentProperty(\"leftSide\", value, true, false, 10, false);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Trapezoid.prototype, \"rightSide\", {\n /**\r\n * @return Height\r\n */\n get: function get() {\n return this.getPropertyValue(\"rightSide\");\n },\n\n /**\r\n * Height of the right side. Absolute (px) or relative ([[Percent]]).\r\n *\r\n * @default Percent(100)\r\n * @param value Height\r\n */\n set: function set(value) {\n this.setPercentProperty(\"rightSide\", value, true, false, 10, false);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Trapezoid.prototype, \"horizontalNeck\", {\n /**\r\n * @return Horizontal neck position\r\n */\n get: function get() {\n return this.getPropertyValue(\"horizontalNeck\");\n },\n\n /**\r\n * A relative vertical position of the \"neck\". If the top and bottom sides\r\n * are of different width, and `horizontalNeck` is set, a choke point\r\n * will be created at that position, creating a funnel shape.\r\n *\r\n * @param value Horizontal neck position\r\n */\n set: function set(value) {\n this.setPropertyValue(\"horizontalNeck\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Trapezoid.prototype, \"verticalNeck\", {\n /**\r\n * @return Vertical neck position\r\n */\n get: function get() {\n return this.getPropertyValue(\"verticalNeck\");\n },\n\n /**\r\n * A relative horizontal position of the \"neck\". If the left and right sides\r\n * are of different height, and `verticalNeck` is set, a choke point\r\n * will be created at that position, creating a funnel shape.\r\n *\r\n * @param value Vertical neck position\r\n */\n set: function set(value) {\n this.setPropertyValue(\"verticalNeck\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return Trapezoid;\n}(Sprite);\n\nexport { Trapezoid };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Trapezoid\"] = Trapezoid;","/**\r\n * Functionality for drawing triangles.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport * as $path from \"../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a triangle.\r\n *\r\n * @see {@link ITriangleEvents} for a list of available events\r\n * @see {@link ITriangleAdapters} for a list of available Adapters\r\n */\n\nvar Triangle =\n/** @class */\nfunction (_super) {\n __extends(Triangle, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Triangle() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Triangle\";\n _this.element = _this.paper.add(\"path\");\n _this.direction = \"top\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Triangle.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var w = this.pixelWidth;\n var h = this.pixelHeight;\n var path;\n\n switch (this.direction) {\n case \"right\":\n path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: w,\n y: h / 2\n }) + $path.lineTo({\n x: 0,\n y: h\n }) + $path.closePath();\n break;\n\n case \"left\":\n path = $path.moveTo({\n x: w,\n y: 0\n }) + $path.lineTo({\n x: 0,\n y: h / 2\n }) + $path.lineTo({\n x: w,\n y: h\n }) + $path.closePath();\n break;\n\n case \"bottom\":\n path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: w,\n y: 0\n }) + $path.lineTo({\n x: w / 2,\n y: h\n }) + $path.closePath();\n break;\n\n case \"top\":\n path = $path.moveTo({\n x: w / 2,\n y: 0\n }) + $path.lineTo({\n x: w,\n y: h\n }) + $path.lineTo({\n x: 0,\n y: h\n }) + $path.closePath();\n break;\n }\n\n this.path = path;\n };\n\n Object.defineProperty(Triangle.prototype, \"direction\", {\n /**\r\n * Returns direction of a triangle\r\n *\r\n * @return value\r\n */\n get: function get() {\n return this.getPropertyValue(\"direction\");\n },\n\n /**\r\n * Sets direction of a triangle\r\n *\r\n * @param value\r\n */\n set: function set(value) {\n this.setPropertyValue(\"direction\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return Triangle;\n}(Sprite);\n\nexport { Triangle };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Triangle\"] = Triangle;","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { registry } from \"../Registry\";\nimport * as $path from \"./Path\";\nimport * as $array from \"../utils/Array\";\nimport * as $utils from \"../utils/Utils\";\nimport * as $math from \"../utils/Math\";\n/**\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\nvar Tension =\n/** @class */\nfunction () {\n /**\r\n * Constructor.\r\n *\r\n * @param tensionX [description]\r\n * @param tensionY [description]\r\n */\n function Tension(tensionX, tensionY) {\n this._tensionX = tensionX;\n this._tensionY = tensionY;\n }\n /**\r\n * [smooth description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param points [description]\r\n * @return [description]\r\n */\n\n\n Tension.prototype.smooth = function (points) {\n for (var i = points.length - 1; i > 0; i--) {\n var p0 = points[i];\n var p1 = points[i - 1];\n\n if (Math.abs(p0.x - p1.x) < 0.1 && Math.abs(p0.y - p1.y) < 0.1) {\n points.splice(i - 1, 1);\n }\n }\n\n var tensionX = this._tensionX;\n var tensionY = this._tensionY;\n\n if (points.length < 3 || tensionX >= 1 && tensionY >= 1) {\n return $path.polyline(points);\n }\n\n var first = points[0];\n var last = points[points.length - 1];\n var closed = false;\n\n if ($math.round(first.x, 3) == $math.round(last.x) && $math.round(first.y) == $math.round(last.y)) {\n closed = true;\n } // Can't moveTo here, as it wont be possible to have fill then.\n\n\n var path = \"\";\n\n for (var i = 0, len = points.length - 1; i < len; i++) {\n var p0 = points[i - 1];\n var p1 = points[i];\n var p2 = points[i + 1];\n var p3 = points[i + 2];\n\n if (i === 0) {\n if (closed) {\n p0 = points[points.length - 2];\n } else {\n p0 = points[i];\n }\n } else if (i == points.length - 2) {\n if (closed) {\n p3 = points[1];\n } else {\n p3 = points[i + 1];\n }\n }\n\n var controlPointA = $math.getCubicControlPointA(p0, p1, p2, p3, tensionX, tensionY);\n var controlPointB = $math.getCubicControlPointB(p0, p1, p2, p3, tensionX, tensionY);\n path += $path.cubicCurveTo(p2, controlPointA, controlPointB);\n }\n\n return path;\n };\n\n return Tension;\n}();\n\nexport { Tension };\n/**\r\n * Returns a waved line SVG path between two points.\r\n *\r\n * @ignore Exclude from docs\r\n * @param point1 Starting point\r\n * @param point2 Ending point\r\n * @param waveLength Wave length\r\n * @param waveHeight Wave height\r\n * @param adjustWaveLength Adjust wave length based on the actual line length\r\n * @return SVG path\r\n */\n\nexport function wavedLine(point1, point2, waveLength, waveHeight, tension, adjustWaveLength) {\n var x1 = point1.x;\n var y1 = point1.y;\n var x2 = point2.x;\n var y2 = point2.y;\n var distance = $math.getDistance(point1, point2);\n\n if (adjustWaveLength) {\n waveLength = distance / Math.round(distance / waveLength);\n }\n\n var d = registry.getCache($utils.stringify([\"wavedLine\", point1.x, point2.x, point1.y, point2.y, waveLength, waveHeight]));\n\n if (!d) {\n if (distance > 0) {\n var angle = Math.atan2(y2 - y1, x2 - x1);\n var cos = Math.cos(angle);\n var sin = Math.sin(angle);\n var waveLengthX = waveLength * cos;\n var waveLengthY = waveLength * sin;\n\n if (waveLength <= 1 || waveHeight <= 1) {\n d = $path.lineTo(point2);\n } else {\n var halfWaveCount = Math.round(2 * distance / waveLength);\n var points = [];\n var sign_1 = 1;\n\n if (x2 < x1) {\n sign_1 *= -1;\n }\n\n if (y2 < y1) {\n sign_1 *= -1;\n }\n\n for (var i = 0; i <= halfWaveCount; i++) {\n sign_1 *= -1;\n var x = x1 + i * waveLengthX / 2 + sign_1 * waveHeight / 2 * sin;\n var y = y1 + i * waveLengthY / 2 - sign_1 * waveHeight / 2 * cos;\n points.push({\n x: x,\n y: y\n });\n }\n\n d = new Tension(tension, tension).smooth(points);\n }\n } else {\n d = \"\";\n }\n\n registry.setCache($utils.stringify([\"wavedLine\", point1.x, point2.x, point1.y, point2.y, waveLength, waveHeight]), d);\n }\n\n return d;\n}\n\nvar Monotone =\n/** @class */\nfunction () {\n function Monotone(reversed, info) {\n this._reversed = reversed;\n this._closed = info.closed;\n } // According to https://en.wikipedia.org/wiki/Cubic_Hermite_spline#Representations\n // \"you can express cubic Hermite interpolation in terms of cubic Bézier curves\n // with respect to the four values p0, p0 + m0 / 3, p1 - m1 / 3, p1\".\n\n\n Monotone.prototype._curve = function (x0, x1, y0, y1, t0, t1) {\n var dx = (x1 - x0) / 3;\n\n if (this._reversed) {\n return $path.cubicCurveTo({\n x: y1,\n y: x1\n }, {\n x: y0 + dx * t0,\n y: x0 + dx\n }, {\n x: y1 - dx * t1,\n y: x1 - dx\n });\n } else {\n return $path.cubicCurveTo({\n x: x1,\n y: y1\n }, {\n x: x0 + dx,\n y: y0 + dx * t0\n }, {\n x: x1 - dx,\n y: y1 - dx * t1\n });\n }\n };\n\n Monotone.prototype.smooth = function (points) {\n var _this = this;\n\n var x0 = NaN;\n var x1 = NaN;\n var y0 = NaN;\n var y1 = NaN;\n var t0 = NaN;\n var point = 0;\n var output = \"\";\n $array.each(points, function (_a) {\n var x = _a.x,\n y = _a.y;\n\n if (_this._reversed) {\n var temp = x;\n x = y;\n y = temp;\n }\n\n var t1 = NaN;\n\n if (!(x === x1 && y === y1)) {\n switch (point) {\n case 0:\n point = 1;\n\n if (_this._reversed) {\n output += $path.lineTo({\n x: y,\n y: x\n });\n } else {\n output += $path.lineTo({\n x: x,\n y: y\n });\n }\n\n break;\n\n case 1:\n point = 2;\n break;\n\n case 2:\n point = 3;\n output += _this._curve(x0, x1, y0, y1, slope2(x0, x1, y0, y1, t1 = slope3(x0, x1, y0, y1, x, y)), t1);\n break;\n\n default:\n output += _this._curve(x0, x1, y0, y1, t0, t1 = slope3(x0, x1, y0, y1, x, y));\n break;\n }\n\n x0 = x1;\n x1 = x;\n y0 = y1;\n y1 = y;\n t0 = t1;\n }\n });\n\n switch (point) {\n case 2:\n if (this._reversed) {\n output += $path.lineTo({\n x: y1,\n y: x1\n });\n } else {\n output += $path.lineTo({\n x: x1,\n y: y1\n });\n }\n\n break;\n\n case 3:\n output += this._curve(x0, x1, y0, y1, t0, slope2(x0, x1, y0, y1, t0));\n break;\n }\n\n if (this._closed) {\n output += $path.closePath();\n }\n\n return output;\n };\n\n return Monotone;\n}();\n\nexport { Monotone }; // TODO move this someplace else\n\nfunction sign(x) {\n return x < 0 ? -1 : 1;\n}\n\nfunction slope2(x0, x1, y0, y1, t) {\n var h = x1 - x0;\n return h ? (3 * (y1 - y0) / h - t) / 2 : t;\n}\n\nfunction slope3(x0, x1, y0, y1, x2, y2) {\n var h0 = x1 - x0;\n var h1 = x2 - x1;\n var s0 = (y1 - y0) / (h0 || h1 < 0 && -0);\n var s1 = (y2 - y1) / (h1 || h0 < 0 && -0);\n var p = (s0 * h1 + s1 * h0) / (h0 + h1);\n return (sign(s0) + sign(s1)) * Math.min(Math.abs(s0), Math.abs(s1), 0.5 * Math.abs(p)) || 0;\n}\n\nvar MonotoneX =\n/** @class */\nfunction (_super) {\n __extends(MonotoneX, _super);\n\n function MonotoneX(info) {\n return _super.call(this, false, info) || this;\n }\n\n return MonotoneX;\n}(Monotone);\n\nexport { MonotoneX };\n\nvar MonotoneY =\n/** @class */\nfunction (_super) {\n __extends(MonotoneY, _super);\n\n function MonotoneY(info) {\n return _super.call(this, true, info) || this;\n }\n\n return MonotoneY;\n}(Monotone);\n\nexport { MonotoneY };\n/**\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\nvar Basis =\n/** @class */\nfunction () {\n /**\r\n * Constructor.\r\n *\r\n * @param info [description]\r\n */\n function Basis(info) {\n this._closed = info.closed;\n }\n /**\r\n * [smooth description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param points [description]\r\n * @return [description]\r\n */\n\n\n Basis.prototype.smooth = function (points) {\n var _this = this;\n\n var x0 = NaN;\n var x1 = NaN;\n var x2 = NaN;\n var x3 = NaN;\n var x4 = NaN;\n var y0 = NaN;\n var y1 = NaN;\n var y2 = NaN;\n var y3 = NaN;\n var y4 = NaN;\n var point = 0;\n var output = \"\";\n\n var pushCurve = function pushCurve(x, y) {\n output += $path.cubicCurveTo({\n x: (x0 + 4 * x1 + x) / 6,\n y: (y0 + 4 * y1 + y) / 6\n }, {\n x: (2 * x0 + x1) / 3,\n y: (2 * y0 + y1) / 3\n }, {\n x: (x0 + 2 * x1) / 3,\n y: (y0 + 2 * y1) / 3\n });\n };\n\n var pushPoint = function pushPoint(_a) {\n var x = _a.x,\n y = _a.y;\n\n switch (point) {\n case 0:\n point = 1;\n\n if (_this._closed) {\n x2 = x;\n y2 = y;\n } else {\n output += $path.lineTo({\n x: x,\n y: y\n });\n }\n\n break;\n\n case 1:\n point = 2;\n\n if (_this._closed) {\n x3 = x;\n y3 = y;\n }\n\n break;\n\n case 2:\n point = 3;\n\n if (_this._closed) {\n x4 = x;\n y4 = y;\n output += $path.moveTo({\n x: (x0 + 4 * x1 + x) / 6,\n y: (y0 + 4 * y1 + y) / 6\n });\n break;\n } else {\n output += $path.lineTo({\n x: (5 * x0 + x1) / 6,\n y: (5 * y0 + y1) / 6\n }); // fall-through\n }\n\n default:\n pushCurve(x, y);\n break;\n }\n\n x0 = x1;\n x1 = x;\n y0 = y1;\n y1 = y;\n };\n\n $array.each(points, pushPoint);\n\n if (this._closed) {\n switch (point) {\n case 1:\n output += $path.moveTo({\n x: x2,\n y: y2\n });\n output += $path.closePath();\n break;\n\n case 2:\n output += $path.moveTo({\n x: (x2 + 2 * x3) / 3,\n y: (y2 + 2 * y3) / 3\n });\n output += $path.lineTo({\n x: (x3 + 2 * x2) / 3,\n y: (y3 + 2 * y2) / 3\n });\n output += $path.closePath();\n break;\n\n case 3:\n pushPoint({\n x: x2,\n y: y2\n });\n pushPoint({\n x: x3,\n y: y3\n });\n pushPoint({\n x: x4,\n y: y4\n });\n break;\n }\n } else {\n switch (point) {\n case 3:\n pushCurve(x1, y1);\n // fall-through\n\n case 2:\n output += $path.lineTo({\n x: x1,\n y: y1\n });\n break;\n }\n\n output += $path.closePath();\n }\n\n return output;\n };\n\n return Basis;\n}();\n\nexport { Basis };","/**\r\n * Functionality for drawing waved circles.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Circle } from \"./Circle\";\nimport { registry } from \"../Registry\";\nimport * as $path from \"../rendering/Path\";\nimport * as $math from \"../utils/Math\";\nimport * as $utils from \"../utils/Utils\";\nimport * as $smoothing from \"../../core/rendering/Smoothing\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a waved circle.\r\n *\r\n * @see {@link IWavedCircleEvents} for a list of available events\r\n * @see {@link IWavedCircleAdapters} for a list of available Adapters\r\n */\n\nvar WavedCircle =\n/** @class */\nfunction (_super) {\n __extends(WavedCircle, _super);\n /**\r\n * Constructor\r\n */\n\n\n function WavedCircle() {\n var _this = _super.call(this) || this;\n\n _this.className = \"WavedCircle\";\n _this.element = _this.paper.add(\"path\");\n _this.waveLength = 16;\n _this.waveHeight = 4;\n _this.fill = undefined;\n _this.fillOpacity = 0;\n _this.tension = 0.8;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the waved line.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n WavedCircle.prototype.draw = function () {\n var path = \"\";\n var radius = this.pixelRadius;\n\n if (radius > 0) {\n var points = this.getPoints(radius);\n path = $path.moveTo(points[0]) + new $smoothing.Tension(this.tension, this.tension).smooth(points);\n }\n\n var innerRadius = this.pixelInnerRadius;\n\n if (innerRadius > 0) {\n var points = this.getPoints(innerRadius);\n points.reverse();\n path += $path.moveTo(points[0]) + new $smoothing.Tension(this.tension, this.tension).smooth(points);\n }\n\n this.path = path;\n };\n /**\r\n * Returns points that circle consists of.\r\n *\r\n * @param radius Radius (px)\r\n * @return Points\r\n */\n\n\n WavedCircle.prototype.getPoints = function (radius) {\n var circleLength = radius * Math.PI * 2;\n var halfWaveHeight = this.waveHeight / 2;\n var waveLength = circleLength / Math.round(circleLength / this.waveLength);\n var halfWaveLength = waveLength / 2;\n var points = [];\n var count = circleLength / waveLength;\n\n for (var i = 0; i <= count; i++) {\n var angle1 = i * waveLength / circleLength * 360;\n var angle2 = (i * waveLength + halfWaveLength) / circleLength * 360;\n points.push({\n x: (radius - halfWaveHeight) * $math.cos(angle1),\n y: (radius - halfWaveHeight) * $math.sin(angle1)\n });\n points.push({\n x: (radius + halfWaveHeight) * $math.cos(angle2),\n y: (radius + halfWaveHeight) * $math.sin(angle2)\n });\n }\n\n points.pop();\n return points;\n };\n\n Object.defineProperty(WavedCircle.prototype, \"innerRadius\", {\n /**\r\n * @return Inner radius\r\n */\n get: function get() {\n return this.getPropertyValue(\"innerRadius\");\n },\n\n /**\r\n * Inner radius of the circle in pixels (absolute) or [[Percent]] (relative).\r\n *\r\n * @param value Inner radius\r\n */\n set: function set(value) {\n this.setPercentProperty(\"innerRadius\", value, true, false, 10, false);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedCircle.prototype, \"pixelInnerRadius\", {\n /**\r\n * Calculated inner radius of the circle in pixels.\r\n *\r\n * @readonly\r\n * @return Inner radius (px)\r\n */\n get: function get() {\n return $utils.relativeToValue(this.innerRadius, $math.min(this.innerWidth / 2, this.innerHeight / 2));\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedCircle.prototype, \"waveLength\", {\n /**\r\n * @return Wave length (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"waveLength\");\n },\n\n /**\r\n * Wave length in pixels.\r\n *\r\n * @default 16\r\n * @param value Wave length (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"waveLength\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedCircle.prototype, \"waveHeight\", {\n /**\r\n * @return Wave height (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"waveHeight\");\n },\n\n /**\r\n * Wave height in pixels.\r\n *\r\n * @default 4\r\n * @param value Wave height (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"waveHeight\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedCircle.prototype, \"tension\", {\n /**\r\n * @return Tension\r\n */\n get: function get() {\n return this.getPropertyValue(\"tension\");\n },\n\n /**\r\n * Tension of the wave.\r\n *\r\n * @default 0.8\r\n * @param value Tension\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tension\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return WavedCircle;\n}(Circle);\n\nexport { WavedCircle };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"WavedCircle\"] = WavedCircle;","/**\r\n * Functionality for drawing waved lines.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Line } from \"./Line\";\nimport { color } from \"../utils/Color\";\nimport { wavedLine } from \"../rendering/Smoothing\";\nimport * as $path from \"../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a waved line.\r\n *\r\n * @see {@link IWavedLineEvents} for a list of available events\r\n * @see {@link IWavedLineAdapters} for a list of available Adapters\r\n */\n\nvar WavedLine =\n/** @class */\nfunction (_super) {\n __extends(WavedLine, _super);\n /**\r\n * Constructor\r\n */\n\n\n function WavedLine() {\n var _this = _super.call(this) || this;\n\n _this.className = \"WavedLine\";\n _this.element = _this.paper.add(\"path\");\n _this.waveLength = 16;\n _this.waveHeight = 4;\n _this.tension = 0.8;\n _this.pixelPerfect = false;\n _this.fill = color();\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the waved line.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n WavedLine.prototype.draw = function () {\n //super.draw();\n var p1 = {\n x: this.x1,\n y: this.y1\n };\n var p2 = {\n x: this.x2,\n y: this.y2\n };\n this.path = $path.moveTo(p1) + wavedLine(p1, p2, this.waveLength, this.waveHeight, this.tension, true);\n };\n\n Object.defineProperty(WavedLine.prototype, \"waveLength\", {\n /**\r\n * @return Wave length (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"waveLength\");\n },\n\n /**\r\n * Wave length in pixels.\r\n *\r\n * @default 16\r\n * @param value Wave length (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"waveLength\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedLine.prototype, \"waveHeight\", {\n /**\r\n * @return Wave height (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"waveHeight\");\n },\n\n /**\r\n * Wave height in pixels.\r\n *\r\n * @default 4\r\n * @param value Wave height (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"waveHeight\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedLine.prototype, \"tension\", {\n /**\r\n * @return Tension\r\n */\n get: function get() {\n return this.getPropertyValue(\"tension\");\n },\n\n /**\r\n * Tension of the wave.\r\n *\r\n * @default 0.8\r\n * @param value Tension\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tension\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return WavedLine;\n}(Line);\n\nexport { WavedLine };","/**\r\n * Functionality for drawing rectangles with waved edges.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Rectangle } from \"./Rectangle\";\nimport { wavedLine } from \"../rendering/Smoothing\";\nimport * as $path from \"../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a rectangle with waved edges.\r\n *\r\n * @see {@link IWavedRectangleEvents} for a list of available events\r\n * @see {@link IWavedRectangleAdapters} for a list of available Adapters\r\n */\n\nvar WavedRectangle =\n/** @class */\nfunction (_super) {\n __extends(WavedRectangle, _super);\n /**\r\n * Constructor\r\n */\n\n\n function WavedRectangle() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"WavedRectangle\"; // Add path element\n\n _this.element = _this.paper.add(\"path\"); // Set defaults\n\n _this.waveLength = 16;\n _this.waveHeight = 4;\n _this.tension = 0.8;\n\n _this.setPropertyValue(\"wavedLeft\", true);\n\n _this.setPropertyValue(\"wavedRight\", true);\n\n _this.setPropertyValue(\"wavedTop\", true);\n\n _this.setPropertyValue(\"wavedBottom\", true); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the waved rectangle.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n WavedRectangle.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var w = this.pixelWidth;\n var h = this.pixelHeight;\n\n if (w > 0 && h > 0) {\n var p1 = {\n x: 0,\n y: 0\n };\n var p2 = {\n x: w,\n y: 0\n };\n var p3 = {\n x: w,\n y: h\n };\n var p4 = {\n x: 0,\n y: h\n };\n var waveLengthH = Math.min(w, this.waveLength);\n var waveHeightH = Math.min(h, this.waveHeight);\n var waveLengthV = Math.min(h, this.waveLength);\n var waveHeightV = Math.min(w, this.waveHeight);\n var td = \"\";\n var rd = \"\";\n var bd = \"\";\n var ld = \"\";\n\n if (this.wavedTop) {\n td = wavedLine(p1, p2, waveLengthH, waveHeightH, this.tension, true);\n }\n\n if (this.wavedRight) {\n rd = wavedLine(p2, p3, waveLengthV, waveHeightV, this.tension, true);\n }\n\n if (this.wavedBottom) {\n bd = wavedLine(p3, p4, waveLengthH, waveHeightH, this.tension, true);\n }\n\n if (this.wavedLeft) {\n ld = wavedLine(p4, p1, waveLengthV, waveHeightV, this.tension, true);\n }\n\n this.path = $path.moveTo(p1) + td + $path.lineTo(p2) + rd + $path.lineTo(p3) + bd + $path.lineTo(p4) + ld + \"z\";\n }\n };\n\n Object.defineProperty(WavedRectangle.prototype, \"waveLength\", {\n /**\r\n * @return Wave length (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"waveLength\");\n },\n\n /**\r\n * Wave length in pixels.\r\n *\r\n * @default 16\r\n * @param value Wave length (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"waveLength\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedRectangle.prototype, \"waveHeight\", {\n /**\r\n * @return Wave height (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"waveHeight\");\n },\n\n /**\r\n * Wave height in pixels.\r\n *\r\n * @default 4\r\n * @param value Wave height (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"waveHeight\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets which side should be waved or not. If particular side is set to\r\n * `false`, a straight line will be drawn on that side.\r\n *\r\n * @param top Top waved?\r\n * @param right Right side waved?\r\n * @param bottom Bottom Waved?\r\n * @param left Left side waved?\r\n */\n\n WavedRectangle.prototype.setWavedSides = function (top, right, bottom, left) {\n this.wavedTop = top;\n this.wavedRight = right;\n this.wavedBottom = bottom;\n this.wavedLeft = left;\n };\n\n Object.defineProperty(WavedRectangle.prototype, \"tension\", {\n /**\r\n * @return Tension\r\n */\n get: function get() {\n return this.getPropertyValue(\"tension\");\n },\n\n /**\r\n * Tension of the wave.\r\n *\r\n * @default 0.8\r\n * @param value Tension\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tension\", value);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedRectangle.prototype, \"wavedRight\", {\n /**\r\n * @return Wave right side?\r\n */\n get: function get() {\n return this.getPropertyValue(\"wavedRight\");\n },\n\n /**\r\n * Specifies if right side should be waved.\r\n *\r\n * @default true\r\n * @param value Waved?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"wavedRight\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedRectangle.prototype, \"wavedLeft\", {\n /**\r\n * @return Wave left side?\r\n */\n get: function get() {\n return this.getPropertyValue(\"wavedLeft\");\n },\n\n /**\r\n * Specifies if left side should be waved.\r\n *\r\n * @default true\r\n * @param value Waved?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"wavedLeft\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedRectangle.prototype, \"wavedTop\", {\n /**\r\n * @return Wave top side?\r\n */\n get: function get() {\n return this.getPropertyValue(\"wavedTop\");\n },\n\n /**\r\n * Specifies if top side should be waved.\r\n *\r\n * @default true\r\n * @param value Waved?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"wavedTop\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(WavedRectangle.prototype, \"wavedBottom\", {\n /**\r\n * @return Wave bottom side?\r\n */\n get: function get() {\n return this.getPropertyValue(\"wavedBottom\");\n },\n\n /**\r\n * Specifies if bottom side should be waved.\r\n *\r\n * @default true\r\n * @param value Waved?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"wavedBottom\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return WavedRectangle;\n}(Rectangle);\n\nexport { WavedRectangle };","/**\r\n * Zoom out button functionality.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Button } from \"./Button\";\nimport { Sprite } from \"../Sprite\";\nimport { registry } from \"../Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport * as $path from \"../rendering/Path\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a zoom out button.\r\n *\r\n * @see {@link IZoomOutButtonEvents} for a list of available events\r\n * @see {@link IZoomOutButtonAdapters} for a list of available Adapters\r\n */\n\nvar ZoomOutButton =\n/** @class */\nfunction (_super) {\n __extends(ZoomOutButton, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ZoomOutButton() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"ZoomOutButton\";\n\n _this.padding(9, 9, 9, 9); //this.dx = - 5;\n //this.dy = 5;\n\n\n _this.showSystemTooltip = true;\n var interfaceColors = new InterfaceColorSet();\n var background = _this.background;\n background.cornerRadius(20, 20, 20, 20);\n background.fill = interfaceColors.getFor(\"primaryButton\");\n background.stroke = interfaceColors.getFor(\"primaryButtonStroke\");\n background.strokeOpacity = 0;\n background.states.getKey(\"hover\").properties.fill = interfaceColors.getFor(\"primaryButtonHover\");\n background.states.getKey(\"down\").properties.fill = interfaceColors.getFor(\"primaryButtonActive\"); // Create an icon\n\n var icon = new Sprite();\n icon.element = _this.paper.add(\"path\");\n var path = $path.moveTo({\n x: 0,\n y: 0\n });\n path += $path.lineTo({\n x: 11,\n y: 0\n });\n icon.path = path;\n icon.pixelPerfect = true;\n icon.padding(8, 3, 8, 3);\n icon.stroke = interfaceColors.getFor(\"primaryButtonText\");\n _this.icon = icon; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n ZoomOutButton.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this);\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Zoom Out\");\n }\n };\n\n return ZoomOutButton;\n}(Button);\n\nexport { ZoomOutButton };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ZoomOutButton\"] = ZoomOutButton;","/**\r\n * Play button functionality.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Button } from \"./Button\";\nimport { RoundedRectangle } from \"./RoundedRectangle\";\nimport { registry } from \"../Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { Triangle } from \"./Triangle\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a zoom out button.\r\n *\r\n * @see {@link IPlayButtonEvents} for a list of available events\r\n * @see {@link IPlayButtonAdapters} for a list of available Adapters\r\n */\n\nvar PlayButton =\n/** @class */\nfunction (_super) {\n __extends(PlayButton, _super);\n /**\r\n * Constructor\r\n */\n\n\n function PlayButton() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"PlayButton\";\n\n _this.padding(12, 12, 12, 12);\n\n _this.showSystemTooltip = true;\n var interfaceColors = new InterfaceColorSet();\n var background = _this.background;\n background.cornerRadius(25, 25, 25, 25);\n background.fill = interfaceColors.getFor(\"primaryButton\");\n background.stroke = interfaceColors.getFor(\"primaryButtonStroke\");\n background.strokeOpacity = 0;\n background.states.getKey(\"hover\").properties.fill = interfaceColors.getFor(\"primaryButtonHover\");\n background.states.getKey(\"down\").properties.fill = interfaceColors.getFor(\"primaryButtonActive\"); // Create a play icon\n\n var playIcon = new Triangle();\n playIcon.direction = \"right\";\n playIcon.width = 9;\n playIcon.height = 11;\n playIcon.marginLeft = 1;\n playIcon.marginRight = 1;\n playIcon.horizontalCenter = \"middle\";\n playIcon.verticalCenter = \"middle\";\n playIcon.stroke = interfaceColors.getFor(\"primaryButtonText\");\n playIcon.fill = playIcon.stroke;\n _this.icon = playIcon; // Create a play icon\n\n var stopIcon = new RoundedRectangle();\n stopIcon.width = 11;\n stopIcon.height = 11;\n stopIcon.horizontalCenter = \"middle\";\n stopIcon.verticalCenter = \"middle\";\n stopIcon.cornerRadius(0, 0, 0, 0);\n stopIcon.stroke = interfaceColors.getFor(\"primaryButtonText\");\n stopIcon.fill = playIcon.stroke;\n _this.togglable = true;\n\n var activeState = _this.states.create(\"active\");\n\n activeState.transitionDuration = 0;\n activeState.properties.icon = stopIcon;\n _this.defaultState.transitionDuration = 0; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n PlayButton.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this);\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Play\");\n }\n };\n\n return PlayButton;\n}(Button);\n\nexport { PlayButton };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"PlayButton\"] = PlayButton;","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObject } from \"../../Base\";\nimport { registry } from \"../../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for color modifiers.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\nvar ColorModifier =\n/** @class */\nfunction (_super) {\n __extends(ColorModifier, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ColorModifier() {\n var _this = _super.call(this) || this;\n\n _this.className = \"ColorModifier\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Modifies color value.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Original color\r\n * @return Modified\r\n */\n\n\n ColorModifier.prototype.modify = function (value) {\n return value;\n };\n\n return ColorModifier;\n}(BaseObject);\n\nexport { ColorModifier };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ColorModifier\"] = ColorModifier;","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { ColorModifier } from \"./ColorModifier\";\nimport { registry } from \"../../Registry\";\nimport * as $math from \"../../utils/Math\";\nimport * as $type from \"../../utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This class can be used to modify linear gradient steps, changing visual\r\n * properties like lightness, brightness, opacity of each set.\r\n *\r\n * It can also set offsets for each gradient step.\r\n *\r\n * E.g. if I want to fill a columns in a column series to be a solid fill from\r\n * top to 80% of height, then gradually fades out, I can use the following\r\n * gradient modifier as a `fillModifier`:\r\n *\r\n * ```TypeScript\r\n * let fillModifier = new am4core.GradientModifier();\r\n * fillModifier.opacities = [1, 1, 0];\r\n * fillModifier.offsets = [0, 0.8, 1];\r\n * columnSeries.columns.template.fillModifier = fillModifier;\r\n * ```\r\n * ```JavaScript\r\n * var fillModifier = new am4core.GradientModifier();\r\n * fillModifier.opacities = [1, 1, 0];\r\n * fillModifier.offsets = [0, 0.8, 1];\r\n * columnSeries.columns.template.fillModifier = fillModifier;\r\n * ```\r\n * ```JSON\r\n * \"series\": [{\r\n * \"type\": \"ColumnSeries\",\r\n * \"columns\": {\r\n * \"fillModifier\": {\r\n * \"type\": \"GradientModifier\",\r\n * \"opacities\": [1, 1, 0],\r\n * \"offsets\": [0, 0.8, 1]\r\n * }\r\n * }\r\n * }]\r\n * ```\r\n */\n\nvar GradientModifier =\n/** @class */\nfunction (_super) {\n __extends(GradientModifier, _super);\n /**\r\n * Constructor.\r\n */\n\n\n function GradientModifier() {\n var _this = _super.call(this) || this;\n\n _this.lightnesses = [];\n _this.brightnesses = [];\n _this.opacities = [];\n _this.offsets = [];\n _this.className = \"GradientModifier\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(GradientModifier.prototype, \"lightnesses\", {\n /**\r\n * @return Lightness values\r\n */\n get: function get() {\n return this._lightnesses;\n },\n\n /**\r\n * An array of lightness values for each step.\r\n *\r\n * @param value Lightness values\r\n */\n set: function set(value) {\n this._lightnesses = value;\n this._brightnesses = [];\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GradientModifier.prototype, \"brightnesses\", {\n /**\r\n * @return Brightness values\r\n */\n get: function get() {\n return this._brightnesses;\n },\n\n /**\r\n * An array of brightness values for each step.\r\n *\r\n * @param value Brightness values\r\n */\n set: function set(value) {\n this._brightnesses = value;\n this._lightnesses = [];\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GradientModifier.prototype, \"opacities\", {\n /**\r\n * @return Opacity values\r\n */\n get: function get() {\n return this._opacities;\n },\n\n /**\r\n * An array of opacity values for each step.\r\n *\r\n * @param value Opacity values\r\n */\n set: function set(value) {\n this._opacities = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GradientModifier.prototype, \"offsets\", {\n /**\r\n * @return Offsets\r\n */\n get: function get() {\n return this._offsets;\n },\n\n /**\r\n * An array of relative position (0-1) for each step.\r\n *\r\n * If not set, all steps will be of equal relative length.\r\n *\r\n * @param value Offsets\r\n */\n set: function set(value) {\n this._offsets = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Modifies the color based on step setting.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Source color\r\n * @return A gradient that matches set modification rules\r\n */\n\n GradientModifier.prototype.modify = function (value) {\n // Clear current gradient\n this.gradient.clear(); // Get step count\n\n var count = 0;\n\n if (this.opacities) {\n count = $math.max(count, this.opacities.length);\n }\n\n if (this.lightnesses) {\n count = $math.max(count, this.lightnesses.length);\n }\n\n if (this.brightnesses) {\n count = $math.max(count, this.brightnesses.length);\n } // Init step values\n\n\n var opacity = 1,\n lightness,\n brightness; // Apply steps\n\n for (var i = 0; i < count; i++) {\n // Take base color\n var color = value; // Check if there are any parameters for this step\n\n if (this.opacities && $type.isNumber(this.opacities[i])) {\n opacity = this.opacities[i];\n }\n\n if (this.lightnesses && $type.isNumber(this.lightnesses[i])) {\n lightness = this.lightnesses[i];\n brightness = undefined;\n }\n\n if (this.brightnesses && $type.isNumber(this.brightnesses[i])) {\n brightness = this.brightnesses[i];\n lightness = undefined;\n } // Check if we need to brighten/lighten color\n\n\n if ($type.isNumber(brightness)) {\n color = value.brighten(this.brightnesses[i]);\n } else if ($type.isNumber(lightness)) {\n color = value.lighten(this.lightnesses[i]);\n } // Get offset (it's OK if it's undefined)\n\n\n var offset = this.offsets[i]; // Apply step\n\n this.gradient.addColor(color, opacity, offset);\n }\n\n return this.gradient;\n };\n\n GradientModifier.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this._offsets = source.offsets;\n this._brightnesses = source.brightnesses;\n this._lightnesses = source.lightnesses;\n this._opacities = source.opacities;\n };\n\n return GradientModifier;\n}(ColorModifier);\n\nexport { GradientModifier };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"GradientModifier\"] = GradientModifier;","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { LinearGradient } from \"./LinearGradient\";\nimport { GradientModifier } from \"./GradientModifier\";\nimport { registry } from \"../../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This class can be used to modify linear gradient steps, changing visual\r\n * properties like lightness, brightness, opacity of each set.\r\n *\r\n * It can also set offsets for each gradient step.\r\n *\r\n * E.g. if I want to fill a columns in a column series to be a solid fill from\r\n * top to 80% of height, then gradually fades out, I can use the following\r\n * gradient modifier as a `fillModifier`:\r\n *\r\n * ```TypeScript\r\n * let fillModifier = new am4core.LinearGradientModifier();\r\n * fillModifier.opacities = [1, 1, 0];\r\n * fillModifier.offsets = [0, 0.8, 1];\r\n * columnSeries.columns.template.fillModifier = fillModifier;\r\n * ```\r\n * ```JavaScript\r\n * var fillModifier = new am4core.LinearGradientModifier();\r\n * fillModifier.opacities = [1, 1, 0];\r\n * fillModifier.offsets = [0, 0.8, 1];\r\n * columnSeries.columns.template.fillModifier = fillModifier;\r\n * ```\r\n * ```JSON\r\n * \"series\": [{\r\n * \"type\": \"ColumnSeries\",\r\n * \"columns\": {\r\n * \"fillModifier\": {\r\n * \"type\": \"LinearGradientModifier\",\r\n * \"opacities\": [1, 1, 0],\r\n * \"offsets\": [0, 0.8, 1]\r\n * }\r\n * }\r\n * }]\r\n * ```\r\n */\n\nvar LinearGradientModifier =\n/** @class */\nfunction (_super) {\n __extends(LinearGradientModifier, _super);\n /**\r\n * Constructor.\r\n */\n\n\n function LinearGradientModifier() {\n var _this = _super.call(this) || this;\n\n _this.className = \"LinearGradientModifier\";\n _this.gradient = new LinearGradient();\n\n _this.applyTheme();\n\n return _this;\n }\n\n LinearGradientModifier.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.gradient = source.gradient.clone();\n };\n\n return LinearGradientModifier;\n}(GradientModifier);\n\nexport { LinearGradientModifier };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"LinearGradientModifier\"] = LinearGradientModifier;","/**\r\n * Cone module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../Container\";\nimport { Sprite, visualProperties } from \"../../Sprite\";\nimport { Ellipse } from \"../../elements/Ellipse\";\nimport { LinearGradientModifier } from \"../../rendering/fills/LinearGradientModifier\";\nimport { percent } from \"../../utils/Percent\";\nimport * as $object from \"../../utils/Object\";\nimport * as $path from \"../../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Builds a round cone/cylinder.\r\n *\r\n * @see {@link IConeEvents} for a list of available events\r\n * @see {@link IConeAdapters} for a list of available Adapters\r\n */\n\nvar Cone =\n/** @class */\nfunction (_super) {\n __extends(Cone, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Cone() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Cone\";\n _this.angle = 30;\n _this.radius = percent(100);\n _this.topRadius = percent(100);\n _this.top = _this.createChild(Ellipse);\n _this.top.shouldClone = false;\n _this.bottom = _this.createChild(Ellipse);\n _this.bottom.shouldClone = false;\n _this.body = _this.createChild(Sprite);\n _this.body.shouldClone = false;\n\n _this.body.setElement(_this.paper.add(\"path\"));\n\n _this.layout = \"none\";\n _this.bodyFillModifier = new LinearGradientModifier();\n _this.bodyFillModifier.lightnesses = [0, -0.25, 0];\n _this.body.fillModifier = _this.bodyFillModifier;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Cone.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n $object.copyProperties(this, this.top, visualProperties);\n $object.copyProperties(this, this.bottom, visualProperties);\n $object.copyProperties(this, this.body, visualProperties);\n var w = this.innerWidth;\n var h = this.innerHeight;\n var bottom = this.bottom;\n var top = this.top;\n var angle = this.angle;\n var radiusBase;\n var dx;\n var dy;\n\n if (this.orientation == \"horizontal\") {\n radiusBase = h / 2;\n bottom.y = h / 2;\n top.y = h / 2;\n top.x = w;\n dx = (90 - angle) / 90;\n dy = 0;\n this.bodyFillModifier.gradient.rotation = 90;\n } else {\n dx = 0;\n dy = (90 - angle) / 90;\n radiusBase = w / 2;\n bottom.y = h;\n bottom.x = w / 2;\n top.x = w / 2;\n this.bodyFillModifier.gradient.rotation = 0;\n }\n\n var radius = this.radius.value * radiusBase;\n var topRadius = this.topRadius.value * radiusBase;\n bottom.radius = radius - radius * dx;\n bottom.radiusY = radius - radius * dy;\n top.radius = topRadius - topRadius * dx;\n top.radiusY = topRadius - topRadius * dy;\n var path;\n\n if (this.orientation == \"horizontal\") {\n path = $path.moveTo({\n x: 0,\n y: h / 2 - bottom.radiusY\n }) + $path.arcTo(-90, -180, bottom.radius, bottom.radiusY) + $path.lineTo({\n x: w,\n y: h / 2 + top.radiusY\n }) + $path.arcTo(90, 180, top.radius, top.radiusY) + $path.closePath();\n } else {\n path = $path.moveTo({\n x: w / 2 - top.radius,\n y: 0\n }) + $path.arcTo(180, -180, top.radius, top.radiusY) + $path.lineTo({\n x: w / 2 + bottom.radius,\n y: h\n }) + $path.arcTo(0, 180, bottom.radius, bottom.radiusY) + $path.closePath();\n }\n\n this.body.path = path;\n };\n\n Object.defineProperty(Cone.prototype, \"angle\", {\n /**\r\n * @return Angle\r\n */\n get: function get() {\n return this.getPropertyValue(\"angle\");\n },\n\n /**\r\n * Angle of the point of view to the 3D element. (0-360)\r\n *\r\n * @default 30\r\n * @param value Angle\r\n */\n set: function set(value) {\n this.setPropertyValue(\"angle\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Cone.prototype, \"radius\", {\n /**\r\n * @return Bottom radius\r\n */\n get: function get() {\n return this.getPropertyValue(\"radius\");\n },\n\n /**\r\n * A relative radius of the cone's bottom (base).\r\n *\r\n * It is relevant to the inner width or height of the element.\r\n *\r\n * @default Percent(100)\r\n * @param value Bottom radius\r\n */\n set: function set(value) {\n this.setPropertyValue(\"radius\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Cone.prototype, \"topRadius\", {\n /**\r\n * @return Top radius\r\n */\n get: function get() {\n return this.getPropertyValue(\"topRadius\");\n },\n\n /**\r\n * A relative radius of the cone's top (tip).\r\n *\r\n * It is relevant to the inner width or height of the element.\r\n *\r\n * @default Percent(0)\r\n * @param value Top radius\r\n */\n set: function set(value) {\n this.setPropertyValue(\"topRadius\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Cone.prototype, \"orientation\", {\n /**\r\n * Orientation\r\n */\n get: function get() {\n return this.getPropertyValue(\"orientation\");\n },\n\n /**\r\n * Orientation of the cone\r\n *\r\n * @default \"vertical\"\r\n * @param value Orientation\r\n */\n set: function set(value) {\n this.setPropertyValue(\"orientation\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return Cone;\n}(Container);\n\nexport { Cone };","/**\r\n * Module for \"Lighten\" filter.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Filter } from \"./Filter\";\nimport { registry } from \"../../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a \"Lighten\" filter.\r\n */\n\nvar LightenFilter =\n/** @class */\nfunction (_super) {\n __extends(LightenFilter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function LightenFilter() {\n var _this = _super.call(this) || this;\n\n _this.className = \"LightenFilter\"; // Create elements\n // NOTE: we do not need to add each individual element to `_disposers`\n // because `filterPrimitives` has an event handler which automatically adds\n // anything added to it to `_disposers`\n\n _this.feColorMatrix = _this.paper.add(\"feColorMatrix\");\n\n _this.feColorMatrix.attr({\n \"type\": \"matrix\"\n });\n\n _this.filterPrimitives.push(_this.feColorMatrix); // Set default properties\n\n\n _this.lightness = 0;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(LightenFilter.prototype, \"lightness\", {\n /**\r\n * @return Lightness\r\n */\n get: function get() {\n return this.properties[\"lightness\"];\n },\n\n /**\r\n * Lightness of the target colors.\r\n *\r\n * If `lightness` is a positive number, the filter will make all colors\r\n * lighter.\r\n *\r\n * If `lightness` is negative, colors will be darkened.\r\n *\r\n * @param value Lightness\r\n */\n set: function set(value) {\n this.properties[\"lightness\"] = value;\n var v = value + 1;\n this.feColorMatrix.attr({\n \"values\": v + \" 0 0 0 0 0 \" + v + \" 0 0 0 0 0 \" + v + \" 0 0 0 0 0 1 0\"\n });\n },\n enumerable: true,\n configurable: true\n });\n return LightenFilter;\n}(Filter);\n\nexport { LightenFilter };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"LightenFilter\"] = LightenFilter;","/**\r\n * Creates a 3D rectangle.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../Container\";\nimport { Sprite } from \"../../Sprite\";\nimport * as $math from \"../../utils/Math\";\nimport * as $path from \"../../rendering/Path\";\nimport { Color, color, toColor } from \"../../utils/Color\";\nimport { RadialGradient } from \"../../rendering/fills/RadialGradient\";\nimport { LinearGradient } from \"../../rendering/fills/LinearGradient\";\nimport { LightenFilter } from \"../../rendering/filters/LightenFilter\";\nimport * as $type from \"../../utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Builds a 3D rectangle\r\n * @see {@link IRectangle3DEvents} for a list of available events\r\n * @see {@link IRectangle3DAdapters} for a list of available Adapters\r\n */\n\nvar Rectangle3D =\n/** @class */\nfunction (_super) {\n __extends(Rectangle3D, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Rectangle3D() {\n var _this = _super.call(this) || this;\n\n _this.angle = 30;\n _this.depth = 30;\n _this.className = \"Rectangle3D\";\n _this.layout = \"none\";\n\n var sideBack = _this.createChild(Sprite);\n\n sideBack.shouldClone = false;\n sideBack.setElement(_this.paper.add(\"path\"));\n sideBack.isMeasured = false;\n _this.sideBack = sideBack;\n\n _this._disposers.push(_this.sideBack);\n\n var sideBottom = _this.createChild(Sprite);\n\n sideBottom.shouldClone = false;\n sideBottom.setElement(_this.paper.add(\"path\"));\n sideBottom.isMeasured = false;\n _this.sideBottom = sideBottom;\n\n _this._disposers.push(_this.sideBottom);\n\n var sideLeft = _this.createChild(Sprite);\n\n sideLeft.shouldClone = false;\n sideLeft.setElement(_this.paper.add(\"path\"));\n sideLeft.isMeasured = false;\n _this.sideLeft = sideLeft;\n\n _this._disposers.push(_this.sideLeft);\n\n var sideRight = _this.createChild(Sprite);\n\n sideRight.shouldClone = false;\n sideRight.setElement(_this.paper.add(\"path\"));\n sideRight.isMeasured = false;\n _this.sideRight = sideRight;\n\n _this._disposers.push(_this.sideRight);\n\n var sideTop = _this.createChild(Sprite);\n\n sideTop.shouldClone = false;\n sideTop.setElement(_this.paper.add(\"path\"));\n sideTop.isMeasured = false;\n _this.sideTop = sideTop;\n\n _this._disposers.push(_this.sideTop);\n\n var sideFront = _this.createChild(Sprite);\n\n sideFront.shouldClone = false;\n sideFront.setElement(_this.paper.add(\"path\"));\n sideFront.isMeasured = false;\n _this.sideFront = sideFront;\n\n _this._disposers.push(_this.sideFront);\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Rectangle3D.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n var w = this.innerWidth;\n var h = this.innerHeight;\n var depth = this.depth;\n var angle = this.angle;\n var sin = $math.sin(angle);\n var cos = $math.cos(angle);\n var a = {\n x: 0,\n y: 0\n };\n var b = {\n x: w,\n y: 0\n };\n var c = {\n x: w,\n y: h\n };\n var d = {\n x: 0,\n y: h\n };\n var ah = {\n x: depth * cos,\n y: -depth * sin\n };\n var bh = {\n x: depth * cos + w,\n y: -depth * sin\n };\n var ch = {\n x: depth * cos + w,\n y: -depth * sin + h\n };\n var dh = {\n x: depth * cos,\n y: -depth * sin + h\n };\n this.sideFront.path = $path.moveTo(a) + $path.lineTo(b) + $path.lineTo(c) + $path.lineTo(d) + $path.closePath();\n this.sideBack.path = $path.moveTo(ah) + $path.lineTo(bh) + $path.lineTo(ch) + $path.lineTo(dh) + $path.closePath();\n this.sideLeft.path = $path.moveTo(a) + $path.lineTo(ah) + $path.lineTo(dh) + $path.lineTo(d) + $path.closePath();\n this.sideRight.path = $path.moveTo(b) + $path.lineTo(bh) + $path.lineTo(ch) + $path.lineTo(c) + $path.closePath();\n this.sideBottom.path = $path.moveTo(d) + $path.lineTo(dh) + $path.lineTo(ch) + $path.lineTo(c) + $path.closePath();\n this.sideTop.path = $path.moveTo(a) + $path.lineTo(ah) + $path.lineTo(bh) + $path.lineTo(b) + $path.closePath();\n };\n\n Object.defineProperty(Rectangle3D.prototype, \"depth\", {\n /**\r\n * @return Depth (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"depth\");\n },\n\n /**\r\n * Depth (Z dimension) of the 3D rectangle in pixels.\r\n *\r\n * @default 30\r\n * @param value Depth (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"depth\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Rectangle3D.prototype, \"angle\", {\n /**\r\n * @return Angle\r\n */\n get: function get() {\n return this.getPropertyValue(\"angle\");\n },\n\n /**\r\n * Angle of the point of view to the 3D element. (0-360)\r\n *\r\n * @default 30\r\n * @param value Angle\r\n */\n set: function set(value) {\n this.setPropertyValue(\"angle\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets actual `fill` property on the SVG element, including applicable color\r\n * modifiers.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Fill\r\n */\n\n Rectangle3D.prototype.setFill = function (value) {\n _super.prototype.setFill.call(this, value);\n\n if (!$type.isObject(value) || \"r\" in value) {\n value = toColor(value);\n }\n\n var colorStr;\n\n if (value instanceof Color) {\n colorStr = value.hex;\n } else if (value instanceof LinearGradient || value instanceof RadialGradient) {\n colorStr = value.stops.getIndex(0).color.hex;\n } else {\n var filter = new LightenFilter();\n filter.lightness = -0.2;\n this.sideBack.filters.push(filter);\n var filter2 = filter.clone();\n filter2.lightness = -0.4;\n this.sideLeft.filters.push(filter2);\n var filter3 = filter.clone();\n filter3.lightness = -0.2;\n this.sideRight.filters.push(filter3);\n var filter4 = filter.clone();\n filter4.lightness = -0.1;\n this.sideTop.filters.push(filter4);\n var filter5 = filter.clone();\n filter5.lightness = -0.5;\n this.sideBottom.filters.push(filter5);\n }\n\n if (colorStr) {\n this.sideBack.fill = color(colorStr).lighten(-0.2);\n this.sideLeft.fill = color(colorStr).lighten(-0.4);\n this.sideRight.fill = color(colorStr).lighten(-0.2);\n this.sideTop.fill = color(colorStr).lighten(-0.1);\n this.sideBottom.fill = color(colorStr).lighten(-0.5);\n }\n };\n /**\r\n * Copies all properties and related data from a different instance of Rectangle3D.\r\n *\r\n * @param source Source Rectangle3D\r\n */\n\n\n Rectangle3D.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.sideBack.copyFrom(source.sideBack);\n this.sideLeft.copyFrom(source.sideLeft);\n this.sideRight.copyFrom(source.sideRight);\n this.sideTop.copyFrom(source.sideTop);\n this.sideBottom.copyFrom(source.sideBottom);\n };\n\n return Rectangle3D;\n}(Container);\n\nexport { Rectangle3D };","/**\r\n * 3D slice module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Slice } from \"../Slice\";\nimport { Sprite } from \"../../Sprite\";\nimport * as $math from \"../../utils/Math\";\nimport * as $path from \"../../rendering/Path\";\nimport * as $type from \"../../utils/Type\";\nimport { Color, color } from \"../../utils/Color\";\nimport { RadialGradient } from \"../../rendering/fills/RadialGradient\";\nimport { LinearGradient } from \"../../rendering/fills/LinearGradient\";\nimport { LightenFilter } from \"../../rendering/filters/LightenFilter\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a 3D slice of a Pie chart.\r\n *\r\n * @see {@link ISlice3DEvents} for a list of available events\r\n * @see {@link ISlice3DAdapters} for a list of available Adapters\r\n */\n\nvar Slice3D =\n/** @class */\nfunction (_super) {\n __extends(Slice3D, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Slice3D() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"Slice3D\";\n _this.layout = \"none\"; // Create edge container\n\n var edge = _this.createChild(Sprite);\n\n _this.edge = edge;\n edge.shouldClone = false;\n edge.isMeasured = false;\n edge.toBack(); // Set defaults\n\n _this.angle = 30;\n _this.depth = 20; // Create side A element\n\n var sideA = _this.createChild(Sprite);\n\n _this.sideA = sideA;\n sideA.shouldClone = false;\n sideA.isMeasured = false; //sideA.setElement(this.paper.add(\"path\"));\n //sideA.strokeOpacity = 0;\n // Crate side B element\n\n var sideB = _this.createChild(Sprite);\n\n _this.sideB = sideB;\n sideB.shouldClone = false;\n sideB.isMeasured = false; //sideB.setElement(this.paper.add(\"path\"));\n //sideB.strokeOpacity = 0;\n // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Sets actual `fill` property on the SVG element, including applicable color\r\n * modifiers.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Fill\r\n */\n\n\n Slice3D.prototype.setFill = function (value) {\n _super.prototype.setFill.call(this, value);\n\n var colorStr;\n\n if (value instanceof Color) {\n colorStr = value.hex;\n } else if (value instanceof LinearGradient || value instanceof RadialGradient) {\n colorStr = value.stops.getIndex(0).color.hex;\n } else {\n var filter = new LightenFilter();\n filter.lightness = -0.25;\n this.edge.filters.push(filter);\n this.sideA.filters.push(filter.clone());\n this.sideB.filters.push(filter.clone());\n }\n\n if (colorStr) {\n var edgeFill = color(colorStr).lighten(-0.25);\n this.edge.fill = edgeFill;\n this.sideA.fill = edgeFill;\n this.sideB.fill = edgeFill;\n this.edge.stroke = edgeFill;\n this.sideA.stroke = edgeFill;\n this.sideB.stroke = edgeFill;\n }\n };\n /**\r\n * Draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Slice3D.prototype.draw = function () {\n this.cornerRadius = 0;\n this.innerCornerRadius = 0;\n\n _super.prototype.draw.call(this);\n\n if (this.arc !== 0 && this.radius > 0 && this.depth > 0) {\n this.sideB.show(0);\n this.sideA.show(0);\n this.edge.show(0);\n var startAngle = this.startAngle;\n var arc = this.arc;\n var innerRadius = this.pixelInnerRadius || 0;\n var radiusY = this.radiusY || 0; //let cornerRadius = this.cornerRadius || 0;\n //let innerCornerRadius = this.innerCornerRadius;\n\n var radius = this.radius; // this is code duplicate with $path.arc. @todo to think how to avoid it\n\n var endAngle = startAngle + arc; //let crSin = $math.sin($math.min(arc, 45) / 2);\n //innerCornerRadius = innerCornerRadius || cornerRadius;\n\n var innerRadiusY = radiusY / radius * innerRadius; //let cornerRadiusY = (radiusY / radius) * cornerRadius;\n //let innerCornerRadiusY = (radiusY / radius) * innerCornerRadius;\n //cornerRadius = $math.fitToRange(cornerRadius, 0, (radius - innerRadius) / 2);\n //cornerRadiusY = $math.fitToRange(cornerRadiusY, 0, (radiusY - innerRadiusY) / 2);\n //innerCornerRadius = $math.fitToRange(innerCornerRadius, 0, (radius - innerRadius) / 2);\n //innerCornerRadiusY = $math.fitToRange(innerCornerRadiusY, 0, (radiusY - innerRadiusY) / 2);\n //cornerRadius = $math.fitToRange(cornerRadius, 0, radius * crSin);\n //cornerRadiusY = $math.fitToRange(cornerRadiusY, 0, radiusY * crSin);\n //innerCornerRadius = $math.fitToRange(innerCornerRadius, 0, innerRadius * crSin);\n //innerCornerRadiusY = $math.fitToRange(innerCornerRadiusY, 0, innerRadiusY * crSin);\n //let crAngle: number = Math.asin(cornerRadius / radius / 2) * $math.DEGREES * 2;\n //let crAngleY: number = Math.asin(cornerRadiusY / radiusY / 2) * $math.DEGREES * 2;\n //if (innerRadius < innerCornerRadius) {\n //\tinnerRadius = innerCornerRadius;\n //}\n //if (innerRadiusY < innerCornerRadiusY) {\n //\tinnerRadiusY = innerCornerRadiusY;\n //}\n //let crInnerAngle: number = Math.asin(innerCornerRadius / innerRadius / 2) * $math.DEGREES * 2;\n //let crInnerAngleY: number = Math.asin(innerCornerRadiusY / innerRadiusY / 2) * $math.DEGREES * 2;\n //if (!$type.isNumber(crInnerAngle)) {\n //\tcrInnerAngle = 0;\n //}\n //if (!$type.isNumber(crInnerAngleY)) {\n //\tcrInnerAngleY = 0;\n //}\n //let middleAngle = startAngle + arc / 2;\n //let mPoint = { x: $math.round($math.cos(middleAngle) * innerRadius, 4), y: $math.round($math.sin(middleAngle) * innerRadiusY, 4) };\n\n var a0 = {\n x: $math.cos(startAngle) * innerRadius,\n y: $math.sin(startAngle) * innerRadiusY\n };\n var b0 = {\n x: $math.cos(startAngle) * radius,\n y: $math.sin(startAngle) * radiusY\n };\n var c0 = {\n x: $math.cos(endAngle) * radius,\n y: $math.sin(endAngle) * radiusY\n };\n var d0 = {\n x: $math.cos(endAngle) * innerRadius,\n y: $math.sin(endAngle) * innerRadiusY\n }; // end of duplicate\n\n var h = this.depth;\n var ah = {\n x: a0.x,\n y: a0.y - h\n };\n var bh = {\n x: b0.x,\n y: b0.y - h\n };\n var ch = {\n x: c0.x,\n y: c0.y - h\n };\n var dh = {\n x: d0.x,\n y: d0.y - h\n };\n var edgePath = \"\";\n var count = Math.ceil(arc / 5);\n var step = arc / count;\n var mangle = startAngle;\n var prevPoint = bh;\n\n for (var i = 0; i < count; i++) {\n mangle += step;\n\n if (mangle > 0 && mangle < 180) {\n edgePath += $path.moveTo(prevPoint);\n var pp = {\n x: $math.cos(mangle) * radius,\n y: $math.sin(mangle) * radiusY - h\n };\n edgePath += $path.lineTo({\n x: prevPoint.x,\n y: prevPoint.y + h\n });\n edgePath += $path.arcToPoint({\n x: pp.x,\n y: pp.y + h\n }, radius, radiusY, true);\n edgePath += $path.lineTo(pp);\n edgePath += $path.arcToPoint(prevPoint, radius, radiusY);\n edgePath += \"z\";\n prevPoint = pp;\n } else {\n edgePath += $path.moveTo(prevPoint);\n var pp = {\n x: $math.cos(mangle) * radius,\n y: $math.sin(mangle) * radiusY - h\n };\n edgePath += $path.arcToPoint(pp, radius, radiusY, true);\n edgePath += $path.lineTo({\n x: pp.x,\n y: pp.y + h\n });\n edgePath += $path.arcToPoint({\n x: prevPoint.x,\n y: prevPoint.y + h\n }, radius, radiusY);\n edgePath += $path.lineTo(prevPoint);\n edgePath += \"z\";\n prevPoint = pp;\n }\n }\n\n prevPoint = ah;\n mangle = startAngle;\n\n for (var i = 0; i < count; i++) {\n mangle += step;\n\n if (mangle > 0 && mangle < 180) {\n edgePath += $path.moveTo(prevPoint);\n var pp = {\n x: $math.cos(mangle) * innerRadius,\n y: $math.sin(mangle) * innerRadiusY - h\n };\n edgePath += $path.lineTo({\n x: prevPoint.x,\n y: prevPoint.y + h\n });\n edgePath += $path.arcToPoint({\n x: pp.x,\n y: pp.y + h\n }, innerRadius, innerRadiusY, true);\n edgePath += $path.lineTo(pp);\n edgePath += $path.arcToPoint(prevPoint, innerRadius, innerRadiusY);\n edgePath += \"z\";\n prevPoint = pp;\n } else {\n edgePath += $path.moveTo(prevPoint);\n var pp = {\n x: $math.cos(mangle) * innerRadius,\n y: $math.sin(mangle) * innerRadiusY - h\n };\n edgePath += $path.arcToPoint(pp, innerRadius, innerRadiusY, true);\n edgePath += $path.lineTo({\n x: pp.x,\n y: pp.y + h\n });\n edgePath += $path.arcToPoint({\n x: prevPoint.x,\n y: prevPoint.y + h\n }, innerRadius, innerRadiusY);\n edgePath += $path.lineTo(prevPoint);\n edgePath += \"z\";\n prevPoint = pp;\n }\n }\n\n this.edge.path = edgePath;\n /*\r\n a0 = { x: $math.cos(startAngle) * (innerRadius + innerCornerRadius), y: $math.sin(startAngle) * (innerRadiusY + innerCornerRadiusY) };\r\n b0 = { x: $math.cos(startAngle) * (radius - cornerRadius), y: $math.sin(startAngle) * (radiusY - cornerRadiusY) };\r\n c0 = { x: $math.cos(endAngle) * (radius - cornerRadius), y: $math.sin(endAngle) * (radiusY - cornerRadiusY) };\r\n d0 = { x: $math.cos(endAngle) * (innerRadius + innerCornerRadius), y: $math.sin(endAngle) * (innerRadiusY + innerCornerRadiusY) };\r\n // end of duplicate\r\n \r\n ah = { x: a0.x, y: a0.y - h };\r\n bh = { x: b0.x, y: b0.y - h };\r\n ch = { x: c0.x, y: c0.y - h };\r\n dh = { x: d0.x, y: d0.y - h };\r\n */\n\n this.sideA.path = $path.moveTo(a0) + $path.lineTo(b0) + $path.lineTo(bh) + $path.lineTo(ah) + $path.closePath();\n this.sideB.path = $path.moveTo(c0) + $path.lineTo(d0) + $path.lineTo(dh) + $path.lineTo(ch) + $path.closePath();\n\n if (this.startAngle < 90) {\n this.sideA.toBack();\n } else {\n this.sideA.toFront();\n }\n\n if (this.startAngle + this.arc > 90) {\n this.sideB.toBack();\n } else {\n this.sideB.toFront();\n }\n\n this.slice.dy = -h;\n } else {\n this.sideA.hide(0);\n this.sideB.hide(0);\n this.edge.hide(0);\n }\n };\n\n Object.defineProperty(Slice3D.prototype, \"depth\", {\n /**\r\n * @return Depth (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"depth\");\n },\n\n /**\r\n * Depth (height) of the 3D slice in pixels.\r\n *\r\n * @default 20\r\n * @param depth Depth (px)\r\n */\n set: function set(depth) {\n this.setPropertyValue(\"depth\", depth, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice3D.prototype, \"angle\", {\n /**\r\n * @return Angle\r\n */\n get: function get() {\n var angle = this.getPropertyValue(\"angle\");\n\n if (!$type.isNumber(angle)) {\n angle = 0;\n }\n\n return angle;\n },\n\n /**\r\n * Angle of the point of view to the 3D element. (0-360)\r\n *\r\n * @default 30\r\n * @param value Angle\r\n */\n set: function set(value) {\n this.setPropertyValue(\"angle\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Slice3D.prototype, \"radiusY\", {\n /**\r\n * @return Vertical radius (0-1)\r\n */\n get: function get() {\n var radiusY = this.getPropertyValue(\"radiusY\");\n\n if (!$type.isNumber(radiusY)) {\n radiusY = this.radius - this.radius * this.angle / 90;\n }\n\n return radiusY;\n },\n\n /**\r\n * Vertical radius for creating skewed slices.\r\n *\r\n * This is relevant to `radius`, e.g. 0.5 will set vertical radius to half\r\n * the `radius`.\r\n *\r\n * @param value Vertical radius (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"radiusY\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies all properties and related data from a different instance of Axis.\r\n *\r\n * @param source Source Axis\r\n */\n\n Slice3D.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.edge.copyFrom(source.edge);\n this.sideA.copyFrom(source.sideA);\n this.sideB.copyFrom(source.sideB);\n };\n\n return Slice3D;\n}(Slice);\n\nexport { Slice3D };","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { RadialGradient } from \"./RadialGradient\";\nimport { GradientModifier } from \"./GradientModifier\";\nimport { registry } from \"../../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This class can be used to modify radial gradient steps, changing visual\r\n * properties like lightness, brightness, opacity of each set.\r\n *\r\n * It can also set offsets for each gradient step.\r\n *\r\n * E.g. if I want to fill a columns in a column series to be a solid fill from\r\n * top to 80% of height, then gradually fades out, I can use the following\r\n * gradient modifier as a `fillModifier`:\r\n *\r\n * ```TypeScript\r\n * let fillModifier = new am4core.LinearGradientModifier();\r\n * fillModifier.opacities = [1, 1, 0];\r\n * fillModifier.offsets = [0, 0.8, 1];\r\n * columnSeries.columns.template.fillModifier = fillModifier;\r\n * ```\r\n * ```JavaScript\r\n * var fillModifier = new am4core.LinearGradientModifier();\r\n * fillModifier.opacities = [1, 1, 0];\r\n * fillModifier.offsets = [0, 0.8, 1];\r\n * columnSeries.columns.template.fillModifier = fillModifier;\r\n * ```\r\n * ```JSON\r\n * \"series\": [{\r\n * \"type\": \"ColumnSeries\",\r\n * \"columns\": {\r\n * \"fillModifier\": {\r\n * \"type\": \"LinearGradientModifier\",\r\n * \"opacities\": [1, 1, 0],\r\n * \"offsets\": [0, 0.8, 1]\r\n * }\r\n * }\r\n * }]\r\n * ```\r\n */\n\nvar RadialGradientModifier =\n/** @class */\nfunction (_super) {\n __extends(RadialGradientModifier, _super);\n /**\r\n * Constructor.\r\n */\n\n\n function RadialGradientModifier() {\n var _this = _super.call(this) || this;\n\n _this.className = \"RadialGradientModifier\";\n _this.gradient = new RadialGradient();\n\n _this.applyTheme();\n\n return _this;\n }\n\n RadialGradientModifier.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.gradient = source.gradient.clone();\n };\n\n return RadialGradientModifier;\n}(GradientModifier);\n\nexport { RadialGradientModifier };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"RadialGradientModifier\"] = RadialGradientModifier;","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Pattern } from \"./Pattern\";\nimport { registry } from \"../../Registry\";\nimport * as $path from \"../../rendering/Path\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Line pattern.\r\n */\n\nvar LinePattern =\n/** @class */\nfunction (_super) {\n __extends(LinePattern, _super);\n /**\r\n * Constructor\r\n */\n\n\n function LinePattern() {\n var _this = _super.call(this) || this;\n\n _this.properties[\"gap\"] = 0;\n _this._line = _this.paper.add(\"path\");\n\n _this.addElement(_this._line);\n\n return _this;\n }\n /**\r\n * Draws the pattern.\r\n */\n\n\n LinePattern.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (Math.round(this.rotation / 90) != this.rotation / 90) {\n this.properties[\"shapeRendering\"] = \"auto\";\n }\n\n if (this._line) {\n var w = this.width;\n var h = this.height;\n var path = \"\";\n\n if (!this.gap) {\n if (Math.round(this.rotation / 90) != this.rotation / 90) {\n path = $path.moveTo({\n x: -w,\n y: h / 2\n }) + $path.lineTo({\n x: w * 2,\n y: h / 2\n });\n this.properties[\"rotationX\"] = this.width / 2;\n this.properties[\"rotationY\"] = this.height / 2;\n } else {\n path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: w,\n y: 0\n });\n }\n } else {\n var step = this.gap + this.strokeWidth;\n var count = this.height / step;\n\n for (var i = -count / 2; i < count * 1.5; i++) {\n if (Math.round(this.rotation / 90) != this.rotation / 90) {\n path += $path.moveTo({\n x: -w,\n y: (i + 0.5) * step\n }) + $path.lineTo({\n x: w * 2,\n y: (i + 0.5) * step\n });\n this.properties[\"rotationX\"] = this.width / 2;\n this.properties[\"rotationY\"] = this.height / 2;\n } else {\n path += $path.moveTo({\n x: -w,\n y: i * step\n }) + $path.lineTo({\n x: w * 2,\n y: i * step\n });\n }\n }\n }\n\n this._line.attr({\n \"d\": path\n });\n }\n };\n\n Object.defineProperty(LinePattern.prototype, \"gap\", {\n /**\r\n * @return gap\r\n */\n get: function get() {\n return this.properties[\"gap\"];\n },\n\n /**\r\n * Number of pixels between pattern lines.\r\n *\r\n * The pattern will automatically draw required number of lines to fill\r\n * pattern area maintaining `gap` distance between them.\r\n *\r\n * 0 (zero) means only single line will be drawn.\r\n *\r\n * @default 0\r\n * @since 4.7.7\r\n */\n set: function set(value) {\n this.properties[\"gap\"] = value;\n this.draw();\n },\n enumerable: true,\n configurable: true\n });\n return LinePattern;\n}(Pattern);\n\nexport { LinePattern };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"LinePattern\"] = LinePattern;","/**\r\n * Rectangular pattern module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Pattern } from \"./Pattern\";\nimport { registry } from \"../../Registry\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Circular pattern\r\n */\n\nvar CirclePattern =\n/** @class */\nfunction (_super) {\n __extends(CirclePattern, _super);\n /**\r\n * Constructor\r\n */\n\n\n function CirclePattern() {\n var _this = _super.call(this) || this;\n\n _this.properties[\"radius\"] = 2;\n _this._circle = _this.paper.add(\"circle\");\n\n _this.addElement(_this._circle);\n\n _this.shapeRendering = \"auto\";\n return _this;\n }\n /**\r\n * Draws the circle element.\r\n */\n\n\n CirclePattern.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (this._circle) {\n this._circle.attr({\n \"r\": this.radius,\n \"cx\": this.width / 2,\n \"cy\": this.height / 2\n });\n }\n };\n\n Object.defineProperty(CirclePattern.prototype, \"radius\", {\n /**\r\n * @return Radius (px)\r\n */\n get: function get() {\n return this.properties[\"radius\"];\n },\n\n /**\r\n * Circle radius in pixels.\r\n *\r\n * @param value Radius (px)\r\n */\n set: function set(value) {\n this.properties[\"radius\"] = value;\n this.draw();\n },\n enumerable: true,\n configurable: true\n });\n return CirclePattern;\n}(Pattern);\n\nexport { CirclePattern };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"CirclePattern\"] = CirclePattern;","/**\r\n * Rectangular pattern module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Pattern } from \"./Pattern\";\nimport { registry } from \"../../Registry\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Rectangular pattern\r\n */\n\nvar RectPattern =\n/** @class */\nfunction (_super) {\n __extends(RectPattern, _super);\n /**\r\n * Constructor\r\n */\n\n\n function RectPattern() {\n var _this = _super.call(this) || this;\n\n _this.rectHeight = 1;\n _this.rectWidth = 1;\n _this._rect = _this.paper.add(\"rect\");\n\n _this.addElement(_this._rect);\n\n return _this;\n }\n /**\r\n * Draws the rectangular element.\r\n */\n\n\n RectPattern.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n this.properties[\"rotationX\"] = this.width / 2;\n this.properties[\"rotationY\"] = this.height / 2;\n\n if (this._rect) {\n this._rect.attr({\n \"width\": this.rectWidth,\n \"height\": this.rectHeight,\n \"x\": (this.width - this.rectWidth) / 2,\n \"y\": (this.height - this.rectHeight) / 2\n });\n }\n };\n\n Object.defineProperty(RectPattern.prototype, \"rectWidth\", {\n /**\r\n * @return Width (px)\r\n */\n get: function get() {\n return this.properties[\"rectWidth\"];\n },\n\n /**\r\n * Rectangle width in pixels.\r\n *\r\n * @param value Width (px)\r\n */\n set: function set(value) {\n this.properties[\"rectWidth\"] = value;\n this.draw();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RectPattern.prototype, \"rectHeight\", {\n /**\r\n * @return Height (px)\r\n */\n get: function get() {\n return this.properties[\"rectHeight\"];\n },\n\n /**\r\n * Rectangle height in pixels.\r\n *\r\n * @param value Height (px)\r\n */\n set: function set(value) {\n this.properties[\"rectHeight\"] = value;\n this.draw();\n },\n enumerable: true,\n configurable: true\n });\n return RectPattern;\n}(Pattern);\n\nexport { RectPattern };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"RectPattern\"] = RectPattern;","/**\r\n * Module for \"Colorize\" filter.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Filter } from \"./Filter\";\nimport { registry } from \"../../Registry\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a \"Colorize\" filter.\r\n */\n\nvar ColorizeFilter =\n/** @class */\nfunction (_super) {\n __extends(ColorizeFilter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ColorizeFilter() {\n var _this = _super.call(this) || this;\n\n _this.className = \"ColorizeFilter\"; // Create elements\n // NOTE: we do not need to add each individual element to `_disposers`\n // because `filterPrimitives` has an event handler which automatically adds\n // anything added to it to `_disposers`\n\n _this.feColorMatrix = _this.paper.add(\"feColorMatrix\");\n\n _this.feColorMatrix.attr({\n \"type\": \"matrix\"\n }); //this.feColorMatrix.setAttribute(\"in\", \"SourceAlpha\");\n\n\n _this.filterPrimitives.push(_this.feColorMatrix); // Set default properties\n\n\n _this.intensity = 1;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * (Re)applies colors to the already existing filter by modifying filyer's\r\n * color matrix element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n ColorizeFilter.prototype.applyFilter = function () {\n var i = this.intensity;\n var ii = 1 - i;\n var r;\n var g;\n var b;\n var color = this.color;\n\n if (color && color.rgb) {\n r = color.rgb.r / 255 * i;\n g = color.rgb.g / 255 * i;\n b = color.rgb.b / 255 * i;\n } else {\n r = 0;\n g = 0;\n b = 0;\n }\n\n this.feColorMatrix.attr({\n \"values\": ii + \" 0 0 0 \" + r + \" 0 \" + ii + \" 0 0 \" + g + \" 0 0 \" + ii + \" 0 \" + b + \" 0 0 0 1 0\"\n });\n };\n\n Object.defineProperty(ColorizeFilter.prototype, \"color\", {\n /**\r\n * @return Color\r\n */\n get: function get() {\n return this.properties[\"color\"];\n },\n\n /**\r\n * Target color to apply to the element.\r\n *\r\n * Depending on the `intensity`, all colors of the target element will steer\r\n * towards this color.\r\n *\r\n * E.g. setting to `am4core.color(\"greener\")` will make all colors greener.\r\n *\r\n * @param value Color\r\n */\n set: function set(value) {\n this.properties[\"color\"] = value;\n this.applyFilter();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ColorizeFilter.prototype, \"intensity\", {\n /**\r\n * @return Intensity (0-1)\r\n */\n get: function get() {\n return this.properties.intensity;\n },\n\n /**\r\n * Intensity of the color (0-1).\r\n *\r\n * The bigger the number the more of a `color` target's colors will become.\r\n *\r\n * 0 means the colors will remain as they are.\r\n * 1 means all colors will become the target `color`.\r\n *\r\n * @default 1\r\n * @param value Intensity (0-1)\r\n */\n set: function set(value) {\n this.properties.intensity = value;\n this.applyFilter();\n },\n enumerable: true,\n configurable: true\n });\n return ColorizeFilter;\n}(Filter);\n\nexport { ColorizeFilter };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ColorizeFilter\"] = ColorizeFilter;","/**\r\n * Module for \"Desaturate\" filter.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Filter } from \"./Filter\";\nimport { registry } from \"../../Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creats a \"Desaturate\" filter\r\n */\n\nvar DesaturateFilter =\n/** @class */\nfunction (_super) {\n __extends(DesaturateFilter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function DesaturateFilter() {\n var _this = _super.call(this) || this;\n\n _this.className = \"DesaturateFilter\"; // Create elements\n // NOTE: we do not need to add each individual element to `_disposers`\n // because `filterPrimitives` has an event handler which automatically adds\n // anything added to it to `_disposers`\n\n _this.feColorMatrix = _this.paper.add(\"feColorMatrix\");\n\n _this.feColorMatrix.attr({\n \"type\": \"saturate\"\n });\n\n _this.filterPrimitives.push(_this.feColorMatrix); // Set default properties\n\n\n _this.width = 120;\n _this.height = 120;\n _this.saturation = 0;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(DesaturateFilter.prototype, \"saturation\", {\n /**\r\n * @return Saturation (0-1)\r\n */\n get: function get() {\n return this.properties[\"saturation\"];\n },\n\n /**\r\n * Saturation.\r\n *\r\n * 0 - completely desaturated.\r\n * 1 - fully saturated (gray).\r\n *\r\n * @param value Saturation (0-1)\r\n */\n set: function set(value) {\n this.properties[\"saturation\"] = value;\n this.feColorMatrix.attr({\n \"values\": value.toString()\n });\n },\n enumerable: true,\n configurable: true\n });\n return DesaturateFilter;\n}(Filter);\n\nexport { DesaturateFilter };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"DesaturateFilter\"] = DesaturateFilter;","/**\r\n * Module for \"Blur\" filter.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Filter } from \"./Filter\";\nimport { registry } from \"../../Registry\";\n;\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a \"Blur\" filter.\r\n */\n\nvar BlurFilter =\n/** @class */\nfunction (_super) {\n __extends(BlurFilter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function BlurFilter() {\n var _this = _super.call(this) || this;\n\n _this.className = \"BlurFilter\"; // Create elements\n // NOTE: we do not need to add each individual element to `_disposers`\n // because `filterPrimitives` has an event handler which automatically adds\n // anything added to it to `_disposers`\n\n _this.feGaussianBlur = _this.paper.add(\"feGaussianBlur\");\n\n _this.feGaussianBlur.attr({\n \"result\": \"blurOut\",\n \"in\": \"SourceGraphic\"\n });\n\n _this.filterPrimitives.push(_this.feGaussianBlur); // Set default properties\n\n\n _this.width = 200;\n _this.height = 200;\n _this.blur = 1.5;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(BlurFilter.prototype, \"blur\", {\n /**\r\n * @return Blur\r\n */\n get: function get() {\n return this.properties.blur;\n },\n\n /**\r\n * Blur value.\r\n *\r\n * The bigger the value, the blurrier the target element will become.\r\n *\r\n * @default 1.5\r\n * @param value Blur\r\n */\n set: function set(value) {\n this.properties.blur = value;\n this.feGaussianBlur.attr({\n \"stdDeviation\": value / this.scale\n });\n },\n enumerable: true,\n configurable: true\n });\n return BlurFilter;\n}(Filter);\n\nexport { BlurFilter };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"BlurFilter\"] = BlurFilter;","/**\r\n * Module for \"Focus\" filter.\r\n */\nimport { __extends } from \"tslib\";\nimport { Filter } from \"./Filter\";\nimport { InterfaceColorSet } from \"../../utils/InterfaceColorSet\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a \"Focus\" filter.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/accessibility/} more about accessibility\r\n * @see {@link https://www.amcharts.com/docs/v4/tutorials/changing-appearance-of-focused-items/} cusomizing focus appearance\r\n */\n\nvar FocusFilter =\n/** @class */\nfunction (_super) {\n __extends(FocusFilter, _super);\n /**\r\n * Constructor\r\n */\n\n\n function FocusFilter() {\n var _this = _super.call(this) || this;\n\n _this.className = \"FocusFilter\"; // Create elements\n // NOTE: we do not need to add each individual element to `_disposers`\n // because `filterPrimitives` has an event handler which automatically adds\n // anything added to it to `_disposers`\n\n _this.feFlood = _this.paper.add(\"feFlood\");\n\n _this.feFlood.attr({\n \"flood-color\": new InterfaceColorSet().getFor(\"primaryButtonHover\"),\n \"result\": \"base\"\n });\n\n _this.filterPrimitives.push(_this.feFlood);\n\n _this.feMorphology = _this.paper.add(\"feMorphology\");\n\n _this.feMorphology.attr({\n \"result\": \"bigger\",\n \"in\": \"SourceGraphic\",\n \"operator\": \"dilate\",\n \"radius\": \"2\"\n });\n\n _this.filterPrimitives.push(_this.feMorphology);\n\n _this.feColorMatrix = _this.paper.add(\"feColorMatrix\");\n\n _this.feColorMatrix.attr({\n \"result\": \"mask\",\n \"in\": \"bigger\",\n \"type\": \"matrix\",\n \"values\": \"0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 1 0\"\n });\n\n _this.filterPrimitives.push(_this.feColorMatrix);\n\n _this.feComposite = _this.paper.add(\"feComposite\");\n\n _this.feComposite.attr({\n \"result\": \"drop\",\n \"in\": \"base\",\n \"in2\": \"mask\",\n \"operator\": \"in\"\n });\n\n _this.filterPrimitives.push(_this.feComposite);\n\n _this.feBlend = _this.paper.add(\"feBlend\");\n\n _this.feBlend.attr({\n \"in\": \"SourceGraphic\",\n \"in2\": \"drop\",\n \"mode\": \"normal\"\n });\n\n _this.filterPrimitives.push(_this.feBlend); // Set default properties\n\n\n _this.width = 130;\n _this.height = 130;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(FocusFilter.prototype, \"stroke\", {\n /**\r\n * @return Color\r\n */\n get: function get() {\n return this.properties[\"stroke\"];\n },\n\n /**\r\n * Stroke (outline) color.\r\n *\r\n * @param value Color\r\n */\n set: function set(value) {\n this.properties[\"stroke\"] = value;\n this.feFlood.attr({\n \"flood-color\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(FocusFilter.prototype, \"strokeWidth\", {\n /**\r\n * @return Outline thickness (px)\r\n */\n get: function get() {\n return this.properties[\"strokeWidth\"];\n },\n\n /**\r\n * Stroke (outline) thickness in pixels.\r\n *\r\n * @param value Outline thickness (px)\r\n */\n set: function set(value) {\n this.properties[\"strokeWidth\"] = value;\n this.feMorphology.attr({\n \"radius\": value\n });\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(FocusFilter.prototype, \"opacity\", {\n /**\r\n * @return Outline opacity (0-1)\r\n */\n get: function get() {\n return this.properties[\"opacity\"];\n },\n\n /**\r\n * Opacity of the outline. (0-1)\r\n *\r\n * @param value Outline opacity (0-1)\r\n */\n set: function set(value) {\n this.properties[\"opacity\"] = value;\n this.feColorMatrix.attr({\n \"values\": \"0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 \" + value + \" 0\"\n });\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Sets filter's target element.\r\n *\r\n * In addition it also disables built-in focus outline on element this\r\n * filter is applied to.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Element filter is being attached to\r\n */\n\n FocusFilter.prototype.setSprite = function (value) {\n if (this._sprite && this._sprite != value) {\n this._sprite.group.removeStyle(\"outline\");\n }\n\n value.group.addStyle({\n \"outline\": \"none\"\n });\n\n _super.prototype.setSprite.call(this, value);\n };\n\n return FocusFilter;\n}(Filter);\n\nexport { FocusFilter };","/**\r\n * This module contains ColorSet object definition\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObject } from \"../Base\";\nimport { Color, color } from \"./Color\";\nimport { registry } from \"../Registry\";\nimport * as $colors from \"./Colors\";\nimport * as $type from \"./Type\";\nimport * as $utils from \"./Utils\";\nimport * as $math from \"./Math\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Represents a set of colors. Can also generate colors according to set rules.\r\n *\r\n * @important\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/colors/} for color-related info\r\n */\n\nvar ColorSet =\n/** @class */\nfunction (_super) {\n __extends(ColorSet, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ColorSet() {\n var _this = _super.call(this) || this;\n /**\r\n * Holds the list of the colors in this set. (preset or auto-generated)\r\n */\n\n\n _this._list = [];\n /**\r\n * Current step in a color generator's cycle.\r\n */\n\n _this._currentStep = 0;\n /**\r\n * If set to non-zero value, the ColorSet will start iterating colors from\r\n * that particular index, not the first color in the list.\r\n */\n\n _this._startIndex = 0;\n /**\r\n * Current pass in the color generator's cycle. Normally a generator would\r\n * cycle through all available hue range, then repeat it, alternating other\r\n * color properties, to generate distinctive colors.\r\n */\n\n _this._currentPass = 0;\n /**\r\n * A base color. If there are no colors pre-set in the color list, ColorSet\r\n * will use this color as a base when generating new ones, applying\r\n * `stepOptions` and `passOptions` to this base color.\r\n */\n\n _this.baseColor = new Color({\n r: 103,\n g: 183,\n b: 220\n });\n /**\r\n * Modifications to apply with each new generated color.\r\n */\n\n _this.stepOptions = {};\n /**\r\n * Modifications to apply on top of `stepOptions` for each \"pass\" of the\r\n * color generation.\r\n *\r\n * A \"pass\" is when ColorSet generates `minColors` number of colors.\r\n */\n\n _this.passOptions = {\n brighten: -0.2\n };\n /**\r\n * An index increment to use when iterating through color list.\r\n *\r\n * Default is 1, which means returning each and every color.\r\n *\r\n * Setting it to a bigger number will make ColorSet `next()` iterator skip\r\n * some colors.\r\n *\r\n * E.g. setting to 2, will return every second color in the list.\r\n *\r\n * This is useful, when the color list has colors that are too close each\r\n * other for contrast.\r\n *\r\n * However, having bigger number will mean that `next()` iterator will go\r\n * through the list quicker, and the generator will kick sooner.\r\n */\n\n _this.step = 1;\n /**\r\n * A number of colors to generate in one \"pass\".\r\n *\r\n * This setting can be automatically overridden, if ColorSet has a list of\r\n * pre-set colors. In such case ColorSet will generate exactly the same\r\n * number of colors with each pass as there were colors in original set.\r\n */\n\n _this.minColors = 20;\n /**\r\n * Do not let the \"lightness\" of generated color to fall below this\r\n * threshold.\r\n */\n\n _this.minLightness = 0.2;\n /**\r\n * Do not let the \"lightness\" of generated color to get above this threshold.\r\n */\n\n _this.maxLightness = 0.9;\n /**\r\n * Randomly shuffle generated colors.\r\n */\n\n _this.shuffle = false;\n /**\r\n * When colors are generated, based on `stepOptions`, each generated color\r\n * gets either lighter or darker.\r\n *\r\n * If this is set to `true`, color generator will switch to opposing spectrum\r\n * when reaching `minLightness` or `maxLightness`.\r\n *\r\n * E.g. if we start off with a red color, then gradually generate lighter\r\n * colors through rose shades, then switch back to dark red and gradually\r\n * increase the lightness of it until it reaches the starting red.\r\n *\r\n * If set to `false` it will stop there and cap lightness at whatever level\r\n * we hit `minLightness` or `maxLightness`, which may result in a number of\r\n * the same colors.\r\n */\n\n _this.wrap = true;\n /**\r\n * Re-use same colors in the pre-set list, when ColorSet runs out of colors,\r\n * rather than start generating new ones.\r\n */\n\n _this.reuse = false;\n /**\r\n * Saturation of colors. This will change saturation of all colors of color\r\n * set.\r\n *\r\n * It is recommended to set this in theme, as changing it at run time won't\r\n * make the items to redraw and change color.\r\n */\n\n _this.saturation = 1;\n _this.className = \"ColorSet\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(ColorSet.prototype, \"list\", {\n /**\r\n * Returns current list of colors.\r\n *\r\n * If there are none, a new list of colors is generated, based on various\r\n * ColorSet settings.\r\n *\r\n * @return Color list\r\n */\n get: function get() {\n if (!this._list) {\n this.generate(this.minColors);\n }\n\n return this._list;\n },\n\n /**\r\n * Sets a list of pre-defined colors to use for the iterator.\r\n *\r\n * @param value Color list\r\n */\n set: function set(value) {\n this._list = value;\n this.reset();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Gets reusable color.\r\n *\r\n * @param index Index of color\r\n * @return Color\r\n */\n\n ColorSet.prototype.getReusableColor = function (index) {\n if (this._list.length == 0) {\n this.generate(1);\n return this.list[0];\n } else {\n var tmpstep = index - Math.floor(index / this._list.length) * this.list.length;\n return this.list[tmpstep];\n }\n };\n /**\r\n * Returns next color in the list using internal iterator counter.\r\n *\r\n * If `step` is set to something other than 1, it may return other color than\r\n * exact next one in the list.\r\n *\r\n * @return Color\r\n */\n\n\n ColorSet.prototype.next = function () {\n var color;\n\n if (this.list.length <= this._currentStep) {\n if (this.reuse) {\n color = this.getReusableColor(this._currentStep);\n } else {\n this.generate($math.max(this.minColors, this._currentStep + 1));\n color = this.list[this._currentStep];\n }\n } else {\n color = this.list[this._currentStep];\n }\n\n this._currentStep += this.step;\n return color.saturate(this.saturation);\n };\n /**\r\n * Returns a color at specific index in the list.\r\n *\r\n * @param i Index\r\n * @return Color\r\n */\n\n\n ColorSet.prototype.getIndex = function (i) {\n var color;\n\n if (this.list.length <= i) {\n if (this.reuse) {\n color = this.getReusableColor(i);\n } else {\n this.generate(this.minColors);\n color = this.getIndex(i);\n }\n } else {\n color = this.list[i];\n }\n\n return color.saturate(this.saturation);\n };\n /**\r\n * Resets internal iterator.\r\n *\r\n * Calling `next()` after this will return the very first color in the color\r\n * list, even if it was already returned before.\r\n */\n\n\n ColorSet.prototype.reset = function () {\n this._currentStep = this._startIndex;\n };\n\n Object.defineProperty(ColorSet.prototype, \"currentStep\", {\n /**\r\n * @return Step\r\n */\n get: function get() {\n return this._currentStep;\n },\n\n /**\r\n * Sets current color iteration. You can use this property to skip some\r\n * colors from iteration. E.g. setting it to `10` will skip first ten\r\n * colors.\r\n *\r\n * Please note that the number is zero-based.\r\n *\r\n * @param value Step\r\n */\n set: function set(value) {\n this._currentStep = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ColorSet.prototype, \"startIndex\", {\n /**\r\n * @return Index\r\n */\n get: function get() {\n return this._startIndex;\n },\n\n /**\r\n * If set to non-zero value, the ColorSet will start iterating colors from\r\n * that particular index, not the first color in the list.\r\n *\r\n * @default 0\r\n * @since 4.4.9\r\n * @param value Index\r\n */\n set: function set(value) {\n this._startIndex = value;\n this.reset();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Generates colors based on the various ColorSet settings.\r\n *\r\n * @param count Number of colors to generate\r\n */\n\n ColorSet.prototype.generate = function (count) {\n // Init\n var curColor = this.currentColor;\n var hsl = $colors.rgbToHsl($type.getValue(curColor.rgb));\n var hueStep = $type.hasValue(this.stepOptions.hue) ? this.stepOptions.hue : 1 / count;\n var mods = {\n brighten: 0,\n lighten: 0,\n hue: hsl.h,\n lightness: hsl.l,\n saturation: hsl.s\n }; // Generate list of hues, and shuffle them\n\n var hues = [];\n var startIndex = this.list.length == 0 ? 0 : 1;\n\n if (this.reuse) {\n for (var i = startIndex; i <= count; i++) {\n hues.push($colors.rgbToHsl($type.getValue(this._list[i].rgb)).h);\n }\n } else {\n for (var i = startIndex; i <= count; i++) {\n var h = hsl.h + hueStep * i;\n\n if (this.wrap && h > 1) {\n h -= 1;\n }\n\n hues.push(h);\n }\n } // Shuffle colors randomly\n\n\n if (this.shuffle) {\n hues.sort(function (a, b) {\n return Math.random() - 0.5;\n });\n } // Generate colors by rotating hue\n\n\n for (var i = 0; i < count; i++) {\n // Update hue\n if (this.reuse) {\n hsl = $colors.rgbToHsl($type.getValue(this._list[i].rgb));\n } else {\n hsl.h = hues.shift();\n } // Apply HSL mods\n\n\n this.applyStepOptions(hsl, mods, i, this._currentPass); // Convert back to Color\n\n var c = color($colors.hslToRgb(hsl)); // Apply regular color mods\n\n var brighten = (this.stepOptions.brighten || 0) * i + (this.passOptions.brighten || 0) * this._currentPass;\n\n if (brighten != 0) {\n if (this.wrap) {\n brighten = $utils.fitNumberRelative(brighten, this.minLightness, this.maxLightness);\n } else {\n brighten = $utils.fitNumber(brighten, this.minLightness, this.maxLightness);\n }\n\n c = c.brighten(brighten);\n }\n\n var lighten = (this.stepOptions.lighten || 0) * i + (this.passOptions.lighten || 0) * this._currentPass;\n\n if (lighten != 0) {\n if (this.wrap) {\n lighten = $utils.fitNumberRelative(lighten, this.minLightness, this.maxLightness);\n } else {\n lighten = $utils.fitNumber(lighten, this.minLightness, this.maxLightness);\n }\n\n c = c.lighten(lighten);\n }\n\n this._list.push(c);\n }\n\n this._currentPass++;\n };\n\n Object.defineProperty(ColorSet.prototype, \"currentColor\", {\n /**\r\n * Returns current last color. It's either the last color in the list of\r\n * colors, or `baseColor` if list is empty.\r\n *\r\n * @return Color\r\n */\n get: function get() {\n if (this._list.length == 0) {\n return this.baseColor.saturate(this.saturation);\n } else {\n return this._list[this._list.length - 1].saturate(this.saturation);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Generates modifiers for color, based on what step and pass.\r\n *\r\n * @param hsl Curren HSL value of the color to modify\r\n * @param base The modifiers that were before modification to use as a base\r\n * @param step Current step\r\n * @param pass Current pass\r\n */\n\n ColorSet.prototype.applyStepOptions = function (hsl, base, step, pass) {\n // Process lightness\n hsl.l = base.lightness + (this.stepOptions.lightness || 0) * step + (this.passOptions.lightness || 0) * pass;\n\n if (this.wrap) {\n if (hsl.l > 1) {\n hsl.l = hsl.l - Math.floor(hsl.l);\n } else if (hsl.l < 0) {\n hsl.l = -(hsl.l - Math.floor(hsl.l));\n }\n\n hsl.l = $utils.fitNumberRelative(hsl.l, this.minLightness, this.maxLightness);\n } else {\n if (hsl.l > 1) {\n hsl.l = 1;\n } else if (hsl.l < 0) {\n hsl.l = 0;\n }\n\n hsl.l = $utils.fitNumber(hsl.l, this.minLightness, this.maxLightness);\n }\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n ColorSet.prototype.processConfig = function (config) {\n if (config) {\n // Cast colors\n if ($type.hasValue(config.list) && $type.isArray(config.list)) {\n for (var i = 0, len = config.list.length; i < len; i++) {\n if (!(config.list[i] instanceof Color)) {\n config.list[i] = color(config.list[i]);\n }\n }\n }\n\n if ($type.hasValue(config.baseColor) && !(config.baseColor instanceof Color)) {\n config.baseColor = color(config.baseColor);\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n\n return ColorSet;\n}(BaseObject);\n\nexport { ColorSet };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ColorSet\"] = ColorSet;","/**\r\n * This module contains PatternSet object definition\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { BaseObject } from \"../Base\";\nimport { Color } from \"./Color\";\nimport { InterfaceColorSet } from \"./InterfaceColorSet\";\nimport { LinePattern } from \"../rendering/fills/LinePattern\";\nimport { RectPattern } from \"../rendering/fills/RectPattern\";\nimport { CirclePattern } from \"../rendering/fills/CirclePattern\";\nimport { registry } from \"../Registry\";\n/**\r\n * ============================================================================\r\n * REQUISITES\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines an interable list of distinctive patterns that can be used in\r\n * conjunction to colors to generate various fill patterns.\r\n *\r\n * @important\r\n * @since 4.7.5\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/colors/} for color-related info\r\n */\n\nvar PatternSet =\n/** @class */\nfunction (_super) {\n __extends(PatternSet, _super);\n /**\r\n * Constructor\r\n */\n\n\n function PatternSet() {\n var _this = _super.call(this) || this;\n /**\r\n * Holds the list of the colors in this set. (preset or auto-generated)\r\n */\n\n\n _this._list = [];\n /**\r\n * Current step.\r\n */\n\n _this._currentStep = 0;\n /**\r\n * If set to non-zero value, the PatternSet will start iterating patterns from\r\n * that particular index, not the first pattern in the list.\r\n */\n\n _this._startIndex = 0;\n /**\r\n * Current pass in cycle. Once all patterns in the list are iterated,\r\n * iteration restarts from beginning and currentPass is incremented.\r\n */\n\n _this._currentPass = 0;\n /**\r\n * A base color. If there are no colors pre-set in the color list, ColorSet\r\n * will use this color as a base when generating new ones, applying\r\n * `stepOptions` and `passOptions` to this base color.\r\n */\n\n _this.baseColor = new Color({\n r: 103,\n g: 183,\n b: 220\n });\n _this.className = \"PatternSet\"; // Set base color to be used for pattern elements\n\n var interfaceColors = new InterfaceColorSet(); // Set default patterns\n\n _this.list = [_this.getLinePattern(1000, 45, 1, 6), _this.getRectPattern(10, 0, 4), _this.getLinePattern(1000, -45, 1, 6), _this.getCirclePattern(11, 2, true), _this.getLinePattern(6, 90, 1), _this.getRectPattern(12, 45, 6, true), _this.getLinePattern(6, 0, 1), _this.getRectPattern(7, 0, 4), _this.getLinePattern(1000, 45, 2, 3, \"4,2\"), _this.getCirclePattern(9, 3, false), _this.getLinePattern(1000, -45, 2, 3, \"4,2\"), _this.getRectPattern(10, 45, Math.sqrt(50)), _this.getLinePattern(1000, -45, 2, 1), _this.getRectPattern(10, 0, 9), _this.getLinePattern(1000, 45, 2, 1), _this.getLinePattern(1000, 0, 3, 1), _this.getRectPattern(10, 45, 10), _this.getLinePattern(1000, 90, 3, 1)];\n _this.baseColor = interfaceColors.getFor(\"stroke\");\n\n _this.applyTheme();\n\n return _this;\n }\n\n PatternSet.prototype.getLinePattern = function (size, rotation, thickness, gap, strokeDashArray) {\n var pattern = new LinePattern();\n pattern.width = size;\n pattern.height = size;\n pattern.stroke = this.baseColor;\n pattern.gap = gap;\n pattern.strokeDasharray = strokeDashArray;\n pattern.strokeWidth = thickness;\n pattern.rotation = rotation;\n return pattern;\n };\n\n PatternSet.prototype.getRectPattern = function (size, rotation, thickness, outline) {\n var pattern = new RectPattern();\n pattern.width = size;\n pattern.height = size;\n pattern.rectWidth = thickness;\n pattern.rectHeight = thickness;\n\n if (outline) {\n pattern.stroke = this.baseColor;\n pattern.strokeWidth = 1;\n pattern.fillOpacity = 0;\n } else {\n pattern.fill = this.baseColor;\n pattern.strokeWidth = 0;\n }\n\n if (rotation != 0) {\n pattern.shapeRendering = \"auto\";\n }\n\n pattern.rotation = rotation;\n return pattern;\n };\n\n PatternSet.prototype.getCirclePattern = function (size, radius, outline) {\n var pattern = new CirclePattern();\n pattern.width = size;\n pattern.height = size;\n pattern.shapeRendering = \"auto\";\n pattern.radius = radius;\n\n if (outline) {\n pattern.stroke = this.baseColor;\n pattern.strokeWidth = 1;\n pattern.fillOpacity = 0;\n } else {\n pattern.fill = this.baseColor;\n pattern.strokeWidth = 0;\n }\n\n return pattern;\n };\n\n Object.defineProperty(PatternSet.prototype, \"list\", {\n /**\r\n * @return Pattern list\r\n */\n get: function get() {\n return this._list;\n },\n\n /**\r\n * List of pre-defined patterns to be used in set.\r\n *\r\n * @param value Pattern list\r\n */\n set: function set(value) {\n this._list = value;\n this.reset();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns the next pattern in list.\r\n *\r\n * @return Pattern\r\n */\n\n PatternSet.prototype.next = function () {\n var pattern = this.getIndex(this.currentStep);\n this._currentStep++;\n return pattern;\n };\n /**\r\n * Returns a color at specific index in the list.\r\n *\r\n * @param i Index\r\n * @return Pattern\r\n */\n\n\n PatternSet.prototype.getIndex = function (i) {\n var pattern;\n\n while (this.list.length <= i) {\n this.generatePatterns();\n }\n\n pattern = this.list[i];\n return pattern.clone();\n };\n /**\r\n * Generates a new set of patterns.\r\n */\n\n\n PatternSet.prototype.generatePatterns = function () {\n var count = this.list.length / (this._currentPass + 1);\n this._currentPass++;\n\n for (var i = 0; i < count; i++) {\n this.list.push(this.list[i].clone());\n }\n };\n /**\r\n * Resets internal iterator.\r\n *\r\n * Calling `next()` after this will return the very first color in the color\r\n * list, even if it was already returned before.\r\n */\n\n\n PatternSet.prototype.reset = function () {\n this._currentStep = this._startIndex;\n };\n\n Object.defineProperty(PatternSet.prototype, \"currentStep\", {\n /**\r\n * @return Step\r\n */\n get: function get() {\n return this._currentStep;\n },\n\n /**\r\n * Sets current color iteration. You can use this property to skip some\r\n * colors from iteration. E.g. setting it to `10` will skip first ten\r\n * colors.\r\n *\r\n * Please note that the number is zero-based.\r\n *\r\n * @param value Step\r\n */\n set: function set(value) {\n this._currentStep = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(PatternSet.prototype, \"startIndex\", {\n /**\r\n * @return Index\r\n */\n get: function get() {\n return this._startIndex;\n },\n\n /**\r\n * If set to non-zero value, the ColorSet will start iterating colors from\r\n * that particular index, not the first color in the list.\r\n *\r\n * @default 0\r\n * @param value Index\r\n */\n set: function set(value) {\n this._startIndex = value;\n this.reset();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n PatternSet.prototype.processConfig = function (config) {\n // if (config) {\n // \t// Set up axis ranges\n // \tif ($type.hasValue(config.list) && $type.isArray(config.list)) {\n // \t\tfor (let i = 0, len = config.list.length; i < len; i++) {\n // \t\t\tif (!(config.list[i] instanceof Color)) {\n // \t\t\t\tconfig.list[i] = color(config.list[i]);\n // \t\t\t}\n // \t\t}\n // \t}\n // }\n _super.prototype.processConfig.call(this, config);\n };\n\n return PatternSet;\n}(BaseObject);\n\nexport { PatternSet };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"PatternSet\"] = PatternSet;","/**\r\n * A plugin base class.\r\n */\n\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This is a base class that provides core functionality for plugins.\r\n *\r\n * The easiest way to start off with a new plugin is to extend this class.\r\n *\r\n * It will provide all the mandatory functionality, such as disposers.\r\n *\r\n * @since 4.2.2\r\n */\nvar Plugin =\n/** @class */\nfunction () {\n /**\r\n * Constructor\r\n */\n function Plugin() {\n /**\r\n * Is this object disposed?\r\n */\n this._disposed = false;\n /**\r\n * List of IDisposer which will be disposed when the BaseObject is disposed.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n this._disposers = []; // Nothing to do here\n }\n /**\r\n * Decorates series with required events and adapters used to hijack its\r\n * data.\r\n */\n\n\n Plugin.prototype.init = function () {// Does nothing\n // Override it\n };\n /**\r\n * Returns if this element is already disposed.\r\n *\r\n * @return Is disposed?\r\n */\n\n\n Plugin.prototype.isDisposed = function () {\n return this._disposed;\n };\n /**\r\n * Disposes this object and related stuff.\r\n */\n\n\n Plugin.prototype.dispose = function () {\n if (!this._disposed) {\n this._disposed = true;\n var a = this._disposers;\n this._disposers = null;\n\n while (a.length !== 0) {\n var disposer = a.shift();\n disposer.dispose();\n }\n }\n };\n\n return Plugin;\n}();\n\nexport { Plugin };","/**\r\n * AmChartsLogo module.\r\n *\r\n * AmChartsLogo shows amCharts logo for non-commercial users of a library.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../Container\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { Polyspline } from \"./Polyspline\";\nimport { color } from \"../utils/Color\";\nimport { LinearGradient } from \"../rendering/fills/LinearGradient\";\nimport { DesaturateFilter } from \"../rendering/filters/DesaturateFilter\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A class used to draw and display progress indicator.\r\n *\r\n * @see {@link IAmChartsLogoEvents} for a list of available events\r\n * @see {@link IAmChartsLogoAdapters} for a list of available Adapters\r\n * @ignore Exclude from docs\r\n */\n\nvar AmChartsLogo =\n/** @class */\nfunction (_super) {\n __extends(AmChartsLogo, _super);\n /**\r\n * Constructor\r\n */\n\n\n function AmChartsLogo() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"AmChartsLogo\";\n _this.valign = \"bottom\";\n var d = 0.3;\n _this.opacity = 0.3;\n _this.defaultState.properties.opacity = 0.4;\n _this.url = \"https://www.amcharts.com/\";\n _this.urlTarget = \"_blank\";\n _this.showSystemTooltip = true;\n _this.readerTitle = \"Chart created using amCharts library\";\n _this.width = 220 * d;\n _this.height = 70 * d;\n _this.background.opacity = 0;\n var aColor = color(\"#474758\");\n\n if (new InterfaceColorSet().getFor(\"background\").alternative.hex == \"#ffffff\") {\n aColor = color(\"#ffffff\");\n }\n\n var aGradient = new LinearGradient();\n aGradient.addColor(aColor);\n aGradient.addColor(aColor, 1, 0.75);\n aGradient.addColor(color(\"#3cabff\"), 1, 0.755);\n aGradient.rotation = -10;\n var aStroke = aGradient;\n\n var m = _this.createChild(Polyspline);\n\n m.shouldClone = false;\n m.isMeasured = false;\n m.segments = [[{\n x: 50 * d,\n y: 50 * d\n }, {\n x: 90 * d,\n y: 50 * d\n }, {\n x: 120 * d,\n y: 20 * d\n }, {\n x: 135 * d,\n y: 35 * d\n }, {\n x: 150 * d,\n y: 20 * d\n }, {\n x: 180 * d,\n y: 50 * d\n }, {\n x: 200 * d,\n y: 50 * d\n }]];\n m.strokeWidth = 6 * d;\n m.tensionX = 0.8;\n m.tensionY = 1;\n m.stroke = color(\"#3cabff\");\n\n var a = _this.createChild(Polyspline);\n\n a.shouldClone = false;\n a.isMeasured = false;\n a.segments = [[{\n x: 20 * d,\n y: 50 * d\n }, {\n x: 50 * d,\n y: 50 * d\n }, {\n x: 90 * d,\n y: 12 * d\n }, {\n x: 133 * d,\n y: 50 * d\n }, {\n x: 170 * d,\n y: 50 * d\n }, {\n x: 200 * d,\n y: 50 * d\n }]];\n a.strokeWidth = 6 * d;\n a.tensionX = 0.75;\n a.tensionY = 1;\n a.stroke = aStroke;\n\n _this._disposers.push(a);\n\n var desaturateFilter = new DesaturateFilter();\n\n _this.filters.push(desaturateFilter);\n\n var desaturateFilterHover = new DesaturateFilter();\n desaturateFilterHover.saturation = 1;\n\n var hoverState = _this.states.create(\"hover\");\n\n hoverState.properties.opacity = 1;\n hoverState.filters.push(desaturateFilterHover); // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n return AmChartsLogo;\n}(Container);\n\nexport { AmChartsLogo };","import { __read, __spread } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { system } from \"../System\";\nimport { registry } from \"../Registry\";\nimport { Container } from \"../Container\";\nimport { Component } from \"../Component\";\nimport { Paper } from \"../rendering/Paper\";\nimport { SVGContainer, svgContainers } from \"../rendering/SVGContainer\";\nimport { FocusFilter } from \"../rendering/filters/FocusFilter\";\nimport { Preloader } from \"../elements/Preloader\";\nimport { AmChartsLogo } from \"../elements/AmChartsLogo\";\nimport { Tooltip } from \"../elements/Tooltip\";\nimport { Disposer, MultiDisposer } from \"../utils/Disposer\";\nimport { percent } from \"./Percent\";\nimport { options } from \"../Options\";\nimport * as $array from \"./Array\";\nimport * as $type from \"./Type\";\nimport * as $dom from \"./DOM\";\nimport * as $utils from \"./Utils\";\nimport * as $log from \"./Log\";\n/**\r\n * ============================================================================\r\n * INSTANTIATION FUNCTIONS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates all HTML and SVG containers needed for the chart instance, as well\r\n * as the new [[Sprite]] (as specified in `classType` parameter).\r\n *\r\n * @param htmlElement A container to creat elements in\r\n * @param classType A class definition of the new element to create\r\n * @return Newly-created Sprite object\r\n */\n\nfunction createChild(htmlElement, classType) {\n var htmlContainer = $dom.getElement(htmlElement); // If there's no container available yet, we create a fake one\n\n var tmpContainer = false;\n\n if (!htmlContainer) {\n htmlContainer = document.createElement(\"div\");\n htmlContainer.style.width = \"200px\";\n htmlContainer.style.height = \"200px\";\n htmlContainer.style.top = \"0\";\n htmlContainer.style.left = \"0\";\n htmlContainer.style.visibility = \"hidden\";\n htmlContainer.style.position = \"absolute\";\n document.body.appendChild(htmlContainer);\n tmpContainer = true;\n }\n\n if (htmlContainer) {\n htmlContainer.innerHTML = \"\"; //htmlContainer.style.overflow = \"hidden\";\n\n var svgDiv_1 = new SVGContainer(htmlContainer);\n var paper = new Paper(svgDiv_1.SVGContainer, \"svg-\" + (svgContainers.length - 1)); // the approach with masks is chosen because overflow:visible is set on SVG element in order tooltips could go outside\n // svg area - this is often needed when working with small charts.\n // main container which holds content container and tooltips container\n\n var container_1 = new Container();\n container_1.htmlContainer = htmlContainer;\n container_1.svgContainer = svgDiv_1;\n container_1.width = percent(100);\n container_1.height = percent(100);\n container_1.background.fillOpacity = 0;\n container_1.paper = paper;\n paper.append(container_1.group); // Set up moving to proper element container if it's not yet ready at call time\n\n if (tmpContainer) {\n $dom.ready(function () {\n container_1.moveHtmlContainer(htmlElement);\n });\n } // this is set from parent container, but this one doesn't have, so do it manually.\n\n\n container_1.relativeWidth = 1;\n container_1.relativeHeight = 1;\n svgDiv_1.container = container_1; // creating classType instance\n\n var sprite_1 = container_1.createChild(classType);\n sprite_1.topParent = container_1;\n var uid = sprite_1.uid;\n registry.invalidSprites[uid] = [];\n registry.invalidDatas[uid] = [];\n registry.invalidPositions[uid] = [];\n registry.invalidLayouts[uid] = [];\n container_1.baseId = uid;\n sprite_1.isBaseSprite = true;\n sprite_1.focusFilter = new FocusFilter();\n registry.baseSprites.push(sprite_1);\n registry.baseSpritesByUid[uid] = sprite_1;\n sprite_1.maskRectangle = {\n x: 0,\n y: 0,\n width: Math.max(svgDiv_1.width || 0, 0),\n height: Math.max(svgDiv_1.height || 0, 0)\n }; // this solves issues with display:none, as all children are measured as 0x0\n\n container_1.events.on(\"maxsizechanged\", function (event) {\n if (event.previousWidth == 0 || event.previousHeight == 0) {\n container_1.deepInvalidate();\n }\n\n if (sprite_1.maskRectangle) {\n sprite_1.maskRectangle = {\n x: 0,\n y: 0,\n width: Math.max(svgDiv_1.width || 0, 0),\n height: Math.max(svgDiv_1.height || 0, 0)\n };\n }\n });\n var loopTimer_1 = null; // Checks to see whether the chart was properly disposed or not\n\n var loop_1 = function loop_1() {\n if (!sprite_1.isDisposed()) {\n if ($dom.getRoot(sprite_1.dom) == null) {\n if (options.autoDispose) {\n container_1.htmlContainer = undefined;\n svgDiv_1.htmlElement = undefined;\n sprite_1.dispose();\n } else {\n $log.warn(\"Chart was not disposed\", sprite_1.uid);\n }\n\n loopTimer_1 = null;\n } else {\n loopTimer_1 = window.setTimeout(loop_1, 1000);\n }\n } else {\n loopTimer_1 = null;\n }\n };\n\n loop_1();\n sprite_1.addDisposer(new Disposer(function () {\n if (loopTimer_1 !== null) {\n clearTimeout(loopTimer_1);\n }\n\n $array.remove(registry.baseSprites, sprite_1);\n registry.baseSpritesByUid[sprite_1.uid] = undefined;\n })); // TODO figure out a better way of doing this\n\n sprite_1.addDisposer(container_1); // tooltip container\n\n var tooltipContainer_1 = container_1.createChild(Container);\n tooltipContainer_1.topParent = container_1;\n tooltipContainer_1.width = percent(100);\n tooltipContainer_1.height = percent(100);\n tooltipContainer_1.isMeasured = false;\n container_1.tooltipContainer = tooltipContainer_1;\n sprite_1.tooltip = new Tooltip();\n sprite_1.tooltip.hide(0);\n sprite_1.tooltip.setBounds({\n x: 0,\n y: 0,\n width: tooltipContainer_1.maxWidth,\n height: tooltipContainer_1.maxHeight\n });\n tooltipContainer_1.events.on(\"maxsizechanged\", function () {\n $type.getValue(sprite_1.tooltip).setBounds({\n x: 0,\n y: 0,\n width: tooltipContainer_1.maxWidth,\n height: tooltipContainer_1.maxHeight\n });\n }, undefined, false); //@todo: maybe we don't need to create one by default but only on request?\n\n var preloader_1 = new Preloader();\n preloader_1.events.on(\"inited\", function () {\n preloader_1.__disabled = true;\n }, undefined, false);\n container_1.preloader = preloader_1; //if (!options.commercialLicense) {\n\n if (sprite_1 instanceof Container && !sprite_1.hasLicense()) {\n var logo_1 = tooltipContainer_1.createChild(AmChartsLogo);\n tooltipContainer_1.events.on(\"maxsizechanged\", function (ev) {\n if (tooltipContainer_1.maxWidth <= 100 || tooltipContainer_1.maxHeight <= 50) {\n logo_1.hide();\n } else if (logo_1.isHidden || logo_1.isHiding) {\n logo_1.show();\n }\n }, undefined, false);\n sprite_1.logo = logo_1;\n logo_1.align = \"left\";\n logo_1.valign = \"bottom\";\n }\n\n $utils.used(sprite_1.numberFormatter); // need to create one.\n // Set this as an autonomouse instance\n // Controls like Preloader, Export will use this.\n\n container_1.isStandaloneInstance = true;\n\n if (options.onlyShowOnViewport) {\n if (!$dom.isElementInViewport(htmlContainer, options.viewportTarget)) {\n sprite_1.__disabled = true;\n sprite_1.tooltipContainer.__disabled = true;\n var disposers = [$dom.addEventListener(window, \"DOMContentLoaded\", function () {\n viewPortHandler(sprite_1);\n }), $dom.addEventListener(window, \"load\", function () {\n viewPortHandler(sprite_1);\n }), $dom.addEventListener(window, \"resize\", function () {\n viewPortHandler(sprite_1);\n }), $dom.addEventListener(window, \"scroll\", function () {\n viewPortHandler(sprite_1);\n })];\n\n if (options.viewportTarget) {\n var targets = $type.isArray(options.viewportTarget) ? options.viewportTarget : options.viewportTarget ? [options.viewportTarget] : [];\n\n for (var i = 0; i < targets.length; i++) {\n var target = targets[i];\n disposers.push($dom.addEventListener(target, \"resize\", function () {\n viewPortHandler(sprite_1);\n }));\n disposers.push($dom.addEventListener(target, \"scroll\", function () {\n viewPortHandler(sprite_1);\n }));\n }\n }\n\n var disposer = new MultiDisposer(disposers);\n sprite_1.addDisposer(disposer);\n sprite_1.vpDisposer = disposer;\n } else if (options.queue) {\n addToQueue(sprite_1);\n }\n } else if (options.queue) {\n addToQueue(sprite_1);\n }\n\n return sprite_1;\n } else {\n system.log(\"html container not found\");\n throw new Error(\"html container not found\");\n }\n}\n/**\r\n * Disposes all of the currently active charts.\r\n */\n\n\nexport function disposeAllCharts() {\n while (registry.baseSprites.length !== 0) {\n registry.baseSprites.pop().dispose();\n }\n}\nexport function addToQueue(sprite) {\n if (registry.queue.indexOf(sprite) == -1) {\n sprite.__disabled = true;\n sprite.tooltipContainer.__disabled = true;\n sprite.events.disableType(\"appeared\");\n\n if (registry.queue.length == 0) {\n registry.events.once(\"exitframe\", function () {\n queueHandler(sprite);\n });\n system.requestFrame();\n }\n\n sprite.addDisposer(new Disposer(function () {\n removeFromQueue(sprite);\n }));\n registry.queue.push(sprite);\n }\n}\nexport function removeFromQueue(sprite) {\n var index = registry.queue.indexOf(sprite);\n\n if (index >= 0) {\n registry.queue.splice(registry.queue.indexOf(sprite), 1);\n var nextSprite = registry.queue[index];\n\n if (nextSprite) {\n queueHandler(nextSprite);\n }\n }\n}\n/**\r\n * Checks whether the chart was not initialized fully due to setting\r\n * of `onlyShowOnViewport`. If it hasn't and is now in the viewport\r\n * the chart will be initialized.\r\n *\r\n * @since 4.9.12\r\n * @param sprite Top-level chart object\r\n */\n\nexport function viewPortHandler(sprite) {\n if (sprite.__disabled && $dom.isElementInViewport(sprite.htmlContainer, options.viewportTarget)) {\n if (sprite.vpDisposer) {\n sprite.vpDisposer.dispose();\n }\n\n addToQueue(sprite);\n }\n}\nexport function queueHandler(sprite) {\n if (sprite && sprite.tooltipContainer) {\n sprite.__disabled = false;\n sprite.tooltipContainer.__disabled = false;\n sprite.events.enableType(\"appeared\");\n sprite.dispatch(\"removedfromqueue\");\n\n if (sprite.showOnInit) {\n sprite.events.on(\"appeared\", function () {\n removeFromQueue(sprite);\n });\n }\n\n if (sprite.vpDisposer) {\n sprite.vpDisposer.dispose();\n }\n\n if (sprite instanceof Container) {\n sprite.invalidateLabels();\n }\n\n if (sprite.tooltipContainer) {\n sprite.tooltipContainer.invalidateLayout();\n }\n\n if (sprite instanceof Component) {\n sprite.invalidateData();\n sprite.reinit();\n sprite.events.once(\"datavalidated\", function () {\n if (sprite.showOnInit) {\n sprite.appear();\n } else {\n removeFromQueue(sprite);\n }\n });\n } else {\n sprite.reinit();\n sprite.events.once(\"inited\", function () {\n removeFromQueue(sprite);\n });\n\n if (sprite.showOnInit) {\n sprite.appear();\n }\n }\n }\n}\n/**\r\n * A shortcut to creating a chart instance.\r\n *\r\n * The first argument is either a reference to or an id of a DOM element to be\r\n * used as a container for the chart.\r\n *\r\n * The second argument is the type reference of the chart type. (for plain\r\n * JavaScript users this can also be a string indicating chart type)\r\n *\r\n * ```TypeScript\r\n * let chart = am4core.create(\"chartdiv\", am4charts.PieChart);\r\n * ```\r\n * ```JavaScript\r\n * // Can pass in chart type reference like this:\r\n * var chart = am4core.create(\"chartdiv\", am4charts.PieChart);\r\n *\r\n * // ... or chart class type as a string:\r\n * var chart = am4core.create(\"chartdiv\", \"PieChart\");\r\n * ```\r\n *\r\n * @param htmlElement Reference or id of the target container element\r\n * @param classType Class type of the target chart type\r\n * @return Chart instance\r\n */\n\nexport function create(htmlElement, classType) {\n // This is a nasty hack for the benefit of vanilla JS users, who do not\n // enjoy benefits of type-check anyway.\n // We're allowing passing in a name of the class rather than type reference\n // itself.\n var classError;\n\n if ($type.isString(classType)) {\n if ($type.hasValue(registry.registeredClasses[classType])) {\n classType = registry.registeredClasses[classType];\n } else {\n classType = registry.registeredClasses[\"Container\"];\n classError = new Error(\"Class [\" + classType + \"] is not loaded.\");\n }\n } // Create the chart\n\n\n var chart = createChild(htmlElement, classType); // Error?\n\n if (classError) {\n chart.raiseCriticalError(classError);\n }\n\n return chart;\n}\n/**\r\n * A shortcut to creating a chart from a config object.\r\n *\r\n * Example:\r\n *\r\n * ```TypeScript\r\n * let chart am4core.createFromConfig({ ... }, \"chartdiv\", am4charts.XYChart );\r\n * ```\r\n * ```JavaScript\r\n * var chart am4core.createFromConfig({ ... }, \"chartdiv\", \"XYChart\" );\r\n * ```\r\n *\r\n * If `chartType` parameter is not supplied it must be set in a config object,\r\n * via reference to chart type, e.g.:\r\n *\r\n * ```TypeScript\r\n * {\r\n * \"type\": am4charts.XYChart,\r\n * // ...\r\n * }\r\n * ```\r\n * ```JavaScript\r\n * {\r\n * \"type\": am4charts.XYChart,\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * Or via string: (if you are using JavaScript)\r\n *\r\n * ```TypeScript\r\n * {\r\n * \"type\": \"XYChart\",\r\n * // ...\r\n * }\r\n * ```\r\n * ```JavaScript\r\n * {\r\n * \"type\": \"XYChart\",\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * A `container` can either be a reference to an HTML container to put chart\r\n * in, or it's unique id.\r\n *\r\n * If `container` is not specified, it must be included in the config object:\r\n *\r\n * ```TypeScript\r\n * {\r\n * \"type\": \"XYChart\",\r\n * \"container\": \"chartdiv\",\r\n * // ...\r\n * }\r\n * ```\r\n * ```JavaScript\r\n * {\r\n * \"type\": \"XYChart\",\r\n * \"container\": \"chartdiv\",\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @param config Config object in property/value pairs\r\n * @param htmlElement Container reference or ID\r\n * @param objectType Chart type\r\n * @return A newly created chart instance\r\n * @todo Throw exception if type is not correct\r\n */\n\nexport function createFromConfig(config, htmlElement, classType) {\n // Extract chart type from config if necessary\n if (!$type.hasValue(classType)) {\n classType = config.type;\n delete config.type;\n } // Extract element from config if necessary\n\n\n if (!$type.hasValue(htmlElement)) {\n htmlElement = config.container;\n delete config.container;\n } // Check if we need to extract actual type reference\n\n\n var finalType;\n var classError;\n\n if ($type.isString(classType) && $type.hasValue(registry.registeredClasses[classType])) {\n finalType = registry.registeredClasses[classType];\n } else if (typeof classType !== \"function\") {\n finalType = Container;\n classError = new Error(\"Class [\" + classType + \"] is not loaded.\");\n } else {\n finalType = classType;\n } // Create the chart\n\n\n var chart = createChild(htmlElement, finalType); // Set config\n\n if (classError) {\n chart.raiseCriticalError(classError);\n } else {\n chart.config = config;\n }\n\n return chart;\n}\n/**\r\n * Useful in creating real queues form mult-chart creation.\r\n *\r\n * Accepts a reference to a function which crates and returns actual chart\r\n * object.\r\n *\r\n * It returns a `Promise` which you can use to catch chart instance once it's\r\n * created.\r\n *\r\n * ```TypeScript\r\n * am4core.createDeferred(function(div) {\r\n * // Create first chart\r\n * let chart = am4core.create(div, am4charts.XYChart);\r\n * // ...\r\n * return chart;\r\n * }, \"chartdiv1\").then(chart) {\r\n * // `chart` variable holds an instance of the chart\r\n * console.log(\"Chart ready\", chart);\r\n * }\r\n *\r\n * am4core.createDeferred(function(div) {\r\n * // Create second chart\r\n * let chart = am4core.create(div, am4charts.PieChart);\r\n * // ...\r\n * return chart;\r\n * }, \"chartdiv2\").then(chart) {\r\n * // `chart` variable holds an instance of the chart\r\n * console.log(\"Chart ready\", chart);\r\n * }\r\n * ```\r\n * ```JavaScript\r\n * am4core.createDeferred(function(div) {\r\n * // Create first chart\r\n * var chart = am4core.create(div, am4charts.XYChart);\r\n * // ...\r\n * return chart;\r\n * }, \"chartdiv1\").then(chart) {\r\n * // `chart` variable holds an instance of the chart\r\n * console.log(\"Chart ready\", chart);\r\n * }\r\n *\r\n * am4core.createDeferred(function(div) {\r\n * // Create second chart\r\n * var chart = am4core.create(div, am4charts.PieChart);\r\n * // ...\r\n * return chart;\r\n * }, \"chartdiv2\").then(chart) {\r\n * // `chart` variable holds an instance of the chart\r\n * console.log(\"Chart ready\", chart);\r\n * }\r\n * ```\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/performance/#Deferred_daisy_chained_instantiation} for more information\r\n * @since 4.10.0\r\n * @param callback Callback function that creates chart\r\n * @param scope Scope to call callback in\r\n * @param ...rest Parameters to pass into callback\r\n * @return Promise with chart instance\r\n */\n\nexport function createDeferred(callback, scope) {\n var rest = [];\n\n for (var _i = 2; _i < arguments.length; _i++) {\n rest[_i - 2] = arguments[_i];\n }\n\n return new Promise(function (resolve, reject) {\n registry.deferred.push({\n scope: scope,\n callback: callback,\n args: rest,\n resolve: resolve\n });\n\n if (registry.deferred.length == 1) {\n processNextDeferred();\n }\n });\n}\n\nfunction processNextDeferred() {\n var _a;\n\n var next = registry.deferred[0];\n\n if (next) {\n var sprite_2 = (_a = next.callback).call.apply(_a, __spread([next.scope], next.args));\n\n sprite_2.events.on(\"ready\", function () {\n next.resolve(sprite_2);\n registry.deferred.shift();\n\n if (options.deferredDelay) {\n setTimeout(processNextDeferred, options.deferredDelay);\n } else {\n processNextDeferred();\n }\n });\n }\n}\n/**\r\n * Applies a theme to System, and subsequently all chart instances created\r\n * from that point forward.\r\n *\r\n * amCharts supports multiple themes. Calling `useTheme` multiple times will\r\n * make the System apply multiple themes, rather than overwrite previously\r\n * set one.\r\n *\r\n * This enables combining features from multiple themes on the same chart.\r\n * E.g.:\r\n *\r\n * ```TypeScript\r\n * am4core.useTheme(am4themes.material);\r\n * am4core.useTheme(am4themes.animated);\r\n * ```\r\n * ```JavaScript\r\n * am4core.useTheme(am4themes.material);\r\n * am4core.useTheme(am4themes.animated);\r\n * ```\r\n *\r\n * The above will apply both the Material color and animation options to all\r\n * charts created.\r\n *\r\n * @param value A reference to a theme\r\n */\n\n\nexport function useTheme(value) {\n if (registry.themes.indexOf(value) === -1) {\n registry.themes.push(value);\n }\n}\n/**\r\n * Removes a theme from \"active themes\" list, so it won't get applied to any\r\n * charts created subsequently.\r\n *\r\n * @param value A reference to a theme\r\n */\n\nexport function unuseTheme(value) {\n $array.remove(registry.themes, value);\n}\n/**\r\n * Removes all \"active\" themes. Any charts created subsequently will not have\r\n * any theme applied to them.\r\n */\n\nexport function unuseAllThemes() {\n registry.themes = [];\n}\n/**\r\n * Adds a license, e.g.:\r\n *\r\n * ```TypeScript\r\n * am4core.addLicense(\"xxxxxxxx\");\r\n * ```\r\n * ```JavaScript\r\n * am4core.addLicense(\"xxxxxxxx\");\r\n * ```\r\n *\r\n * Multiple licenses can be added to cover for multiple products.\r\n *\r\n * @since 4.5.16\r\n * @param license License key\r\n */\n\nexport function addLicense(license) {\n options.licenses.push(license);\n}","/**\r\n * Legend-related functionality.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Component } from \"../core/Component\";\nimport { DataItem } from \"../core/DataItem\";\nimport { ListTemplate, ListDisposer } from \"../core/utils/List\";\nimport { RoundedRectangle } from \"../core/elements/RoundedRectangle\";\nimport { Container } from \"../core/Container\";\nimport { Label } from \"../core/elements/Label\";\nimport { keyboard } from \"../core/utils/Keyboard\";\nimport { registry } from \"../core/Registry\";\nimport { getInteraction } from \"../core/interaction/Interaction\";\nimport { percent, Percent } from \"../core/utils/Percent\";\nimport { InterfaceColorSet } from \"../core/utils/InterfaceColorSet\";\nimport * as $utils from \"../core/utils/Utils\";\nimport * as $type from \"../core/utils/Type\";\nimport * as $math from \"../core/utils/Math\";\nimport { Sprite } from \"../core/Sprite\";\nimport { Disposer } from \"../core/utils/Disposer\";\nimport { MouseCursorStyle } from \"../core/interaction/Mouse\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../core/utils/Responsive\";\nimport { Scrollbar } from \"../core/elements/Scrollbar\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[Legend]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar LegendDataItem =\n/** @class */\nfunction (_super) {\n __extends(LegendDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function LegendDataItem() {\n var _this = _super.call(this) || this;\n /**\r\n * @ignore\r\n */\n\n\n _this.childrenCreated = false;\n _this.className = \"LegendDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(LegendDataItem.prototype, \"label\", {\n /**\r\n * A legend item's [[Label]] element.\r\n *\r\n * @return Label\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._label) {\n var label_1 = this.component.labels.create();\n this._label = label_1;\n this.addSprite(label_1);\n\n this._disposers.push(label_1);\n\n label_1.parent = this.itemContainer;\n\n this._disposers.push(new Disposer(function () {\n if ($type.hasValue(_this.component)) {\n _this.component.labels.removeValue(label_1);\n }\n }));\n }\n\n return this._label;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(LegendDataItem.prototype, \"color\", {\n /**\r\n * @return Main color\r\n */\n get: function get() {\n return this.properties.color;\n },\n\n /**\r\n * Main color of legend data item.\r\n *\r\n * This is set by the target element this legend item represents, like\r\n * a Series or a Slice.\r\n *\r\n * It can be used to derive a color in legend's sub-items, like label:\r\n *\r\n * ```TypeScript\r\n * chart.legend.labels.template.text = \"[{color}]{name}[/]\";\r\n * ```\r\n * ```JavaScript\r\n * chart.legend.labels.template.text = \"[{color}]{name}[/]\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"legend\": {\r\n * // ...\r\n * \"labels\": {\r\n * \"text\": \"[{color}]{name}[/]\"\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/legend/#Legend_labels} For more information about configuring legend labels.\r\n * @param value Main color\r\n */\n set: function set(value) {\n this.setProperty(\"color\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(LegendDataItem.prototype, \"valueLabel\", {\n /**\r\n * A legend item's [[Label]] element for \"value label\".\r\n *\r\n * @return Label\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._valueLabel) {\n var valueLabel_1 = this.component.valueLabels.create();\n this._valueLabel = valueLabel_1;\n this.addSprite(valueLabel_1);\n\n this._disposers.push(valueLabel_1);\n\n valueLabel_1.parent = this.itemContainer;\n\n this._disposers.push(new Disposer(function () {\n if ($type.hasValue(_this.component)) {\n _this.component.valueLabels.removeValue(valueLabel_1);\n }\n }));\n }\n\n return this._valueLabel;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(LegendDataItem.prototype, \"itemContainer\", {\n /**\r\n * A reference to the main [[Container]] that holds legend item's elements:\r\n * marker and labels.\r\n *\r\n * @return Item container\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._itemContainer) {\n var component_1 = this.component;\n var itemContainer_1 = component_1.itemContainers.create();\n itemContainer_1.parent = component_1;\n this._itemContainer = itemContainer_1;\n this.addSprite(itemContainer_1);\n\n this._disposers.push(itemContainer_1); // Add click/tap event to toggle item\n\n\n if (itemContainer_1.togglable) {\n itemContainer_1.events.on(\"toggled\", function (ev) {\n component_1.toggleDataItem(ev.target.dataItem);\n }, undefined, false);\n } // Add focus event so that we can track which object is currently in focus\n // for keyboard toggling\n\n\n if (itemContainer_1.focusable) {\n itemContainer_1.events.on(\"hit\", function (ev) {\n // We need this here in order to reset focused item when it is clicked\n // normally so that it is not toggled by ENTER afterwards\n component_1.focusedItem = undefined;\n }, undefined, false);\n itemContainer_1.events.on(\"focus\", function (ev) {\n component_1.focusedItem = ev.target.dataItem;\n }, undefined, false);\n itemContainer_1.events.on(\"blur\", function (ev) {\n component_1.focusedItem = undefined;\n }, undefined, false);\n }\n\n this._disposers.push(new Disposer(function () {\n if ($type.hasValue(_this.component)) {\n _this.component.itemContainers.removeValue(itemContainer_1);\n }\n }));\n\n if (this.dataContext.uidAttr) {\n itemContainer_1.readerControls = this.dataContext.uidAttr();\n itemContainer_1.readerLabelledBy = this.dataContext.uidAttr();\n }\n\n var sprite = this.dataContext;\n\n if ((sprite instanceof DataItem || sprite instanceof Sprite) && !sprite.isDisposed()) {\n var visibilitychanged = function visibilitychanged(ev) {\n itemContainer_1.readerChecked = ev.visible;\n itemContainer_1.events.disableType(\"toggled\");\n itemContainer_1.isActive = !ev.visible;\n itemContainer_1.events.enableType(\"toggled\");\n };\n\n sprite.addDisposer(new Disposer(function () {\n if (_this.component) {\n _this.component.dataItems.remove(_this);\n }\n }));\n\n if (sprite instanceof Sprite) {\n itemContainer_1.addDisposer(sprite.events.on(\"visibilitychanged\", visibilitychanged, undefined, false));\n itemContainer_1.addDisposer(sprite.events.on(\"hidden\", function (ev) {\n itemContainer_1.readerChecked = false;\n itemContainer_1.events.disableType(\"toggled\");\n itemContainer_1.isActive = true;\n itemContainer_1.events.enableType(\"toggled\");\n }, undefined, false));\n itemContainer_1.addDisposer(sprite.events.on(\"shown\", function (ev) {\n itemContainer_1.readerChecked = true;\n itemContainer_1.events.disableType(\"toggled\");\n itemContainer_1.isActive = false;\n itemContainer_1.events.enableType(\"toggled\");\n }, undefined, false));\n } else {\n itemContainer_1.addDisposer(sprite.events.on(\"visibilitychanged\", visibilitychanged, undefined, false));\n }\n }\n }\n\n return this._itemContainer;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(LegendDataItem.prototype, \"marker\", {\n /**\r\n * A [[Container]] that holds legend item's marker element.\r\n *\r\n * @return Marker\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._marker) {\n var marker_1 = this.component.markers.create();\n this._marker = marker_1;\n marker_1.parent = this.itemContainer;\n this.addSprite(marker_1);\n\n this._disposers.push(marker_1);\n\n this._disposers.push(new Disposer(function () {\n if ($type.hasValue(_this.component)) {\n _this.component.markers.removeValue(marker_1);\n }\n }));\n }\n\n return this._marker;\n },\n enumerable: true,\n configurable: true\n });\n return LegendDataItem;\n}(DataItem);\n\nexport { LegendDataItem };\n/**\r\n * ============================================================================\r\n * REQUISITES\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a class that carries legend settings.\r\n *\r\n * A legend might change its settings dynamically. Legend can also be shared\r\n * by several elements, requiring different settings.\r\n *\r\n * Having legend's settings in a separate object is a good way to \"hot swap\"\r\n * a set of settings for the legend.\r\n */\n\nvar LegendSettings =\n/** @class */\nfunction () {\n function LegendSettings() {\n /**\r\n * Should marker be created for each legend item.\r\n */\n this.createMarker = true;\n }\n\n return LegendSettings;\n}();\n\nexport { LegendSettings };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * [[Legend]] class is used to create legend for the chart.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/legend/} for Legend documentation\r\n * @see {@link ILegendEvents} for a list of available events\r\n * @see {@link ILegendAdapters} for a list of available Adapters\r\n */\n\nvar Legend =\n/** @class */\nfunction (_super) {\n __extends(Legend, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Legend() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Legend\"; // Set defaults\n\n _this.layout = \"grid\";\n\n _this.setPropertyValue(\"useDefaultMarker\", false);\n\n _this.setPropertyValue(\"scrollable\", false);\n\n _this.setPropertyValue(\"contentAlign\", \"center\"); // Create a template container and list for legend items\n\n\n var itemContainer = new Container();\n itemContainer.applyOnClones = true;\n itemContainer.padding(8, 0, 8, 0);\n itemContainer.margin(0, 10, 0, 10);\n itemContainer.layout = \"horizontal\";\n itemContainer.clickable = true;\n itemContainer.focusable = true;\n itemContainer.role = \"switch\";\n itemContainer.togglable = true;\n itemContainer.cursorOverStyle = MouseCursorStyle.pointer;\n itemContainer.background.fillOpacity = 0; // creates hit area\n // Create container list using item template we just created\n\n _this.itemContainers = new ListTemplate(itemContainer);\n\n _this._disposers.push(new ListDisposer(_this.itemContainers));\n\n _this._disposers.push(_this.itemContainers.template); // Set up global keyboard events for toggling elements\n\n\n _this._disposers.push(getInteraction().body.events.on(\"keyup\", function (ev) {\n if (keyboard.isKey(ev.event, \"enter\") && _this.focusedItem) {\n var focusedItem = _this.focusedItem;\n var target = focusedItem.itemContainer;\n\n if (target.togglable) {\n _this.toggleDataItem(focusedItem);\n } else if (target.clickable && target.events.isEnabled(\"hit\")) {\n target.dispatchImmediately(\"hit\", {\n event: ev\n }); // We need this here because \"hit\" event resets `this.focusedItem`\n // And we need it here\n\n _this.focusedItem = focusedItem;\n }\n }\n }, _this));\n\n var interfaceColors = new InterfaceColorSet(); // Create a template container and list for the a marker\n\n var marker = new Container();\n marker.width = 23;\n marker.height = 23;\n marker.interactionsEnabled = false;\n marker.applyOnClones = true;\n marker.setStateOnChildren = true;\n marker.background.fillOpacity = 0;\n marker.background.strokeOpacity = 0;\n marker.propertyFields.fill = \"fill\";\n marker.valign = \"middle\";\n var disabledColor = interfaceColors.getFor(\"disabledBackground\");\n marker.events.on(\"childadded\", function (event) {\n var child = event.newValue;\n var activeState = child.states.create(\"active\");\n activeState.properties.stroke = disabledColor;\n activeState.properties.fill = disabledColor;\n });\n _this.markers = new ListTemplate(marker);\n\n _this._disposers.push(new ListDisposer(_this.markers));\n\n _this._disposers.push(_this.markers.template); // Create a legend background element\n\n\n var rectangle = marker.createChild(RoundedRectangle);\n rectangle.width = percent(100);\n rectangle.height = percent(100);\n rectangle.applyOnClones = true;\n rectangle.propertyFields.fill = \"fill\"; //othrwise old edge doesn't like as the same pattern is set both on parent and child https://codepen.io/team/amcharts/pen/72d7a98f3fb811d3118795220ff63182\n\n rectangle.strokeOpacity = 0; // Create a template container and list for item labels\n\n var label = new Label();\n label.text = \"{name}\";\n label.margin(0, 5, 0, 5);\n label.valign = \"middle\";\n label.applyOnClones = true;\n label.states.create(\"active\").properties.fill = interfaceColors.getFor(\"disabledBackground\");\n _this.labels = new ListTemplate(label);\n\n _this._disposers.push(new ListDisposer(_this.labels));\n\n _this._disposers.push(_this.labels.template);\n\n label.interactionsEnabled = false;\n label.truncate = true;\n label.fullWords = false; // Create a template container and list for item value labels\n\n var valueLabel = new Label();\n valueLabel.margin(0, 5, 0, 0);\n valueLabel.valign = \"middle\";\n valueLabel.width = 50; // to avoid rearranging legend entries when value changes.\n\n valueLabel.align = \"right\";\n valueLabel.textAlign = \"end\";\n valueLabel.applyOnClones = true;\n valueLabel.states.create(\"active\").properties.fill = interfaceColors.getFor(\"disabledBackground\");\n valueLabel.interactionsEnabled = false;\n _this.valueLabels = new ListTemplate(valueLabel);\n\n _this._disposers.push(new ListDisposer(_this.valueLabels));\n\n _this._disposers.push(_this.valueLabels.template);\n\n _this.position = \"bottom\"; // don't use setPropertyValue here!\n // Create a state for disabled legend items\n\n itemContainer.states.create(\"active\");\n itemContainer.setStateOnChildren = true; // Apply accessibility settings\n\n _this.role = \"group\";\n\n _this.events.on(\"layoutvalidated\", _this.handleScrollbar, _this, false);\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n Legend.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this);\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Legend\");\n }\n };\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n Legend.prototype.createDataItem = function () {\n return new LegendDataItem();\n };\n /**\r\n * [validateDataElements description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Legend.prototype.validateDataElements = function () {\n if (this.scrollbar) {\n this.scrollbar.start = 0;\n this.scrollbar.end = 1;\n }\n\n _super.prototype.validateDataElements.call(this);\n };\n /**\r\n * [validateDataElement description]\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem Data item\r\n * @todo Description\r\n * @todo Figure out how to update appearance of legend item without losing focus\r\n * @todo Update legend marker appearance as apperance of related series changes\r\n */\n\n\n Legend.prototype.validateDataElement = function (dataItem) {\n _super.prototype.validateDataElement.call(this, dataItem); // Get data item (legend item's) container\n\n\n var container = dataItem.itemContainer;\n var marker = dataItem.marker;\n $utils.used(dataItem.label);\n var valueLabel = dataItem.valueLabel; // Set parent and update current state\n\n container.readerChecked = dataItem.dataContext.visible; // Tell series its legend data item\n\n dataItem.dataContext.legendDataItem = dataItem;\n var tempMaxWidth = dataItem.label.maxWidth;\n\n if (!(dataItem.label.width instanceof Percent)) {\n dataItem.label.width = undefined;\n }\n\n if (tempMaxWidth > 0) {\n dataItem.label.maxWidth = tempMaxWidth;\n }\n\n if (valueLabel.align == \"right\") {\n valueLabel.width = undefined;\n }\n\n var legendSettings = dataItem.dataContext.legendSettings; // If we are not using default markers, create a unique legend marker based\n // on the data item type\n\n var dataContext = dataItem.dataContext;\n\n if (dataContext.createLegendMarker && (!this.useDefaultMarker || !(dataContext instanceof Sprite))) {\n if (!dataItem.childrenCreated) {\n dataContext.createLegendMarker(marker);\n dataItem.childrenCreated = true;\n }\n } else {\n this.markers.template.propertyFields.fill = undefined;\n }\n\n if (dataContext.updateLegendValue) {\n dataContext.updateLegendValue(); // this solves issue with external legend, as legend is created after chart updates legend values\n }\n\n if (dataContext.component && dataContext.component.updateLegendValue) {\n dataContext.component.updateLegendValue(dataContext);\n }\n\n if (valueLabel.invalid) {\n valueLabel.validate();\n }\n\n if (valueLabel.text == \"\" || valueLabel.text == undefined) {\n valueLabel.__disabled = true;\n } else {\n valueLabel.__disabled = false;\n }\n\n if (legendSettings && (legendSettings.itemValueText != undefined || legendSettings.valueText != undefined)) {\n valueLabel.__disabled = false;\n }\n\n var visible = dataItem.dataContext.visible;\n\n if (visible === undefined) {\n visible = true;\n }\n\n visible = $type.toBoolean(visible);\n dataItem.dataContext.visible = visible;\n container.events.disableType(\"toggled\");\n container.isActive = !visible;\n\n if (container.isActive) {\n container.setState(\"active\", 0);\n } else {\n container.setState(\"default\", 0);\n }\n\n container.events.enableType(\"toggled\");\n };\n\n Legend.prototype.afterDraw = function () {\n var _this = this;\n\n var maxWidth = this.getPropertyValue(\"maxWidth\");\n var maxLabelWidth = 0;\n this.labels.each(function (label) {\n if (label.invalid) {\n label.maxWidth = undefined;\n label.validate();\n }\n\n if (label.measuredWidth + label.pixelMarginLeft + label.pixelMarginRight > maxLabelWidth) {\n maxLabelWidth = label.measuredWidth + label.pixelMarginLeft + label.pixelMarginRight;\n }\n });\n var maxValueLabelWidth = 0;\n this.valueLabels.each(function (label) {\n if (label.invalid) {\n label.validate();\n }\n\n if (label.measuredWidth + label.pixelMarginLeft + label.pixelMarginRight > maxValueLabelWidth) {\n maxValueLabelWidth = label.measuredWidth + label.pixelMarginLeft + label.pixelMarginRight;\n }\n });\n var maxMarkerWidth = 0;\n this.markers.each(function (marker) {\n if (marker.invalid) {\n marker.validate();\n }\n\n if (marker.measuredWidth + marker.pixelMarginLeft + marker.pixelMarginRight > maxMarkerWidth) {\n maxMarkerWidth = marker.measuredWidth + marker.pixelMarginLeft + marker.pixelMarginRight;\n }\n });\n var itemContainer = this.itemContainers.template;\n var margin = itemContainer.pixelMarginRight + itemContainer.pixelMarginLeft;\n var maxAdjustedLabelWidth;\n var trueMaxWidth = maxLabelWidth + maxValueLabelWidth + maxMarkerWidth;\n\n if (!$type.isNumber(maxWidth)) {\n maxAdjustedLabelWidth = maxLabelWidth;\n } else {\n maxWidth = maxWidth - margin;\n\n if (maxWidth > trueMaxWidth) {\n maxWidth = trueMaxWidth;\n }\n\n maxAdjustedLabelWidth = maxWidth - maxMarkerWidth - maxValueLabelWidth;\n }\n\n this.labels.each(function (label) {\n if (_this.valueLabels.template.align == \"right\" || label.measuredWidth > maxAdjustedLabelWidth) {\n if (!(label.width instanceof Percent)) {\n label.width = Math.min(label.maxWidth, maxAdjustedLabelWidth - label.pixelMarginLeft - label.pixelMarginRight);\n label.maxWidth = label.width;\n }\n }\n });\n\n if (this.valueLabels.template.align == \"right\") {\n this.valueLabels.each(function (valueLabel) {\n valueLabel.width = maxValueLabelWidth - valueLabel.pixelMarginRight - valueLabel.pixelMarginLeft;\n });\n }\n\n _super.prototype.afterDraw.call(this);\n };\n\n Legend.prototype.handleScrollbar = function () {\n var scrollbar = this.scrollbar;\n\n if (this.scrollable && scrollbar) {\n scrollbar.height = this.measuredHeight;\n scrollbar.x = this.measuredWidth - scrollbar.pixelWidth - scrollbar.pixelMarginLeft;\n\n if (this.contentHeight > this.measuredHeight) {\n scrollbar.visible = true;\n scrollbar.thumb.height = scrollbar.height * this.measuredHeight / this.contentHeight;\n this.paddingRight = scrollbar.pixelWidth + scrollbar.pixelMarginLeft + +scrollbar.pixelMarginRight;\n } else {\n scrollbar.visible = false;\n }\n\n this.updateMasks();\n }\n };\n\n Object.defineProperty(Legend.prototype, \"position\", {\n /**\r\n * @return Position\r\n */\n get: function get() {\n return this.getPropertyValue(\"position\");\n },\n\n /**\r\n * Position of the legend.\r\n *\r\n * Options: \"left\", \"right\", \"top\", \"bottom\" (default), or \"absolute\".\r\n *\r\n * IMPORTANT: [[MapChart]] will ignore this setting, as it is using different\r\n * layout structure than other charts.\r\n *\r\n * To position legend in [[MapChart]] set legend's `align` (`\"left\"` or\r\n * `\"right\"`) and `valign` (`\"top\"` or `\"bottom\"`) properties instead.\r\n *\r\n * @default \"bottom\"\r\n * @param value Position\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"position\", value)) {\n if (value == \"left\" || value == \"right\") {\n this.margin(10, 5, 10, 10);\n this.valign = \"middle\";\n this.contentAlign = \"none\";\n this.valueLabels.template.align = \"right\";\n\n if (!$type.isNumber(this.maxColumns)) {\n this.maxColumns = 1;\n }\n\n this.width = undefined;\n this.maxWidth = 220;\n } else {\n this.maxColumns = undefined;\n this.width = percent(100);\n this.valueLabels.template.align = \"left\";\n }\n\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Legend.prototype, \"useDefaultMarker\", {\n /**\r\n * @return Use default marker?\r\n */\n get: function get() {\n return this.getPropertyValue(\"useDefaultMarker\");\n },\n\n /**\r\n * Should legend try to mirror the look of the related item when building\r\n * the marker for legend item?\r\n *\r\n * If set to `false` it will try to make the marker look like its related\r\n * item.\r\n *\r\n * E.g. if an item is for a Line Series, it will display a line of the\r\n * same thickness, color, and will use the same bullets if series have them.\r\n *\r\n * If set to `true`, all markers will be shown as squares, regardless of te\r\n * series type.\r\n *\r\n * @default false\r\n * @param value Use default marker?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"useDefaultMarker\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Legend.prototype, \"scrollable\", {\n /**\r\n * @return Legend Scrollable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"scrollable\");\n },\n\n /**\r\n * If set to `true` the Legend will display a scrollbar if its contents do\r\n * not fit into its `maxHeight`.\r\n *\r\n * Please note that `maxHeight` is automatically set for Legend when its\r\n * `position` is set to `\"left\"` or `\"right\"`.\r\n *\r\n * @default false\r\n * @since 4.8.0\r\n * @param value Legend Scrollable?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"scrollable\", value, true)) {\n if (value) {\n var scrollbar = this.createChild(Scrollbar);\n this.scrollbar = scrollbar;\n scrollbar.isMeasured = false;\n scrollbar.orientation = \"vertical\";\n scrollbar.endGrip.__disabled = true;\n scrollbar.startGrip.__disabled = true;\n scrollbar.visible = false;\n scrollbar.marginLeft = 5;\n this._mouseWheelDisposer = this.events.on(\"wheel\", this.handleWheel, this, false);\n\n this._disposers.push(this._mouseWheelDisposer);\n\n this._disposers.push(scrollbar.events.on(\"rangechanged\", this.updateMasks, this, false));\n } else {\n if (this._mouseWheelDisposer) {\n this._mouseWheelDisposer.dispose();\n\n if (this.scrollbar) {\n this.scrollbar.dispose();\n this.scrollbar = undefined;\n }\n }\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Handles mouse wheel scrolling of legend.\r\n *\r\n * @param event Event\r\n */\n\n Legend.prototype.handleWheel = function (event) {\n var shift = event.shift.y;\n var scrollbar = this.scrollbar;\n\n if (scrollbar) {\n var ds = shift / 1000 * this.measuredHeight / this.contentHeight;\n var delta = scrollbar.end - scrollbar.start;\n\n if (shift > 0) {\n scrollbar.start = $math.max(0, scrollbar.start - ds);\n scrollbar.end = scrollbar.start + delta;\n } else {\n scrollbar.end = $math.min(1, scrollbar.end - ds);\n scrollbar.start = scrollbar.end - delta;\n }\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n Legend.prototype.updateMasks = function () {\n var _this = this;\n\n if (this.scrollbar) {\n this.itemContainers.each(function (itemContainer) {\n itemContainer.dy = -_this.scrollbar.thumb.pixelY * _this.contentHeight / _this.measuredHeight;\n itemContainer.maskRectangle = {\n x: 0,\n y: -itemContainer.dy,\n width: _this.measuredWidth,\n height: _this.measuredHeight\n };\n });\n }\n };\n /**\r\n * Toggles a legend item.\r\n *\r\n * @ignore Exclude from docs\r\n * @param item Legend item\r\n * @todo Maybe do it with togglable instead\r\n */\n\n\n Legend.prototype.toggleDataItem = function (item) {\n var dataContext = item.dataContext;\n\n if (!dataContext.visible || dataContext.isHiding || dataContext instanceof Sprite && dataContext.isHidden) {\n item.color = item.colorOrig;\n dataContext.appeared = true;\n item.itemContainer.isActive = false;\n\n if (dataContext.hidden === true) {\n dataContext.hidden = false;\n }\n\n if (dataContext.show) {\n dataContext.show();\n } else {\n dataContext.visible = true;\n }\n\n this.svgContainer.readerAlert(this.language.translate(\"%1 shown\", this.language.locale, item.label.readerTitle));\n } else {\n item.itemContainer.isActive = true;\n dataContext.appeared = true;\n\n if (dataContext.hide) {\n dataContext.hide();\n } else {\n dataContext.visible = false;\n }\n\n this.svgContainer.readerAlert(this.language.translate(\"%1 hidden\", this.language.locale, item.label.readerTitle));\n item.color = new InterfaceColorSet().getFor(\"disabledBackground\");\n }\n };\n\n Object.defineProperty(Legend.prototype, \"preloader\", {\n /**\r\n * Override preloader method so that legend does not accidentally show its\r\n * own preloader.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Always `undefined`\r\n */\n get: function get() {\n return;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * [handleDataItemPropertyChange description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Legend.prototype.handleDataItemPropertyChange = function (dataItem, name) {\n dataItem.valueLabel.invalidate();\n dataItem.label.invalidate();\n };\n\n return Legend;\n}(Component);\n\nexport { Legend };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Legend\"] = Legend;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Move legend to below the chart if chart is narrow\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.widthXS,\n state: function state(target, stateId) {\n if (target instanceof Legend && (target.position == \"left\" || target.position == \"right\")) {\n var state = target.states.create(stateId);\n state.properties.position = \"bottom\";\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Move legend to the right if chart is very short\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.heightXS,\n state: function state(target, stateId) {\n if (target instanceof Legend && (target.position == \"top\" || target.position == \"bottom\")) {\n var state = target.states.create(stateId);\n state.properties.position = \"right\";\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Disable legend altogether on small charts\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.isXS,\n state: function state(target, stateId) {\n if (target instanceof Legend) {\n var state = target.states.create(stateId);\n state.properties.disabled = true;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * Axis break module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { MutableValueDisposer } from \"../../core/utils/Disposer\";\nimport { WavedLine } from \"../../core/elements/WavedLine\";\nimport { List } from \"../../core/utils/List\";\nimport { registry } from \"../../core/Registry\";\nimport { color } from \"../../core/utils/Color\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Base class to define \"breaks\" on axes.\r\n *\r\n * @see {@link IAxisBreakEvents} for a list of available events\r\n * @see {@link IAxisBreakAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar AxisBreak =\n/** @class */\nfunction (_super) {\n __extends(AxisBreak, _super);\n /**\r\n * Constructor\r\n */\n\n\n function AxisBreak() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Reference to parent Axis.\r\n */\n\n\n _this._axis = new MutableValueDisposer();\n /**\r\n * A list of axis data items which fall within this break.\r\n */\n\n _this.dataItems = new List();\n _this.className = \"AxisBreak\"; // Set defaults\n\n _this.breakSize = 0.01;\n _this.marginLeft = -5;\n _this.marginRight = -5;\n _this.marginTop = -5;\n _this.marginBottom = -5;\n var interfaceColors = new InterfaceColorSet(); // Create elements\n // (these won't be used actually, just for setting properties)\n\n var fillShape = new WavedLine();\n fillShape.fill = interfaceColors.getFor(\"background\");\n fillShape.stroke = color();\n fillShape.fillOpacity = 0.9;\n fillShape.zIndex = 0;\n _this._fillShape = fillShape;\n var startLine = new WavedLine();\n startLine.fill = color();\n startLine.stroke = interfaceColors.getFor(\"grid\");\n startLine.strokeOpacity = 0.3;\n startLine.zIndex = 1;\n _this._startLine = startLine;\n var endLine = new WavedLine();\n endLine.fill = color();\n endLine.stroke = color(\"#000000\"); // interfaceColors.getFor(\"grid\");\n\n endLine.strokeOpacity = 0.3;\n endLine.zIndex = 2;\n _this._endLine = endLine;\n\n _this._disposers.push(_this._axis); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n\n AxisBreak.prototype.dispose = function () {\n _super.prototype.dispose.call(this);\n\n if (this._fillShape) {\n this._fillShape.dispose();\n }\n\n if (this._startLine) {\n this._startLine.dispose();\n }\n\n if (this._endLine) {\n this._endLine.dispose();\n }\n };\n\n Object.defineProperty(AxisBreak.prototype, \"startLine\", {\n /**\r\n * @return Element\r\n */\n get: function get() {\n return this._startLine;\n },\n\n /**\r\n * An element used for the starting line of the break.\r\n *\r\n * @param sprite Element\r\n */\n set: function set(sprite) {\n if (this._startLine) {\n this._startLine.dispose();\n }\n\n this._startLine = sprite;\n this.addBreakSprite(sprite);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"endLine\", {\n /**\r\n * @return Element\r\n */\n get: function get() {\n return this._endLine;\n },\n\n /**\r\n * An element used for the end line of the break.\r\n *\r\n * @param sprite Element\r\n */\n set: function set(sprite) {\n if (this._endLine) {\n this._endLine.dispose();\n }\n\n this._endLine = sprite;\n this.addBreakSprite(sprite);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"fillShape\", {\n /**\r\n * @return Element\r\n */\n get: function get() {\n return this._fillShape;\n },\n\n /**\r\n * An element used for fill of the break.\r\n *\r\n * @param sprite Element\r\n */\n set: function set(sprite) {\n if (this._fillShape) {\n this._fillShape.dispose();\n }\n\n this._fillShape = sprite;\n this.addBreakSprite(sprite);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Adds a break element (e.g. lines, fill) to the break, which is\r\n * [[Container]].\r\n *\r\n * @ignore Exclude from docs\r\n * @param sprite Element to add\r\n */\n\n AxisBreak.prototype.addBreakSprite = function (sprite) {\n sprite.parent = this;\n sprite.isMeasured = false;\n\n this._disposers.push(sprite);\n };\n\n Object.defineProperty(AxisBreak.prototype, \"axis\", {\n /**\r\n * @return Axis\r\n */\n get: function get() {\n return this._axis.get();\n },\n\n /**\r\n * An Axis this Break is associated with.\r\n *\r\n * @param axis Axis\r\n */\n set: function set(axis) {\n if (this._axis.get() !== axis) {\n this._axis.set(axis, axis.renderer.gridContainer.events.on(\"transformed\", this.invalidate, this, false));\n\n axis.renderer.createBreakSprites(this); // this can't go to copyFrom, as axis is set later\n\n var breakTemplate = axis.axisBreaks.template;\n this.startLine.copyFrom(breakTemplate.startLine);\n this.endLine.copyFrom(breakTemplate.endLine);\n this.fillShape.copyFrom(breakTemplate.fillShape);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"breakSize\", {\n /**\r\n * @return Relative axis break\r\n */\n get: function get() {\n return this.getPropertyValue(\"breakSize\");\n },\n\n /**\r\n * A size of the break relative to the actual size of the scope break spans.\r\n *\r\n * For example, if `breakSize = 0.1` and unbroken scope of values it spans\r\n * would be 100 pixels, the break would be 10 pixels wide.\r\n *\r\n * 0 means the break will completely collapse and hide the values.\r\n * 1 means break would be not collapse at all, which would make it\r\n * effectively useless.\r\n *\r\n * @default 0.01\r\n * @param value Relative axis break\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"breakSize\", value)) {\n if (this.axis) {\n this.axis.invalidate();\n this.axis.invalidateSeries();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"startPoint\", {\n /**\r\n * Returns pixel coordinates of axis break's start.\r\n *\r\n * @return Start point\r\n */\n get: function get() {\n var renderer = this.axis.renderer;\n\n if (renderer) {\n return renderer.positionToPoint(this.startPosition);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"endPoint\", {\n /**\r\n * Returns pixel coordinates of axis break's end.\r\n *\r\n * @return End point\r\n */\n get: function get() {\n var renderer = this.axis.renderer;\n\n if (renderer) {\n return renderer.positionToPoint(this.endPosition);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"startPosition\", {\n /**\r\n * Returns a relative position at which axis break starts.\r\n *\r\n * This is a calculated position, meaning it shows relative position of the\r\n * break after break is applied.\r\n *\r\n * @return Start position\r\n */\n get: function get() {\n return;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"endPosition\", {\n /**\r\n * Returns a relative position at which axis break ends.\r\n *\r\n * This is a calculated position, meaning it shows relative position of the\r\n * break after break is applied.\r\n *\r\n * @return End position\r\n */\n get: function get() {\n return;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Draws the axis break.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n AxisBreak.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (this.axis) {\n var renderer = this.axis.renderer;\n renderer.updateBreakElement(this);\n }\n };\n\n Object.defineProperty(AxisBreak.prototype, \"startValue\", {\n /**\r\n * @return Starting value\r\n */\n get: function get() {\n return this.getPropertyValue(\"startValue\");\n },\n\n /**\r\n * A starting value for the break.\r\n *\r\n * @param value Starting value\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"startValue\", value)) {\n if (this.axis) {\n this.axis.invalidate();\n this.axis.invalidateSeries();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisBreak.prototype, \"endValue\", {\n /**\r\n * @return End value\r\n */\n get: function get() {\n return this.getPropertyValue(\"endValue\");\n },\n\n /**\r\n * An end value for the break.\r\n *\r\n * @param value End value\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"endValue\", value)) {\n if (this.axis) {\n this.axis.invalidate();\n this.axis.invalidateSeries();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n return AxisBreak;\n}(Container);\n\nexport { AxisBreak };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisBreak\"] = AxisBreak;","/**\r\n * Base class for all Axis\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Component } from \"../../core/Component\";\nimport { Container } from \"../../core/Container\";\nimport { DataItem } from \"../../core/DataItem\";\nimport { AxisBreak } from \"./AxisBreak\";\nimport { Label } from \"../../core/elements/Label\";\nimport { Tooltip } from \"../../core/elements/Tooltip\";\nimport { SortedListTemplate } from \"../../core/utils/SortedList\";\nimport { List, ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { Disposer, MultiDisposer } from \"../../core/utils/Disposer\";\nimport { registry } from \"../../core/Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $number from \"../../core/utils/Number\";\nimport * as $array from \"../../core/utils/Array\";\nimport * as $type from \"../../core/utils/Type\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../../core/utils/Responsive\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[Axis]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar AxisDataItem =\n/** @class */\nfunction (_super) {\n __extends(AxisDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function AxisDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(AxisDataItem.prototype, \"grid\", {\n /**\r\n * @return Grid element\r\n */\n get: function get() {\n if (!this._grid) {\n var component_1 = this.component;\n\n if (component_1) {\n var template = void 0;\n var grid_1;\n\n if (this.isRange) {\n template = component_1.axisRanges.template.grid;\n\n if (template.disabled) {\n return;\n } else {\n grid_1 = template.clone();\n }\n } else {\n template = component_1.renderer.grid.template;\n\n if (template.disabled) {\n return;\n } else {\n grid_1 = component_1.renderer.grid.create();\n\n this._disposers.push(new Disposer(function () {\n component_1.renderer.grid.removeValue(grid_1);\n }));\n }\n }\n\n this.grid = grid_1;\n grid_1.shouldClone = false;\n\n this._disposers.push(grid_1);\n\n grid_1.axis = this.component;\n }\n }\n\n return this._grid;\n },\n\n /**\r\n * A [[Grid]] element associated with this data item.\r\n *\r\n * If there is no grid element associated with data item, a new one is\r\n * created and returned.\r\n *\r\n * @param grid Grid element\r\n */\n set: function set(grid) {\n if (this._grid && this._grid != grid) {\n $array.remove(this.sprites, this._grid);\n this._grid.dataItem = undefined;\n }\n\n if (grid) {\n if (grid.dataItem && grid.dataItem != this) {\n $array.remove(grid.dataItem.sprites, grid);\n grid.dataItem.grid = undefined;\n }\n\n this.addSprite(grid);\n }\n\n this._grid = grid;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"tick\", {\n /**\r\n * @return Tick element\r\n */\n get: function get() {\n if (!this._tick) {\n var component_2 = this.component;\n\n if (component_2) {\n var template = void 0;\n var tick_1;\n\n if (this.isRange) {\n template = component_2.axisRanges.template.tick;\n\n if (template.disabled) {\n return;\n } else {\n tick_1 = template.clone();\n }\n } else {\n template = component_2.renderer.ticks.template;\n\n if (template.disabled) {\n return;\n } else {\n tick_1 = component_2.renderer.ticks.create();\n\n this._disposers.push(new Disposer(function () {\n component_2.renderer.ticks.removeValue(tick_1);\n }));\n }\n }\n\n this.tick = tick_1;\n tick_1.axis = this.component;\n tick_1.shouldClone = false;\n\n this._disposers.push(tick_1);\n }\n }\n\n return this._tick;\n },\n\n /**\r\n * An [[AxisTick]] element associated with this data item.\r\n *\r\n * If there is no tick element associated with data item, a new one is\r\n * created and returned.\r\n *\r\n * @param tick Tick element\r\n */\n set: function set(tick) {\n if (this._tick && this._tick != tick) {\n $array.remove(this.sprites, this._tick);\n this._tick.dataItem = undefined;\n }\n\n if (tick) {\n if (tick.dataItem && tick.dataItem != this) {\n $array.remove(tick.dataItem.sprites, tick);\n tick.dataItem.tick = undefined;\n }\n\n this.addSprite(tick);\n }\n\n this._tick = tick;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"label\", {\n /**\r\n * @return Label element\r\n */\n get: function get() {\n if (!this._label) {\n var component_3 = this.component;\n\n if (component_3) {\n var template = void 0;\n var label_1;\n\n if (this.isRange) {\n template = component_3.axisRanges.template.label;\n\n if (template.disabled) {\n return;\n } else {\n label_1 = template.clone();\n }\n } else {\n template = component_3.renderer.labels.template;\n\n if (template.disabled) {\n return;\n } else {\n label_1 = component_3.renderer.labels.create();\n\n this._disposers.push(new Disposer(function () {\n component_3.renderer.labels.removeValue(label_1);\n }));\n }\n }\n\n this._disposers.push(label_1);\n\n this.label = label_1;\n label_1.shouldClone = false;\n label_1.axis = this.component;\n label_1.virtualParent = component_3;\n }\n }\n\n return this._label;\n },\n\n /**\r\n * An [[AxisLabel]] element associated with this data item.\r\n *\r\n * If there is no label element associated with data item, a new one is\r\n * created and returned.\r\n *\r\n * @param label Label element\r\n */\n set: function set(label) {\n if (this._label && this._label != label) {\n $array.remove(this.sprites, this._label);\n this._label.dataItem = undefined;\n }\n\n if (label) {\n if (label.dataItem && label.dataItem != this) {\n $array.remove(label.dataItem.sprites, label);\n label.dataItem.label = undefined;\n }\n\n this.addSprite(label);\n }\n\n this._label = label;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"axisFill\", {\n /**\r\n * @return Label element\r\n */\n get: function get() {\n if (!this._axisFill) {\n var component_4 = this.component;\n\n if (component_4) {\n var template = void 0;\n var axisFill_1;\n\n if (this.isRange) {\n template = component_4.axisRanges.template.axisFill;\n\n if (!this.isTemplate && template.disabled) {\n return;\n } else {\n axisFill_1 = template.clone();\n }\n } else {\n template = component_4.renderer.axisFills.template;\n\n if (template.disabled) {\n return;\n } else {\n axisFill_1 = component_4.renderer.axisFills.create();\n\n this._disposers.push(new Disposer(function () {\n component_4.renderer.axisFills.removeValue(axisFill_1);\n }));\n }\n }\n\n this.axisFill = axisFill_1;\n axisFill_1.shouldClone = false;\n\n this._disposers.push(axisFill_1);\n }\n }\n\n return this._axisFill;\n },\n\n /**\r\n * An [[AxisFill]] associated element with this data item.\r\n *\r\n * If there is no fill element associated with data item, a new one is\r\n * created and returned.\r\n *\r\n * @param label Label element\r\n */\n set: function set(axisFill) {\n if (this._axisFill && this._axisFill != axisFill) {\n $array.remove(this.sprites, this._axisFill);\n this._axisFill.dataItem = undefined;\n }\n\n if (axisFill) {\n if (axisFill.dataItem && axisFill.dataItem != this) {\n $array.remove(axisFill.dataItem.sprites, axisFill);\n axisFill.dataItem.axisFill = undefined;\n }\n\n axisFill.axis = this.component;\n this.addSprite(axisFill);\n }\n\n this._axisFill = axisFill;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"text\", {\n /**\r\n * @return Text label\r\n */\n get: function get() {\n return this._text;\n },\n\n /**\r\n * Text to be used as data item's label.\r\n *\r\n * @param text Text label\r\n */\n set: function set(text) {\n this._text = text;\n\n if (this._label) {\n // do not use getter, it will create unwanted instances!\n this._label.text = text;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"mask\", {\n /**\r\n * Data item's mask.\r\n *\r\n * @return Mask\r\n */\n get: function get() {\n return this._mask;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"contents\", {\n /**\r\n * Returns a [[Container]] to place all visual elements, related to data item\r\n * in.\r\n *\r\n * If there is no Container, a new one is created.\r\n *\r\n * @return Contents container\r\n */\n get: function get() {\n if (!this._contents) {\n var contents = new Container();\n this.addSprite(contents);\n contents.isMeasured = false;\n this._contents = contents;\n var component = this.component;\n\n if (component) {\n var mask = component.renderer.createFill(this.component);\n mask.disabled = false;\n mask.axis = component;\n this.addSprite(mask);\n this._mask = mask;\n contents.mask = mask;\n }\n }\n\n return this._contents;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisDataItem.prototype, \"axisBreak\", {\n /**\r\n * @return Axis break\r\n */\n get: function get() {\n return this._axisBreak;\n },\n\n /**\r\n * An [[AxisBreak]] this data item falls within.\r\n *\r\n * @param axisBreak Axis break\r\n */\n set: function set(axisBreak) {\n if (this._axisBreak) {\n this._axisBreak.dataItems.removeValue(this);\n }\n\n if (axisBreak) {\n axisBreak.dataItems.push(this);\n }\n\n this._axisBreak = axisBreak;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Re-draws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n AxisDataItem.prototype.validate = function () {\n if (this.component) {\n this.component.validateDataElement(this);\n }\n };\n /**\r\n * Appends data item's elements to the parent [[Container]].\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisDataItem.prototype.appendChildren = function () {\n if (this.component) {\n this.component.appendDataItem(this);\n }\n };\n /**\r\n * Checks if data item has particular property set.\r\n *\r\n * @param prop Property name\r\n * @return Property set?\r\n */\n\n\n AxisDataItem.prototype.hasProperty = function (prop) {\n return prop == \"component\" ? true : _super.prototype.hasProperty.call(this, prop);\n };\n /**\r\n * Copies all parameters from another [[AxisDataItem]].\r\n *\r\n * @param source Source AxisDataItem\r\n */\n\n\n AxisDataItem.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.text = source.text;\n\n if (source.bullet) {\n this.bullet = source.bullet.clone();\n }\n\n this.minPosition = source.minPosition;\n this.maxPosition = source.maxPosition;\n };\n /**\r\n * Sets visibility of the Data Item.\r\n *\r\n * @param value Data Item\r\n */\n\n\n AxisDataItem.prototype.setVisibility = function (value, noChangeValues) {\n _super.prototype.setVisibility.call(this, value, noChangeValues);\n\n if (this._contents) {\n this._contents.visible = value;\n }\n };\n\n Object.defineProperty(AxisDataItem.prototype, \"bullet\", {\n /**\r\n * @return Bullet\r\n */\n get: function get() {\n return this._bullet;\n },\n\n /**\r\n * Set it to an instance of any [[Sprite]]. It will be displayed as an axis\r\n * bullet in the middle of the cell, or specific value.\r\n *\r\n * If you need position bullet relatively to the cell, use [[AxisBullet]]\r\n * instead. It has a `location` property which can be used to indicate\r\n * precise relative location within cell/range.\r\n *\r\n * Also, [[AxisBullet]] is a [[Container]] so you can push any other element\r\n * into it.\r\n *\r\n * NOTE: `location` is relative to the parent axis range's scope, i.e.\r\n * between its `date` and `endDate` for [[DateAxis]], or `value`/`endValue`\r\n * ([[ValueAxis]]), or `category`/`endCategory` ([[categoryAxis]]).\r\n *\r\n * ```TypeScript\r\n * let range = dateAxis.axisRanges.create();\r\n * range.date = new Date(2018, 0, 5);\r\n *\r\n * let flag = new am4plugins_bullets.FlagBullet();\r\n * flag.label.text = \"Hello\";\r\n *\r\n * range.bullet = flag;\r\n * ```\r\n * ```JavaScript\r\n * var range = dateAxis.axisRanges.create();\r\n * range.date = new Date(2018, 0, 5);\r\n *\r\n * var flag = new am4plugins_bullets.FlagBullet();\r\n * flag.label.text = \"Hello\";\r\n *\r\n * range.bullet = flag;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"xAxes\": [{\r\n * \"type\": \"DateAxis\",\r\n * // ...\r\n * \"axisRanges\": [{\r\n * \"date\": new Date(2018, 0, 5),\r\n * \"bullet: {\r\n * \"type\": \"FlagBullet\",\r\n * \"label\": {\r\n * \"text\": \"Hello\"\r\n * }\r\n * }\r\n * }]\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @since 4.5.9\r\n * @param value Bullet\r\n */\n set: function set(value) {\n if (this._bullet && this._bullet != value) {\n $array.remove(this.sprites, this._bullet);\n this._bullet.dataItem = undefined;\n }\n\n this._bullet = value;\n\n if (value) {\n this.addSprite(value);\n }\n },\n enumerable: true,\n configurable: true\n });\n return AxisDataItem;\n}(DataItem);\n\nexport { AxisDataItem };\n/**\r\n * ============================================================================\r\n * REQUISITES\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines named positions for data item's location within [[Axis]].\r\n */\n\nexport var AxisItemLocation;\n\n(function (AxisItemLocation) {\n AxisItemLocation[AxisItemLocation[\"Start\"] = 0] = \"Start\";\n AxisItemLocation[AxisItemLocation[\"Middle\"] = 0.5] = \"Middle\";\n AxisItemLocation[AxisItemLocation[\"End\"] = 1] = \"End\";\n})(AxisItemLocation || (AxisItemLocation = {}));\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for all Axis elements.\r\n *\r\n * @see {@link IAxisEvents} for a list of available Events\r\n * @see {@link IAxisAdapters} for a list of available Adapters\r\n */\n\n\nvar Axis =\n/** @class */\nfunction (_super) {\n __extends(Axis, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Axis() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Number of Grid elements on the axis.\r\n */\n\n\n _this._gridCount = 10;\n /**\r\n * A list of [[XYSeries]] that are using this Axis.\r\n */\n\n _this._series = new List();\n /**\r\n * Specifies if axis should be automatically disposed when removing from\r\n * chart's axis list.\r\n *\r\n * @default true\r\n */\n\n _this.autoDispose = true;\n /**\r\n * @ignore\r\n */\n\n _this._axisItemCount = 0;\n\n if (_this.constructor === Axis) {\n throw new Error(\"'Axis' cannot be instantiated directly. Please use a specific axis type.\");\n }\n\n _this.hideTooltipWhileZooming = true;\n _this.minWidth = 0.0001;\n _this.minHeight = 0.0001;\n _this.className = \"Axis\";\n _this.shouldClone = false;\n\n _this.setPropertyValue(\"cursorTooltipEnabled\", true);\n\n _this.toggleZoomOutButton = true;\n _this.zoomable = true;\n var interfaceColors = new InterfaceColorSet(); // Create title\n\n _this.title = new Label();\n _this.title.shouldClone = false;\n\n _this._disposers.push(_this.title);\n\n _this.setPropertyValue(\"startLocation\", 0);\n\n _this.setPropertyValue(\"endLocation\", 1); // Data item iterator\n\n\n _this._dataItemsIterator = new $iter.ListIterator(_this.dataItems, function () {\n return _this.dataItems.create();\n });\n _this._dataItemsIterator.createNewItems = true; // Create tooltip\n\n var tooltip = new Tooltip();\n\n _this._disposers.push(tooltip);\n\n tooltip.label.padding(5, 10, 5, 10);\n tooltip.background.pointerLength = 5;\n tooltip.fitPointerToBounds = true;\n tooltip.background.filters.clear(); // Set virtual parentfor the tooltip so that it can properly inheirt\n // formatters from the axis.\n\n tooltip.virtualParent = _this; // Create background element for the tooltip\n\n var background = tooltip.background;\n background.cornerRadius = 0;\n background.fill = interfaceColors.getFor(\"alternativeBackground\");\n background.stroke = background.fill;\n background.strokeWidth = 1;\n background.fillOpacity = 1;\n tooltip.label.fill = interfaceColors.getFor(\"alternativeText\");\n _this.tooltip = tooltip; // Accessibility\n\n _this.readerHidden = true;\n\n _this.events.on(\"rangechangestarted\", function () {\n _this.series.each(function (series) {\n if (series.hideTooltipWhileZooming) {\n series.tooltip.hide();\n series.tooltip.preventShow = true;\n }\n });\n\n if (_this.hideTooltipWhileZooming) {\n _this.tooltip.hide();\n\n _this.tooltip.preventShow = true;\n }\n }, undefined, false);\n\n _this.events.on(\"rangechangeended\", function () {\n _this.series.each(function (series) {\n if (series.hideTooltipWhileZooming) {\n series.tooltip.hide();\n series.tooltip.preventShow = false;\n }\n });\n\n if (_this.hideTooltipWhileZooming) {\n _this.tooltip.hide();\n\n _this.tooltip.preventShow = false;\n }\n }, undefined, false);\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Holds reference to a function that accepts a DataItem and its index as\r\n * parameters.\r\n *\r\n * It can either return a fill opacity for a fill, or manipulate data item\r\n * directly, to create various highlighting scenarios.\r\n *\r\n * For example, you can set it up to highlight only weekends on a\r\n * [[DateAxis]].\r\n */\n\n\n Axis.prototype.fillRule = function (dataItem, index) {\n if (!$type.isNumber(index)) {\n index = dataItem.index;\n }\n\n if (index / 2 == Math.round(index / 2)) {\n dataItem.axisFill.__disabled = true;\n dataItem.axisFill.opacity = 0;\n } else {\n dataItem.axisFill.opacity = 1;\n dataItem.axisFill.__disabled = false;\n }\n };\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n Axis.prototype.createDataItem = function () {\n return new AxisDataItem();\n };\n /**\r\n * Invalidates layout.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.invalidateLayout = function () {\n _super.prototype.invalidateLayout.call(this); // this puts series after axis in invalidation order also makes series update it's data items in case widht/height of a series is not 100%\n\n\n $iter.each(this.series.iterator(), function (series) {\n series.invalidateLayout();\n });\n };\n /**\r\n * Invalidates series of this axis.\r\n */\n\n\n Axis.prototype.invalidateSeries = function () {\n // this puts series after axis in invalidation order also makes series update it's data items in case widht/height of a series is not 100%\n $iter.each(this.series.iterator(), function (series) {\n series.invalidate();\n });\n };\n /**\r\n * Override to cancel super call for data element validation.\r\n * @ignore\r\n */\n\n\n Axis.prototype.validateDataElements = function () {\n this._axisItemCount = 0;\n\n if (this.ghostLabel) {\n this.renderer.updateLabelElement(this.ghostLabel, this.start, this.end);\n this.ghostLabel.validate();\n }\n };\n /**\r\n * Recalculates the number of grid items on the axis.\r\n */\n\n\n Axis.prototype.updateGridCount = function () {\n if (this.renderer) {\n var gridCount = this.axisLength / this.renderer.minGridDistance;\n\n if (gridCount != this._gridCount) {\n this._gridCount = gridCount;\n this.clearCache();\n }\n }\n };\n /**\r\n * Redraws the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.validateLayout = function () {\n this.axisFullLength = this.axisLength / (this.end - this.start);\n\n _super.prototype.validateLayout.call(this);\n\n this.updateGridCount();\n var renderer = this.renderer;\n\n if (renderer) {\n renderer.updateAxisLine();\n renderer.updateTooltip();\n renderer.updateBaseGridElement();\n }\n\n if (this._prevLength != this.axisLength) {\n this.dispatchImmediately(\"lengthchanged\");\n this._prevLength = this.axisLength;\n }\n };\n /**\r\n * Initializes Axis' renderer.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.initRenderer = function () {};\n /**\r\n * Adds a data item to the Axis.\r\n *\r\n * @param dataItem Data item\r\n */\n\n\n Axis.prototype.appendDataItem = function (dataItem) {\n var renderer = this.renderer;\n var tick = dataItem.tick;\n\n if (tick) {\n if (tick.above) {\n tick.parent = renderer.bulletsContainer;\n } else {\n tick.parent = renderer.gridContainer;\n }\n }\n\n if (dataItem.label) {\n dataItem.label.parent = renderer;\n }\n\n var axisFill = dataItem.axisFill;\n\n if (axisFill) {\n if (axisFill.above) {\n axisFill.parent = renderer.bulletsContainer;\n } else {\n axisFill.parent = renderer.gridContainer;\n }\n }\n\n var grid = dataItem.grid;\n\n if (grid) {\n if (grid.above) {\n grid.parent = renderer.bulletsContainer;\n } else {\n grid.parent = renderer.gridContainer;\n }\n }\n\n if (dataItem.bullet) {\n dataItem.bullet.parent = renderer.bulletsContainer;\n }\n };\n /**\r\n * Redraws Axis' related items.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.validate = function () {\n _super.prototype.validate.call(this);\n\n this.validateLayout();\n this.renderer.updateGridContainer();\n };\n /**\r\n * Redars Axis ranges.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.validateAxisRanges = function () {\n var _this = this;\n\n $iter.each(this.axisRanges.iterator(), function (axisRange) {\n _this.appendDataItem(axisRange);\n\n _this.validateDataElement(axisRange);\n\n if (axisRange.grid) {\n axisRange.grid.validate();\n }\n\n if (axisRange.tick) {\n axisRange.tick.validate();\n }\n\n if (axisRange.axisFill) {\n axisRange.axisFill.validate();\n }\n\n if (axisRange.label) {\n axisRange.label.validate();\n }\n });\n };\n /**\r\n * Invalidates all axis breaks, so they are redrawn.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.validateBreaks = function () {\n if (this._axisBreaks) {\n $iter.each(this._axisBreaks.iterator(), function (axisBreak) {\n axisBreak.invalidate();\n });\n }\n };\n /**\r\n * Associates an Axis break with this Axis, after it is inserted into\r\n * `axisBreaks`.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n Axis.prototype.processBreak = function (event) {\n var axisBreak = event.newValue;\n axisBreak.parent = this.renderer.breakContainer;\n axisBreak.axis = this;\n };\n /**\r\n * Registers a [[XYSeries]] element with this Axis.\r\n *\r\n * Returns a [[Disposer]] for all events, added to Series for watching\r\n * changes in Axis, and vice versa.\r\n * @ignore\r\n * @param series Series\r\n * @return Event disposer\r\n */\n\n\n Axis.prototype.registerSeries = function (series) {\n var _this = this;\n\n this.series.moveValue(series);\n return new MultiDisposer([new Disposer(function () {\n _this.series.removeValue(series);\n }), this.events.on(\"lengthchanged\", series.invalidate, series, false), this.events.on(\"lengthchanged\", series.createMask, series, false), this.events.on(\"startchanged\", series.invalidate, series, false), this.events.on(\"endchanged\", series.invalidate, series, false)]);\n };\n\n Object.defineProperty(Axis.prototype, \"renderer\", {\n /**\r\n * @return Renderer\r\n */\n get: function get() {\n return this._renderer;\n },\n\n /**\r\n * An [[AxisRenderer]] to be used to render this Axis.\r\n *\r\n * Please note that most of the settings, related to Axis' appearance are set\r\n * via its renderer. Not directly on the Axis.\r\n *\r\n * E.g.:\r\n *\r\n * ```TypeScript\r\n * axis.renderer.inside = true;\r\n * axis.renderer.minLabelPosition = 0.1;\r\n * axis.renderer.maxLabelPosition = 0.9;\r\n * ```\r\n * ```JavaScript\r\n * axis.renderer.inside = true;\r\n * axis.renderer.minLabelPosition = 0.1;\r\n * axis.renderer.maxLabelPosition = 0.9;\r\n * ```\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/} for more info\r\n * @param renderer Renderer\r\n */\n set: function set(renderer) {\n if (renderer != this._renderer) {\n this._renderer = renderer;\n renderer.chart = this.chart;\n renderer.axis = this;\n renderer.parent = this;\n this.title.parent = this; // we add title to axis and set layout in renderer to avoid one extra container, as otherwise axis container would be used for holding renderer only\n\n this.initRenderer();\n\n this._disposers.push(renderer.gridContainer.events.on(\"maxsizechanged\", this.invalidate, this, false));\n\n var ghostLabel_1 = this.renderer.labels.create();\n\n this._disposers.push(ghostLabel_1);\n\n ghostLabel_1.dataItem = this.dataItems.template.clone(); // just for the adapters not to fail\n\n ghostLabel_1.text = \"L\";\n ghostLabel_1.parent = this.renderer;\n ghostLabel_1.shouldClone = false;\n ghostLabel_1.fillOpacity = 0;\n ghostLabel_1.opacity = 0;\n ghostLabel_1.strokeOpacity = 0;\n ghostLabel_1.interactionsEnabled = false;\n ghostLabel_1.validate();\n this.ghostLabel = ghostLabel_1;\n this.events.on(\"beforedatavalidated\", function () {\n ghostLabel_1.text = \"L\";\n }, undefined, false);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts a relative position to angle. (for circular axes)\r\n *\r\n * @param position Position (0-1)\r\n * @return Angle\r\n */\n\n Axis.prototype.positionToAngle = function (position) {\n return this.renderer.positionToAngle(position);\n };\n /**\r\n * Converts pixel coordinates to a relative position. (0-1)\r\n *\r\n * @param point Coorinates (px)\r\n * @return Position (0-1)\r\n */\n\n\n Axis.prototype.pointToPosition = function (point) {\n return this.renderer.pointToPosition(point);\n };\n /**\r\n * Converts relative position to coordinate.\r\n *\r\n * @since 4.7.15\r\n * @param position (0-1)\r\n * @return coordinate (px)\r\n */\n\n\n Axis.prototype.positionToCoordinate = function (position) {\n return this.renderer.positionToCoordinate(position);\n };\n /**\r\n * [getAnyRangePath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param start [description]\r\n * @param end [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getAnyRangePath = function (start, end) {\n return this.renderer.getPositionRangePath(start, end);\n };\n /**\r\n * Converts any positional parameter to a relative position on axis.\r\n *\r\n * @todo Description (review)\r\n * @param value Pisition\r\n * @return Position (0-1)\r\n */\n\n\n Axis.prototype.anyToPosition = function (value) {\n return 0;\n };\n /**\r\n * Converts any positional parameter to a relative position on axis.\r\n *\r\n * @todo Description (review)\r\n * @param value Pisition\r\n * @return Orientation point\r\n */\n\n\n Axis.prototype.anyToPoint = function (value) {\n return {\n x: 0,\n y: 0,\n angle: 0\n };\n };\n /**\r\n * [getPositionRangePath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param startPosition [description]\r\n * @param endPosition [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getPositionRangePath = function (startPosition, endPosition) {\n if (this.renderer) {\n return this.renderer.getPositionRangePath(startPosition, endPosition);\n }\n\n return \"\";\n };\n\n Object.defineProperty(Axis.prototype, \"axisLength\", {\n /**\r\n * Actual axis length in pixels.\r\n *\r\n * @return Axis length (px)\r\n */\n get: function get() {\n if (this.renderer) {\n return this.renderer.axisLength;\n }\n\n return 0;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Axis.prototype, \"cursorTooltipEnabled\", {\n /**\r\n * @return Display tooltip?\r\n */\n get: function get() {\n return this.getPropertyValue(\"cursorTooltipEnabled\");\n },\n\n /**\r\n * Indicates if axis should display a tooltip for chart's cursor.\r\n *\r\n * @param value Display tooltip?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"cursorTooltipEnabled\", value)) {\n if (value && this.renderer) {\n this.renderer.updateTooltip();\n } else if (this.tooltip) {\n this.tooltip.hide(0);\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Axis.prototype, \"toggleZoomOutButton\", {\n /**\r\n * @return Toggle zoom out button?\r\n */\n get: function get() {\n return this.getPropertyValue(\"toggleZoomOutButton\");\n },\n\n /**\r\n * Normally, when axis is zoomed in, a zoom out button is shown by a chart,\r\n * and vice versa: when axis is zoomed out completely, zoom out button is\r\n * hidden.\r\n *\r\n * Setting this to `false` will disable this behavior. Zooming in our out\r\n * this axis will not reveal or hide zoom out button.\r\n *\r\n * @default true\r\n * @since 4.6.2\r\n * @param value Toggle zoom out button?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"toggleZoomOutButton\", value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Hides element's [[Tooltip]].\r\n *\r\n * @see {@link Tooltip}\r\n */\n\n Axis.prototype.hideTooltip = function (duration) {\n _super.prototype.hideTooltip.call(this, duration);\n\n this._tooltipPosition = undefined;\n };\n /**\r\n * Shows Axis tooltip at specific relative position within Axis. (0-1)\r\n *\r\n * @param position Position (0-1)\r\n * @param local or global position\r\n */\n\n\n Axis.prototype.showTooltipAtPosition = function (position, local) {\n var tooltip = this._tooltip;\n\n if (!tooltip || this.dataItems.length <= 0) {\n this._tooltipPosition = undefined;\n } else {\n if (!local) {\n position = this.toAxisPosition(position);\n }\n\n if (!$type.isNumber(position) || position < this.start || position > this.end) {\n tooltip.hide(0);\n this._tooltipPosition = undefined;\n return;\n }\n\n var renderer = this.renderer; //@todo: think of how to solve this better\n\n if (!tooltip.parent) {\n tooltip.parent = this.tooltipContainer;\n }\n\n var tooltipLocation = renderer.tooltipLocation;\n var startPosition = this.getCellStartPosition(position);\n var endPosition = this.getCellEndPosition(position);\n\n if (this.tooltipPosition == \"fixed\") {\n position = startPosition + (endPosition - startPosition) * tooltipLocation;\n }\n\n position = $math.fitToRange(position, this.start, this.end);\n\n if (this._tooltipPosition != position) {\n this._tooltipPosition = position;\n var tooltipLocation2 = renderer.tooltipLocation2;\n var startPoint = renderer.positionToPoint(startPosition, tooltipLocation2);\n var endPoint = renderer.positionToPoint(endPosition, tooltipLocation2); // save values so cursor could use them\n\n this.currentItemStartPoint = startPoint;\n this.currentItemEndPoint = endPoint;\n\n if (renderer.fullWidthTooltip) {\n tooltip.width = endPoint.x - startPoint.x;\n tooltip.height = endPoint.y - startPoint.y;\n }\n\n var point = renderer.positionToPoint(position, tooltipLocation2);\n var globalPoint = $utils.spritePointToSvg(point, this.renderer.line);\n tooltip.text = this.getTooltipText(position);\n\n if (tooltip.text) {\n tooltip.delayedPointTo(globalPoint);\n tooltip.show();\n }\n }\n\n if (!this.cursorTooltipEnabled || this.tooltip.disabled) {\n tooltip.hide(0);\n }\n }\n };\n /**\r\n * Converts relative position (0-1) to Axis position with zoom level and\r\n * inversed taken into account.\r\n *\r\n * @param position Global position (0-1)\r\n * @return Position within Axis (0-1)\r\n */\n\n\n Axis.prototype.toAxisPosition = function (position) {\n position = this.renderer.toAxisPosition(position);\n\n if (position == undefined) {\n return;\n }\n\n position = position * (this.end - this.start);\n\n if (this.renderer.inversed) {\n position = this.end - position;\n } else {\n position = this.start + position;\n }\n\n return position;\n };\n /**\r\n * Converts position on the axis with zoom level and\r\n * inversed taken into account to global position.\r\n *\r\n * @param position Axis position (0-1)\r\n * @return Global position (0-1)\r\n */\n\n\n Axis.prototype.toGlobalPosition = function (position) {\n if (this.renderer.inversed) {\n position = this.end - position;\n } else {\n position = position - this.start;\n }\n\n return position / (this.end - this.start);\n };\n /**\r\n * Returns text to be used for cursor's Axis tooltip.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @param position Position coordinate (px)\r\n * @return Label text\r\n */\n\n\n Axis.prototype.getTooltipText = function (position) {\n return;\n };\n /**\r\n * Updates Axis' tooltip's position and possibly size, and pointer (stem)\r\n * place.\r\n *\r\n * @ignore Exclude from docs\r\n * @param pointerOrientation Pointer (stem) orientation\r\n * @param boundingRectangle A rectangle for tooltip to fit within\r\n */\n\n\n Axis.prototype.updateTooltip = function (pointerOrientation, boundingRectangle) {\n var tooltip = this._tooltip;\n\n if (tooltip) {\n tooltip.fixDoc = false;\n tooltip.pointerOrientation = pointerOrientation;\n tooltip.setBounds($utils.spriteRectToSvg(boundingRectangle, this.renderer.line));\n }\n };\n /**\r\n * [roundPosition description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param position Relative position\r\n * @param location Location on axis\r\n * @return Rounded position\r\n */\n\n\n Axis.prototype.roundPosition = function (position, location, axisLocation) {\n return position;\n };\n /**\r\n * [getCellStartPosition description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param position [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getCellStartPosition = function (position) {\n return position;\n };\n /**\r\n * [getCellEndPosition description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param position [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getCellEndPosition = function (position) {\n return position;\n };\n\n Object.defineProperty(Axis.prototype, \"axisRanges\", {\n /**\r\n * A list of axis ranges for this Axis.\r\n *\r\n * @return Axis ranges\r\n */\n get: function get() {\n if (!this._axisRanges) {\n var dataItem = this.createDataItem();\n dataItem.isRange = true;\n dataItem.axisFill = this.renderer.axisFills.template.clone();\n dataItem.grid = this.renderer.grid.template.clone();\n dataItem.tick = this.renderer.ticks.template.clone();\n dataItem.label = this.renderer.labels.template.clone();\n dataItem.isTemplate = true;\n dataItem.component = this;\n dataItem.axisFill.disabled = false;\n dataItem.tick.disabled = false;\n dataItem.grid.disabled = false;\n dataItem.label.disabled = false;\n this._axisRanges = new ListTemplate(dataItem);\n\n this._axisRanges.events.on(\"inserted\", this.processAxisRange, this, false);\n\n this._disposers.push(new ListDisposer(this._axisRanges));\n\n this._disposers.push(this._axisRanges.template);\n }\n\n return this._axisRanges;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Decorates an axis range after it has been added to the axis range list.\r\n *\r\n * @param event Event\r\n */\n\n Axis.prototype.processAxisRange = function (event) {\n var axisRange = event.newValue;\n axisRange.component = this;\n axisRange.isRange = true;\n };\n\n Object.defineProperty(Axis.prototype, \"axisBreaks\", {\n /**\r\n * A list of axis breaks on this Axis.\r\n *\r\n * @return Axis breaks.\r\n */\n get: function get() {\n if (!this._axisBreaks) {\n this._axisBreaks = new SortedListTemplate(this.createAxisBreak(), function (a, b) {\n return $number.order(a.adjustedStartValue, b.adjustedStartValue);\n });\n\n this._axisBreaks.events.on(\"inserted\", this.processBreak, this, false);\n\n this._disposers.push(new ListDisposer(this._axisBreaks));\n\n this._disposers.push(this._axisBreaks.template);\n }\n\n return this._axisBreaks;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates a new axis break.\r\n *\r\n * @return Axis break\r\n */\n\n Axis.prototype.createAxisBreak = function () {\n return new AxisBreak();\n };\n\n Object.defineProperty(Axis.prototype, \"series\", {\n /**\r\n * A list of Series currently associated with this Axis.\r\n *\r\n * @return Series\r\n */\n get: function get() {\n if (!this._series) {\n this._series = new List();\n }\n\n return this._series;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Processes Series' data items.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Axis.prototype.processSeriesDataItems = function () {};\n /**\r\n * Processes Series' single data item.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem Data item\r\n */\n\n\n Axis.prototype.processSeriesDataItem = function (dataItem, axisLetter) {};\n /**\r\n * Post-processes Serie's data items.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.postProcessSeriesDataItems = function (series) {};\n /**\r\n * Post-processes Serie's single data item.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem Data item\r\n */\n\n\n Axis.prototype.postProcessSeriesDataItem = function (dataItem) {}; //\n\n /**\r\n * Updates Axis based on all Series that might influence it.\r\n *\r\n * Called by Series after Series data is validated.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.updateAxisBySeries = function () {};\n /**\r\n * Hides unused data items.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Axis.prototype.hideUnusedDataItems = function () {\n var _this = this; // hide all unused\n\n\n var dataItemsIterator = this._dataItemsIterator;\n dataItemsIterator.createNewItems = false;\n $iter.each(dataItemsIterator.iterator(), function (dataItem) {\n _this.validateDataElement(dataItem); // solves shrinking\n\n\n dataItem.__disabled = true;\n });\n dataItemsIterator.clear();\n dataItemsIterator.createNewItems = true;\n };\n /**\r\n * Returns a Series' data item that corresponds to specific position on Axis.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @param series Series\r\n * @param position Position (0-1)\r\n * @param findNearest Should axis try to find nearest tooltip if there is no data item at exact position\r\n * @return Data item\r\n */\n\n\n Axis.prototype.getSeriesDataItem = function (series, position, findNearest) {\n return;\n };\n /**\r\n * Returns an angle that corresponds to specific position on axis.\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem Data item\r\n * @param key ???\r\n * @param location Location\r\n * @param stackKey ???\r\n * @return Angle\r\n */\n\n\n Axis.prototype.getAngle = function (dataItem, key, location, stackKey, range) {\n return;\n };\n /**\r\n * [getX description]\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem [description]\r\n * @param key [description]\r\n * @param location [description]\r\n * @param stackKey [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getX = function (dataItem, key, location, stackKey, range) {\n return;\n };\n /**\r\n * [getX description]\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem [description]\r\n * @param key [description]\r\n * @param location [description]\r\n * @param stackKey [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getPositionX = function (dataItem, key, location, stackKey, range) {\n return;\n };\n /**\r\n * [getY description]\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem [description]\r\n * @param key [description]\r\n * @param location [description]\r\n * @param stackKey [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getY = function (dataItem, key, location, stackKey, range) {\n return;\n };\n /**\r\n * [getY description]\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem [description]\r\n * @param key [description]\r\n * @param location [description]\r\n * @param stackKey [description]\r\n * @return [description]\r\n */\n\n\n Axis.prototype.getPositionY = function (dataItem, key, location, stackKey, range) {\n return;\n };\n\n Object.defineProperty(Axis.prototype, \"basePoint\", {\n /**\r\n * Coordinates of the actual axis start.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Base point coordinates\r\n */\n get: function get() {\n return {\n x: 0,\n y: 0\n };\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * [dataChangeUpdate description]\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n Axis.prototype.dataChangeUpdate = function () {};\n /**\r\n * [dataChangeUpdate description]\r\n *\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Axis.prototype.seriesDataChangeUpdate = function (series) {};\n /**\r\n * Removes axis breaks that fall between `min` and `max` (???)\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param min Start value\r\n * @param max End value\r\n * @return Spread o\r\n */\n\n\n Axis.prototype.adjustDifference = function (min, max) {\n var difference = max - min;\n\n if ($type.isNumber(difference)) {\n if (this._axisBreaks) {\n $iter.eachContinue(this._axisBreaks.iterator(), function (axisBreak) {\n var startValue = axisBreak.adjustedStartValue;\n var endValue = axisBreak.adjustedEndValue;\n\n if ($type.isNumber(startValue) && $type.isNumber(endValue)) {\n // breaks are sorted, we don't need go further anymore\n if (startValue > max) {\n return false;\n }\n\n if (endValue >= min) {\n if ($type.isNumber(startValue) && $type.isNumber(endValue)) {\n var breakSize = axisBreak.breakSize;\n var intersection = $math.intersection({\n start: startValue,\n end: endValue\n }, {\n start: min,\n end: max\n });\n\n if (intersection) {\n difference -= (intersection.end - intersection.start) * (1 - breakSize);\n }\n }\n }\n\n return true;\n }\n });\n }\n\n return difference;\n }\n };\n /**\r\n * Checks if specific value falls within a break.\r\n *\r\n * Returns [[AxisBreak]] the value falls into.\r\n *\r\n * @param value Value to check\r\n * @return Axis break\r\n */\n\n\n Axis.prototype.isInBreak = function (value) {\n if (this._axisBreaks) {\n return $iter.find(this._axisBreaks.iterator(), function (axisBreak) {\n return value >= axisBreak.adjustedStartValue && value <= axisBreak.adjustedEndValue;\n });\n }\n };\n /**\r\n * [fixAxisBreaks description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n Axis.prototype.fixAxisBreaks = function () {\n var _this = this;\n\n if (this._axisBreaks) {\n var axisBreaks = this._axisBreaks;\n\n if (axisBreaks.length > 0) {\n // first make sure that startValue is <= end value\n // This needs to make a copy of axisBreaks because it mutates the list while traversing\n // TODO very inefficient\n $array.each($iter.toArray(axisBreaks.iterator()), function (axisBreak) {\n var startValue = $math.min(axisBreak.startValue, axisBreak.endValue);\n var endValue = $math.max(axisBreak.startValue, axisBreak.endValue);\n axisBreak.adjustedStartValue = startValue;\n axisBreak.adjustedEndValue = endValue;\n\n _this._axisBreaks.update(axisBreak);\n });\n var firstAxisBreak = axisBreaks.first;\n var previousEndValue_1 = Math.min(firstAxisBreak.startValue, firstAxisBreak.endValue); // process breaks\n // TODO does this need to call axisBreaks.update ?\n\n $iter.each(axisBreaks.iterator(), function (axisBreak) {\n var startValue = axisBreak.adjustedStartValue;\n var endValue = axisBreak.adjustedEndValue; // breaks can't overlap\n // if break starts before previous break ends\n\n if (startValue < previousEndValue_1) {\n startValue = previousEndValue_1;\n\n if (endValue < previousEndValue_1) {\n endValue = previousEndValue_1;\n }\n }\n\n axisBreak.adjustedStartValue = startValue;\n axisBreak.adjustedEndValue = endValue;\n });\n }\n }\n };\n\n Object.defineProperty(Axis.prototype, \"startIndex\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return [description]\r\n */\n get: function get() {\n return 0;\n },\n\n /**\r\n * We need start/end indexes of axes to be 0 - `dataItems.length`.\r\n *\r\n * Yes, also for category axis, this helps to avoid jumping of categories\r\n * while scrolling and does not do a lot of extra work as we use\r\n * protected `_startIndex` and `_endIndex` when working with items.\r\n *\r\n * @hidden\r\n */\n\n /**\r\n * [startIndex description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param value [description]\r\n */\n set: function set(value) {},\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Axis.prototype, \"endIndex\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return [description]\r\n */\n get: function get() {\n return this.dataItems.length;\n },\n\n /**\r\n * [endIndex description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param value [description]\r\n */\n set: function set(value) {},\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a formatted label based on position.\r\n *\r\n * Individual axis types should override this method to generate a label\r\n * that is relevant to axis type.\r\n *\r\n * Please note that `position` represents position within axis which may be\r\n * zoomed and not correspond to Cursor's `position`.\r\n *\r\n * To convert Cursor's `position` to Axis' `position` use `toAxisPosition()` method.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/tutorials/tracking-cursors-position-via-api/#Tracking_Cursor_s_position} For more information about cursor tracking.\r\n * @param position Relative position on axis (0-1)\r\n * @return Position label\r\n */\n\n Axis.prototype.getPositionLabel = function (position) {\n return Math.round(position * 100) + \"%x\";\n };\n\n Object.defineProperty(Axis.prototype, \"chart\", {\n /**\r\n * @return Chart\r\n */\n get: function get() {\n return this._chart;\n },\n\n /**\r\n * A Chart this Axis belongs to.\r\n *\r\n * @param value Chart\r\n */\n set: function set(value) {\n this._chart = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates a data item for a Series range.\r\n *\r\n * @param series Target Series\r\n * @return Range data item\r\n */\n\n Axis.prototype.createSeriesRange = function (series) {\n var range = this.axisRanges.create();\n range.component = this;\n range.axisFill = this.renderer.axisFills.template.clone();\n range.axisFill.disabled = false;\n range.axisFill.fillOpacity = 0;\n range.grid = this.renderer.grid.template.clone();\n range.grid.disabled = true;\n range.tick = this.renderer.ticks.template.clone();\n range.tick.disabled = true;\n range.label = this.renderer.labels.template.clone();\n range.label.disabled = true;\n range.addDisposer(new Disposer(function () {\n series.axisRanges.removeValue(range);\n }));\n series.axisRanges.push(range);\n return range;\n };\n /**\r\n * Copies all properties and related data from a different instance of Axis.\r\n *\r\n * @param source Source Axis\r\n */\n\n\n Axis.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n if (this.renderer) {\n this.renderer.copyFrom(source.renderer);\n } else {\n if (source.renderer) {\n this.renderer = source.renderer.clone();\n\n this._disposers.push(this.renderer);\n }\n }\n\n if (source.title) {\n if (!this.title) {\n this.title = source.title.clone();\n this.title.parent = this;\n } else {\n this.title.copyFrom(source.title);\n }\n\n this._disposers.push(this.title);\n }\n };\n /**\r\n * Resets internal iterator.\r\n */\n\n\n Axis.prototype.resetIterators = function () {\n this._dataItemsIterator.reset();\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n Axis.prototype.processConfig = function (config) {\n if (config) {\n // Set up axis ranges\n if ($type.hasValue(config.axisRanges) && $type.isArray(config.axisRanges)) {\n for (var i = 0, len = config.axisRanges.length; i < len; i++) {\n var range = config.axisRanges[i]; // If `series` is set, we know it's a series range\n\n if ($type.hasValue(range[\"series\"])) {\n if ($type.isString(range[\"series\"])) {\n if (this.map.hasKey(range[\"series\"])) {\n //range[\"series\"] = this.map.getKey(range[\"series\"]);\n config.axisRanges[i] = this.createSeriesRange(this.map.getKey(range[\"series\"]));\n delete range[\"series\"];\n config.axisRanges[i].config = range;\n }\n }\n }\n }\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n /**\r\n * Ordering function used in JSON setup.\r\n *\r\n * @param a Item A\r\n * @param b Item B\r\n * @return Order\r\n */\n\n\n Axis.prototype.configOrder = function (a, b) {\n if (a == b) {\n return 0;\n } // last\n else if (a == \"title\") {\n return 1;\n } else if (b == \"title\") {\n return -1;\n } // first\n else if (a == \"component\") {\n return -1;\n } else if (b == \"component\") {\n return 1;\n } else {\n return _super.prototype.configOrder.call(this, a, b);\n }\n };\n\n Object.defineProperty(Axis.prototype, \"startLocation\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"startLocation\");\n },\n\n /**\r\n * Axis start location. Works on Date/Category axis, doesn't work on Value axis.\r\n *\r\n * * 0 - Full first cell is shown.\r\n * * 0.5 - Half of first cell is shown.\r\n * * 1 - None of the first cell is visible. (you probably don't want that)\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"startLocation\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Axis.prototype, \"endLocation\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"endLocation\");\n },\n\n /**\r\n * Axis end location. Works on Date/Category axis, doesn't work on Value axis.\r\n *\r\n * * 0 - None of the last cell is shown. (don't do that)\r\n * * 0.5 - Half of the last cell is shown.\r\n * * 1 - Full last cell is shown.\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"endLocation\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n\n Axis.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (this.renderer) {\n this.renderer.gridContainer.disabled = value;\n }\n\n return changed;\n };\n\n Object.defineProperty(Axis.prototype, \"title\", {\n /**\r\n * @return Title label\r\n */\n get: function get() {\n return this._title;\n },\n\n /**\r\n * A reference to a [[Label]] element which serves as a title to the axis.\r\n *\r\n * When axis is created it aleready has an element, so you can just modify\r\n * it.\r\n *\r\n * Or you can replace it with your own instance of `Label`.\r\n *\r\n * @param value Title label\r\n */\n set: function set(value) {\n if (this._title && this._title != value) {\n this._title.dispose();\n }\n\n if (value) {\n this._title = value;\n value.parent = this;\n value.shouldClone = false;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Axis.prototype, \"hideTooltipWhileZooming\", {\n /**\r\n * @return Hide tooltip while zooming?\r\n */\n get: function get() {\n return this.getPropertyValue(\"hideTooltipWhileZooming\");\n },\n\n /**\r\n * Indicates if axis' tooltip should be hidden while axis range is animating\r\n * (zooming)\r\n *\r\n * @default true\r\n * @since 4.7.16\r\n * @param value Hide tooltip while zooming?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"hideTooltipWhileZooming\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Axis.prototype, \"zoomable\", {\n /**\r\n * @return Zoomable?\r\n */\n get: function get() {\n return this.getPropertyValue(\"zoomable\");\n },\n\n /**\r\n * Should the axis be zoomed with scrollbar/cursor?\r\n *\r\n * @default true\r\n * @since 4.9.28\r\n * @param value Zoomable?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"zoomable\", value);\n },\n enumerable: true,\n configurable: true\n });\n return Axis;\n}(Component);\n\nexport { Axis };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Axis\"] = Axis;\nregistry.registeredClasses[\"AxisDataItem\"] = AxisDataItem;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Disable axis tooltips.\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.maybeXS,\n state: function state(target, stateId) {\n if (target instanceof Axis && target.tooltip) {\n var state = target.states.create(stateId);\n state.properties.cursorTooltipEnabled = false;\n return state;\n }\n\n return null;\n }\n});","/**\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../../core/Sprite\";\nimport { registry } from \"../../core/Registry\";\nimport { color } from \"../../core/utils/Color\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw Axis line.\r\n *\r\n * @see {@link IAxisLineEvents} for a list of available events\r\n * @see {@link IAxisLineAdapters} for a list of available Adapters\r\n */\n\nvar AxisLine =\n/** @class */\nfunction (_super) {\n __extends(AxisLine, _super);\n /**\r\n * Constructor\r\n */\n\n\n function AxisLine() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisLine\";\n _this.element = _this.paper.add(\"path\");\n var interfaceColors = new InterfaceColorSet();\n _this.stroke = interfaceColors.getFor(\"grid\");\n _this.strokeOpacity = 0.15;\n _this.pixelPerfect = true;\n _this.fill = color();\n\n _this.applyTheme();\n\n _this.interactionsEnabled = false;\n return _this; //this.element.moveTo({ x: 0, y: 0 });\n }\n\n return AxisLine;\n}(Sprite);\n\nexport { AxisLine };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisLine\"] = AxisLine;","import { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../../core/Sprite\";\nimport { registry } from \"../../core/Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * AxisFill is a base class used to defines fill shapes for various\r\n * type-specific Axes.\r\n *\r\n * Axis fills are used to add fills to specific ranges of those axes.\r\n *\r\n * @see {@link IAxisFillEvents} for a list of available events\r\n * @see {@link IAxisFillAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar AxisFill =\n/** @class */\nfunction (_super) {\n __extends(AxisFill, _super);\n /**\r\n * Constructor.\r\n *\r\n * @param axis Axis\r\n */\n\n\n function AxisFill(axis) {\n var _this = _super.call(this) || this;\n\n _this.axis = axis;\n _this.element = _this.paper.add(\"path\");\n _this.className = \"AxisFill\";\n _this.isMeasured = false;\n _this.location = 0;\n _this.above = false;\n var interfaceColors = new InterfaceColorSet();\n _this.fill = interfaceColors.getFor(\"alternativeBackground\");\n _this.fillOpacity = 0;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n AxisFill.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (this.axis) {\n this.axis.invalidateDataItems();\n }\n\n return changed;\n };\n /**\r\n * Draws the fill element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisFill.prototype.draw = function () {\n _super.prototype.draw.call(this);\n\n if (this.__disabled || this.disabled) {\n return;\n }\n\n if (this.axis && $type.isNumber(this.startPosition) && $type.isNumber(this.endPosition)) {\n this.fillPath = this.axis.getPositionRangePath(this.startPosition, this.endPosition);\n this.path = this.fillPath;\n\n if (this.isMeasured) {\n this.measure();\n }\n }\n };\n\n Object.defineProperty(AxisFill.prototype, \"startPosition\", {\n /**\r\n * @return Start position\r\n */\n get: function get() {\n return this.getPropertyValue(\"startPosition\");\n },\n\n /**\r\n * An actual starting position of the fill.\r\n *\r\n * @param value Starting position\r\n */\n set: function set(value) {\n this.setPropertyValue(\"startPosition\", value);\n this.invalidate(); // this is needed as relative position might not change when zooming\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisFill.prototype, \"endPosition\", {\n /**\r\n * @return End position\r\n */\n get: function get() {\n return this.getPropertyValue(\"endPosition\");\n },\n\n /**\r\n * An actual end position of the fill.\r\n *\r\n * @param value End position\r\n */\n set: function set(value) {\n this.setPropertyValue(\"endPosition\", value);\n this.invalidate(); // this is needed as relative position might not change when zooming\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisFill.prototype, \"location\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"location\");\n },\n\n /**\r\n * Relative location of the fill. (0-1)\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"location\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n AxisFill.prototype.setPath = function (value) {\n if (this.setPropertyValue(\"path\", value)) {\n this.element.attr({\n \"d\": value\n });\n return true;\n }\n\n return false;\n };\n\n Object.defineProperty(AxisFill.prototype, \"above\", {\n /**\r\n * @return Draw above series?\r\n */\n get: function get() {\n return this.getPropertyValue(\"above\");\n },\n\n /**\r\n * Normally fill goes below series. Set this to `true` to go above.\r\n *\r\n * @default false\r\n * @since 4.5.9\r\n * @param value Draw above series?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"above\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return AxisFill;\n}(Sprite);\n\nexport { AxisFill };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisFill\"] = AxisFill;","/**\r\n * A module defining functionality for axis grid elements.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../../core/Sprite\";\nimport { registry } from \"../../core/Registry\";\nimport { color } from \"../../core/utils/Color\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../../core/utils/Responsive\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Displays an axis grid line.\r\n *\r\n * @see {@link IGridEvents} for a list of available events\r\n * @see {@link IGridAdapters} for a list of available Adapters\r\n * @todo Review: container is better, as we'll be able to attach something to the grid, also with 3d charts we might need some additional elements\r\n * @important\r\n */\n\nvar Grid =\n/** @class */\nfunction (_super) {\n __extends(Grid, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Grid() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Grid\";\n _this.element = _this.paper.add(\"path\");\n _this.location = 0.5;\n _this.isMeasured = false;\n _this.above = false;\n var interfaceColors = new InterfaceColorSet();\n _this.stroke = interfaceColors.getFor(\"grid\");\n _this.pixelPerfect = true;\n _this.strokeOpacity = 0.15;\n _this.fill = color(); // \"none\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Grid.prototype, \"location\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"location\");\n },\n\n /**\r\n * Location within axis cell to place grid line on.\r\n *\r\n * * 0 - start\r\n * * 0.5 - middle\r\n * * 1 - end\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"location\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Grid.prototype, \"above\", {\n /**\r\n * @return Draw above series?\r\n */\n get: function get() {\n return this.getPropertyValue(\"above\");\n },\n\n /**\r\n * Normally fill goes below series. Set this to `true` to go above.\r\n *\r\n * @default false\r\n * @since 4.5.9\r\n * @param value Draw above series?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"above\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n Grid.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (this.axis) {\n this.axis.invalidateDataItems();\n }\n\n return changed;\n };\n\n return Grid;\n}(Sprite);\n\nexport { Grid };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Grid\"] = Grid;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Disable grid on smaller charts\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.maybeXS,\n state: function state(target, stateId) {\n if (target instanceof Grid) {\n var state = target.states.create(stateId);\n state.properties.disabled = true;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * Axis Label module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Label } from \"../../core/elements/Label\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Use to create labels on Axis.\r\n *\r\n * @see {@link IAxisLabelEvents} for a list of available events\r\n * @see {@link IAxisLabelAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar AxisLabel =\n/** @class */\nfunction (_super) {\n __extends(AxisLabel, _super);\n /**\r\n * Constructor\r\n */\n\n\n function AxisLabel() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisLabel\";\n _this.isMeasured = false;\n\n _this.padding(10, 10, 10, 10);\n\n _this.location = 0.5; //this.nonScaling = true; // not good for perf\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(AxisLabel.prototype, \"location\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"location\");\n },\n\n /**\r\n * Relative location of the label. (0-1)\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"location\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisLabel.prototype, \"inside\", {\n /**\r\n * Returns if label is set to be drawn inside axis.\r\n *\r\n * @return Inside?\r\n */\n get: function get() {\n return this.getPropertyValue(\"inside\");\n },\n\n /**\r\n * Sets if label should be drawn inside axis.\r\n *\r\n * @param value Inside?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"inside\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n AxisLabel.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (this.axis) {\n this.axis.invalidateDataItems();\n }\n\n return changed;\n };\n\n return AxisLabel;\n}(Label);\n\nexport { AxisLabel };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisLabel\"] = AxisLabel;","/**\r\n * Tick module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Sprite } from \"../../core/Sprite\";\nimport { registry } from \"../../core/Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A basic Tick class.\r\n *\r\n * A tick is a short dash, mainly connecting an object like axis or slice to\r\n * it's textual label.\r\n *\r\n * @see {@link ITickEvents} for a list of available events\r\n * @see {@link ITickAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar Tick =\n/** @class */\nfunction (_super) {\n __extends(Tick, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Tick() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Tick\";\n var interfaceColors = new InterfaceColorSet();\n _this.fillOpacity = 0;\n _this.length = 6;\n _this.strokeOpacity = 0.2;\n _this.stroke = interfaceColors.getFor(\"grid\");\n _this.isMeasured = false;\n _this.nonScalingStroke = true;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Tick.prototype, \"length\", {\n /**\r\n * @return Length (px)\r\n */\n get: function get() {\n if (this.disabled) {\n return 0;\n }\n\n return this.getPropertyValue(\"length\");\n },\n\n /**\r\n * Length of the tick in pixels.\r\n *\r\n * @param value Length (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"length\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return Tick;\n}(Sprite);\n\nexport { Tick };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Tick\"] = Tick;","/**\r\n * Axis Tick module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Tick } from \"../elements/Tick\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws an axis tick\r\n * @see {@link IAxisTickEvents} for a list of available events\r\n * @see {@link IAxisTickAdapters} for a list of available Adapters\r\n */\n\nvar AxisTick =\n/** @class */\nfunction (_super) {\n __extends(AxisTick, _super);\n\n function AxisTick() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisTick\";\n _this.element = _this.paper.add(\"path\");\n _this.location = 0.5;\n _this.above = false;\n _this.isMeasured = false;\n _this.pixelPerfect = true;\n _this.strokeOpacity = 0;\n _this.length = 5;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(AxisTick.prototype, \"location\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"location\");\n },\n\n /**\r\n * Relative location of the tick. (0-1)\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"location\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisTick.prototype, \"inside\", {\n /**\r\n * Returns if label is set to be drawn inside axis.\r\n *\r\n * @return Inside?\r\n */\n get: function get() {\n return this.getPropertyValue(\"inside\");\n },\n\n /**\r\n * Sets if tick should be drawn inside axis.\r\n *\r\n * @param value Inside?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"inside\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisTick.prototype, \"above\", {\n /**\r\n * @return Draw above series?\r\n */\n get: function get() {\n return this.getPropertyValue(\"above\");\n },\n\n /**\r\n * Normally tick goes below series. Set this to `true` to go above.\r\n *\r\n * @default false\r\n * @since 4.5.9\r\n * @param value Draw above series?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"above\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n AxisTick.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (this.axis) {\n this.axis.invalidateDataItems();\n }\n\n return changed;\n };\n\n return AxisTick;\n}(Tick);\n\nexport { AxisTick };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisTick\"] = AxisTick;","/**\r\n * Module, defining base Axis Renderer.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { MutableValueDisposer } from \"../../core/utils/Disposer\";\nimport { AxisDataItem } from \"./Axis\";\nimport { AxisLine } from \"./AxisLine\";\nimport { AxisFill } from \"./AxisFill\";\nimport { Grid } from \"./Grid\";\nimport { AxisLabel } from \"./AxisLabel\";\nimport { AxisTick } from \"./AxisTick\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { registry } from \"../../core/Registry\";\nimport { percent } from \"../../core/utils/Percent\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for all axis renderers.\r\n *\r\n * @see {@link IAxisRendererEvents} for a list of available events\r\n * @see {@link IAxisRendererAdapters} for a list of available Adapters\r\n */\n\nvar AxisRenderer =\n/** @class */\nfunction (_super) {\n __extends(AxisRenderer, _super);\n /**\r\n * Constructor.\r\n *\r\n * @param axis Related axis\r\n */\n\n\n function AxisRenderer() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * A related chart.\r\n */\n\n\n _this._chart = new MutableValueDisposer();\n _this.className = \"AxisRenderer\"; // Set defaults\n\n _this.minGridDistance = 50;\n _this.inside = false;\n _this.inversed = false;\n _this.tooltipLocation = 0.5;\n _this.fullWidthTooltip = false;\n _this.cellStartLocation = 0;\n _this.cellEndLocation = 1;\n _this.minLabelPosition = 0;\n _this.maxLabelPosition = 1;\n _this.shouldClone = false;\n\n var gridContainer = _this.createChild(Container);\n\n gridContainer.shouldClone = false;\n gridContainer.layout = \"none\"; //\tgridContainer.isMeasured = false;\n\n gridContainer.virtualParent = _this;\n gridContainer.width = percent(100);\n gridContainer.height = percent(100);\n _this.gridContainer = gridContainer; // not good without this\n\n gridContainer.events.on(\"maxsizechanged\", function () {\n if (_this.inited) {\n _this.invalidateAxisItems();\n }\n }, _this, false);\n\n var breakContainer = _this.createChild(Container);\n\n breakContainer.shouldClone = false;\n breakContainer.isMeasured = false;\n breakContainer.layout = \"none\";\n breakContainer.width = percent(100);\n breakContainer.height = percent(100);\n _this.breakContainer = breakContainer;\n\n var bulletsContainer = _this.createChild(Container);\n\n bulletsContainer.shouldClone = false;\n bulletsContainer.isMeasured = false;\n bulletsContainer.layout = \"none\";\n bulletsContainer.width = percent(100);\n bulletsContainer.height = percent(100);\n _this.bulletsContainer = bulletsContainer;\n _this.line = _this.createChild(AxisLine);\n _this.line.shouldClone = false;\n _this.line.strokeOpacity = 0;\n\n var baseGrid = _this.createChild(Grid);\n\n baseGrid.shouldClone = false;\n _this.baseGrid = baseGrid; // Make elements disposable\n\n var disposers = _this._disposers;\n disposers.push(baseGrid);\n disposers.push(_this.line);\n disposers.push(gridContainer);\n disposers.push(breakContainer);\n disposers.push(bulletsContainer);\n disposers.push(_this._chart);\n _this.ticks.template.disabled = true;\n _this.axisFills.template.disabled = true;\n _this.axisFills.template.interactionsEnabled = false; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(AxisRenderer.prototype, \"axis\", {\n /**\r\n * Axis of a renderer\r\n * @return axis Axis\r\n */\n get: function get() {\n return this._axis;\n },\n\n /**\r\n * Axis of a renderer\r\n * @param axis Axis\r\n */\n set: function set(axis) {\n this.setAxis(axis);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n AxisRenderer.prototype.setAxis = function (axis) {\n this._axis = axis;\n this.baseGrid.parent = axis;\n this.line.parent = axis;\n this.gridContainer.bind(\"opacity\", axis);\n };\n /**\r\n * Called when rendered is attached to an Axis, as well as a property of\r\n * Axis that might affect the appearance is updated.\r\n *\r\n * E.g. `axis.opposite`, `axis.inside`, etc.\r\n *\r\n * This method is called **before** draw, so that any related setting\r\n * changed in this method can be changed.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRenderer.prototype.processRenderer = function () {\n this.events.on(\"sizechanged\", this.updateTooltip, this, false);\n this.events.on(\"positionchanged\", this.updateTooltip, this, false);\n this.labels.template.inside = this.inside;\n this.ticks.template.inside = this.inside;\n };\n /**\r\n * Updates Axis' tooltip.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRenderer.prototype.updateTooltip = function () {// This is a placeholder method for extending classes to override.\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"axisLength\", {\n /**\r\n * Returns actual length of the Axis, in pixels.\r\n *\r\n * @return Length (px)\r\n */\n get: function get() {\n // This is a placeholder method for extending classes to override.\n return 0;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Re-positions an element to new coordinates.\r\n *\r\n * @ignore Exclude from docs\r\n * @param item A target element\r\n * @param point New coordinates\r\n */\n\n AxisRenderer.prototype.positionItem = function (item, point) {\n if (item) {\n item.moveTo(point);\n }\n };\n /**\r\n * Converts relative position on axis to point coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @return Point\r\n */\n\n\n AxisRenderer.prototype.positionToPoint = function (position, position2) {\n // This is a placeholder method for extending classes to override.\n return {\n x: 0,\n y: 0\n };\n };\n /**\r\n * Converts relative position on axis to angle.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review / units)\r\n * @param position Position (0-1)\r\n * @return Angle\r\n */\n\n\n AxisRenderer.prototype.positionToAngle = function (position) {\n // This is a placeholder method for extending classes to override.\n return 0;\n };\n /**\r\n * Converts relative position (0-1) on axis to a pixel coordinate.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinate (px)\r\n */\n\n\n AxisRenderer.prototype.positionToCoordinate = function (position) {\n var coordinate;\n var axis = this.axis;\n var axisFullLength = axis.axisFullLength;\n\n if (axis.renderer.inversed) {\n coordinate = (axis.end - position) * axisFullLength;\n } else {\n coordinate = (position - axis.start) * axisFullLength;\n }\n\n return coordinate;\n };\n\n AxisRenderer.prototype.updateGridContainer = function () {};\n\n AxisRenderer.prototype.getHeight = function () {\n var gridContainer = this.gridContainer;\n\n if (gridContainer.parent) {\n return gridContainer.parent.pixelHeight;\n }\n\n return this.gridContainer.pixelHeight || 0;\n };\n\n AxisRenderer.prototype.getWidth = function () {\n var gridContainer = this.gridContainer;\n\n if (gridContainer.parent) {\n return gridContainer.parent.pixelWidth;\n }\n\n return this.gridContainer.pixelWidth || 0;\n };\n /**\r\n * Converts a coordinate in pixels to a relative position. (0-1)\r\n *\r\n * @param coordinate Coordinate (px)\r\n * @param coordinate2 Coordinate of a second axis, only needed for complex axes systems, like timeline (px)\r\n * @return Position (0-1)\r\n */\n\n\n AxisRenderer.prototype.coordinateToPosition = function (coordinate, coordinate2) {\n var position;\n var axis = this.axis;\n var axisFullLength = axis.axisFullLength;\n\n if (axis.renderer.inversed) {\n position = axis.end - coordinate / axisFullLength;\n } else {\n position = coordinate / axisFullLength + axis.start;\n }\n\n return $math.round(position, 5);\n };\n /**\r\n * Converts a point at specific coordinates to a relative position (0-1)\r\n * on the axis.\r\n *\r\n * @ignore Exclude from docs\r\n * @param point Point\r\n * @return Position (0-1)\r\n */\n\n\n AxisRenderer.prototype.pointToPosition = function (point) {\n // This is a placeholder method for extending classes to override.\n return 0;\n };\n /**\r\n * [getPositionRangePath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param startPosition Starting position\r\n * @param endPosition End position\r\n * @return SVG path\r\n */\n\n\n AxisRenderer.prototype.getPositionRangePath = function (startPosition, endPosition) {\n return \"\";\n };\n /**\r\n * Invalidates all axis data items, effectively causing them re-evaluated.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n */\n\n\n AxisRenderer.prototype.invalidateAxisItems = function () {\n var axis = this.axis;\n\n if (axis) {\n axis.invalidateDataItems();\n }\n };\n /**\r\n * Updates and positions a grid element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param grid Grid element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRenderer.prototype.updateGridElement = function (grid, position, endPosition) {// This is a placeholder method for extending classes to override.\n };\n /**\r\n * Updates and positions a tick element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param tick Tick element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRenderer.prototype.updateTickElement = function (tick, position, endPosition) {// This is a placeholder method for extending classes to override.\n };\n /**\r\n * Updates and positions axis bullet.\r\n *\r\n * @ignore Exclude from docs\r\n * @param bullet AxisBullet element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRenderer.prototype.updateBullet = function (bullet, position, endPosition) {// This is a placeholder method for extending classes to override.\n };\n /**\r\n * Updates and positions a label element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param label Label element\r\n * @param position Starting position\r\n * @param endPosition Ending position\r\n */\n\n\n AxisRenderer.prototype.updateLabelElement = function (label, position, endPosition, location) {// This is a placeholder method for extending classes to override.\n };\n /**\r\n * Updates and positions the axis fill element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param fill Fill element\r\n * @param position Starting position\r\n * @param endPosition Ending position\r\n */\n\n\n AxisRenderer.prototype.updateFillElement = function (fill, position, endPosition) {\n fill.startPosition = position;\n fill.endPosition = endPosition;\n };\n /**\r\n * Updates and positions the axis line element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRenderer.prototype.updateAxisLine = function () {// This is a placeholder method for extending classes to override.\n };\n /**\r\n * Updates and positions the base grid element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRenderer.prototype.updateBaseGridElement = function () {// This is a placeholder method for extending classes to override.\n };\n /**\r\n * Updates and positions an axis break element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param axisBreak Break element\r\n */\n\n\n AxisRenderer.prototype.updateBreakElement = function (axisBreak) {\n this.positionItem(axisBreak.startLine, axisBreak.startPoint);\n this.toggleVisibility(axisBreak.startLine, axisBreak.startPosition, 0, 1);\n this.positionItem(axisBreak.endLine, axisBreak.endPoint);\n this.toggleVisibility(axisBreak.endLine, axisBreak.endPosition, 0, 1);\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"minGridDistance\", {\n /**\r\n * @return Min distance (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minGridDistance\");\n },\n\n /**\r\n * Minimum distance in pixels between grid elements.\r\n *\r\n * Use it to control density of the grid/labels on the axis.element.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/positioning-axis-elements/#Setting_the_density_of_the_the_grid_labels} for more info\r\n * @param value Min distance (px)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"minGridDistance\", value)) {\n if (this.axis) {\n this.axis.invalidateDataItems();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"chart\", {\n /**\r\n * @ignore Exclude from docs\r\n * @return Chart\r\n */\n get: function get() {\n return this._chart.get();\n },\n\n /**\r\n * A chart, associated with the Axis.\r\n *\r\n * @ignore Exclude from docs\r\n * @param value Chart\r\n */\n set: function set(value) {\n this._chart.set(value, null);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Toggles visibility of an element, based on its current position and\r\n * min/max position settings.\r\n *\r\n * E.g. labels based on `minLabelPosition` and `maxLabelPosition`.\r\n *\r\n * @ignore Exclude from docs\r\n * @param sprite An element to toggle\r\n * @param position Elements current position\r\n * @param minPosition Min position setting\r\n * @param maxPosition Max position setting\r\n */\n\n AxisRenderer.prototype.toggleVisibility = function (sprite, position, minPosition, maxPosition) {\n var axis = this.axis;\n var dataItem = sprite.dataItem;\n\n if (dataItem && dataItem instanceof AxisDataItem) {\n if ($type.isNumber(dataItem.minPosition)) {\n minPosition = dataItem.minPosition;\n }\n\n if ($type.isNumber(dataItem.maxPosition)) {\n maxPosition = dataItem.maxPosition;\n }\n }\n\n var updatedStart = axis.start + (axis.end - axis.start) * (minPosition - 0.0001);\n var updatedEnd = axis.start + (axis.end - axis.start) * (maxPosition + 0.0001);\n\n if (!sprite.disabled) {\n if (position < updatedStart || position > updatedEnd) {\n sprite.__disabled = true;\n } else {\n sprite.__disabled = false;\n }\n }\n };\n /**\r\n * Creates visual elements for and axis break.\r\n *\r\n * @ignore Exclude from docs\r\n * @param axisBreak Axis break\r\n */\n\n\n AxisRenderer.prototype.createBreakSprites = function (axisBreak) {// This is a placeholder method for extending classes to override.\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"axisFills\", {\n /**\r\n * A list of Axis' Fill elements.\r\n *\r\n * Those are fill elements that cover the space between every second set\r\n * of grid lines, and can be configured to create striped charts.\r\n *\r\n * Please note that these are disabled by default. To enable them, set\r\n * template to true.\r\n *\r\n * ```TypeScript\r\n * categoryAxis.renderer.axisFills.template.disabled = false;\r\n * ```\r\n * ```JavaScript\r\n * categoryAxis.renderer.axisFills.template.disabled = false;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"xAxes\": [{\r\n * // ...\r\n * \"renderer\": {\r\n * \"axisFills\": {\r\n * \"disabled\": false\r\n * }\r\n * }\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/tutorials/alternated-axis-fills/} this tutorial for more info.\r\n * @return Fill elements\r\n */\n get: function get() {\n if (!this._axisFills) {\n var fill = this.createFill(this.axis);\n this._axisFills = new ListTemplate(fill);\n fill.applyOnClones = true;\n fill.events.on(\"enabled\", this.invalidateAxisItems, this, false);\n\n this._disposers.push(new ListDisposer(this._axisFills));\n\n this._disposers.push(this._axisFills.template);\n }\n\n return this._axisFills;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a new fill element, suitable for this Axis Renderer type.\r\n *\r\n * @return Fill element\r\n */\n\n AxisRenderer.prototype.createFill = function (axis) {\n return new AxisFill(axis);\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"grid\", {\n /**\r\n * A list of Axis' Grid elements.\r\n *\r\n * @return Grid elements\r\n */\n get: function get() {\n if (!this._grid) {\n var grid = this.createGrid();\n this._grid = new ListTemplate(grid);\n grid.applyOnClones = true;\n grid.events.on(\"enabled\", this.invalidateAxisItems, this, false);\n\n this._disposers.push(new ListDisposer(this._grid));\n\n this._disposers.push(this._grid.template);\n }\n\n return this._grid;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a new grid element, suitable for this Axis Renderer type.\r\n *\r\n * @return Grid element\r\n */\n\n AxisRenderer.prototype.createGrid = function () {\n return new Grid();\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"ticks\", {\n /**\r\n * A list of Axis' Tick elements.\r\n *\r\n * Please note that these are disabled by default. To enable ticks, you'll\r\n * need to set `disabled` and `strokeOpacity` properties of the tick template.\r\n *\r\n * ```TypeScript\r\n * categoryAxis.renderer.ticks.template.disabled = false;\r\n * categoryAxis.renderer.ticks.template.strokeOpacity = 0.5;\r\n * ```\r\n * ```JavaScript\r\n * categoryAxis.renderer.ticks.template.disabled = false;\r\n * categoryAxis.renderer.ticks.template.strokeOpacity = 0.5;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"xAxes\": [{\r\n * // ...\r\n * \"renderer\": {\r\n * \"ticks\": {\r\n * \"disabled\": false,\r\n * \"strokeOpacity\": 0.5\r\n * }\r\n * }\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @return Tick elements\r\n */\n get: function get() {\n if (!this._ticks) {\n var tick = this.createTick();\n tick.applyOnClones = true;\n tick.isMeasured = false;\n tick.events.on(\"enabled\", this.invalidateAxisItems, this, false);\n this._ticks = new ListTemplate(tick);\n\n this._disposers.push(new ListDisposer(this._ticks));\n\n this._disposers.push(this._ticks.template);\n }\n\n return this._ticks;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a new tick element, suitable for this Axis Renderer type.\r\n *\r\n * @return Tick element\r\n */\n\n AxisRenderer.prototype.createTick = function () {\n return new AxisTick();\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"labels\", {\n /**\r\n * A list of Axis' Label elements.\r\n *\r\n * @return Label elements\r\n */\n get: function get() {\n if (!this._labels) {\n var label = this.createLabel();\n this._labels = new ListTemplate(label);\n label.applyOnClones = true;\n label.events.on(\"enabled\", this.invalidateAxisItems, this, false);\n\n this._disposers.push(new ListDisposer(this._labels));\n\n this._disposers.push(this._labels.template);\n }\n\n return this._labels;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a new label element, suitable for this Axis Renderer type.\r\n *\r\n * @return Label element\r\n */\n\n AxisRenderer.prototype.createLabel = function () {\n return new AxisLabel();\n };\n\n Object.defineProperty(AxisRenderer.prototype, \"inside\", {\n /**\r\n * @return Labels inside?\r\n */\n get: function get() {\n return this.getPropertyValue(\"inside\");\n },\n\n /**\r\n * Indicates whether Axis' labels and ticks should be drawn inside Plot area.\r\n *\r\n * Does not work with all renderers, like AxisRendererRadial.\r\n *\r\n * @param value Labels inside?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"inside\", value)) {\n if (this.axis) {\n this.axis.invalidate();\n }\n }\n\n if (value) {\n this.width = 0;\n this.height = 0;\n } else {\n this.width = undefined;\n this.height = undefined;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"opposite\", {\n /**\r\n * @return Draw axis on opposite side?\r\n */\n get: function get() {\n return this.getPropertyValue(\"opposite\");\n },\n\n /**\r\n * Indicates whether Axis should be drawn on the opposite side of the plot\r\n * area than it would normally be drawn based on chart's settings.\r\n *\r\n * Does not work with all renderers, like [[AxisRendererRadial]] and\r\n * [[AxisRenderer Circular].\r\n *\r\n * @param value Draw axis on opposite side?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"opposite\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"fullWidthTooltip\", {\n /**\r\n * @return Full width tooltip?\r\n */\n get: function get() {\n return this.getPropertyValue(\"fullWidthTooltip\");\n },\n\n /**\r\n * Indicates if Axis tooltip should take the whole width of the axis cell.\r\n * (between two grid lines)\r\n *\r\n * NOTE: this setting is ignored on circular axis types.\r\n *\r\n * @param value Full width tooltip?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"fullWidthTooltip\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"tooltipLocation\", {\n /**\r\n * @return Tooltip location\r\n */\n get: function get() {\n return this.getPropertyValue(\"tooltipLocation\");\n },\n\n /**\r\n * Location within axis cell to show tooltip on. (0-1)\r\n *\r\n * 0 - show at the start\r\n * 0.5 - show right in the middle\r\n * 1 - show at the end\r\n *\r\n * @param value Tooltip location\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tooltipLocation\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"tooltipLocation2\", {\n /**\r\n * @return Tooltip location\r\n */\n get: function get() {\n return this.getPropertyValue(\"tooltipLocation2\");\n },\n\n /**\r\n * Location within secondary axis cell to show tooltip on. (0-1)\r\n *\r\n * 0 - show at the start\r\n * 0.5 - show right in the middle\r\n * 1 - show at the end\r\n *\r\n * @param value Tooltip location\r\n */\n set: function set(value) {\n this.setPropertyValue(\"tooltipLocation2\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"cellStartLocation\", {\n /**\r\n * @return Cell start (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cellStartLocation\");\n },\n\n /**\r\n * Location for the cell start.\r\n *\r\n * Normally a \"cell\" is the whole available width in a category.\r\n *\r\n * If there are several clustered column-like series available, the whole\r\n * space is divided between each clustered column, or column stacks.\r\n *\r\n * `cellStartLocation` identifies where, within available space, the actual\r\n * cell starts.\r\n *\r\n * This, together with column series' `width` will affect actual width of\r\n * columns, and thus gaps between them.\r\n *\r\n * This will affect category-like axes only, like [[DateAxis]], or\r\n * [[CategoryAxis]].\r\n *\r\n * This is used to limit a space occupied by series like column.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/positioning-axis-elements/} for more info.\r\n * @param value Cell start (0-1)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"cellStartLocation\", value)) {\n if (this.axis) {\n this.axis.invalidateSeries();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"cellEndLocation\", {\n /**\r\n * @return Cell end (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"cellEndLocation\");\n },\n\n /**\r\n * Location for the cell end.\r\n *\r\n * Normally a \"cell\" is the whole available width in a category.\r\n *\r\n * If there are several clustered column-like series available, the whole\r\n * space is divided between each clustered column, or column stacks.\r\n *\r\n * `cellEndLocation` identifies where, within available space, the actual\r\n * cell ends.\r\n *\r\n * This, together with column series' `width` will affect actual width of\r\n * columns, and thus gaps between them.\r\n *\r\n * This will affect category-like axes only, like [[DateAxis]], or\r\n * [[CategoryAxis]].\r\n *\r\n * This is used to limit a space occupied by series like column.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/positioning-axis-elements/} for more info.\r\n * @param value Cell end (0-1)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"cellEndLocation\", value)) {\n if (this.axis) {\n this.axis.invalidateSeries();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"inversed\", {\n /**\r\n * @return Flip axis?\r\n */\n get: function get() {\n return this.getPropertyValue(\"inversed\");\n },\n\n /**\r\n * Indicates if the scale of the axis should be flipped.\r\n *\r\n * @param value Flip axis?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"inversed\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"minLabelPosition\", {\n /**\r\n * @return Min label position (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minLabelPosition\");\n },\n\n /**\r\n * Minimum position along the Axis, for labels.\r\n *\r\n * Labels, which have their position closer to the start of the Axis, will be\r\n * automatically hidden.\r\n *\r\n * E.g., setting this to 0.05 (5% of total axis length) would hide labels,\r\n * that would otherwise be drawn very near start of the Axis.\r\n *\r\n * This is especially usefull with `inside = true`, or if the chart hasn't\r\n * got any extra margins.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/positioning-axis-elements/} for more info.\r\n * @param value Min label position (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"minLabelPosition\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AxisRenderer.prototype, \"maxLabelPosition\", {\n /**\r\n * @return Max label position (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxLabelPosition\");\n },\n\n /**\r\n * Maximum position along the Axis, for labels.\r\n *\r\n * Labels, which have their position closer to the and of the Axis, will be\r\n * automatically hidden.\r\n *\r\n * E.g., setting this to 0.95 (95% of total axis length) would hide labels,\r\n * that would otherwise be drawn very near end of the Axis.\r\n *\r\n * This is especially usefull with `inside = true`, or if the chart hasn't\r\n * got any extra margins.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/positioning-axis-elements/} for more info.\r\n * @param value Max label position (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"maxLabelPosition\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies all settings and related items from another object of the same\r\n * type.\r\n *\r\n * @param source Source object\r\n */\n\n AxisRenderer.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.grid.template.copyFrom(source.grid.template);\n this.ticks.template.copyFrom(source.ticks.template);\n this.labels.template.copyFrom(source.labels.template);\n this.axisFills.template.copyFrom(source.axisFills.template);\n this.line.copyFrom(source.line);\n this.baseGrid.copyFrom(source.baseGrid);\n };\n /**\r\n * @ignore\r\n */\n\n\n AxisRenderer.prototype.toAxisPosition = function (value) {\n return value;\n };\n /**\r\n * Sets `visibility` property:\r\n *\r\n * * `true` - visible\r\n * * `false` - hidden\r\n *\r\n * @param value true - visible, false - hidden\r\n * @return Current visibility\r\n */\n\n\n AxisRenderer.prototype.setVisibility = function (value) {\n _super.prototype.setVisibility.call(this, value);\n\n this.bulletsContainer.visible = value;\n };\n\n return AxisRenderer;\n}(Container);\n\nexport { AxisRenderer };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisRenderer\"] = AxisRenderer;","/**\r\n * Axis Bullet module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a positioned bullet (element) on an Axis.\r\n *\r\n * ```TypeScript\r\n * let range = dateAxis.axisRanges.create();\r\n * range.date = new Date(2018, 0, 5);\r\n *\r\n * let flag = new am4plugins_bullets.FlagBullet();\r\n * flag.label.text = \"Hello\";\r\n *\r\n * range.bullet = flag;\r\n * ```\r\n * ```JavaScript\r\n * var range = dateAxis.axisRanges.create();\r\n * range.date = new Date(2018, 0, 5);\r\n *\r\n * var flag = new am4plugins_bullets.FlagBullet();\r\n * flag.label.text = \"Hello\";\r\n *\r\n * range.bullet = flag;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"xAxes\": [{\r\n * \"type\": \"DateAxis\",\r\n * // ...\r\n * \"axisRanges\": [{\r\n * \"date\": new Date(2018, 0, 5),\r\n * \"bullet: {\r\n * \"type\": \"FlagBullet\",\r\n * \"label\": {\r\n * \"text\": \"Hello\"\r\n * }\r\n * }\r\n * }]\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @since 4.5.9\r\n * @see {@link IAxisBulletEvents} for a list of available events\r\n * @see {@link IAxisBulletAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar AxisBullet =\n/** @class */\nfunction (_super) {\n __extends(AxisBullet, _super);\n\n function AxisBullet() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisBullet\";\n _this.location = 0.5;\n _this.isMeasured = false;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(AxisBullet.prototype, \"location\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"location\");\n },\n\n /**\r\n * Relative position within cell/range.\r\n *\r\n * Value range is from from `0` (beginning) to `1` (end).\r\n *\r\n * NOTE: `location` is relative to the parent axis range's scope, i.e.\r\n * between its `date` and `endDate` for [[DateAxis]], or `value`/`endValue`\r\n * ([[ValueAxis]]), or `category`/`endCategory` ([[categoryAxis]]).\r\n *\r\n * ```TypeScript\r\n * let range = dateAxis.axisRanges.create();\r\n * range.date = new Date(2018, 0, 5);\r\n * range.endDate = new Date(2018, 0, 6);\r\n *\r\n * let bullet = new am4charts.AxisBullet();\r\n * bullet.location = 1;\r\n *\r\n * let flag = bullet.createChild(am4plugins_bullets.FlagBullet);\r\n * flag.label.text = \"Hello\";\r\n * ```\r\n * ```JavaScript\r\n * var range = dateAxis.axisRanges.create();\r\n * range.date = new Date(2018, 0, 5);\r\n * range.endDate = new Date(2018, 0, 6);\r\n *\r\n * var bullet = new am4charts.AxisBullet();\r\n * bullet.location = 1;\r\n *\r\n * var flag = bullet.createChild(am4plugins_bullets.FlagBullet);\r\n * flag.label.text = \"Hello\";\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"xAxes\": [{\r\n * \"type\": \"DateAxis\",\r\n * // ...\r\n * \"axisRanges\": [{\r\n * \"date\": new Date(2018, 0, 5),\r\n * \"endDate\": new Date(2018, 0, 6),\r\n * \"bullet: {\r\n * \"type\": \"AxisBullet\",\r\n * \"location\": 1,\r\n * \"children\": [{\r\n * \"type\": \"FlagBullet\",\r\n * \"label\": {\r\n * \"text\": \"Hello\"\r\n * }\r\n * }]\r\n * }\r\n * }]\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @default 0.5\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"location\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n AxisBullet.prototype.setDisabled = function (value) {\n var changed = _super.prototype.setDisabled.call(this, value);\n\n if (this.axis) {\n this.axis.invalidateDataItems();\n }\n\n return changed;\n };\n\n return AxisBullet;\n}(Container);\n\nexport { AxisBullet };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisBullet\"] = AxisBullet;","/**\r\n * Module, defining Axis Renderer for vertical axes.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { AxisRenderer } from \"./AxisRenderer\";\nimport { WavedLine } from \"../../core/elements/WavedLine\";\nimport { WavedRectangle } from \"../../core/elements/WavedRectangle\";\nimport { registry } from \"../../core/Registry\";\nimport { percent, Percent } from \"../../core/utils/Percent\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $path from \"../../core/rendering/Path\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $type from \"../../core/utils/Type\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../../core/utils/Responsive\";\nimport { AxisBullet } from \"./AxisBullet\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A renderer for vertical axis.\r\n *\r\n * @see {@link IAxisRendererYEvents} for a list of available events\r\n * @see {@link IAxisRendererYAdapters} for a list of available Adapters\r\n */\n\nvar AxisRendererY =\n/** @class */\nfunction (_super) {\n __extends(AxisRendererY, _super);\n /**\r\n * Constructor.\r\n *\r\n * @param axis Related axis\r\n */\n\n\n function AxisRendererY() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisRendererY\";\n _this.minGridDistance = 40;\n _this.opposite = false;\n _this.height = percent(100);\n _this.labels.template.verticalCenter = \"middle\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n AxisRendererY.prototype.setAxis = function (axis) {\n _super.prototype.setAxis.call(this, axis);\n\n axis.layout = \"horizontal\";\n };\n /**\r\n * @ignore\r\n */\n\n\n AxisRendererY.prototype.updateGridContainer = function () {\n var axis = this.axis;\n\n if (axis) {\n var gridContainer = this.gridContainer;\n gridContainer.y = axis.pixelY;\n gridContainer.height = axis.axisLength;\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n AxisRendererY.prototype.toAxisPosition = function (value) {\n var axis = this.axis;\n\n if (axis) {\n var inversedPosition = 1 - value;\n var relativePositionSprite = axis.relativePositionSprite;\n var y = axis.pixelY;\n\n if (relativePositionSprite) {\n y = $utils.spritePointToSprite({\n x: 0,\n y: this.pixelY\n }, this.parent, relativePositionSprite).y;\n } else {\n relativePositionSprite = axis.parent;\n }\n\n if (relativePositionSprite) {\n var relativeY = y / relativePositionSprite.innerHeight;\n var relativeHeight = axis.axisLength / relativePositionSprite.innerHeight;\n return 1 - (inversedPosition - relativeY) / relativeHeight;\n }\n }\n\n return value;\n };\n /**\r\n * Called when rendered is attached to an Axis, as well as a property of\r\n * Axis that might affect the appearance is updated.\r\n *\r\n * E.g. `axis.opposite`, `axis.inside`, etc.\r\n *\r\n * This method is called **before** draw, so that any related setting\r\n * changed in this method can be changed.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererY.prototype.processRenderer = function () {\n _super.prototype.processRenderer.call(this);\n\n var axis = this.axis;\n\n if (axis) {\n var title = axis.title;\n title.valign = \"middle\";\n\n if (!(axis.height instanceof Percent)) {\n axis.height = percent(100);\n }\n\n if (this.opposite) {\n title.rotation = 90;\n this.line.toBack();\n title.toFront();\n } else {\n title.rotation = -90;\n title.toBack();\n this.line.toFront();\n }\n }\n };\n /**\r\n * Updates some of the Axis tooltip's visual properties, related to\r\n * rendering of the Axis.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererY.prototype.updateTooltip = function () {\n var axis = this.axis;\n\n if (axis) {\n var bigNum = 2000;\n var bbx = 0;\n var bby = 0;\n var bbw = bigNum;\n var bbh = this.axisLength; // right\n\n if (this.opposite) {\n if (this.inside) {\n bbx = -bigNum;\n bbw = bigNum;\n }\n } // left\n else {\n if (!this.inside) {\n bbx = -bigNum;\n bbw = bigNum;\n }\n }\n\n this.axis.updateTooltip(\"horizontal\", {\n x: bbx,\n y: bby,\n width: bbw,\n height: bbh\n });\n }\n };\n\n Object.defineProperty(AxisRendererY.prototype, \"axisLength\", {\n /**\r\n * Returns actual length of the Axis, in pixels.\r\n *\r\n * @return Length (px)\r\n */\n get: function get() {\n var axis = this.axis;\n return axis.measuredHeight - axis.pixelPaddingTop - axis.pixelPaddingBottom || 0;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts relative position on axis to point coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @param position2 Position (0-1) Position on the second axis\r\n * @return Point\r\n */\n\n AxisRendererY.prototype.positionToPoint = function (position, position2) {\n return {\n x: 0,\n y: this.positionToCoordinate(position)\n };\n };\n /**\r\n * Converts a point at specific coordinates to a relative position (0-1)\r\n * on the axis.\r\n *\r\n * @param point Point\r\n * @return Position (0-1)\r\n */\n\n\n AxisRendererY.prototype.pointToPosition = function (point) {\n return this.coordinateToPosition(point.y, point.x);\n };\n /**\r\n * Converts a coordinate in pixels to a relative position. (0-1)\r\n *\r\n * @param coordinate Coordinate (px)\r\n * @param coordinate2 Coordinate of a second axis, only needed for complex axes systems, like timeline (px)\r\n * @return Position (0-1)\r\n */\n\n\n AxisRendererY.prototype.coordinateToPosition = function (coordinate, coordinate2) {\n var position;\n var axis = this.axis;\n var axisFullLength = axis.axisFullLength;\n\n if (axis.renderer.inversed) {\n position = 1 - axis.start - coordinate / axisFullLength;\n } else {\n position = coordinate / axisFullLength + (1 - axis.end);\n }\n\n return $math.round(position, 5);\n };\n /**\r\n * [getPositionRangePath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param startPosition Starting position\r\n * @param endPosition End position\r\n * @return SVG path\r\n */\n\n\n AxisRendererY.prototype.getPositionRangePath = function (startPosition, endPosition) {\n var y1 = $math.fitToRange(this.positionToCoordinate(startPosition), 0, this.axisLength);\n var y2 = $math.fitToRange(this.positionToCoordinate(endPosition), 0, this.axisLength);\n var h = Math.abs(y2 - y1);\n var w = this.getWidth();\n var y = Math.min(y1, y2);\n var x = 0;\n return $path.rectToPath({\n x: x,\n y: y,\n width: w,\n height: h\n }, true);\n };\n /**\r\n * Updates and positions a grid element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param grid Grid element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRendererY.prototype.updateGridElement = function (grid, position, endPosition) {\n position = position + (endPosition - position) * grid.location;\n var point = this.positionToPoint(position); //\tpoint.y = $utils.spritePointToSprite({ x: 0, y: point.y }, this, this.gridContainer).y;\n\n grid.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: this.getWidth(),\n y: 0\n });\n this.positionItem(grid, point);\n this.toggleVisibility(grid, position, 0, 1);\n };\n /**\r\n * Updates and positions a tick element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param tick Tick element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRendererY.prototype.updateTickElement = function (tick, position, endPosition) {\n position = position + (endPosition - position) * tick.location;\n var point = this.positionToPoint(position);\n var tickLength = tick.length;\n\n try {\n $utils.used(this.axis.title.measuredWidth);\n } catch (_a) {// void\n }\n\n point.x = $utils.spritePointToSprite({\n x: this.line.pixelX,\n y: 0\n }, this.line.parent, this.gridContainer).x;\n\n if (!this.opposite) {\n tickLength *= tick.inside ? 1 : -1;\n } else {\n tickLength *= tick.inside ? -1 : 1;\n }\n\n tick.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: tickLength,\n y: 0\n });\n this.positionItem(tick, point);\n this.toggleVisibility(tick, position, 0, 1);\n };\n /**\r\n * Updates and positions the axis line element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererY.prototype.updateAxisLine = function () {\n this.line.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: 0,\n y: this.axisLength\n });\n };\n /**\r\n * Updates and positions the base grid element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererY.prototype.updateBaseGridElement = function () {\n _super.prototype.updateBaseGridElement.call(this);\n\n var axis = this.axis;\n var w = this.getWidth();\n var h = this.axisLength;\n var y = axis.basePoint.y;\n var baseGrid = this.baseGrid;\n\n if (y < -0.2 || y > h + 0.2) {\n baseGrid.hide(0);\n } else {\n var x = $utils.spritePointToSprite({\n x: 0,\n y: 0\n }, this.gridContainer, baseGrid.parent).x;\n baseGrid.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: w,\n y: 0\n });\n baseGrid.moveTo({\n x: x,\n y: y\n });\n baseGrid.show(0);\n }\n };\n /**\r\n * Updates and positions a label element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param label Label element\r\n * @param position Starting position\r\n * @param endPosition Ending position\r\n */\n\n\n AxisRendererY.prototype.updateLabelElement = function (label, position, endPosition, location) {\n if (!$type.hasValue(location)) {\n location = label.location;\n }\n\n position = position + (endPosition - position) * location;\n label.isMeasured = !label.inside;\n var point = this.positionToPoint(position);\n var horizontalCenter;\n var deltaX = 0;\n var maxWidth = this.gridContainer.maxWidth;\n\n if (this.opposite) {\n if (label.inside) {\n horizontalCenter = \"right\";\n\n if (label.align == \"left\") {\n deltaX = -maxWidth;\n horizontalCenter = \"left\";\n }\n\n if (label.align == \"center\") {\n deltaX = -maxWidth / 2;\n horizontalCenter = \"middle\";\n }\n } else {\n horizontalCenter = \"left\";\n }\n\n point.x = 0 + deltaX;\n } else {\n if (label.inside) {\n horizontalCenter = \"left\";\n\n if (label.align == \"right\") {\n deltaX = maxWidth;\n horizontalCenter = \"right\";\n }\n\n if (label.align == \"center\") {\n deltaX = maxWidth / 2;\n horizontalCenter = \"middle\";\n }\n } else {\n horizontalCenter = \"right\";\n }\n\n point.x = this.measuredWidth + deltaX;\n }\n\n if (label.rotation == 0) {\n // Apply fuzzy logic to verticalCenter only if labels are not rotated\n label.horizontalCenter = horizontalCenter;\n }\n\n this.positionItem(label, point);\n this.toggleVisibility(label, position, this.minLabelPosition, this.maxLabelPosition);\n };\n /**\r\n * Updates and positions an axis break element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param axisBreak Break element\r\n */\n\n\n AxisRendererY.prototype.updateBreakElement = function (axisBreak) {\n _super.prototype.updateBreakElement.call(this, axisBreak);\n\n var startLine = axisBreak.startLine;\n var endLine = axisBreak.endLine;\n var fillShape = axisBreak.fillShape;\n var startPoint = axisBreak.startPoint;\n var endPoint = axisBreak.endPoint;\n var x1 = axisBreak.pixelMarginLeft;\n var x2 = this.getWidth() - axisBreak.pixelMarginLeft - axisBreak.pixelMarginRight;\n startPoint.y = $math.fitToRange(startPoint.y, -1, this.axisLength + 1);\n endPoint.y = $math.fitToRange(endPoint.y, -1, this.axisLength + 1);\n\n if (startPoint.y == endPoint.y && (startPoint.y < 0 || startPoint.y > this.axisLength)) {\n axisBreak.fillShape.__disabled = true;\n } else {\n axisBreak.fillShape.__disabled = false;\n }\n\n var w = Math.abs(x2 - x1);\n startLine.x = x1;\n startLine.height = 0;\n startLine.width = w;\n endLine.x = x1;\n endLine.height = 0;\n endLine.width = w;\n fillShape.width = w;\n fillShape.height = Math.abs(endPoint.y - startPoint.y);\n fillShape.x = x1;\n fillShape.y = endPoint.y;\n };\n /**\r\n * Creates visual elements for and axis break.\r\n *\r\n * @ignore Exclude from docs\r\n * @param axisBreak Axis break\r\n */\n\n\n AxisRendererY.prototype.createBreakSprites = function (axisBreak) {\n axisBreak.startLine = new WavedLine();\n axisBreak.endLine = new WavedLine();\n var wavedRectangle = new WavedRectangle();\n wavedRectangle.setWavedSides(true, false, true, false);\n axisBreak.fillShape = wavedRectangle;\n };\n /**\r\n * Converts a position on the axis to a coordinate in pixels.\r\n *\r\n * @ignore Exclude from docs\r\n * @param position Position (0-1)\r\n * @return Coordinate (px)\r\n */\n\n\n AxisRendererY.prototype.positionToCoordinate = function (position) {\n var coordinate;\n var axis = this.axis;\n var axisFullLength = axis.axisFullLength;\n\n if (!axis.renderer.inversed) {\n coordinate = (axis.end - position) * axisFullLength;\n } else {\n coordinate = (position - axis.start) * axisFullLength;\n }\n\n return coordinate;\n };\n /**\r\n * Updates and positions axis bullets.\r\n *\r\n * @ignore Exclude from docs\r\n * @param bullet AxisBullet element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRendererY.prototype.updateBullet = function (bullet, position, endPosition) {\n var location = 0.5;\n\n if (bullet instanceof AxisBullet) {\n location = bullet.location;\n }\n\n position = position + (endPosition - position) * location;\n var point = this.positionToPoint(position);\n point.x = $utils.spritePointToSprite({\n x: this.line.pixelX,\n y: 0\n }, this.line.parent, this.gridContainer).x;\n this.positionItem(bullet, point);\n this.toggleVisibility(bullet, position, 0, 1);\n };\n\n return AxisRendererY;\n}(AxisRenderer);\n\nexport { AxisRendererY };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisRendererY\"] = AxisRendererY;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Put labels inside plot area.\r\n * Disable first and last labels.\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.widthS,\n state: function state(target, stateId) {\n if (target instanceof AxisRendererY) {\n var state = target.states.create(stateId);\n state.properties.inside = true;\n state.properties.maxLabelPosition = 0.9;\n state.properties.minLabelPosition = 0.1;\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Disable labels altogather on very small charts\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.widthXS,\n state: function state(target, stateId) {\n if (target instanceof AxisRendererY) {\n var state = target.states.create(stateId);\n state.properties.disabled = true;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * A module which defines functionality related to Value Axis Break.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { AxisBreak } from \"./AxisBreak\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Base class to define \"breaks\" on value axis.\r\n *\r\n * A \"break\" can be used to \"cut out\" specific ranges of the axis scale, e.g.\r\n * when comparing columns with relatively similar values, it would make sense\r\n * to cut out their mid section, so that their tip differences are more\r\n * prominent.\r\n *\r\n * @see {@link IValueAxisBreakEvents} for a list of available events\r\n * @see {@link IValueAxisBreakAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar ValueAxisBreak =\n/** @class */\nfunction (_super) {\n __extends(ValueAxisBreak, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ValueAxisBreak() {\n var _this = _super.call(this) || this;\n\n _this.className = \"ValueAxisBreak\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(ValueAxisBreak.prototype, \"startPosition\", {\n /**\r\n * Pixel position of the break's start.\r\n *\r\n * @return Position (px)\r\n * @readonly\r\n */\n get: function get() {\n if (this.axis) {\n return this.axis.valueToPosition(this.adjustedStartValue);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxisBreak.prototype, \"endPosition\", {\n /**\r\n * Pixel position of the break's end.\r\n *\r\n * @return Position (px)\r\n * @readonly\r\n */\n get: function get() {\n if (this.axis) {\n return this.axis.valueToPosition(this.adjustedEndValue);\n }\n },\n enumerable: true,\n configurable: true\n });\n return ValueAxisBreak;\n}(AxisBreak);\n\nexport { ValueAxisBreak };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ValueAxisBreak\"] = ValueAxisBreak;","/**\r\n * Value Axis module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Axis, AxisDataItem } from \"./Axis\";\nimport { AxisRendererY } from \"./AxisRendererY\";\nimport { MultiDisposer } from \"../../core/utils/Disposer\";\nimport { registry } from \"../../core/Registry\";\nimport { ValueAxisBreak } from \"./ValueAxisBreak\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $object from \"../../core/utils/Object\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $utils from \"../../core/utils/Utils\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[ValueAxis]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar ValueAxisDataItem =\n/** @class */\nfunction (_super) {\n __extends(ValueAxisDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ValueAxisDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"ValueAxisDataItem\";\n _this.values.value = {};\n _this.values.endValue = {};\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(ValueAxisDataItem.prototype, \"value\", {\n /**\r\n * @return Value\r\n */\n get: function get() {\n return this.values[\"value\"].value;\n },\n\n /**\r\n * A data point's numeric value.\r\n *\r\n * @param value Value\r\n */\n set: function set(value) {\n this.setValue(\"value\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxisDataItem.prototype, \"endValue\", {\n /**\r\n * @return Value\r\n */\n get: function get() {\n return this.values[\"endValue\"].value;\n },\n\n /**\r\n * Data point's numeric end value.\r\n *\r\n * @param value End value\r\n */\n set: function set(value) {\n this.setValue(\"endValue\", value);\n },\n enumerable: true,\n configurable: true\n });\n return ValueAxisDataItem;\n}(AxisDataItem);\n\nexport { ValueAxisDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to create a value axis for the chart.\r\n *\r\n * ```TypeScript\r\n * // Create the axis\r\n * let valueAxis = chart.yAxes.push(new am4charts.ValueAxis());\r\n *\r\n * // Set settings\r\n * valueAxis.title.text = \"Monthly Sales\";\r\n * ```\r\n * ```JavaScript\r\n * // Create the axis\r\n * var valueAxis = chart.yAxes.push(new am4charts.ValueAxis());\r\n *\r\n * // Set settings\r\n * valueAxis.title.text = \"Monthly Sales\";\r\n * ```\r\n * ```JSON\r\n * \"yAxes\": [{\r\n * \"type\": \"ValueAxis\",\r\n * \"title\": {\r\n * \"text\": \"Monthly Sales\"\r\n * }\r\n * }]\r\n * ```\r\n *\r\n * @see {@link IValueAxisEvents} for a list of available Events\r\n * @see {@link IValueAxisAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar ValueAxis =\n/** @class */\nfunction (_super) {\n __extends(ValueAxis, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ValueAxis() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * [_stepDecimalPlaces description]\r\n *\r\n * @todo Description\r\n */\n\n\n _this._stepDecimalPlaces = 0;\n _this._prevStepDecimalPlaces = 0;\n _this._adjustLabelPrecision = true;\n /**\r\n * Base value for the axis.\r\n */\n\n _this._baseValue = 0;\n /**\r\n * Adjusted start in case we have breaks.\r\n *\r\n * @todo Description\r\n */\n\n _this._adjustedStart = 0;\n /**\r\n * Adjusted end in case we have breaks.\r\n *\r\n * @todo Description\r\n */\n\n _this._adjustedEnd = 1;\n _this._extremesChanged = false;\n _this._deltaMinMax = 1;\n _this._dsc = false;\n /**\r\n * As calculating totals is expensive operation and not often needed, we\r\n * don't do it by default.\r\n *\r\n * In case you use `totalPercent` or `total` in your charts, this must be set\r\n * to `true`.\r\n *\r\n * @default false\r\n * @see {@link https://www.amcharts.com/docs/v4/chart-types/xy-chart/#100_stacks} For using `calculateTotals` for 100% stacked series.\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/formatters/formatting-strings/#Placeholders_for_numeric_values} For using `calculateTotals` in labels.\r\n */\n\n _this.calculateTotals = false;\n _this.className = \"ValueAxis\"; // Set field name\n\n _this.axisFieldName = \"value\"; // Set defaults\n\n _this.setPropertyValue(\"maxZoomFactor\", 1000);\n\n _this.setPropertyValue(\"extraMin\", 0);\n\n _this.setPropertyValue(\"extraMax\", 0);\n\n _this.setPropertyValue(\"strictMinMax\", false);\n\n _this.setPropertyValue(\"maxPrecision\", Number.MAX_VALUE);\n\n _this.setPropertyValue(\"adjustLabelPrecision\", true);\n\n _this.setPropertyValue(\"extraTooltipPrecision\", 0);\n\n _this.keepSelection = false;\n _this.includeRangesInMinMax = false; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Holds reference to a function that accepts a DataItem as parameter.\r\n *\r\n * It can either return a fill opacity for a fill, or manipulate data item\r\n * directly, to create various highlighting scenarios.\r\n */\n\n\n ValueAxis.prototype.fillRule = function (dataItem) {\n var value = dataItem.value;\n var axis = dataItem.component;\n\n if (!dataItem.axisFill.disabled) {\n // rounding in left to solve floating point number\n if ($math.round(value / axis.step / 2, 5) == Math.round(value / axis.step / 2)) {\n dataItem.axisFill.__disabled = true;\n } else {\n dataItem.axisFill.__disabled = false;\n }\n }\n };\n /**\r\n * Returns a new/empty [[DataItem]] of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n ValueAxis.prototype.createDataItem = function () {\n return new ValueAxisDataItem();\n };\n /**\r\n * Returns a new/empty [[AxisBreak]] of the appropriate type.\r\n *\r\n * @return Axis break\r\n */\n\n\n ValueAxis.prototype.createAxisBreak = function () {\n return new ValueAxisBreak();\n };\n /**\r\n * [dataChangeUpdate description]\r\n *\r\n * This is a placeholder to override for extending classes.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n ValueAxis.prototype.dataChangeUpdate = function () {\n this.clearCache();\n\n if (!this.keepSelection) {\n if (this._start != 0 || this._end != 1) {\n this._start = 0;\n this._end = 1;\n this.dispatchImmediately(\"startendchanged\");\n }\n } else {\n if (this._start != 0) {\n this.dispatchImmediately(\"startchanged\");\n }\n\n if (this._end != 1) {\n this.dispatchImmediately(\"endchanged\");\n }\n\n if (this._start != 0 || this._end != 1) {\n this.dispatchImmediately(\"startendchanged\");\n }\n }\n\n this._maxZoomed = this._maxDefined;\n this._minZoomed = this._minDefined;\n this._maxAdjusted = this._maxDefined;\n this._minAdjusted = this._minDefined;\n };\n /**\r\n * Processes data items of the related Series.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n ValueAxis.prototype.processSeriesDataItems = function () {\n // @todo: add some boolean (maybe autodedect) if we need these calculations or not. this place uses a lot of cpu\n if (this.calculateTotals) {\n var series = this.series.getIndex(0);\n var startIndex = series.startIndex;\n\n if (series.dataItems.length > 0) {\n if (startIndex > 0) {\n startIndex--;\n }\n\n var endIndex = series.endIndex;\n\n if (endIndex < series.dataItems.length) {\n endIndex++;\n }\n\n var _loop_1 = function _loop_1(i) {\n // This has to be `var` in order to avoid garbage collection\n var total = {};\n var sum = {};\n this_1.series.each(function (series) {\n if (!series.excludeFromTotal) {\n var dataItem_1 = series.dataItems.getIndex(i);\n\n if (dataItem_1) {\n $object.each(dataItem_1.values, function (key) {\n var value = dataItem_1.values[key].workingValue; // can not use getWorkingValue here!\n\n if ($type.isNumber(value)) {\n if (!$type.isNumber(total[key])) {\n total[key] = Math.abs(value);\n } else {\n total[key] += Math.abs(value);\n }\n\n if (!$type.isNumber(sum[key])) {\n sum[key] = value;\n } else {\n sum[key] += value;\n }\n }\n });\n }\n }\n });\n this_1.series.each(function (series) {\n if (!series.excludeFromTotal) {\n var dataItem_2 = series.dataItems.getIndex(i);\n\n if (dataItem_2) {\n $object.each(dataItem_2.values, function (key) {\n var value = dataItem_2.values[key].workingValue; // can not use getWorkingValue here!\n\n if ($type.isNumber(value)) {\n dataItem_2.setCalculatedValue(key, total[key], \"total\");\n dataItem_2.setCalculatedValue(key, 100 * value / total[key], \"totalPercent\");\n dataItem_2.setCalculatedValue(key, sum[key], \"sum\");\n }\n });\n }\n }\n });\n };\n\n var this_1 = this; // This has to be `var` in order to avoid garbage collection\n\n for (var i = startIndex; i < endIndex; ++i) {\n _loop_1(i);\n }\n }\n }\n };\n /**\r\n * Validates the whole axis. Causes it to redraw.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n */\n\n\n ValueAxis.prototype.validate = function () {\n if (this.axisLength <= 0) {\n return;\n }\n\n _super.prototype.validate.call(this);\n\n this.getMinMax();\n\n if (!$type.isNumber(this._minAdjusted)) {\n this.dataItems.each(function (dataItem) {\n dataItem.value = null;\n });\n }\n\n this.fixAxisBreaks();\n this.calculateZoom();\n this.validateAxisElements();\n this.validateAxisRanges();\n this.validateBreaks();\n this.hideUnusedDataItems();\n this.renderer.invalidateLayout(); // hide too close\n //this.hideTooCloseDataItems();\n };\n /**\r\n * Calculates all positions, related to axis as per current zoom.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n ValueAxis.prototype.calculateZoom = function () {\n if ($type.isNumber(this.min) && $type.isNumber(this.max)) {\n var min = this.positionToValue(this.start);\n var max = this.positionToValue(this.end);\n var differece = this.adjustDifference(min, max);\n var minMaxStep = this.adjustMinMax(min, max, differece, this._gridCount, true);\n var stepDecimalPlaces = $utils.decimalPlaces(minMaxStep.step);\n this._stepDecimalPlaces = stepDecimalPlaces;\n min = $math.round(min, stepDecimalPlaces);\n max = $math.round(max, stepDecimalPlaces);\n minMaxStep = this.adjustMinMax(min, max, differece, this._gridCount, true);\n var step = minMaxStep.step;\n\n if (this.syncWithAxis) {\n var calculated = this.getCache(min + \"-\" + max);\n\n if ($type.isNumber(calculated)) {\n step = calculated;\n }\n } else {\n min = minMaxStep.min;\n max = minMaxStep.max;\n }\n\n if (this._minZoomed != min || this._maxZoomed != max || this._step != step || this._dsc) {\n this._dsc = false;\n this._minZoomed = min;\n this._maxZoomed = max;\n this._step = step;\n this.dispatchImmediately(\"selectionextremeschanged\");\n }\n }\n };\n\n ValueAxis.prototype.fixSmallStep = function (step) {\n if (1 + step == 1) {\n step *= 2;\n return this.fixSmallStep(step);\n }\n\n return step;\n };\n /**\r\n * Validates Axis elements.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n\n ValueAxis.prototype.validateAxisElements = function () {\n var _this = this;\n\n if ($type.isNumber(this.max) && $type.isNumber(this.min)) {\n // first regular items\n var value_1 = this.minZoomed - this._step * 2;\n\n if (!this.logarithmic) {\n value_1 = Math.floor(value_1 / this._step) * this._step;\n } else {\n var differencePower = Math.log(this.max) * Math.LOG10E - Math.log(this.min) * Math.LOG10E;\n\n if (differencePower > 1) {\n value_1 = Math.pow(10, Math.log(this.min) * Math.LOG10E);\n } else {\n value_1 = Math.floor(this.minZoomed / this._step) * this._step;\n\n if (value_1 == 0) {\n value_1 = this.minZoomed;\n }\n }\n }\n\n var maxZoomed = this._maxZoomed + this._step;\n this.resetIterators();\n var dataItemsIterator_1 = this._dataItemsIterator;\n\n if (this._step == 0) {\n return;\n }\n\n this._step = this.fixSmallStep(this._step);\n var i = 0;\n var precisionChanged = this._prevStepDecimalPlaces != this._stepDecimalPlaces;\n this._prevStepDecimalPlaces = this._stepDecimalPlaces;\n\n while (value_1 <= maxZoomed) {\n var axisBreak = this.isInBreak(value_1);\n\n if (!axisBreak) {\n var dataItem = dataItemsIterator_1.find(function (x) {\n return x.value === value_1;\n });\n\n if (dataItem.__disabled) {\n dataItem.__disabled = false;\n } //this.processDataItem(dataItem);\n\n\n this.appendDataItem(dataItem);\n dataItem.axisBreak = undefined;\n\n if (dataItem.value != value_1 || precisionChanged) {\n dataItem.value = value_1;\n dataItem.text = this.formatLabel(value_1);\n\n if (dataItem.label && dataItem.label.invalid) {\n dataItem.label.validate();\n }\n\n if (dataItem.value >= this.min && dataItem.value <= this.max) {\n if (dataItem.label) {\n if (this.axisLetter == \"Y\" && dataItem.label.measuredWidth > this.ghostLabel.measuredWidth || this.axisLetter == \"X\" && dataItem.label.measuredHeight > this.ghostLabel.measuredHeight) {\n this.ghostLabel.text = dataItem.label.currentText;\n this.ghostLabel.validate();\n }\n }\n }\n }\n\n this.validateDataElement(dataItem);\n }\n\n i++;\n var oldValue = value_1;\n\n if (!this.logarithmic) {\n value_1 += this._step;\n } else {\n var differencePower = Math.log(this.max) * Math.LOG10E - Math.log(this.min) * Math.LOG10E;\n\n if (differencePower > 1) {\n value_1 = Math.pow(10, Math.log(this.min) * Math.LOG10E + i);\n } else {\n value_1 += this._step;\n }\n }\n\n var stepPower = Math.pow(10, Math.floor(Math.log(Math.abs(this._step)) * Math.LOG10E));\n\n if (stepPower < 1) {\n // exponent is less then 1 too. Count decimals of exponent\n var decCount = Math.round(Math.abs(Math.log(Math.abs(stepPower)) * Math.LOG10E)) + 2;\n decCount = Math.min(13, decCount); // round value to avoid floating point issues\n\n value_1 = $math.round(value_1, decCount); // ceil causes problems: https://codepen.io/team/amcharts/pen/XWMjZwy?editors=1010\n\n if (oldValue == value_1) {\n value_1 = maxZoomed;\n break;\n }\n }\n }\n\n var axisBreaks = this._axisBreaks;\n\n if (axisBreaks) {\n // breaks later\n var renderer_1 = this.renderer;\n $iter.each(axisBreaks.iterator(), function (axisBreak) {\n if (axisBreak.breakSize > 0) {\n // only add grid if gap is bigger then minGridDistance\n if ($math.getDistance(axisBreak.startPoint, axisBreak.endPoint) > renderer_1.minGridDistance) {\n var breakValue_1 = axisBreak.adjustedMin;\n\n while (breakValue_1 <= axisBreak.adjustedMax) {\n if (breakValue_1 >= axisBreak.adjustedStartValue && breakValue_1 <= axisBreak.adjustedEndValue) {\n var dataItem = dataItemsIterator_1.find(function (x) {\n return x.value === breakValue_1;\n });\n\n if (dataItem.__disabled) {\n dataItem.__disabled = false;\n } //this.processDataItem(dataItem);\n\n\n _this.appendDataItem(dataItem);\n\n dataItem.axisBreak = axisBreak;\n\n if (dataItem.value != breakValue_1) {\n dataItem.value = breakValue_1;\n dataItem.text = _this.formatLabel(breakValue_1);\n\n if (dataItem.label && dataItem.label.invalid) {\n dataItem.label.validate();\n }\n }\n\n _this.validateDataElement(dataItem);\n }\n\n breakValue_1 += axisBreak.adjustedStep;\n }\n }\n }\n });\n }\n }\n };\n /**\r\n * Validates axis data item.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param dataItem Data item\r\n */\n\n\n ValueAxis.prototype.validateDataElement = function (dataItem) {\n _super.prototype.validateDataElement.call(this, dataItem); //dataItem.__disabled = false;\n\n\n dataItem.itemIndex = this._axisItemCount;\n this._axisItemCount++;\n var renderer = this.renderer;\n var value = dataItem.value;\n var endValue = dataItem.endValue;\n var position = this.valueToPosition(value);\n dataItem.position = position;\n var endPosition = position;\n var fillEndPosition = this.valueToPosition(value + this._step);\n\n if ($type.isNumber(endValue)) {\n endPosition = this.valueToPosition(endValue);\n fillEndPosition = endPosition;\n } // this point is needed to calculate distance to satisfy minGridDistance\n\n\n dataItem.point = renderer.positionToPoint(position);\n var tick = dataItem.tick;\n\n if (tick && !tick.disabled) {\n renderer.updateTickElement(tick, position, endPosition);\n }\n\n var grid = dataItem.grid;\n\n if (grid && !grid.disabled) {\n renderer.updateGridElement(grid, position, endPosition);\n }\n\n var label = dataItem.label;\n\n if (label && !label.disabled) {\n renderer.updateLabelElement(label, position, endPosition);\n }\n\n var fill = dataItem.axisFill;\n\n if (fill && !fill.disabled) {\n renderer.updateFillElement(fill, position, fillEndPosition);\n\n if (!dataItem.isRange) {\n this.fillRule(dataItem);\n }\n }\n\n if (dataItem.bullet) {\n renderer.updateBullet(dataItem.bullet, position, endPosition);\n }\n\n var mask = dataItem.mask;\n\n if (mask) {\n renderer.updateFillElement(mask, position, fillEndPosition);\n }\n };\n /**\r\n * Formats the value according to axis' own [[NumberFormatter]].\r\n *\r\n * @param value Source value\r\n * @return Formatted value\r\n */\n\n\n ValueAxis.prototype.formatLabel = function (value) {\n if (this.adjustLabelPrecision && value != 0) {\n return this.numberFormatter.format(value, undefined, this._stepDecimalPlaces);\n } else {\n return this.numberFormatter.format(value);\n }\n };\n\n Object.defineProperty(ValueAxis.prototype, \"basePoint\", {\n /**\r\n * Coordinates of the actual axis start.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Base point\r\n */\n get: function get() {\n var baseValue = this.baseValue;\n var position = this.valueToPosition(baseValue);\n var basePoint = this.renderer.positionToPoint(position);\n return basePoint;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"baseValue\", {\n /**\r\n * @return base value\r\n */\n get: function get() {\n var baseValue = this._baseValue;\n\n if (this.logarithmic) {\n baseValue = this.min;\n }\n\n if (!this._adapterO) {\n return baseValue;\n } else {\n return this._adapterO.apply(\"baseValue\", baseValue);\n }\n },\n\n /**\r\n * A base value.\r\n *\r\n * This is a threshold value that will divide \"positive\" and \"negative\"\r\n * value ranges.\r\n *\r\n * Other scale-related functionality also depend on base value. E.g. stacks,\r\n * value-dependent coloring, etc.\r\n *\r\n * @param value Base value\r\n */\n set: function set(value) {\n this._baseValue = value;\n this.invalidateLayout();\n this.invalidateSeries();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts a numeric value to relative position on axis\r\n *\r\n * An alias to `valueToPosition()`.\r\n *\r\n * @param value Value\r\n * @return Position\r\n */\n\n ValueAxis.prototype.anyToPosition = function (value) {\n return this.valueToPosition(value);\n };\n /**\r\n * Converts a numeric value to orientation point (x, y, angle) on axis\r\n *\r\n * @param value Value\r\n * @return Orientation point\r\n */\n\n\n ValueAxis.prototype.valueToPoint = function (value) {\n var position = this.valueToPosition(value);\n var point = this.renderer.positionToPoint(position);\n var angle = this.renderer.positionToAngle(position);\n return {\n x: point.x,\n y: point.y,\n angle: angle\n };\n };\n /**\r\n * Converts a numeric value to orientation (x, y, angle) point on axis\r\n *\r\n * @param value Value\r\n * @return Orientation point\r\n */\n\n\n ValueAxis.prototype.anyToPoint = function (value) {\n return this.valueToPoint(value);\n };\n /**\r\n * Converts a numeric value to relative position on axis.\r\n *\r\n * @param value Value\r\n * @return relative position\r\n */\n\n\n ValueAxis.prototype.valueToPosition = function (value) {\n if ($type.isNumber(value)) {\n // todo: think if possible to take previous value and do not go through all previous breaks\n var min_1 = this.min;\n var max_1 = this.max;\n\n if ($type.isNumber(min_1) && $type.isNumber(max_1)) {\n var difference = this._difference;\n var axisBreaks = this._axisBreaks;\n\n if (axisBreaks && axisBreaks.length > 0) {\n $iter.eachContinue(axisBreaks.iterator(), function (axisBreak) {\n var startValue = axisBreak.adjustedStartValue;\n var endValue = axisBreak.adjustedEndValue;\n\n if ($type.isNumber(startValue) && $type.isNumber(endValue)) {\n if (value < startValue) {\n return false;\n }\n\n if ($math.intersect({\n start: startValue,\n end: endValue\n }, {\n start: min_1,\n end: max_1\n })) {\n // todo: check this once and set some flag in axisBreak\n startValue = Math.max(startValue, min_1);\n endValue = Math.min(endValue, max_1);\n var breakSize = axisBreak.breakSize; // value to the right of break end\n\n if (value > endValue) {\n min_1 += (endValue - startValue) * (1 - breakSize); // todo: maybe this can be done differently?\n } // value to the left of break start\n else if (value < startValue) {} // value within break\n else {\n value = startValue + (value - startValue) * breakSize;\n }\n }\n }\n\n return true;\n });\n }\n\n var position = void 0;\n\n if (!this.logarithmic) {\n position = (value - min_1) / difference;\n } else {\n var treatZeroAs = this.treatZeroAs;\n\n if ($type.isNumber(treatZeroAs)) {\n if (value <= treatZeroAs) {\n value = treatZeroAs;\n }\n }\n\n position = (Math.log(value) * Math.LOG10E - Math.log(this.min) * Math.LOG10E) / (Math.log(this.max) * Math.LOG10E - Math.log(this.min) * Math.LOG10E);\n } //position = $math.round(position, 10);\n\n\n return position;\n }\n }\n\n return 0;\n };\n /**\r\n * When fontSize of fontFamily changes we need to hard-invalidate all Labels of this container to position them properly.\r\n */\n\n\n ValueAxis.prototype.invalidateLabels = function () {\n _super.prototype.invalidateLabels.call(this);\n\n if (this.dataItems) {\n this.dataItems.each(function (dataItem) {\n dataItem.value = undefined;\n });\n this.invalidate();\n }\n };\n /**\r\n * Converts an relative position to a corresponding value within\r\n * axis' scale.\r\n *\r\n * @param position Position (px)\r\n * @return Value\r\n */\n\n\n ValueAxis.prototype.positionToValue = function (position) {\n var min = this.min;\n var max = this.max;\n\n if ($type.isNumber(min) && $type.isNumber(max)) {\n var difference_1 = max - min; //no need to adjust!\n\n var value_2 = null;\n var axisBreaks = this._axisBreaks;\n\n if (axisBreaks) {\n // in case we have some axis breaks\n if (axisBreaks.length > 0) {\n $iter.eachContinue(axisBreaks.iterator(), function (axisBreak) {\n var breakStartPosition = axisBreak.startPosition;\n var breakEndPosition = axisBreak.endPosition;\n var breakStartValue = axisBreak.adjustedStartValue;\n var breakEndValue = axisBreak.adjustedEndValue;\n\n if ($type.isNumber(breakStartValue) && $type.isNumber(breakEndValue)) {\n if (breakStartValue > max) {\n return false;\n }\n\n if ($math.intersect({\n start: breakStartValue,\n end: breakEndValue\n }, {\n start: min,\n end: max\n })) {\n breakStartValue = $math.max(breakStartValue, min);\n breakEndValue = $math.min(breakEndValue, max);\n var breakSize = axisBreak.breakSize;\n difference_1 -= (breakEndValue - breakStartValue) * (1 - breakSize); // position to the right of break end\n\n if (position > breakEndPosition) {\n min += (breakEndValue - breakStartValue) * (1 - breakSize);\n } // position to the left of break start\n else if (position < breakStartPosition) {} // value within break\n else {\n var breakPosition = (position - breakStartPosition) / (breakEndPosition - breakStartPosition);\n value_2 = breakStartValue + breakPosition * (breakEndValue - breakStartValue);\n return false;\n }\n }\n\n return true;\n }\n });\n }\n }\n\n if (!$type.isNumber(value_2)) {\n if (this.logarithmic) {\n value_2 = Math.pow(Math.E, (position * (Math.log(this.max) * Math.LOG10E - Math.log(this.min) * Math.LOG10E) + Math.log(this.min) * Math.LOG10E) / Math.LOG10E);\n } else {\n value_2 = position * difference_1 + min;\n }\n }\n\n return value_2;\n } //}\n\n };\n /**\r\n * Converts an X coordinate to a relative value in axis' scale.\r\n *\r\n * @param x X (px)\r\n * @return Value\r\n */\n\n\n ValueAxis.prototype.xToValue = function (x) {\n return this.positionToValue(this.pointToPosition({\n x: x,\n y: 0\n }));\n };\n /**\r\n * Converts an Y coordinate to a relative value in axis' scale.\r\n *\r\n * @param y Y (px)\r\n * @return Value\r\n */\n\n\n ValueAxis.prototype.yToValue = function (y) {\n return this.positionToValue(this.pointToPosition({\n x: 0,\n y: y\n }));\n };\n /**\r\n * Converts pixel coordinates to a relative position. (0-1)\r\n *\r\n * @param point Coorinates (px)\r\n * @return Position (0-1)\r\n */\n\n\n ValueAxis.prototype.pointToPosition = function (point) {\n if (this.renderer instanceof AxisRendererY) {\n return 1 - this.renderer.pointToPosition(point);\n } else {\n return this.renderer.pointToPosition(point);\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n ValueAxis.prototype.animateMinMax = function (min, max) {\n return this.animate([{\n property: \"_minAdjusted\",\n from: this._minAdjusted,\n to: min\n }, {\n property: \"_maxAdjusted\",\n from: this._maxAdjusted,\n to: max\n }], this.rangeChangeDuration, this.rangeChangeEasing);\n };\n /**\r\n * Calculates smallest and biggest value for the axis scale.\r\n * @ignore\r\n * @todo Description (review)\r\n */\n\n\n ValueAxis.prototype.getMinMax = function () {\n var _this = this;\n\n this.updateGridCount();\n var min = Number.POSITIVE_INFINITY;\n var max = Number.NEGATIVE_INFINITY; // only if min and max are not set from outside, we go through min and max influencers\n\n if (!$type.isNumber(this._minDefined) || !$type.isNumber(this._maxDefined)) {\n this.series.each(function (series) {\n if (!series.ignoreMinMax) {\n // check min\n var seriesMin = series.min(_this);\n\n if ($type.isNumber(seriesMin) && seriesMin < min) {\n min = seriesMin;\n } // check max\n\n\n var seriesMax = series.max(_this);\n\n if ($type.isNumber(seriesMax) && seriesMax > max) {\n max = seriesMax;\n }\n }\n });\n\n if (this.includeRangesInMinMax) {\n this.axisRanges.each(function (range) {\n if (!range.ignoreMinMax) {\n var minValue = $math.min(range.value, range.endValue);\n var maxValue = $math.max(range.value, range.endValue);\n\n if (minValue < min || !$type.isNumber(min)) {\n min = minValue;\n }\n\n if (maxValue > max || !$type.isNumber(max)) {\n max = maxValue;\n }\n }\n });\n }\n }\n\n if (this.logarithmic) {\n var treatZeroAs = this.treatZeroAs;\n\n if ($type.isNumber(treatZeroAs)) {\n if (min <= 0) {\n min = treatZeroAs;\n }\n }\n\n if (min <= 0) {\n this.raiseCriticalError(new Error(\"Logarithmic value axis can not have values <= 0.\"), true);\n }\n }\n\n if (min == 0 && max == 0) {\n max = 0.9;\n min = -0.9;\n } // if defined from outside\n\n\n if ($type.isNumber(this._minDefined)) {\n min = this._minDefined;\n }\n\n if ($type.isNumber(this._maxDefined)) {\n max = this._maxDefined;\n }\n\n if (this._adapterO) {\n min = this._adapterO.apply(\"min\", min);\n }\n\n if (this._adapterO) {\n max = this._adapterO.apply(\"max\", max);\n }\n\n if (!$type.isNumber(min) || !$type.isNumber(max)) {\n return;\n }\n\n this._minReal = min;\n this._maxReal = max;\n\n if (min == Number.POSITIVE_INFINITY) {\n min = undefined;\n }\n\n if (max == Number.NEGATIVE_INFINITY) {\n max = undefined;\n }\n\n var dif = this.adjustDifference(min, max); // previously it was max-min, but not worked well\n\n min = this.fixMin(min);\n max = this.fixMax(max); // this happens if starLocation and endLocation are 0.5 and DateAxis has only one date\n\n if (max - min <= 1 / Math.pow(10, 15)) {\n if (max - min != 0) {\n this._deltaMinMax = (max - min) / 2;\n } else {\n // the number by which we need to raise 10 to get difference\n var exponent = Math.log(Math.abs(max)) * Math.LOG10E; // here we find a number which is power of 10 and has the same count of numbers as difference has\n\n var power = Math.pow(10, Math.floor(exponent)); // reduce this number by 10 times\n\n power = power / 10;\n this._deltaMinMax = power;\n }\n\n min -= this._deltaMinMax;\n max += this._deltaMinMax;\n }\n\n min -= (max - min) * this.extraMin;\n max += (max - min) * this.extraMax;\n var strict = this.strictMinMax;\n\n if ($type.isNumber(this._maxDefined)) {\n strict = true;\n }\n\n var minMaxStep = this.adjustMinMax(min, max, dif, this._gridCount, strict);\n min = minMaxStep.min;\n max = minMaxStep.max;\n dif = max - min; //new\n // do it for the second time (importat!)\n\n minMaxStep = this.adjustMinMax(min, max, max - min, this._gridCount, true);\n min = minMaxStep.min;\n max = minMaxStep.max; // return min max if strict\n\n if (this.strictMinMax) {\n if ($type.isNumber(this._minDefined)) {\n min = this._minDefined;\n } else {\n min = this._minReal;\n }\n\n if ($type.isNumber(this._maxDefined)) {\n max = this._maxDefined;\n } else {\n max = this._maxReal;\n }\n\n if (max - min <= 0.00000001) {\n min -= this._deltaMinMax;\n max += this._deltaMinMax;\n }\n\n min -= (max - min) * this.extraMin;\n max += (max - min) * this.extraMax;\n }\n\n if (this._adapterO) {\n min = this._adapterO.apply(\"min\", min);\n }\n\n if (this._adapterO) {\n max = this._adapterO.apply(\"max\", max);\n }\n\n this._step = minMaxStep.step;\n\n if (!$type.isNumber(min) && !$type.isNumber(max)) {\n this.start = 0;\n this.end = 1;\n this.renderer.labels.each(function (label) {\n label.dataItem.text = \"\";\n });\n } // checking isNumber is good when all series are hidden\n\n\n if ((this._minAdjusted != min || this._maxAdjusted != max) && $type.isNumber(min) && $type.isNumber(max)) {\n var animation = this._minMaxAnimation;\n\n if (this._extremesChanged && $type.isNumber(this._minAdjusted) && $type.isNumber(this._maxAdjusted) && this.inited) {\n if (animation && !animation.isFinished() && this._finalMax == max && this._finalMin == min) {\n return;\n } else {\n this._finalMin = min;\n this._finalMax = max;\n animation = this.animateMinMax(min, max);\n\n if (animation && !animation.isFinished()) {\n animation.events.on(\"animationprogress\", this.validateDataItems, this);\n animation.events.on(\"animationended\", function () {\n //this.validateDataItems();\n _this.series.each(function (series) {\n series.validate();\n });\n\n _this.validateDataItems();\n\n _this.handleSelectionExtremesChange();\n });\n this._minMaxAnimation = animation;\n } else {\n this.series.each(function (series) {\n series.invalidate();\n });\n }\n\n this.validateDataItems();\n this.dispatchImmediately(\"extremeschanged\");\n this.handleSelectionExtremesChange();\n }\n } else {\n if (animation && !animation.isFinished() && this._finalMax == max && this._finalMin == min) {\n return;\n } else {\n this._minAdjusted = min;\n this._maxAdjusted = max;\n this._finalMin = min;\n this._finalMax = max;\n this.invalidateDataItems();\n this.dispatchImmediately(\"extremeschanged\");\n }\n }\n }\n\n this._extremesChanged = false;\n this._difference = this.adjustDifference(min, max);\n };\n /**\r\n * Adjusts the minimum value.\r\n *\r\n * This is a placeholder method for extending classes to override.\r\n *\r\n * For numeric values this does nothing, however for more complex types, like\r\n * dates, it may be necessary to adjust.\r\n *\r\n * @param value Value\r\n * @return Adjusted value\r\n */\n\n\n ValueAxis.prototype.fixMin = function (value) {\n return value;\n };\n /**\r\n * Adjusts the maximum value.\r\n *\r\n * This is a placeholder method for extending classes to override.\r\n *\r\n * For numeric values this does nothing, however for more complex types, like\r\n * dates, it may be necessary to adjust.\r\n *\r\n * @param value Value\r\n * @return Adjusted value\r\n */\n\n\n ValueAxis.prototype.fixMax = function (value) {\n return value;\n };\n /**\r\n * Adjusts actual min and max scale values so that the axis starts and ends\r\n * at \"nice\" values, unless `strictMinMax` is set.\r\n *\r\n * The `difference` can be something else than `max - min`, because of the\r\n * axis breaks.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param min [description]\r\n * @param max [description]\r\n * @param difference [description]\r\n * @param gridCount [description]\r\n * @param strictMode [description]\r\n * @return [description]\r\n */\n\n\n ValueAxis.prototype.adjustMinMax = function (min, max, difference, gridCount, strictMode) {\n // will fail if 0\n if (gridCount <= 1) {\n gridCount = 1;\n }\n\n gridCount = Math.round(gridCount);\n var initialMin = min;\n var initialMax = max; // in case min and max is the same, use max\n\n if (difference === 0) {\n difference = Math.abs(max);\n } // the number by which we need to raise 10 to get difference\n\n\n var exponent = Math.log(Math.abs(difference)) * Math.LOG10E; // here we find a number which is power of 10 and has the same count of numbers as difference has\n\n var power = Math.pow(10, Math.floor(exponent)); // reduce this number by 10 times\n\n power = power / 10;\n var extra = power;\n\n if (strictMode) {\n extra = 0;\n }\n\n if (!this.logarithmic) {\n // round down min\n if (strictMode) {\n min = Math.floor(min / power) * power; // round up max\n\n max = Math.ceil(max / power) * power;\n } else {\n min = Math.ceil(min / power) * power - extra; // round up max\n\n max = Math.floor(max / power) * power + extra;\n } // don't let min go below 0 if real min is >= 0\n\n\n if (min < 0 && initialMin >= 0) {\n min = 0;\n } // don't let max go above 0 if real max is <= 0\n\n\n if (max > 0 && initialMax <= 0) {\n max = 0;\n }\n } else {\n if (min <= 0) {\n //throw Error(\"Logarithmic value axis can not have values <= 0.\");\n min = this.baseValue;\n } // @todo: think of a better way or to restrict zooming when no series are selected\n\n\n if (min == Infinity) {\n min = 1;\n }\n\n if (max == -Infinity) {\n max = 10;\n }\n\n if (this.strictMinMax) {\n if (this._minDefined > 0) {\n min = this._minDefined;\n } else {\n min = min;\n }\n\n if (this._maxDefined > 0) {\n max = max;\n }\n } else {\n min = Math.pow(10, Math.floor(Math.log(Math.abs(min)) * Math.LOG10E));\n max = Math.pow(10, Math.ceil(Math.log(Math.abs(max)) * Math.LOG10E));\n }\n } // repeat diff, exponent and power again with rounded values\n //difference = this.adjustDifference(min, max);\n\n /*\r\n if(min > initialMin){\r\n min = initialMin;\r\n }\r\n if(max < initialMax){\r\n max = initialMax;\r\n }\r\n */\n\n\n exponent = Math.log(Math.abs(difference)) * Math.LOG10E;\n power = Math.pow(10, Math.floor(exponent));\n power = power / 10; // approximate difference between two grid lines\n\n var step = Math.ceil(difference / gridCount / power) * power;\n var stepPower = Math.pow(10, Math.floor(Math.log(Math.abs(step)) * Math.LOG10E)); // TODO: in v3 I had fixStepE here, ommiting it for a while, need to think about other solution\n // the step should divide by 2, 5, and 10.\n\n var stepDivisor = Math.ceil(step / stepPower); // number 0 - 10\n\n if (stepDivisor > 5) {\n stepDivisor = 10;\n } else if (stepDivisor <= 5 && stepDivisor > 2) {\n stepDivisor = 5;\n } // now get real step\n\n\n step = Math.ceil(step / (stepPower * stepDivisor)) * stepPower * stepDivisor;\n\n if (this.maxPrecision < Number.MAX_VALUE && step != $math.ceil(step, this.maxPrecision)) {\n step = $math.ceil(step, this.maxPrecision);\n }\n\n var decCount = 0; // in case numbers are smaller than 1\n\n if (stepPower < 1) {\n // exponent is less then 1 too. Count decimals of exponent\n decCount = Math.round(Math.abs(Math.log(Math.abs(stepPower)) * Math.LOG10E)) + 1; // round step\n\n step = $math.round(step, decCount);\n }\n\n if (!this.logarithmic) {\n // final min and max\n var minCount = Math.floor(min / step);\n min = $math.round(step * minCount, decCount);\n var maxCount = void 0;\n\n if (!strictMode) {\n maxCount = Math.ceil(max / step);\n } else {\n maxCount = Math.floor(max / step);\n }\n\n if (maxCount == minCount) {\n maxCount++;\n }\n\n max = $math.round(step * maxCount, decCount);\n\n if (max < initialMax) {\n max = max + step;\n }\n\n if (min > initialMin) {\n min = min - step;\n }\n }\n\n return {\n min: min,\n max: max,\n step: step\n };\n };\n\n Object.defineProperty(ValueAxis.prototype, \"min\", {\n /**\r\n * @return Min value\r\n */\n get: function get() {\n var min = this._minAdjusted;\n\n if (!$type.isNumber(min)) {\n min = this._minDefined;\n }\n\n return min;\n },\n\n /**\r\n * A minimum value for the axis scale.\r\n *\r\n * This value might be auto-adjusted by the Axis in order to accomodate the\r\n * grid nicely, i.e. plot area is divided by grid in nice equal cells.\r\n *\r\n * The above might be overridden by `strictMinMax` which will force exact\r\n * user-defined min and max values to be used for scale.\r\n *\r\n * @param value Min value\r\n */\n set: function set(value) {\n if (this._minDefined != value) {\n this._minDefined = value;\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"minDefined\", {\n /**\r\n * Min value as defined by user's code, not auto-calculated.\r\n *\r\n * @readonly\r\n * @return Min value\r\n */\n get: function get() {\n return this._minDefined;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"maxDefined\", {\n /**\r\n * Max value as defined by user's code, not auto-calculated.\r\n *\r\n * @readonly\r\n * @return Man value\r\n */\n get: function get() {\n return this._maxDefined;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"extraMin\", {\n /**\r\n * @return {number}\r\n */\n get: function get() {\n return this.getPropertyValue(\"extraMin\");\n },\n\n /**\r\n * Allows relatively adjusting minimum value of the axis' scale.\r\n *\r\n * The value is relative to the actual range of values currently displayed\r\n * on the axis.\r\n *\r\n * E.g.: 0.5 will mean half of the current range. If we have axis displaying\r\n * from 100 to 200, we will now have axis displaying from 50 to 200 because\r\n * we asked to expand minimum value by 50% (0.5).\r\n *\r\n * NOTE: this setting is not compatible with `strictMinMax`.\r\n *\r\n * @param {number}\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"extraMin\", value)) {\n this.invalidateDataItems();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"extraMax\", {\n /**\r\n * @return Min multiplier\r\n */\n get: function get() {\n return this.getPropertyValue(\"extraMax\");\n },\n\n /**\r\n * Allows relatively adjusting maximum value of the axis' scale.\r\n *\r\n * The value is relative to the actual range of values currently displayed\r\n * on the axis.\r\n *\r\n * E.g.: 0.5 will mean half of the current range. If we have axis displaying\r\n * from 100 to 200, we will now have axis displaying from 100 to 250 because\r\n * we asked to expand maximum value by 50% (0.5).\r\n *\r\n * NOTE: this setting is not compatible with `strictMinMax`.\r\n *\r\n * @param {number}\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"extraMax\", value)) {\n this.invalidateDataItems();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"step\", {\n /**\r\n * Current calculated delta in values between two adjacent grid lines (step).\r\n *\r\n * This is a read-only value and cannot be used to set actual step.\r\n *\r\n * @readonly\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/axes/positioning-axis-elements/#Setting_the_density_of_the_the_grid_labels} For more information about modifying density of labels\r\n * @return [description]\r\n */\n get: function get() {\n return this._step;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"max\", {\n /**\r\n * @return Max value\r\n */\n get: function get() {\n var max = this._maxAdjusted;\n\n if (!$type.isNumber(max)) {\n max = this._maxDefined;\n }\n\n return max;\n },\n\n /**\r\n * A maximum value for the axis scale.\r\n *\r\n * This value might be auto-adjusted by the Axis in order to accomodate the\r\n * grid nicely, i.e. plot area is divided by grid in nice equal cells.\r\n *\r\n * The above might be overridden by `strictMinMax` which will force exact\r\n * user-defined min and max values to be used for scale.\r\n *\r\n * @param value Max value\r\n */\n set: function set(value) {\n if (this._maxDefined != value) {\n this._maxDefined = value;\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"adjustLabelPrecision\", {\n /**\r\n * @return Adjust precision\r\n */\n get: function get() {\n return this.getPropertyValue(\"adjustLabelPrecision\");\n },\n\n /**\r\n * By default the axis will adjust precision of all numbers to match number\r\n * of decimals in all its labels, e.g.: `1.0`, `1.5`, `2.0`.\r\n *\r\n * To disable set `adjustLabelPrecision` to `false`, to use whatever other\r\n * precision or number format settings are set.\r\n *\r\n * IMPORTANT: This setting will be ignored if your number format uses\r\n * modifiers, e.g. `\"#a\"`.\r\n *\r\n * @default true\r\n * @since 4.9.14\r\n * @param value Adjust precision\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"adjustLabelPrecision\", value)) {\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Used for the Series to register itself as the user of this Axis.\r\n *\r\n * This will also decorate both the Series and Axis with event handlers, used\r\n * to redraw on Axis position/zoom change.\r\n *\r\n * A disposer for those events is returned, so that they can be disposed\r\n * together with Series.\r\n *\r\n * @ignore Exclude from docs\r\n * @param series Series\r\n * @return Disposer for events\r\n */\n\n ValueAxis.prototype.registerSeries = function (series) {\n return new MultiDisposer([_super.prototype.registerSeries.call(this, series), series.events.on(\"extremeschanged\", this.handleExtremesChange, this, false), series.events.on(\"selectionextremeschanged\", this.handleSelectionExtremesChange, this, false), this.events.on(\"extremeschanged\", series.invalidate, series, false)]);\n };\n /**\r\n * Perform tasks after Axis zoom.\r\n */\n\n\n ValueAxis.prototype.handleSelectionExtremesChange = function () {\n var _this = this;\n\n var selectionMin;\n var selectionMax;\n var allHidden = true;\n $iter.each(this.series.iterator(), function (series) {\n if (!series.ignoreMinMax && !series.isHidden && !series.outOfRange) {\n if (series.visible && !series.isHiding) {\n allHidden = false;\n }\n\n var seriesSelectionMin = series.selectionMin(_this);\n var seriesSelectionMax = series.selectionMax(_this);\n\n if ($type.isNumber(seriesSelectionMin)) {\n if (!$type.isNumber(selectionMin) || seriesSelectionMin < selectionMin) {\n selectionMin = seriesSelectionMin;\n }\n } // check max\n\n\n if ($type.isNumber(seriesSelectionMax)) {\n if (!$type.isNumber(selectionMax) || seriesSelectionMax > selectionMax) {\n selectionMax = seriesSelectionMax;\n }\n }\n }\n });\n\n if (this.includeRangesInMinMax) {\n this.axisRanges.each(function (range) {\n if (!range.ignoreMinMax) {\n var minValue = $math.min(range.value, range.endValue);\n var maxValue = $math.max(range.value, range.endValue);\n\n if (minValue < selectionMin) {\n selectionMin = minValue;\n }\n\n if (maxValue > selectionMax) {\n selectionMax = maxValue;\n }\n }\n });\n } // this is not good, as if date axis is initially zoomed, selection of y axis is reset to 0, 1 at the end of this method\n //$iter.each(this.series.iterator(), (series) => {\n //\tif (!series.appeared) {\n //\t\tallHidden = true;\n //\t}\n //})\n\n\n if ($type.isNumber(this._minDefined)) {\n if (this.strictMinMax) {\n selectionMin = this._minDefined;\n } else {\n selectionMin = this.min;\n }\n } else if (this.strictMinMax) {\n selectionMin = this._minReal;\n }\n\n if ($type.isNumber(this._maxDefined)) {\n if (this.strictMinMax) {\n selectionMax = this._maxDefined;\n } else {\n selectionMax = this.max;\n }\n } else if (this.strictMinMax) {\n selectionMax = this._maxReal;\n }\n\n if (selectionMin == selectionMax) {\n selectionMin -= this._deltaMinMax;\n selectionMax += this._deltaMinMax;\n var minMaxStep2 = this.adjustMinMax(selectionMin, selectionMax, 0, this._gridCount, this.strictMinMax);\n selectionMin = minMaxStep2.min;\n selectionMax = minMaxStep2.max;\n }\n\n var dif = this.adjustDifference(selectionMin, selectionMax);\n var minMaxStep = this.adjustMinMax(selectionMin, selectionMax, dif, this._gridCount);\n selectionMin = minMaxStep.min;\n selectionMax = minMaxStep.max;\n selectionMin -= (selectionMax - selectionMin) * this.extraMin;\n selectionMax += (selectionMax - selectionMin) * this.extraMax;\n selectionMin = $math.fitToRange(selectionMin, this.min, this.max);\n selectionMax = $math.fitToRange(selectionMax, this.min, this.max); // do it for the second time !important\n\n dif = this.adjustDifference(selectionMin, selectionMax);\n minMaxStep = this.adjustMinMax(selectionMin, selectionMax, dif, this._gridCount, true);\n selectionMin = minMaxStep.min;\n selectionMax = minMaxStep.max;\n\n if (this.strictMinMax) {\n selectionMin = $math.max(selectionMin, this._minDefined);\n selectionMax = $math.min(selectionMax, this._maxDefined);\n }\n\n var step = minMaxStep.step;\n\n if (this.syncWithAxis) {\n minMaxStep = this.syncAxes(selectionMin, selectionMax, step);\n selectionMin = minMaxStep.min;\n selectionMax = minMaxStep.max;\n this.invalidate();\n }\n\n step = minMaxStep.step; // needed because of grouping\n\n this._difference = this.adjustDifference(this.min, this.max);\n var start = this.valueToPosition(selectionMin);\n var end = this.valueToPosition(selectionMax); // in case all series are hidden or hiding, full zoomout\n\n if (allHidden && !this.syncWithAxis) {\n start = 0;\n end = 1;\n }\n\n var declination = 0;\n\n if (this.syncWithAxis) {\n declination = 5;\n this.setCache(selectionMin + \"-\" + selectionMax, step);\n } else {\n if (this._step != step || this._minZoomed != selectionMin || this._maxZoomed != selectionMax) {\n this._dsc = true;\n }\n\n this._step = step;\n this._minZoomed = selectionMin;\n this._maxZoomed = selectionMax;\n }\n\n if (!this.keepSelection) {\n this.zoom({\n start: start,\n end: end\n }, false, false, declination);\n }\n };\n\n Object.defineProperty(ValueAxis.prototype, \"strictMinMax\", {\n /**\r\n * @return Use exact values?\r\n */\n get: function get() {\n return this.getPropertyValue(\"strictMinMax\");\n },\n\n /**\r\n * Indicates whether to blindly use exact `min` and `max` values set by user\r\n * when generating Axis scale.\r\n *\r\n * If not set, the Axis might slightly adjust those values to accomodate a\r\n * better looking grid.\r\n *\r\n * NOTE: if `min` and `max` are not set, setting `strictMinMax` to `true`\r\n * will result in fixing the scale of the axis to actual lowest and highest\r\n * values in the series within currently selected scope.\r\n *\r\n * @default false\r\n * @param value Use exact values?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"strictMinMax\", value)) {\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"logarithmic\", {\n /**\r\n * @return Logarithmic scale?\r\n */\n get: function get() {\n return this.getPropertyValue(\"logarithmic\");\n },\n\n /**\r\n * Indicates if this axis should use a logarithmic scale.\r\n *\r\n * Please note that logarithmic axis can **only** accommodate values bigger\r\n * than zero.\r\n *\r\n * Having zero or negative values will result in error and failure of the\r\n * whole chart.\r\n *\r\n * @param value Logarithmic scale?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"logarithmic\", value)) {\n this.invalidate();\n this.series.each(function (series) {\n series.invalidateDataItems();\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"keepSelection\", {\n /**\r\n * @return Preseve zoom after data update?\r\n */\n get: function get() {\n return this.getPropertyValue(\"keepSelection\");\n },\n\n /**\r\n * Indicates if a current selection (zoom) should be kept across data updates.\r\n *\r\n * If your axis is zoomed while chart's data is updated, the axis will try\r\n * to retain the same start and end values.\r\n *\r\n * You can also use this to initially pre-zoom axis:\r\n *\r\n * ```TypeScript\r\n * axis.keepSelection = true;\r\n * axis.start = 0.5;\r\n * axis.end = 0.7;\r\n * ```\r\n * ```JavaScript\r\n * axis.keepSelection = true;\r\n * axis.start = 0.5;\r\n * axis.end = 0.7;\r\n * ```\r\n * ```JSON\r\n * {\r\n * \"xAxes\": [{\r\n * // ...\r\n * \"keepSelection\": true,\r\n * \"start\": 0.5,\r\n * \"end\": 0.7\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * The above will start the chart zoomed from the middle of the actual scope\r\n * to 70%.\r\n *\r\n * @since 4.1.1\r\n * @default false\r\n * @param value Preseve zoom after data update?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"keepSelection\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"includeRangesInMinMax\", {\n /**\r\n * @return Include ranges?\r\n */\n get: function get() {\n return this.getPropertyValue(\"includeRangesInMinMax\");\n },\n\n /**\r\n * If set to `true`, values of axis ranges will be included when calculating\r\n * range of values / scale of the [[ValueAxis]].\r\n *\r\n * @default false\r\n * @since 4.4.9\r\n * @param value Include ranges?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"includeRangesInMinMax\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"maxPrecision\", {\n /**\r\n * @return max precision\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxPrecision\");\n },\n\n /**\r\n * Maximum number of decimals to allow when placing grid lines and labels\r\n * on axis.\r\n *\r\n * Set it to `0` (zero) to force integer-only axis labels.\r\n *\r\n * @param {number}\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"maxPrecision\", value)) {\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"extraTooltipPrecision\", {\n /**\r\n * @return Extra decimals\r\n */\n get: function get() {\n return this.getPropertyValue(\"extraTooltipPrecision\");\n },\n\n /**\r\n * This setting allows using bigger precision for numbers displayed in axis\r\n * tooltip.\r\n *\r\n * Please note that this setting indicates additional decimal places to\r\n * automatically-calculated axis number precision.\r\n *\r\n * So if your axis displays numbers like 0.1, 0.2, etc. (one decimal place),\r\n * and you set `extraTooltipPrecision = 1`, tooltips will display numbers\r\n * like 0.12, 0.25, etc. (two decimal places).\r\n *\r\n * @default 0\r\n * @since 4.8.3\r\n * @param value Extra decimals\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"extraTooltipPrecision\", value)) {\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Invalidates axis data items when series extremes change\r\n */\n\n ValueAxis.prototype.handleExtremesChange = function () {\n var _this = this;\n\n this._extremesChanged = true;\n this.getMinMax();\n\n if (this.ghostLabel) {\n var mw_1 = 0;\n this.dataItems.each(function (dataItem) {\n if (dataItem.label && dataItem.label.pixelWidth > mw_1) {\n _this.ghostLabel.text = dataItem.label.currentText;\n }\n });\n }\n };\n /**\r\n * Returns relative position on axis for series' data item's value.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem Data item\r\n * @param key Data field to get value from\r\n * @param location Location (0-1)\r\n * @param stackKey ?\r\n * @return X coordinate (px)\r\n */\n\n\n ValueAxis.prototype.getX = function (dataItem, key, location, stackKey, range) {\n return this.renderer.positionToPoint(this.getPositionX(dataItem, key, location, stackKey, range)).x;\n };\n /**\r\n * Returns the X coordinate for series' data item's value.\r\n *\r\n * @since 4.5.14\r\n * @param dataItem Data item\r\n * @param key Data field to get value from\r\n * @param location Location (0-1)\r\n * @param stackKey ?\r\n * @return Relative position\r\n */\n\n\n ValueAxis.prototype.getPositionX = function (dataItem, key, location, stackKey, range) {\n var value = dataItem.getWorkingValue(key);\n\n if (!$type.hasValue(stackKey)) {\n stackKey = \"valueX\";\n }\n\n var stack = dataItem.getValue(stackKey, \"stack\");\n\n if (!$type.isNumber(value)) {\n value = this.baseValue;\n\n if (this.logarithmic) {\n if (stack > 0) {\n value = 0;\n }\n }\n }\n\n var position = this.valueToPosition(value + stack);\n\n if (range) {\n position = $math.fitToRange(position, range.start, range.end);\n }\n\n return position;\n };\n /**\r\n * Returns the Y coordinate for series' data item's value.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem Data item\r\n * @param key Data field to get value from\r\n * @param location Location (0-1)\r\n * @param stackKey Stack ID\r\n * @return Y coordinate (px)\r\n */\n\n\n ValueAxis.prototype.getY = function (dataItem, key, location, stackKey, range) {\n return this.renderer.positionToPoint(this.getPositionY(dataItem, key, location, stackKey, range)).y;\n };\n /**\r\n * Returns relative position on axis for series' data item's value.\r\n *\r\n * @since 4.5.14\r\n * @param dataItem Data item\r\n * @param key Data field to get value from\r\n * @param location Location (0-1)\r\n * @param stackKey Stack ID\r\n * @return Relative position\r\n */\n\n\n ValueAxis.prototype.getPositionY = function (dataItem, key, location, stackKey, range) {\n var value = dataItem.getWorkingValue(key);\n\n if (!$type.hasValue(stackKey)) {\n stackKey = \"valueY\";\n }\n\n var stack = dataItem.getValue(stackKey, \"stack\");\n\n if (!$type.isNumber(value)) {\n value = this.baseValue;\n\n if (this.logarithmic) {\n if (stack > 0) {\n value = 0;\n }\n }\n }\n\n var position = this.valueToPosition(value + stack);\n\n if (range) {\n position = $math.fitToRange(position, range.start, range.end);\n }\n\n return position;\n };\n /**\r\n * Returns an angle for series data item.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description (review)\r\n * @param dataItem Data item\r\n * @param key Data field to get value from\r\n * @param location Location (0-1)\r\n * @param stackKey Stack ID\r\n * @param range Range to fit in\r\n * @return Angle\r\n */\n\n\n ValueAxis.prototype.getAngle = function (dataItem, key, location, stackKey, range) {\n var value = dataItem.getWorkingValue(key);\n var stack = dataItem.getValue(stackKey, \"stack\");\n\n if (!$type.isNumber(value)) {\n value = this.baseValue;\n }\n\n var position = this.valueToPosition(value + stack);\n\n if (range) {\n position = $math.fitToRange(position, range.start, range.end);\n }\n\n return this.positionToAngle(position);\n };\n /**\r\n * [getAnyRangePath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param start [description]\r\n * @param end [description]\r\n * @param location [description]\r\n * @return [description]\r\n */\n\n\n ValueAxis.prototype.getAnyRangePath = function (start, end, location) {\n var startPosition = this.valueToPosition(start);\n var endPosition = this.valueToPosition(end);\n return this.getPositionRangePath(startPosition, endPosition); // Base class (Axis) gets range shape from AxisRenderer\n };\n /**\r\n * Returns text to show in a axis tooltip, based on specific position within\r\n * axis.\r\n *\r\n * The label will be formatted as per [[NumberFormatter]] set for the whole\r\n * chart, or explicitly for this Axis.\r\n *\r\n * @ignore Exclude from docs\r\n * @param position Position (px)\r\n * @return Label (numeric value)\r\n */\n\n\n ValueAxis.prototype.getTooltipText = function (position) {\n var value = $math.round(this.positionToValue(position), this._stepDecimalPlaces + this.extraTooltipPrecision);\n var valueStr = this.tooltip.numberFormatter.format(value);\n\n if (!this._adapterO) {\n return valueStr;\n } else {\n return this._adapterO.apply(\"getTooltipText\", valueStr);\n }\n };\n /**\r\n * Zooms axis to specific values.\r\n *\r\n * @param startValue Start value\r\n * @param endValue End value\r\n * @param skipRangeEvent Do not invoke events\r\n * @param instantly Do not play zoom animations\r\n */\n\n\n ValueAxis.prototype.zoomToValues = function (startValue, endValue, skipRangeEvent, instantly) {\n var start = (startValue - this.min) / (this.max - this.min);\n var end = (endValue - this.min) / (this.max - this.min);\n this.zoom({\n start: start,\n end: end\n }, skipRangeEvent, instantly);\n };\n\n Object.defineProperty(ValueAxis.prototype, \"minZoomed\", {\n /**\r\n * A smallest value in axis scale within current zoom.\r\n *\r\n * @return Min zoom value\r\n */\n get: function get() {\n if (!this.syncWithAxis) {\n return $math.max(this.min, this._minZoomed);\n } else {\n return this._minZoomed;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"maxZoomed\", {\n /**\r\n * A biggest value in axis scale within current zoom.\r\n * @return [description]\r\n */\n get: function get() {\n if (!this.syncWithAxis) {\n return $math.min(this.max, this._maxZoomed);\n } else {\n return this._maxZoomed;\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates positioning of Axis breaks after something changes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n ValueAxis.prototype.fixAxisBreaks = function () {\n var _this = this;\n\n _super.prototype.fixAxisBreaks.call(this);\n\n var axisBreaks = this._axisBreaks;\n\n if (axisBreaks && axisBreaks.length > 0) {\n // process breaks\n axisBreaks.each(function (axisBreak) {\n var startValue = axisBreak.adjustedStartValue;\n var endValue = axisBreak.adjustedEndValue; // break difference\n\n var axisBreakDif = endValue - startValue;\n\n var axisBreakGridCount = Math.ceil(axisBreakDif * axisBreak.breakSize) * _this._gridCount / (_this.max - _this.min); // calculate min, max and step for axis break\n\n\n var breakMinMaxStep = _this.adjustMinMax(startValue, endValue, axisBreakDif, axisBreakGridCount, true);\n\n axisBreak.adjustedStep = breakMinMaxStep.step;\n axisBreak.adjustedMin = breakMinMaxStep.min;\n axisBreak.adjustedMax = breakMinMaxStep.max;\n });\n }\n\n this._difference = this.adjustDifference(this.min, this.max);\n };\n /**\r\n * Returns value based on position.\r\n *\r\n * Please note that `position` represents position within axis which may be\r\n * zoomed and not correspond to Cursor's `position`.\r\n *\r\n * To convert Cursor's `position` to Axis' `position` use `toAxisPosition()` method.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/tutorials/tracking-cursors-position-via-api/#Tracking_Cursor_s_position} For more information about cursor tracking.\r\n * @param position Relative position on axis (0-1)\r\n * @return Position label\r\n */\n\n\n ValueAxis.prototype.getPositionLabel = function (position) {\n var value = this.positionToValue(position);\n return this.numberFormatter.format(value);\n };\n /**\r\n * Shows Axis tooltip at specific value\r\n *\r\n * @param value Value\r\n */\n\n\n ValueAxis.prototype.showTooltipAt = function (value) {\n this.showTooltipAtPosition(this.valueToPosition(value));\n };\n /**\r\n * Copies all properties and related data from a different instance of Axis.\r\n *\r\n * @param source Source Axis\r\n */\n\n\n ValueAxis.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.min = source.min;\n this.max = source.max;\n this.calculateTotals = source.calculateTotals;\n this._baseValue = source.baseValue;\n };\n\n Object.defineProperty(ValueAxis.prototype, \"syncWithAxis\", {\n /**\r\n * @return Target axis\r\n */\n get: function get() {\n return this.getPropertyValue(\"syncWithAxis\");\n },\n\n /**\r\n * Enables syncing of grid with another axis.\r\n *\r\n * To enable, set to a reference of the other `ValueAxis`. This axis will try\r\n * to maintain its scale in such way that its grid matches target axis grid.\r\n *\r\n * IMPORTANT #1: At this stage it's an experimental feature. Use it at your\r\n * own risk, as it may not work in 100% of the scenarios.\r\n *\r\n * IMPORTANT #2: `syncWithAxis` is not compatible with `strictMinMax` and\r\n * `sequencedInterpolation` settings.\r\n *\r\n * IMPORTANT #3: `syncWithAxis` is not compatible with scrollbars. Make sure\r\n * you do not add a scrollbar in the same direction as synced axes. For\r\n * example, if you have vertical synced axes, do not add `scrollbarY` on\r\n * your chart. It will create anomalies when used.\r\n *\r\n * IMPORTANT #4: `syncWithAxis` is not compatible with `XYCursor` if it has\r\n * its `behavior` set to either `zoomY` or `zoomXY`.\r\n *\r\n * @since 4.8.1\r\n * @param axis Target axis\r\n */\n set: function set(axis) {\n var _this = this;\n\n if (this.setPropertyValue(\"syncWithAxis\", axis, true)) {\n if (axis) {\n this._disposers.push(axis.events.on(\"extremeschanged\", this.handleSelectionExtremesChange, this, false));\n\n this._disposers.push(axis.events.on(\"selectionextremeschanged\", this.handleSelectionExtremesChange, this, false));\n\n this._disposers.push(axis.events.on(\"startendchanged\", this.handleSelectionExtremesChange, this, false));\n\n this.events.on(\"shown\", this.handleSelectionExtremesChange, this, false);\n this.events.on(\"maxsizechanged\", function () {\n _this.clearCache();\n\n _this._disposers.push(registry.events.once(\"exitframe\", function () {\n _this.handleSelectionExtremesChange();\n }));\n }, this, false);\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ValueAxis.prototype, \"treatZeroAs\", {\n /**\r\n * @return Zero replacement value\r\n */\n get: function get() {\n return this.getPropertyValue(\"treatZeroAs\");\n },\n\n /**\r\n * If set, zero values will be treated as this value.\r\n *\r\n * It is useful if you need to use data with zero-values on a logarithmic\r\n * axis scale.\r\n *\r\n * @since 4.9.34\r\n * @param value Zero replacement value\r\n */\n set: function set(value) {\n this.setPropertyValue(\"treatZeroAs\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Syncs with a target axis.\r\n *\r\n * @param min Min\r\n * @param max Max\r\n * @param step Step\r\n */\n\n ValueAxis.prototype.syncAxes = function (min, max, step) {\n var axis = this.syncWithAxis;\n\n if (axis) {\n if (!$type.isNumber(min)) {\n min = this.min;\n }\n\n if (!$type.isNumber(max)) {\n max = this.max;\n }\n\n if (!$type.isNumber(step)) {\n step = this._step;\n }\n\n var count = Math.round((axis.maxZoomed - axis.minZoomed) / axis.step);\n var currentCount = Math.round((max - min) / step);\n\n if ($type.isNumber(count) && $type.isNumber(currentCount)) {\n var synced = false;\n var c = 0;\n var diff = (max - min) * 0.01;\n var omin = min;\n var omax = max;\n var ostep = step;\n\n while (synced != true) {\n synced = this.checkSync(omin, omax, ostep, count);\n c++;\n\n if (c > 1000) {\n synced = true;\n }\n\n if (!synced) {\n //omin = min - diff * c;\n if (c / 3 == Math.round(c / 3)) {\n omin = min - diff * c;\n\n if (min >= 0 && omin < 0) {\n omin = 0;\n }\n } else {\n omax = max + diff * c;\n\n if (omax <= 0 && omax > 0) {\n omax = 0;\n }\n }\n\n var minMaxStep = this.adjustMinMax(omin, omax, omax - omin, this._gridCount, true);\n omin = minMaxStep.min;\n omax = minMaxStep.max;\n ostep = minMaxStep.step;\n } else {\n min = omin;\n max = omax;\n step = ostep;\n }\n }\n }\n }\n\n return {\n min: min,\n max: max,\n step: step\n };\n };\n /**\r\n * Returns `true` if axis needs to be resunced with some other axis.\r\n */\n\n\n ValueAxis.prototype.checkSync = function (min, max, step, count) {\n var currentCount = (max - min) / step;\n\n for (var i = 1; i < count; i++) {\n if ($math.round(currentCount / i, 1) == count || currentCount * i == count) {\n return true;\n }\n }\n\n return false;\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n ValueAxis.prototype.processConfig = function (config) {\n if (config) {\n // Set up axes\n if ($type.hasValue(config.syncWithAxis) && $type.isString(config.syncWithAxis)) {\n if (this.map.hasKey(config.syncWithAxis)) {\n config.syncWithAxis = this.map.getKey(config.syncWithAxis);\n } else {\n this.processingErrors.push(\"[ValueAxis] No axis with id \\\"\" + config.syncWithAxis + \"\\\" found for `syncWithAxis`\");\n delete config.xAxis;\n }\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n\n return ValueAxis;\n}(Axis);\n\nexport { ValueAxis };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ValueAxis\"] = ValueAxis;\nregistry.registeredClasses[\"ValueAxisDataItem\"] = ValueAxisDataItem;","/**\r\n * Module, defining Axis Renderer for vertical axes.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { AxisRenderer } from \"./AxisRenderer\";\nimport { AxisBullet } from \"./AxisBullet\";\nimport { WavedLine } from \"../../core/elements/WavedLine\";\nimport { WavedRectangle } from \"../../core/elements/WavedRectangle\";\nimport { registry } from \"../../core/Registry\";\nimport { percent, Percent } from \"../../core/utils/Percent\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $path from \"../../core/rendering/Path\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $type from \"../../core/utils/Type\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../../core/utils/Responsive\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A renderer for horizontal axis.\r\n *\r\n * @see {@link IAxisRendererEvents} for a list of available events\r\n * @see {@link IAxisRendererAdapters} for a list of available Adapters\r\n */\n\nvar AxisRendererX =\n/** @class */\nfunction (_super) {\n __extends(AxisRendererX, _super);\n /**\r\n * Constructor.\r\n *\r\n * @param axis Related axis\r\n */\n\n\n function AxisRendererX() {\n var _this = _super.call(this) || this;\n\n _this.className = \"AxisRendererX\";\n _this.minGridDistance = 120;\n _this.opposite = false;\n _this.rotation = 0;\n _this.width = percent(100);\n _this.labels.template.horizontalCenter = \"middle\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n AxisRendererX.prototype.setAxis = function (axis) {\n _super.prototype.setAxis.call(this, axis);\n\n axis.layout = \"vertical\";\n };\n /**\r\n * @ignore\r\n */\n\n\n AxisRendererX.prototype.updateGridContainer = function () {\n var axis = this.axis;\n\n if (axis) {\n var gridContainer = this.gridContainer;\n gridContainer.x = axis.pixelX;\n gridContainer.width = axis.axisLength;\n }\n };\n /**\r\n * Called when rendered is attached to an Axis, as well as a property of\r\n * Axis that might affect the appearance is updated.\r\n *\r\n * E.g. `axis.opposite`, `axis.inside`, etc.\r\n *\r\n * This method is called **before** draw, so that any related setting\r\n * changed in this method can be changed.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererX.prototype.processRenderer = function () {\n _super.prototype.processRenderer.call(this); // can not do this in init, as axis is set later\n\n\n var axis = this.axis;\n\n if (axis) {\n if (!(axis.width instanceof Percent)) {\n axis.width = percent(100);\n } // @todo Is thi sneeded?\n\n\n $utils.used(this.line);\n var title = axis.title;\n title.rotation = 0;\n title.align = \"center\";\n\n if (this.opposite) {\n this.line.toFront();\n title.toBack();\n } else {\n title.toFront();\n this.toBack();\n this.line.toBack();\n }\n }\n };\n /**\r\n * Updates some of the Axis tooltip's visual properties, related to\r\n * rendering of the Axis.\r\n *\r\n * @todo Description (review)\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererX.prototype.updateTooltip = function () {\n var axis = this.axis;\n\n if (axis) {\n var bigNum = 1000;\n var bbx = this.line.pixelX;\n var bby = this.line.pixelY;\n var bbw = this.axisLength;\n var bbh = bigNum; // top\n\n if (this.opposite) {\n if (!this.inside) {\n bby = -bigNum;\n bbh = bigNum;\n }\n } // bottom\n else {\n if (this.inside) {\n bby = -bigNum;\n bbh = bigNum;\n }\n }\n\n this.axis.updateTooltip(\"vertical\", {\n x: bbx,\n y: bby,\n width: bbw,\n height: bbh\n });\n }\n };\n /**\r\n * Updates and positions a label element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param label Label element\r\n * @param position Starting position\r\n * @param endPosition Ending position\r\n */\n\n\n AxisRendererX.prototype.updateLabelElement = function (label, position, endPosition, location) {\n if (!$type.hasValue(location)) {\n location = label.location;\n }\n\n position = position + (endPosition - position) * location;\n var point = this.positionToPoint(position);\n label.isMeasured = !label.inside;\n var deltaY = 0;\n var verticalCenter;\n var maxHeight = this.gridContainer.maxHeight;\n\n if (this.opposite) {\n if (label.inside) {\n verticalCenter = \"top\";\n\n if (label.valign == \"bottom\") {\n deltaY = maxHeight;\n verticalCenter = \"bottom\";\n }\n\n if (label.valign == \"middle\") {\n deltaY = maxHeight / 2;\n verticalCenter = \"middle\";\n }\n } else {\n verticalCenter = \"bottom\";\n }\n\n point.y = deltaY;\n } else {\n if (label.inside) {\n verticalCenter = \"bottom\";\n\n if (label.valign == \"top\") {\n deltaY = -maxHeight;\n verticalCenter = \"top\";\n }\n\n if (label.valign == \"middle\") {\n deltaY = -maxHeight / 2;\n verticalCenter = \"middle\";\n }\n } else {\n verticalCenter = \"top\";\n }\n\n point.y += deltaY;\n }\n\n if (label.rotation == 0) {\n // Apply fuzzy logic to verticalCenter only if labels are not rotated\n label.verticalCenter = verticalCenter;\n }\n\n this.positionItem(label, point);\n this.toggleVisibility(label, position, this.minLabelPosition, this.maxLabelPosition);\n };\n\n Object.defineProperty(AxisRendererX.prototype, \"axisLength\", {\n /**\r\n * Returns actual length of the Axis, in pixels.\r\n *\r\n * @return Length (px)\r\n */\n get: function get() {\n var axis = this.axis;\n return axis.measuredWidth - axis.pixelPaddingRight - axis.pixelPaddingLeft || 0;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts relative position on axis to point coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @param position2 Position (0-1) Position on the second axis\r\n * @return Point\r\n */\n\n AxisRendererX.prototype.positionToPoint = function (position, position2) {\n return {\n x: this.positionToCoordinate(position),\n y: 0\n };\n };\n /**\r\n * Converts a point at specific coordinates to a relative position (0-1)\r\n * on the axis.\r\n *\r\n * @param point Point\r\n * @return Position (0-1)\r\n */\n\n\n AxisRendererX.prototype.pointToPosition = function (point) {\n return this.coordinateToPosition(point.x, point.y);\n };\n /**\r\n * [getPositionRangePath description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param startPosition Starting position\r\n * @param endPosition End position\r\n * @return SVG path\r\n */\n\n\n AxisRendererX.prototype.getPositionRangePath = function (startPosition, endPosition) {\n var x1 = $math.fitToRange(this.positionToCoordinate(startPosition), 0, this.axisLength);\n var x2 = $math.fitToRange(this.positionToCoordinate(endPosition), 0, this.axisLength);\n var w = Math.abs(x2 - x1);\n var h = this.getHeight();\n var x = Math.min(x1, x2);\n var y = 0;\n return $path.rectToPath({\n x: x,\n y: y,\n width: w,\n height: h\n }, true);\n };\n /**\r\n * Updates and positions an axis break element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param axisBreak Break element\r\n */\n\n\n AxisRendererX.prototype.updateBreakElement = function (axisBreak) {\n _super.prototype.updateBreakElement.call(this, axisBreak);\n\n var startLine = axisBreak.startLine;\n var endLine = axisBreak.endLine;\n var fillShape = axisBreak.fillShape;\n var startPoint = axisBreak.startPoint;\n var endPoint = axisBreak.endPoint;\n var y1 = axisBreak.pixelMarginLeft;\n var y2 = this.getHeight() - axisBreak.pixelMarginTop - axisBreak.pixelMarginBottom;\n startPoint.x = $math.fitToRange(startPoint.x, -1, this.axisLength + 1);\n endPoint.x = $math.fitToRange(endPoint.x, -1, this.axisLength + 1);\n\n if (startPoint.x == endPoint.x && (startPoint.x < 0 || startPoint.x > this.axisLength)) {\n axisBreak.fillShape.__disabled = true;\n } else {\n axisBreak.fillShape.__disabled = false;\n }\n\n startLine.y = y1;\n startLine.width = 0;\n startLine.height = y2;\n endLine.y = y1;\n endLine.width = 0;\n endLine.height = y2;\n fillShape.height = y2;\n fillShape.width = Math.abs(endPoint.x - startPoint.x);\n fillShape.y = y1;\n fillShape.x = startPoint.x;\n };\n /**\r\n * Updates and positions a grid element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param grid Grid element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRendererX.prototype.updateGridElement = function (grid, position, endPosition) {\n position = position + (endPosition - position) * grid.location;\n var point = this.positionToPoint(position); //point.x = $utils.spritePointToSprite({x:point.x, y:0}, this, this.gridContainer).x;\n\n grid.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: 0,\n y: this.getHeight()\n });\n this.positionItem(grid, point);\n this.toggleVisibility(grid, position, 0, 1);\n };\n /**\r\n * Updates and positions a tick element.\r\n *\r\n * @ignore Exclude from docs\r\n * @param tick Tick element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRendererX.prototype.updateTickElement = function (tick, position, endPosition) {\n position = position + (endPosition - position) * tick.location;\n var point = this.positionToPoint(position);\n var tickLength = tick.length;\n point.y = $utils.spritePointToSprite({\n x: 0,\n y: this.line.pixelY\n }, this.line.parent, this.gridContainer).y;\n\n if (this.opposite) {\n tickLength *= tick.inside ? 1 : -1;\n } else {\n tickLength *= tick.inside ? -1 : 1;\n }\n\n tick.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: 0,\n y: tickLength\n });\n this.positionItem(tick, point);\n this.toggleVisibility(tick, position, 0, 1);\n };\n /**\r\n * Updates and positions the axis line element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererX.prototype.updateAxisLine = function () {\n this.line.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: this.axisLength,\n y: 0\n });\n };\n /**\r\n * Updates and positions the base grid element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n AxisRendererX.prototype.updateBaseGridElement = function () {\n _super.prototype.updateBaseGridElement.call(this);\n\n var axis = this.axis;\n var h = this.getHeight();\n var w = this.axisLength;\n var baseGrid = this.baseGrid;\n var x = axis.basePoint.x;\n\n if (x < -0.2 || x > w + 0.2) {\n baseGrid.hide(0);\n } else {\n var y = $utils.spritePointToSprite({\n x: 0,\n y: 0\n }, this.gridContainer, baseGrid.parent).y;\n baseGrid.path = $path.moveTo({\n x: 0,\n y: 0\n }) + $path.lineTo({\n x: 0,\n y: h\n });\n baseGrid.moveTo({\n x: x,\n y: y\n });\n baseGrid.show(0);\n }\n };\n /**\r\n * Creates visual elements for and axis break.\r\n *\r\n * @ignore Exclude from docs\r\n * @param axisBreak Axis break\r\n */\n\n\n AxisRendererX.prototype.createBreakSprites = function (axisBreak) {\n axisBreak.startLine = new WavedLine();\n axisBreak.endLine = new WavedLine();\n var wavedRectangle = new WavedRectangle();\n wavedRectangle.setWavedSides(false, true, false, true);\n axisBreak.fillShape = wavedRectangle;\n };\n /**\r\n * @ignore\r\n */\n\n\n AxisRendererX.prototype.toAxisPosition = function (value) {\n var inversedPosition = value;\n var axis = this.axis;\n\n if (axis) {\n var relativePositionSprite = axis.relativePositionSprite;\n var x = axis.pixelX;\n\n if (relativePositionSprite) {\n x = $utils.spritePointToSprite({\n x: this.pixelX,\n y: 0\n }, this.parent, relativePositionSprite).x;\n } else {\n relativePositionSprite = axis.parent;\n }\n\n if (relativePositionSprite) {\n var relativeX = x / relativePositionSprite.innerWidth;\n var relativeWidth = axis.axisLength / relativePositionSprite.innerWidth;\n return (inversedPosition - relativeX) / relativeWidth;\n }\n }\n\n return value;\n };\n /**\r\n * Updates and positions axis bullets.\r\n *\r\n * @ignore Exclude from docs\r\n * @param bullet AxisBullet element\r\n * @param position Starting position\r\n * @param endPosition End position\r\n */\n\n\n AxisRendererX.prototype.updateBullet = function (bullet, position, endPosition) {\n var location = 0.5;\n\n if (bullet instanceof AxisBullet) {\n location = bullet.location;\n }\n\n position = position + (endPosition - position) * location;\n var point = this.positionToPoint(position);\n point.y = $utils.spritePointToSprite({\n x: 0,\n y: this.line.pixelY\n }, this.line.parent, this.gridContainer).y;\n this.positionItem(bullet, point);\n this.toggleVisibility(bullet, position, 0, 1);\n };\n\n return AxisRendererX;\n}(AxisRenderer);\n\nexport { AxisRendererX };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AxisRendererX\"] = AxisRendererX;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Put labels inside plot area.\r\n * Disable first and last labels.\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.heightXS,\n state: function state(target, stateId) {\n if (target instanceof AxisRendererX) {\n var state = target.states.create(stateId);\n state.properties.inside = true;\n state.properties.maxLabelPosition = 0.9;\n state.properties.minLabelPosition = 0.1;\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Disable labels altogather on very small charts\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.heightXXS,\n state: function state(target, stateId) {\n if (target instanceof AxisRendererX) {\n var state = target.states.create(stateId);\n state.properties.disabled = true;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * HeatLegend module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { LinearGradient } from \"../../core/rendering/fills/LinearGradient\";\nimport { registry } from \"../../core/Registry\";\nimport { toColor, Color } from \"../../core/utils/Color\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { percent } from \"../../core/utils/Percent\";\nimport { ValueAxis } from \"../../charts/axes/ValueAxis\";\nimport { AxisRendererX } from \"../../charts/axes/AxisRendererX\";\nimport { AxisRendererY } from \"../../charts/axes/AxisRendererY\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $colors from \"../../core/utils/Colors\";\nimport { RoundedRectangle } from \"../../core/elements/RoundedRectangle\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This class creates a link (waved color-filled line) between two nodes in a\r\n * Sankey Diagram.\r\n *\r\n * @see {@link IHeatLegendEvents} for a list of available events\r\n * @see {@link IHeatLegendAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar HeatLegend =\n/** @class */\nfunction (_super) {\n __extends(HeatLegend, _super);\n /**\r\n * Constructor\r\n */\n\n\n function HeatLegend() {\n var _this = _super.call(this) || this;\n\n _this.className = \"HeatLegend\";\n _this.markerContainer = _this.createChild(Container);\n _this.markerContainer.shouldClone = false;\n _this.markerCount = 1; // Create a template container and list for the a marker\n\n var marker = new RoundedRectangle();\n marker.minHeight = 20;\n marker.minWidth = 20;\n marker.interactionsEnabled = false;\n marker.fillOpacity = 1;\n marker.cornerRadius(0, 0, 0, 0);\n _this.markerContainer.minHeight = 20;\n _this.markerContainer.minWidth = 20;\n _this.orientation = \"horizontal\";\n _this.markers = new ListTemplate(marker);\n\n _this._disposers.push(new ListDisposer(_this.markers));\n\n _this._disposers.push(_this.markers.template);\n\n _this.applyTheme();\n\n return _this;\n }\n\n HeatLegend.prototype.getMinFromRules = function (property) {\n var series = this.series;\n\n if (series) {\n var minValue_1;\n $iter.eachContinue(series.heatRules.iterator(), function (heatRule) {\n if (heatRule.property == property) {\n minValue_1 = heatRule.min;\n return false;\n }\n\n return true;\n });\n return minValue_1;\n }\n };\n\n HeatLegend.prototype.getMaxFromRules = function (property) {\n var series = this.series;\n\n if (series) {\n var maxValue_1;\n $iter.each(series.heatRules.iterator(), function (heatRule) {\n if (heatRule.property == property) {\n maxValue_1 = heatRule.max;\n return false;\n }\n\n return true;\n });\n return maxValue_1;\n }\n };\n /**\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n HeatLegend.prototype.validate = function () {\n _super.prototype.validate.call(this);\n\n this.valueAxis.renderer.inversed = this.reverseOrder;\n var series = this.series;\n var minColor = this.minColor;\n var maxColor = this.maxColor;\n\n if (!$type.hasValue(minColor)) {\n minColor = toColor(this.getMinFromRules(\"fill\"));\n }\n\n if (!$type.hasValue(maxColor)) {\n maxColor = toColor(this.getMaxFromRules(\"fill\"));\n }\n\n if (series) {\n var seriesFill = series.fill;\n\n if (!$type.hasValue(minColor) && seriesFill instanceof Color) {\n minColor = seriesFill;\n }\n\n if (!$type.hasValue(maxColor) && seriesFill instanceof Color) {\n maxColor = seriesFill;\n }\n }\n\n if (!$type.hasValue(maxColor)) {\n maxColor = toColor(this.getMaxFromRules(\"fill\"));\n }\n\n var minOpacity = $type.toNumber(this.getMinFromRules(\"fillOpacity\"));\n\n if (!$type.isNumber(minOpacity)) {\n minOpacity = 1;\n }\n\n var maxOpacity = $type.toNumber(this.getMaxFromRules(\"fillOpacity\"));\n\n if (!$type.isNumber(maxOpacity)) {\n maxOpacity = 1;\n }\n\n var minStrokeOpacity = $type.toNumber(this.getMinFromRules(\"strokeOpacity\"));\n\n if (!$type.isNumber(minStrokeOpacity)) {\n minStrokeOpacity = 1;\n }\n\n var maxStrokeOpacity = $type.toNumber(this.getMaxFromRules(\"strokeOpacity\"));\n\n if (!$type.isNumber(maxStrokeOpacity)) {\n maxStrokeOpacity = 1;\n }\n\n var minStroke = toColor(this.getMinFromRules(\"stroke\"));\n var maxStroke = toColor(this.getMaxFromRules(\"stroke\")); //if (series) {\n\n for (var i = 0; i < this.markerCount; i++) {\n var marker = this.markers.getIndex(i);\n\n if (!marker) {\n marker = this.markers.create();\n marker.parent = this.markerContainer;\n marker.height = percent(100);\n marker.width = percent(100);\n }\n\n if (this.markerCount == 1) {\n var gradient = new LinearGradient();\n\n if (this.reverseOrder) {\n gradient.addColor(maxColor, maxOpacity);\n gradient.addColor(minColor, minOpacity);\n } else {\n gradient.addColor(minColor, minOpacity);\n gradient.addColor(maxColor, maxOpacity);\n }\n\n if (this.orientation == \"vertical\") {\n gradient.rotation = -90;\n }\n\n marker.fill = gradient;\n\n if ($type.hasValue(minStroke) && $type.hasValue(maxStroke)) {\n var strokeGradient = new LinearGradient();\n\n if (this.reverseOrder) {\n strokeGradient.addColor(maxStroke, maxStrokeOpacity);\n strokeGradient.addColor(minStroke, minStrokeOpacity);\n } else {\n strokeGradient.addColor(minStroke, minStrokeOpacity);\n strokeGradient.addColor(maxStroke, maxStrokeOpacity);\n }\n\n if (this.orientation == \"vertical\") {\n strokeGradient.rotation = -90;\n }\n\n marker.stroke = strokeGradient;\n }\n } else {\n var c = i;\n\n if (this.reverseOrder) {\n c = this.markerCount - i - 1;\n }\n\n var color = new Color($colors.interpolate(minColor.rgb, maxColor.rgb, c / this.markerCount));\n marker.fill = color;\n var opacity = minOpacity + (maxOpacity - minOpacity) * c / this.markerCount;\n marker.fillOpacity = opacity;\n\n if ($type.hasValue(minStroke) && $type.hasValue(maxStroke)) {\n var color_1 = new Color($colors.interpolate(minStroke.rgb, maxStroke.rgb, c / this.markerCount));\n marker.stroke = color_1;\n var opacity_1 = minStrokeOpacity + (maxStrokeOpacity - minStrokeOpacity) * c / this.markerCount;\n marker.strokeOpacity = opacity_1;\n }\n }\n }\n\n var renderer = this.valueAxis.renderer;\n\n if (this.markerCount > 1) {\n if (this.orientation == \"horizontal\") {\n renderer.minGridDistance = this.measuredWidth / this.markerCount;\n } else {\n renderer.minGridDistance = this.measuredHeight / this.markerCount;\n }\n }\n\n this.valueAxis.invalidate();\n\n for (var i = this.markerCount, len = this.markers.length; i < len; i++) {\n this.markers.getIndex(i).parent = undefined;\n }\n };\n\n Object.defineProperty(HeatLegend.prototype, \"minColor\", {\n /**\r\n * Returns minColor value\r\n * @return {Color}\r\n */\n get: function get() {\n return this.getPropertyValue(\"minColor\");\n },\n\n /**\r\n * Min color of a heat legend. If a series is set for the legend, minColor is taken from series.\r\n *\r\n * @param {Color}\r\n */\n set: function set(value) {\n if (!(value instanceof Color)) {\n value = toColor(value);\n }\n\n this.setColorProperty(\"minColor\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"maxColor\", {\n /**\r\n * Returns maxColor value\r\n * @return {Color}\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxColor\");\n },\n\n /**\r\n * Max color of a heat legend. If a series is set for the legend, maxColor is taken from series.\r\n *\r\n * @param {Color}\r\n */\n set: function set(value) {\n if (!(value instanceof Color)) {\n value = toColor(value);\n }\n\n this.setColorProperty(\"maxColor\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"markerCount\", {\n /**\r\n * Returns number of color squares (markers).\r\n * @return {number}\r\n */\n get: function get() {\n return this.getPropertyValue(\"markerCount\");\n },\n\n /**\r\n * Number of color squares (markers) in the heat legend. If only 1 marker is used, it will be filled with gradient.\r\n *\r\n * @param {number}\r\n */\n set: function set(value) {\n this.setPropertyValue(\"markerCount\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"minValue\", {\n /**\r\n * Returns minimum value of heat legend.\r\n * @return {number}\r\n */\n get: function get() {\n return this.getPropertyValue(\"minValue\");\n },\n\n /**\r\n * Minimum value of heat legend's value axis. If a series is set for the legend, min is taken from series.\r\n *\r\n * @param {number}\r\n */\n set: function set(value) {\n this.setPropertyValue(\"minValue\", value);\n this.valueAxis.min = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"maxValue\", {\n /**\r\n * Returns maximum value of heat legend.\r\n * @return {number}\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxValue\");\n },\n\n /**\r\n * Maximum value of heat legend's value axis. If a series is set for the legend, max is taken from series.\r\n *\r\n * @param {number}\r\n */\n set: function set(value) {\n this.setPropertyValue(\"maxValue\", value);\n this.valueAxis.max = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"orientation\", {\n /**\r\n * Returns orientation value.\r\n *\r\n * @return {\"horizontal\" | \"vertical\"}\r\n */\n get: function get() {\n return this.getPropertyValue(\"orientation\");\n },\n\n /**\r\n * Heat legend orientation. Note, if you change orientation of a heat legend, you must set value axis renderer properties after that, as with orientation renderer changes.\r\n *\r\n * @param {\"horizontal\" | \"vertical\"}\r\n */\n set: function set(value) {\n this.setPropertyValue(\"orientation\", value, true);\n var markerContainer = this.markerContainer;\n var valueAxis = this.valueAxis; // HORIZONTAL\n\n if (value == \"horizontal\") {\n if (!$type.hasValue(this.width)) {\n this.width = 200;\n }\n\n this.height = undefined;\n valueAxis.width = percent(100);\n valueAxis.height = undefined;\n valueAxis.tooltip.pointerOrientation = \"vertical\";\n this.layout = \"vertical\";\n markerContainer.width = percent(100);\n markerContainer.height = undefined;\n\n if (!(valueAxis.renderer instanceof AxisRendererX)) {\n valueAxis.renderer = new AxisRendererX();\n }\n } // VERTICAL\n else {\n if (!$type.hasValue(this.height)) {\n this.height = 200;\n }\n\n this.width = undefined;\n this.layout = \"horizontal\";\n markerContainer.width = undefined;\n markerContainer.height = percent(100);\n valueAxis.height = percent(100);\n valueAxis.width = undefined;\n valueAxis.tooltip.pointerOrientation = \"horizontal\";\n\n if (!(valueAxis.renderer instanceof AxisRendererY)) {\n valueAxis.renderer = new AxisRendererY();\n }\n\n valueAxis.renderer.inside = true;\n valueAxis.renderer.labels.template.inside = true;\n this.markerContainer.reverseOrder = true;\n }\n\n var renderer = valueAxis.renderer;\n renderer.grid.template.disabled = true;\n renderer.axisFills.template.disabled = true;\n renderer.baseGrid.disabled = true;\n renderer.labels.template.padding(2, 3, 2, 3);\n renderer.minHeight = undefined;\n renderer.minWidth = undefined;\n this.markerContainer.layout = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"valueAxis\", {\n /**\r\n * Returns valueAxis value.\r\n * @return {ValueAxis}\r\n */\n get: function get() {\n if (!this._valueAxis) {\n this.valueAxis = this.createChild(ValueAxis);\n this.valueAxis.shouldClone = false;\n }\n\n return this._valueAxis;\n },\n\n /**\r\n * Sets a value axis of heat legend. Value axis for heat legend is created automatically.\r\n * @param {ValueAxis}\r\n */\n set: function set(valueAxis) {\n this._valueAxis = valueAxis;\n valueAxis.parent = this;\n valueAxis.strictMinMax = true;\n this.orientation = this.orientation;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(HeatLegend.prototype, \"series\", {\n /**\r\n * Returns series value.\r\n * @return {Series}\r\n */\n get: function get() {\n return this._series;\n },\n\n /**\r\n * You can set series for heat legend. It will take min, max, minColor and maxColor values from this series.\r\n * @param series\r\n */\n set: function set(series) {\n var _this = this;\n\n this._series = series;\n var dataField = \"value\";\n\n try {\n var dataFieldDefined = series.heatRules.getIndex(0).dataField;\n\n if (dataFieldDefined) {\n dataField = dataFieldDefined;\n }\n } catch (err) {}\n\n this.updateMinMax(series.dataItem.values[dataField].low, series.dataItem.values[dataField].high);\n series.dataItem.events.on(\"calculatedvaluechanged\", function (event) {\n _this.updateMinMax(series.dataItem.values[dataField].low, series.dataItem.values[dataField].high);\n }, undefined, false);\n series.heatRules.events.on(\"inserted\", this.invalidate, this, false);\n series.heatRules.events.on(\"removed\", this.invalidate, this, false);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates min/max of value axis.\r\n * @ignore\r\n */\n\n HeatLegend.prototype.updateMinMax = function (min, max) {\n var valueAxis = this.valueAxis;\n\n if (!$type.isNumber(this.minValue)) {\n valueAxis.min = min;\n valueAxis.invalidate();\n }\n\n if (!$type.isNumber(this.maxValue)) {\n valueAxis.max = max;\n valueAxis.invalidate();\n }\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n HeatLegend.prototype.processConfig = function (config) {\n if (config) {\n // Set up series\n if ($type.hasValue(config.series) && $type.isString(config.series)) {\n if ($type.isString(config.series)) {\n if (this.map.hasKey(config.series)) {\n config.series = this.map.getKey(config.series);\n } else {\n var seriesId_1 = config.series;\n var disposer_1 = this.map.events.on(\"insertKey\", function (ev) {\n if (ev.key == seriesId_1) {\n this.series = ev.newValue;\n disposer_1.dispose();\n }\n }, this);\n\n this._disposers.push(disposer_1);\n\n delete config.series;\n }\n }\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n\n return HeatLegend;\n}(Container);\n\nexport { HeatLegend };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"HeatLegend\"] = HeatLegend;","/**\r\n * Grip module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Button } from \"./Button\";\nimport { Sprite } from \"../Sprite\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { registry } from \"../Registry\";\nimport { percent } from \"../utils/Percent\";\nimport * as $path from \"../rendering/Path\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a grip element that can be used for scrolling or other things.\r\n *\r\n * @see {@link IGripEvents} for a list of available events\r\n * @see {@link IGripAdapters} for a list of available Adapters\r\n * @since 4.4.0\r\n */\n\nvar Grip =\n/** @class */\nfunction (_super) {\n __extends(Grip, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Grip() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"Grip\";\n var cs = new InterfaceColorSet(); // Set defaults\n\n _this.layout = \"absolute\";\n\n _this.padding(10, 10, 10, 10);\n\n _this.margin(3, 3, 3, 3);\n\n _this.background.fillOpacity = 0.3;\n\n _this.background.cornerRadius(10, 10, 10, 10); // Create an icon\n\n\n var icon = new Sprite();\n icon.element = _this.paper.add(\"path\");\n var path = $path.moveTo({\n x: -6,\n y: 0\n });\n path += $path.lineTo({\n x: 6,\n y: 0\n });\n path += $path.moveTo({\n x: -8,\n y: -6\n });\n path += $path.lineTo({\n x: 0,\n y: -12\n });\n path += $path.lineTo({\n x: 8,\n y: -6\n });\n path += $path.moveTo({\n x: -8,\n y: 6\n });\n path += $path.lineTo({\n x: 0,\n y: 12\n });\n path += $path.lineTo({\n x: 8,\n y: 6\n });\n icon.path = path;\n icon.strokeWidth = 2;\n icon.fillOpacity = 0;\n icon.pixelPerfect = true;\n icon.padding(0, 4, 0, 4);\n icon.stroke = cs.getFor(\"text\");\n icon.strokeOpacity = 0.7;\n icon.align = \"center\";\n icon.valign = \"middle\";\n _this.icon = icon;\n\n _this.label.dispose();\n\n _this.label = undefined; // Set default position\n\n _this.position = \"right\"; // Set up autohide\n\n _this.autoHideDelay = 3000;\n\n _this.events.on(\"shown\", function (ev) {\n if (_this._autoHideTimeout) {\n _this._autoHideTimeout.dispose();\n }\n\n if (_this.autoHideDelay) {\n _this._autoHideTimeout = _this.setTimeout(function () {\n _this.hide();\n }, _this.autoHideDelay);\n }\n });\n\n _this.events.on(\"down\", function (ev) {\n if (_this._autoHideTimeout) {\n _this._autoHideTimeout.dispose();\n }\n });\n\n _this.events.on(\"out\", function (ev) {\n if (_this.autoHideDelay) {\n _this._autoHideTimeout = _this.setTimeout(function () {\n _this.hide();\n }, _this.autoHideDelay);\n }\n }); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Grip.prototype, \"position\", {\n /**\r\n * @return Position\r\n */\n get: function get() {\n return this.getPropertyValue(\"position\");\n },\n\n /**\r\n * Sets position of the grip.\r\n *\r\n * Available options: \"left\", \"right\" (default), \"top\", \"bottom\".\r\n *\r\n * @param value Position\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"position\", value)) {\n switch (value) {\n case \"left\":\n this.align = \"left\";\n this.valign = \"middle\";\n this.horizontalCenter = \"left\";\n this.verticalCenter = \"middle\";\n this.icon.rotation = 0;\n this.width = undefined;\n this.height = percent(30);\n break;\n\n case \"right\":\n this.align = \"right\";\n this.valign = \"middle\";\n this.horizontalCenter = \"right\";\n this.verticalCenter = \"middle\";\n this.icon.rotation = 0;\n this.width = undefined;\n this.height = percent(30);\n break;\n\n case \"top\":\n this.align = \"center\";\n this.valign = \"top\";\n this.horizontalCenter = \"middle\";\n this.verticalCenter = \"top\";\n this.icon.rotation = 90;\n this.width = percent(30);\n this.height = undefined;\n break;\n\n case \"bottom\":\n this.align = \"center\";\n this.valign = \"bottom\";\n this.horizontalCenter = \"middle\";\n this.verticalCenter = \"bottom\";\n this.icon.rotation = 90;\n this.width = percent(30);\n this.height = undefined;\n break;\n\n default:\n this.align = \"center\";\n this.valign = \"middle\";\n this.horizontalCenter = \"middle\";\n this.verticalCenter = \"middle\";\n this.icon.rotation = 90;\n this.width = percent(30);\n this.height = undefined;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Grip.prototype, \"autoHideDelay\", {\n /**\r\n * @return Delay\r\n */\n get: function get() {\n return this.getPropertyValue(\"autoHideDelay\");\n },\n\n /**\r\n * Number of milliseconds to show grip until it is hidden automatically.\r\n *\r\n * @default 3000\r\n * @param value Delay\r\n */\n set: function set(value) {\n this.setPropertyValue(\"autoHideDelay\", value);\n },\n enumerable: true,\n configurable: true\n });\n return Grip;\n}(Button);\n\nexport { Grip };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Grip\"] = Grip;","/**\r\n * [[Chart]] class provides base functionality for all chart types to inherit.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { registry } from \"../core/Registry\";\nimport { Component } from \"../core/Component\";\nimport { MutableValueDisposer, Disposer } from \"../core/utils/Disposer\";\nimport { ListTemplate, ListDisposer } from \"../core/utils/List\";\nimport { Container } from \"../core/Container\";\nimport { Label } from \"../core/elements/Label\";\nimport { Grip } from \"../core/elements/Grip\";\nimport { DataItem } from \"../core/DataItem\";\nimport { percent } from \"../core/utils/Percent\";\nimport * as $iter from \"../core/utils/Iterator\";\nimport * as $type from \"../core/utils/Type\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../core/utils/Responsive\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[Chart]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar ChartDataItem =\n/** @class */\nfunction (_super) {\n __extends(ChartDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ChartDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"ChartDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n return ChartDataItem;\n}(DataItem);\n\nexport { ChartDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for all Charts.\r\n *\r\n * @see {@link IChartEvents} for a list of available Events\r\n * @see {@link IChartAdapters} for a list of available Adapters\r\n */\n\nvar Chart =\n/** @class */\nfunction (_super) {\n __extends(Chart, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Chart() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * A reference to chart's [[Legend]].\r\n * @ignore\r\n */\n\n\n _this._legend = new MutableValueDisposer();\n\n if (_this.constructor === Chart) {\n throw new Error(\"'Chart' cannot be instantiated directly. Please use a specific chart type.\");\n }\n\n _this.className = \"Chart\"; // Create a list of titles\n\n var template = new Label();\n _this.titles = new ListTemplate(template);\n\n _this._disposers.push(new ListDisposer(_this.titles));\n\n _this._disposers.push(template); // Chart component is also a container. it holds _chartAndLegendCont and titles\n\n\n _this.width = percent(100);\n _this.height = percent(100);\n _this.layout = \"vertical\"; // Chart and legend\n\n var chartAndLegendContainer = _this.createChild(Container);\n\n chartAndLegendContainer.shouldClone = false;\n chartAndLegendContainer.layout = \"vertical\";\n chartAndLegendContainer.width = percent(100);\n chartAndLegendContainer.height = percent(100);\n _this.chartAndLegendContainer = chartAndLegendContainer; // Chart container holds all the elements of a chart, extept titles and legend\n\n var chartContainer = chartAndLegendContainer.createChild(Container);\n chartContainer.shouldClone = false;\n chartContainer.width = percent(100);\n chartContainer.height = percent(100);\n _this.chartContainer = chartContainer;\n _this.showOnInit = true;\n\n _this._disposers.push(_this._legend); // Add title list events to apply certain formatting options and to make\n // the chart reference them as accessible screen reader labels\n\n\n _this.titles.events.on(\"inserted\", function (label) {\n _this.processTitle(label);\n\n _this.updateReaderTitleReferences();\n }, _this, false);\n\n _this.titles.events.on(\"removed\", function (label) {\n _this.updateReaderTitleReferences();\n }, _this, false); // Accessibility\n // It seems we can't set focusable on the whole chart because it seems to\n // mess up the whole focus event system - getting a focus on an inside\n // object also trigger focus on parent\n //this.focusable = true;\n\n\n _this.role = \"region\";\n _this.defaultState.transitionDuration = 1; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n Chart.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this);\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Chart\");\n }\n };\n /**\r\n * Initiates drawing of the chart.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Chart.prototype.draw = function () {\n this.fixLayout();\n\n _super.prototype.draw.call(this);\n };\n /**\r\n * Updates legend's hierarchy based on the position.\r\n */\n\n\n Chart.prototype.fixLayout = function () {\n var legend = this.legend;\n\n if (legend) {\n var chartAndLegendContainer = this.chartAndLegendContainer;\n var chartContainer = this.chartContainer;\n chartContainer.x = undefined;\n chartContainer.y = undefined;\n\n if (legend.position != \"absolute\") {\n legend.x = undefined;\n legend.y = undefined;\n }\n\n switch (legend.position) {\n case \"left\":\n chartAndLegendContainer.layout = \"horizontal\";\n legend.toBack();\n break;\n\n case \"right\":\n chartAndLegendContainer.layout = \"horizontal\";\n legend.toFront();\n break;\n\n case \"top\":\n chartAndLegendContainer.layout = \"vertical\";\n legend.toBack();\n break;\n\n case \"bottom\":\n chartAndLegendContainer.layout = \"vertical\";\n legend.toFront();\n break;\n\n case \"absolute\":\n legend.isMeasured = false;\n break;\n }\n }\n };\n /**\r\n * Setups the legend to use the chart's data.\r\n */\n\n\n Chart.prototype.feedLegend = function () {// Nothing here. This method is provided only as a \"placeholder\" for\n // extending classes to override\n };\n /**\r\n * Adds a new title to the chart when it is inserted into chart's titles\r\n * list.\r\n * @param event An event object which is triggered when inserting into titles list\r\n * @return Label object\r\n */\n\n\n Chart.prototype.processTitle = function (event) {\n var title = event.newValue;\n title.parent = this;\n title.toBack();\n title.shouldClone = false;\n title.align = \"center\"; // Need to explicitly apply the `id` attribute so it can be referenced by\n // `aria-labelledby`\n\n title.uidAttr();\n return title;\n };\n /**\r\n * Checks if chart has any title elements. If it does, we will use them in an\r\n * `aria-labelledby` attribute so that screen readers can use them to properly\r\n * describe the chart when it is focused or hovered.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Chart.prototype.updateReaderTitleReferences = function () {\n if (this.titles.length) {\n var titleIds_1 = [];\n $iter.each(this.titles.iterator(), function (title) {\n titleIds_1.push(title.uid);\n });\n this.setSVGAttribute({\n \"aria-labelledby\": titleIds_1.join(\" \")\n });\n } else {\n this.removeSVGAttribute(\"aria-labelledby\");\n }\n };\n\n Object.defineProperty(Chart.prototype, \"legend\", {\n /**\r\n * @return Legend\r\n */\n get: function get() {\n return this._legend.get();\n },\n\n /**\r\n * Holds the instance of chart's [[Leged]].\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/legend/} for more information about legends\r\n * @param Legend\r\n */\n set: function set(legend) {\n this.setLegend(legend);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Prepares the legend instance for use in this chart.\r\n *\r\n * @param legend Legend\r\n */\n\n Chart.prototype.setLegend = function (legend) {\n var _this = this;\n\n if (this._legend.get() !== legend) {\n if (legend) {\n // Set legend options\n legend.parent = this.chartAndLegendContainer;\n\n this._legend.set(legend, legend.events.on(\"propertychanged\", function (event) {\n if (event.property == \"position\") {\n _this.fixLayout();\n }\n }, undefined, false));\n\n legend.addDisposer(new Disposer(function () {\n _this.legend = undefined;\n }));\n } else {\n this._legend.reset();\n }\n\n this.feedLegend();\n }\n };\n /**\r\n * Destroys this object and all related data.\r\n */\n\n\n Chart.prototype.dispose = function () {\n // otherwise there might be some errors when disposing chart which was just inited\n if (this.legend) {\n this.legend.dispose();\n }\n\n _super.prototype.dispose.call(this);\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n Chart.prototype.processConfig = function (config) {\n if (config) {\n // Set up legend\n if ($type.hasValue(config.legend) && !$type.hasValue(config.legend.type)) {\n config.legend.type = \"Legend\";\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n /**\r\n * Copies all properties from another instance of [[Series]].\r\n *\r\n * @param source Source series\r\n */\n\n\n Chart.prototype.copyFrom = function (source) {\n this.titles.copyFrom(source.titles);\n this.chartContainer.copyFrom(source.chartContainer);\n\n if (source.legend) {\n this.legend = source.legend.clone();\n this.legend.removeChildren();\n }\n\n _super.prototype.copyFrom.call(this, source);\n };\n\n Object.defineProperty(Chart.prototype, \"dragGrip\", {\n /**\r\n * @return Grip\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._dragGrip) {\n var grip_1 = this.tooltipContainer.createChild(Grip);\n grip_1.align = \"right\";\n grip_1.valign = \"middle\";\n grip_1.hide(0);\n grip_1.events.on(\"down\", function (ev) {\n if (ev.touch) {\n _this.interactionsEnabled = false;\n }\n });\n grip_1.events.on(\"up\", function (ev) {\n _this.interactionsEnabled = true;\n });\n this.events.on(\"down\", function (ev) {\n if (ev.touch) {\n grip_1.show();\n }\n });\n this._dragGrip = grip_1;\n }\n\n return this._dragGrip;\n },\n\n /**\r\n * An instance of [[Grip]] which serves as a grip point which appears on\r\n * touch and allows scrolling whole page even if chart is occupying the\r\n * whole of the screen and would otherwise prevent scrolling.\r\n *\r\n * @since 4.4.0\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/touch/} For more information.\r\n * @param value Grip\r\n */\n set: function set(value) {\n this._dragGrip = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Chart.prototype, \"focusable\", {\n get: function get() {\n return this.parent.focusable;\n },\n set: function set(value) {\n this.parent.focusable = value;\n },\n enumerable: true,\n configurable: true\n });\n return Chart;\n}(Component);\n\nexport { Chart };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Chart\"] = Chart;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Reduce horizontal margins\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.widthXS,\n state: function state(target, stateId) {\n if (target instanceof Chart) {\n var state = target.states.create(stateId);\n\n if (target.pixelPaddingLeft > 10) {\n state.properties.paddingLeft = 10;\n }\n\n if (target.pixelPaddingRight > 10) {\n state.properties.paddingRight = 10;\n }\n\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Reduce vertical margins\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.heightXS,\n state: function state(target, stateId) {\n if (target instanceof Chart) {\n var state = target.states.create(stateId);\n\n if (target.pixelPaddingTop > 10) {\n state.properties.paddingTop = 10;\n }\n\n if (target.pixelPaddingBottom > 10) {\n state.properties.paddingBottom = 10;\n }\n\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Remove horizontal padding\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.widthXXS,\n state: function state(target, stateId) {\n if (target instanceof Chart) {\n var state = target.states.create(stateId);\n state.properties.paddingLeft = 0;\n state.properties.paddingRight = 0;\n return state;\n }\n\n return null;\n }\n});\n/**\r\n * Remove vertical padding\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.heightXXS,\n state: function state(target, stateId) {\n if (target instanceof Chart) {\n var state = target.states.create(stateId);\n state.properties.paddingTop = 0;\n state.properties.paddingBottom = 0;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * Module that defines everything related to building bullets.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { registry } from \"../../core/Registry\";\nimport { defaultRules, ResponsiveBreakpoints } from \"../../core/utils/Responsive\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Class used to creates bullets.\r\n *\r\n * @see {@link IBulletEvents} for a list of available events\r\n * @see {@link IBulletAdapters} for a list of available Adapters\r\n * @todo Usage example\r\n * @important\r\n */\n\nvar Bullet =\n/** @class */\nfunction (_super) {\n __extends(Bullet, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Bullet() {\n var _this = _super.call(this) || this;\n\n _this.className = \"Bullet\";\n _this.isMeasured = false;\n _this.tooltipX = 0;\n _this.tooltipY = 0;\n _this.layout = \"none\";\n _this.applyOnClones = true;\n _this.copyToLegendMarker = true;\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(Bullet.prototype, \"locationX\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"locationX\");\n },\n\n /**\r\n * Relative horizontal location within cell. (0-1)\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"locationX\", value)) {\n var dataItem = this.dataItem;\n\n if (dataItem && dataItem.component) {\n dataItem.component.invalidate();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Bullet.prototype, \"locationY\", {\n /**\r\n * @return Location (0-1)\r\n */\n get: function get() {\n return this.getPropertyValue(\"locationY\");\n },\n\n /**\r\n * Relative vertical location within cell. (0-1)\r\n *\r\n * @param value Location (0-1)\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"locationY\", value)) {\n var dataItem = this.dataItem;\n\n if (dataItem && dataItem.component) {\n dataItem.component.invalidate();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Bullet.prototype, \"xField\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this.getPropertyValue(\"xField\");\n },\n\n /**\r\n * [xField description]\r\n *\r\n * @todo Description\r\n * @param value [description]\r\n */\n set: function set(value) {\n this.setPropertyValue(\"xField\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Bullet.prototype, \"yField\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this.getPropertyValue(\"yField\");\n },\n\n /**\r\n * [yField description]\r\n *\r\n * Description\r\n * @param value [description]\r\n */\n set: function set(value) {\n this.setPropertyValue(\"yField\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Bullet.prototype, \"isDynamic\", {\n /**\r\n * @return Redraw on data change?\r\n */\n get: function get() {\n return this.getPropertyValue(\"isDynamic\");\n },\n\n /**\r\n * Indicates if the bullet is \"dynamic\".\r\n *\r\n * In most cases the bullets remain the same, even if the underlying data\r\n * changes.\r\n *\r\n * However, in cases where bullet also displays a label, or its size depends\r\n * on data, it also needs to be redrawn when the underlying data changes.\r\n *\r\n * Only those bullets that have set `isDynamic = true` will be redrawn each\r\n * time data changes. Regular bullets will be reused as they are.\r\n *\r\n * @default false\r\n * @param value Redraw on data change?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"isDynamic\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Bullet.prototype, \"copyToLegendMarker\", {\n /**\r\n * @return Redraw on data change?\r\n */\n get: function get() {\n return this.getPropertyValue(\"copyToLegendMarker\");\n },\n\n /**\r\n * Indicates if the bullet should be copied to legend marker\r\n *\r\n * @default false\r\n * @param value Redraw on data change?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"copyToLegendMarker\", value);\n },\n enumerable: true,\n configurable: true\n });\n return Bullet;\n}(Container);\n\nexport { Bullet };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Bullet\"] = Bullet;\n/**\r\n * Add default responsive rules\r\n */\n\n/**\r\n * Hide bullets\r\n */\n\ndefaultRules.push({\n relevant: ResponsiveBreakpoints.isXS,\n state: function state(target, stateId) {\n if (target instanceof Bullet) {\n var state = target.states.create(stateId);\n state.properties.disabled = true;\n return state;\n }\n\n return null;\n }\n});","/**\r\n * Functionality for any series-based elements, like Line Series (graphs),\r\n * Pie slice lists, etc.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Component } from \"../../core/Component\";\nimport { Sprite } from \"../../core/Sprite\";\nimport { List, ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { Dictionary, DictionaryDisposer } from \"../../core/utils/Dictionary\";\nimport { DataItem } from \"../../core/DataItem\";\nimport { Container } from \"../../core/Container\";\nimport { Tooltip } from \"../../core/elements/Tooltip\";\nimport { Bullet } from \"../elements/Bullet\";\nimport { LegendSettings } from \"../Legend\";\nimport { options } from \"../../core/Options\";\nimport { Color } from \"../../core/utils/Color\";\nimport { registry } from \"../../core/Registry\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $ease from \"../../core/utils/Ease\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $object from \"../../core/utils/Object\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $array from \"../../core/utils/Array\";\nimport * as $colors from \"../../core/utils/Colors\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[Series]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar SeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(SeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function SeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"SeriesDataItem\"; //@todo Should we make `bullets` list disposable?\n //this._disposers.push(new DictionaryDisposer(this.bullets));\n\n _this.values.value = {};\n _this.values.value = {};\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(SeriesDataItem.prototype, \"bullets\", {\n /**\r\n * A dictionary of data items bullets, where key is uid of a bullet template.\r\n */\n get: function get() {\n if (!this._bullets) {\n this._bullets = new Dictionary();\n\n this._disposers.push(new DictionaryDisposer(this._bullets));\n }\n\n return this._bullets;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Destroys this object and all related data.\r\n */\n\n SeriesDataItem.prototype.dispose = function () {\n this.bullets.clear();\n\n _super.prototype.dispose.call(this);\n };\n\n Object.defineProperty(SeriesDataItem.prototype, \"value\", {\n /**\r\n * @return Value\r\n */\n get: function get() {\n return this.values.value.value;\n },\n\n /**\r\n * data items's numeric value.\r\n *\r\n * @param value Value\r\n */\n set: function set(value) {\n this.setValue(\"value\", value);\n },\n enumerable: true,\n configurable: true\n });\n return SeriesDataItem;\n}(DataItem);\n\nexport { SeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines base class for any kind of serial data.\r\n *\r\n * @see {@link ISeriesEvents} for a list of available Events\r\n * @see {@link ISeriesAdapters} for a list of available Adapters\r\n * @todo Separate axis-related stuff to some other class so that MapSeries would not have unrelated stuff\r\n */\n\nvar Series =\n/** @class */\nfunction (_super) {\n __extends(Series, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Series() {\n var _this = _super.call(this) || this;\n /**\r\n * Should this series excluded from the axis scale calculations?\r\n *\r\n * @default false\r\n */\n\n\n _this._ignoreMinMax = false;\n /**\r\n * Should series' bullets?\r\n *\r\n * @default true\r\n */\n\n _this._showBullets = true;\n /**\r\n * Settings for the appearance of the related legend items.\r\n */\n\n _this.legendSettings = new LegendSettings();\n /**\r\n * Lowest overal values by type.\r\n */\n\n _this._tmin = new Dictionary();\n /**\r\n * Highest overal values by type.\r\n */\n\n _this._tmax = new Dictionary();\n /**\r\n * Lowest values in current selection by type.\r\n */\n\n _this._smin = new Dictionary();\n /**\r\n * Highest values in current selection by type.\r\n */\n\n _this._smax = new Dictionary();\n /**\r\n * [dataItemsByAxis description]\r\n *\r\n * Both by category and date.\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n */\n\n _this.dataItemsByAxis = new Dictionary();\n /**\r\n * Normally series items are focusable using keyboard, so that people can\r\n * select them with a TAB key. However, if there are a lot of data points on\r\n * screen it might be long and useless to tab through all o fthem.\r\n *\r\n * This is where `skipFocusThreshold` comes in. If there are more items than\r\n * the value set here, we will not make those focusable and rather let screen\r\n * reader software rely on the series summary, or authors provide alternative\r\n * detailed information display, such as HTML table.\r\n *\r\n * Different series might have different threshold defaults.\r\n */\n\n _this.skipFocusThreshold = 20;\n /**\r\n * Used to indicate if `itemReaderText` was changed \"from the outside\".\r\n */\n\n _this._itemReaderTextChanged = false;\n /**\r\n * Most of the series use absolute values. However sometimes various\r\n * calculated percent values are need, e.g. item's percent representation\r\n * across all values in series, etc.\r\n *\r\n * It's a resource-intensive operation, so it is disabled by default.\r\n *\r\n * If you need percents to be calculated, e.g. for showing them in tooltips,\r\n * or creating 100% stacks, this setting needs to be set to `true`.\r\n *\r\n * NOTE: `PieChart`, which relies on slice percentages, has this\r\n * automatically set to `true`.\r\n *\r\n * @default false\r\n */\n\n _this.calculatePercent = false;\n /**\r\n * When `calculatePercent` is enabled and data item's percent value is\r\n * calculated, last item's real value is used instead of its working value.\r\n *\r\n * This is done for the animations when last item in series (e.g. slice in\r\n * a `PieSeries`) is hidden or shown. (if we would use real value, the\r\n * calculated percent would always be 100%).\r\n *\r\n * Sometimes there is a need (e.g. for drill-down Sunburst) to disable this\r\n * hack by setting `usePercentHack` to `false`.\r\n *\r\n * @since 4.9.13\r\n * @default true\r\n */\n\n _this.usePercentHack = true;\n /**\r\n * Specifies if series should be automatically disposed when removing from\r\n * chart's `series` list.\r\n *\r\n * @default true\r\n */\n\n _this.autoDispose = true;\n /**\r\n * When chart/series' data is processed, all kinds of derivative values are\r\n * calculated. E.g. sum, min, max, change, etc. This is a potentially\r\n * time-consuming operation, especially prominent in data-heavy charts.\r\n *\r\n * If your chart does not need those values, and you have a lot of data,\r\n * setting this to `true` might give a dramatic increase in initial chart\r\n * load speed.\r\n *\r\n * Please note, regular column and line series usage scenarios do not\r\n * require derivative values. Those come into play only when you do advanced\r\n * functionality like coloring segments of charts in different colors\r\n * depending on change between open and close values, have stacked series, or\r\n * display any of the derived values, like percent, in tooltips or bullets.\r\n *\r\n * @default false\r\n */\n\n _this.simplifiedProcessing = false;\n\n if (_this.constructor === Series) {\n throw new Error(\"'Series' cannot be instantiated directly. Please use a specific series type.\");\n }\n\n _this.className = \"Series\";\n _this.isMeasured = false;\n _this.layout = \"none\";\n _this.shouldClone = false;\n\n _this.setPropertyValue(\"hidden\", false);\n\n _this.axisRanges = new List();\n\n _this.axisRanges.events.on(\"inserted\", _this.processAxisRange, _this, false);\n\n _this.minBulletDistance = 0; // otherwise we'll have a lot of cases when people won't see bullets and think it's a bug\n\n _this.mainContainer = _this.createChild(Container);\n _this.mainContainer.shouldClone = false;\n _this.mainContainer.mask = _this.createChild(Sprite);\n\n _this._disposers.push(_this.mainContainer); // all bullets should go on top of lines/fills. So we add a separate container for bullets and later set it's parent to chart.bulletsContainer\n\n\n var bulletsContainer = _this.mainContainer.createChild(Container);\n\n _this._shouldBeReady.push(bulletsContainer);\n\n bulletsContainer.shouldClone = false;\n bulletsContainer.layout = \"none\";\n bulletsContainer.virtualParent = _this;\n\n _this._disposers.push(bulletsContainer);\n\n _this.bulletsContainer = bulletsContainer;\n _this.tooltip = new Tooltip();\n _this.tooltip.virtualParent = _this;\n\n _this._disposers.push(_this.tooltip);\n\n _this.hiddenState.transitionEasing = $ease.cubicIn; // this data item holds sums, averages, etc\n\n _this.dataItem = _this.createDataItem();\n\n _this._disposers.push(_this.dataItem);\n\n _this.dataItem.component = _this; // Apply accessibility\n\n _this.role = \"group\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * We need this here so that class names can be applied to bullets container.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Series.prototype.applyTheme = function () {\n _super.prototype.applyTheme.call(this);\n\n if (options.autoSetClassName && this.bulletsContainer) {\n this.bulletsContainer.className = this.className + \"-bullets\";\n this.bulletsContainer.setClassName();\n }\n };\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n Series.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this);\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Series\");\n }\n };\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n Series.prototype.createDataItem = function () {\n return new SeriesDataItem();\n };\n\n Object.defineProperty(Series.prototype, \"chart\", {\n /**\r\n * @return Chart\r\n */\n get: function get() {\n return this._chart;\n },\n\n /**\r\n * Chart series is used on.\r\n *\r\n * @param value Chart\r\n */\n set: function set(value) {\n this._chart = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Positions bullet.\r\n *\r\n * @param bullet Sprite\r\n */\n\n Series.prototype.positionBullet = function (bullet) {// Placeholder method for extending classes to override.\n };\n /**\r\n * Decorates newly created bullet after it has been instert into the list.\r\n *\r\n * @param event List event\r\n * @todo investigate why itemReaderText is undefined\r\n */\n\n\n Series.prototype.processBullet = function (event) {\n var _this = this;\n\n var bullet = event.newValue;\n bullet.isTemplate = true; // Add accessibility options to bullet\n // If there are relatively few bullets, make them focusable\n\n this.events.once(\"datavalidated\", function (ev) {\n if (_this.itemsFocusable()) {\n bullet.focusable = true;\n }\n });\n this.invalidate();\n };\n /**\r\n * removes bullets\r\n *\r\n * @param event List event\r\n */\n\n\n Series.prototype.removeBullet = function (event) {\n var bullet = event.oldValue;\n this.dataItems.each(function (dataItem) {\n var eachBullet = dataItem.bullets.getKey(bullet.uid);\n\n if (eachBullet) {\n eachBullet.dispose();\n }\n });\n this.invalidate();\n };\n /**\r\n * Validates data items.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Series.prototype.validateDataItems = function () {\n _super.prototype.validateDataItems.call(this);\n\n this.processValues(false);\n };\n /**\r\n * Returns first value for the specific key in the series.\r\n *\r\n * @param key Key\r\n * @return Value\r\n * @todo Description\r\n * @todo Convert to propert object property iterator\r\n */\n\n\n Series.prototype.getFirstValue = function (key, startIndex) {\n // find first\n\n /*\r\n return $iter.findMap(this.dataItems.iterator(), (dataItem) => {\r\n for (let key in dataItem.values) {\r\n if ($object.hasKey(dataItem.values, key)) {\r\n let value: number = dataItem.values[key].workingValue;\r\n if ($type.isNumber(value)) {\r\n return value;\r\n }\r\n }\r\n }\r\n return null;\r\n });*/\n //if (startIndex > 0 && startIndex < this.dataItems.length - 1) {\n //startIndex++;\n //}\n for (var i = startIndex; i >= 0; i--) {\n var dataItem = this.dataItems.getIndex(i);\n var value = dataItem.getActualWorkingValue(key);\n\n if ($type.isNumber(value)) {\n return value;\n }\n }\n\n return null;\n };\n /**\r\n * Returns first value for the specific key in the series.\r\n *\r\n * @param key Key\r\n * @return Value\r\n * @todo Description\r\n * @todo Convert to propert object property iterator\r\n */\n\n\n Series.prototype.getAbsoluteFirstValue = function (key) {\n for (var i = 0; i < this.dataItems.length; i++) {\n var dataItem = this.dataItems.getIndex(i);\n var value = dataItem.values[key].value;\n\n if ($type.isNumber(value)) {\n return value;\n }\n }\n\n return null;\n };\n /**\r\n * [rangeChangeUpdate description]\r\n *\r\n * @todo Description\r\n */\n\n\n Series.prototype.rangeChangeUpdate = function () {\n _super.prototype.rangeChangeUpdate.call(this);\n\n this.processValues(true);\n };\n /**\r\n * [processValues description]\r\n *\r\n * @todo Description\r\n * @todo Convert to propert object property iterator\r\n * @param dataItems [description]\r\n */\n\n\n Series.prototype.processValues = function (working) {\n var _this = this;\n\n if (!this.simplifiedProcessing) {\n var dataItems = this.dataItems;\n var count_1 = {};\n var sum_1 = {};\n var absoluteSum_1 = {};\n var low_1 = {};\n var high_1 = {};\n var open_1 = {};\n var close_1 = {};\n var previous_1 = {};\n var first_1 = {};\n var absoluteFirst_1 = {}; //let duration: number = 0; // todo: check if series uses selection.change or selection.change.percent and set duration to interpolationduration\n\n var startIndex_1 = $math.max(0, this.startIndex);\n startIndex_1 = $math.min(startIndex_1, this.dataItems.length);\n var endIndex = $math.min(this.endIndex, this.dataItems.length);\n\n if (!$type.isNumber(startIndex_1)) {\n startIndex_1 = 0;\n }\n\n if (!$type.isNumber(endIndex)) {\n endIndex = this.dataItems.length;\n }\n\n if (startIndex_1 > 0) {\n var dataItem_1 = dataItems.getIndex(startIndex_1 - 1);\n $object.each(dataItem_1.values, function (key, values) {\n var value = dataItem_1.getActualWorkingValue(key);\n\n if ($type.isNumber(value)) {\n // save previous\n previous_1[key] = value;\n }\n });\n }\n\n var _loop_1 = function _loop_1(i) {\n var dataItem_2 = dataItems.getIndex(i);\n $object.each(dataItem_2.values, function (key, values) {\n var value = dataItem_2.getActualWorkingValue(key); //if (i >= startIndex && i <= endIndex) { // do not add to count, sum etc if it is not within start/end index\n\n if ($type.isNumber(value)) {\n // count values\n if (!$type.isNumber(count_1[key])) {\n count_1[key] = 0;\n }\n\n count_1[key]++; // sum values\n\n if (!$type.isNumber(sum_1[key])) {\n sum_1[key] = 0;\n }\n\n sum_1[key] += value; // absolute sum values\n\n if (!$type.isNumber(absoluteSum_1[key])) {\n absoluteSum_1[key] = 0;\n }\n\n absoluteSum_1[key] += Math.abs(value); // open\n\n if (!$type.isNumber(open_1[key])) {\n open_1[key] = value;\n } // close\n\n\n close_1[key] = value; // low\n\n if (!$type.isNumber(low_1[key])) {\n low_1[key] = value;\n } else {\n if (low_1[key] > value) {\n low_1[key] = value;\n }\n } // high\n\n\n if (!$type.isNumber(high_1[key])) {\n high_1[key] = value;\n } else {\n if (high_1[key] < value) {\n high_1[key] = value;\n }\n }\n\n if (!$type.isNumber(first_1[key])) {\n first_1[key] = _this.getFirstValue(key, startIndex_1);\n }\n\n if (!$type.isNumber(absoluteFirst_1[key])) {\n absoluteFirst_1[key] = _this.getAbsoluteFirstValue(key);\n } // change\n\n\n dataItem_2.setCalculatedValue(key, value - first_1[key], \"change\"); // change from start percent\n // will fail if first value is 0\n\n dataItem_2.setCalculatedValue(key, (value - first_1[key]) / first_1[key] * 100, \"changePercent\");\n dataItem_2.setCalculatedValue(key, value - absoluteFirst_1[key], \"startChange\");\n dataItem_2.setCalculatedValue(key, (value - absoluteFirst_1[key]) / absoluteFirst_1[key] * 100, \"startChangePercent\"); // previous change\n\n var prevValue = previous_1[key];\n\n if (!$type.isNumber(prevValue)) {\n prevValue = value;\n }\n\n dataItem_2.setCalculatedValue(key, value - prevValue, \"previousChange\"); // previous change percent\n\n dataItem_2.setCalculatedValue(key, (value - prevValue) / prevValue * 100, \"previousChangePercent\"); // save previous\n\n previous_1[key] = value;\n }\n });\n };\n\n for (var i = startIndex_1; i < endIndex; i++) {\n _loop_1(i);\n }\n\n if (this.calculatePercent) {\n var _loop_2 = function _loop_2(i) {\n var dataItem_3 = dataItems.getIndex(i);\n $object.each(dataItem_3.values, function (key) {\n var ksum = absoluteSum_1[key];\n var value = dataItem_3.getActualWorkingValue(key);\n\n if ($type.isNumber(value)) {\n if (ksum > 0) {\n if (_this.usePercentHack) {\n // this hack is made in order to make it possible to animate single slice to 0\n // if there is only one slice left, percent value is always 100%, so it won't animate\n // so we use real value of a slice instead of current value\n if (value == ksum) {\n ksum = dataItem_3.values[key].value;\n }\n }\n\n var percent = value / ksum * 100;\n dataItem_3.setCalculatedValue(key, percent, \"percent\");\n } else {\n dataItem_3.setCalculatedValue(key, 0, \"percent\");\n }\n }\n });\n };\n\n for (var i = startIndex_1; i < endIndex; i++) {\n _loop_2(i);\n }\n } // calculate one before first (cant do that in cycle, as we don't know open yet\n // when drawing line chart we should draw line to the invisible data point to the left, otherwise the line will always look like it starts from the selected point\n // so we do startIndex - 1\n\n\n if (startIndex_1 > 0) {\n var zeroItem_1 = dataItems.getIndex(startIndex_1 - 1);\n $object.each(zeroItem_1.values, function (key) {\n var value = zeroItem_1.values[key].value; // change\n\n zeroItem_1.setCalculatedValue(key, value - open_1[key], \"change\"); // change percent\n\n zeroItem_1.setCalculatedValue(key, (value - open_1[key]) / open_1[key] * 100, \"changePercent\");\n });\n } // we save various data like sum, average to dataPoint of the series\n\n\n var dataItem_4 = this.dataItem;\n $object.each(dataItem_4.values, function (key) {\n dataItem_4.setCalculatedValue(key, sum_1[key], \"sum\");\n dataItem_4.setCalculatedValue(key, absoluteSum_1[key], \"absoluteSum\");\n dataItem_4.setCalculatedValue(key, sum_1[key] / count_1[key], \"average\");\n dataItem_4.setCalculatedValue(key, open_1[key], \"open\");\n dataItem_4.setCalculatedValue(key, close_1[key], \"close\");\n dataItem_4.setCalculatedValue(key, low_1[key], \"low\");\n dataItem_4.setCalculatedValue(key, high_1[key], \"high\");\n dataItem_4.setCalculatedValue(key, count_1[key], \"count\");\n });\n }\n };\n /**\r\n * (Re)validates the whole series, effectively causing it to redraw.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Series.prototype.validate = function () {\n if ($utils.isIE()) {\n this.filters.clear();\n }\n\n $iter.each(this.axisRanges.iterator(), function (axisRange) {\n //axisRange.contents.disposeChildren(); // not good for columns, as they are reused\n //\t\t\taxisRange.appendChildren();\n axisRange.validate();\n });\n\n _super.prototype.validate.call(this);\n\n var bulletsContainer = this.bulletsContainer;\n bulletsContainer.fill = this.fill;\n bulletsContainer.stroke = this.stroke;\n bulletsContainer.x = this.pixelX;\n bulletsContainer.y = this.pixelY;\n\n if (this.bulletsContainer.children.length > 0) {\n if (this._showBullets) {\n for (var i = 0; i < this.startIndex; i++) {\n var dataItem = this.dataItems.getIndex(i);\n\n if (dataItem) {\n dataItem.bullets.each(function (key, bullet) {\n bullet.__disabled = true;\n });\n }\n }\n\n for (var i = this.dataItems.length - 1; i > this.endIndex; i--) {\n var dataItem = this.dataItems.getIndex(i);\n\n if (dataItem) {\n dataItem.bullets.each(function (key, bullet) {\n bullet.__disabled = true;\n });\n }\n }\n } else {\n this.bulletsContainer.children.each(function (bullet) {\n bullet.__disabled = true;\n });\n }\n }\n\n this.updateTooltipBounds();\n };\n /**\r\n * @ignore\r\n */\n\n\n Series.prototype.updateTooltipBounds = function () {\n if (this.topParent) {\n var x = 0;\n var y = 0;\n var w = this.topParent.maxWidth;\n var h = this.topParent.maxHeight;\n var rect = {\n x: x,\n y: y,\n width: w,\n height: h\n };\n this.tooltip.setBounds(rect);\n }\n };\n\n Series.prototype.shouldCreateBullet = function (dataItem, bulletTemplate) {\n return true;\n };\n /**\r\n * Validates data item's element, effectively redrawing it.\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem Data item\r\n */\n\n\n Series.prototype.validateDataElement = function (dataItem) {\n var _this = this;\n\n _super.prototype.validateDataElement.call(this, dataItem);\n\n if (this._showBullets) {\n if (!this.isHidden) {\n this.bulletsContainer.visible = true;\n }\n\n this.bullets.each(function (bulletTemplate) {\n // always better to use the same, this helps to avoid redrawing\n var bullet = dataItem.bullets.getKey(bulletTemplate.uid);\n\n if (_this.shouldCreateBullet(dataItem, bulletTemplate)) {\n if (!bullet) {\n var disabledField = bulletTemplate.propertyFields.disabled;\n var dataContext = dataItem.dataContext;\n\n if (disabledField && dataContext && dataContext[disabledField] === false) {\n bulletTemplate.applyOnClones = false;\n bulletTemplate.disabled = false;\n bullet = bulletTemplate.clone();\n bulletTemplate.disabled = true;\n bulletTemplate.applyOnClones = true;\n } else {\n bullet = bulletTemplate.clone();\n }\n\n bullet.shouldClone = false;\n dataItem.addSprite(bullet);\n\n if (!_this.visible || _this.isHiding) {\n bullet.hide(0);\n }\n }\n\n var currentDataItem = bullet.dataItem;\n\n if (currentDataItem != dataItem) {\n // set to undefined in order not to reuse\n if (currentDataItem) {\n currentDataItem.bullets.setKey(bulletTemplate.uid, undefined);\n }\n\n var readerText_1 = _this.itemReaderText;\n\n if (bullet instanceof Bullet) {\n if (!readerText_1) {\n readerText_1 = \"{\" + bullet.xField + \"}: {\" + bullet.yField + \"}\";\n }\n\n if (bullet.isDynamic) {\n dataItem.events.on(\"workingvaluechanged\", bullet.deepInvalidate, bullet, false); //dataItem.events.on(\"calculatedvaluechanged\", bullet.deepInvalidate, bullet, false);\n\n _this.dataItem.events.on(\"workingvaluechanged\", bullet.deepInvalidate, bullet, false);\n }\n\n bullet.deepInvalidate();\n } // Add accessibility to bullet\n\n\n if (bullet.focusable) {\n bullet.events.on(\"focus\", function (ev) {\n bullet.readerTitle = _this.populateString(readerText_1, bullet.dataItem);\n }, undefined, false);\n bullet.events.on(\"blur\", function (ev) {\n bullet.readerTitle = \"\";\n }, undefined, false);\n }\n\n if (bullet.hoverable) {\n bullet.events.on(\"over\", function (ev) {\n bullet.readerTitle = _this.populateString(readerText_1, bullet.dataItem);\n }, undefined, false);\n bullet.events.on(\"out\", function (ev) {\n bullet.readerTitle = \"\";\n }, undefined, false);\n }\n }\n\n bullet.parent = _this.bulletsContainer;\n dataItem.bullets.setKey(bulletTemplate.uid, bullet); // pass max w/h so we'd know if we should show/hide somethings\n\n bullet.maxWidth = dataItem.itemWidth;\n bullet.maxHeight = dataItem.itemHeight;\n bullet.__disabled = false;\n\n _this.positionBullet(bullet);\n } else {\n if (bullet) {\n bullet.__disabled = true;\n }\n }\n });\n } else {\n this.bulletsContainer.visible = false;\n }\n };\n /**\r\n * [handleDataItemWorkingValueChange description]\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Series.prototype.handleDataItemWorkingValueChange = function (dataItem, name) {\n if (!this.dataRangeInvalid) {\n this.invalidateProcessedData();\n }\n };\n\n Object.defineProperty(Series.prototype, \"ignoreMinMax\", {\n /**\r\n * @return Exclude from calculations?\r\n */\n get: function get() {\n return this._ignoreMinMax;\n },\n\n /**\r\n * Should this series excluded from the axis scale calculations?\r\n *\r\n * @default false\r\n * @param value Exclude from calculations?\r\n */\n set: function set(value) {\n this._ignoreMinMax = value;\n this.invalidateDataItems();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Create a mask for the series.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n Series.prototype.createMask = function () {// A placeholder method for extending classes to override.\n };\n /**\r\n * Process axis range after it has been added to the list.\r\n *\r\n * @param event Event\r\n */\n\n\n Series.prototype.processAxisRange = function (event) {\n // create container if not existing\n if (!this.rangesContainer) {\n this.rangesContainer = this.createChild(Container);\n this.rangesContainer.shouldClone = false;\n this.rangesContainer.isMeasured = false;\n }\n\n var axisRange = event.newValue;\n\n if (axisRange) {\n axisRange.contents.parent = this.rangesContainer;\n axisRange.isRange = true;\n axisRange.events.on(\"valuechanged\", this.invalidateDataItems, this, false);\n }\n };\n /**\r\n * [getAxisField description]\r\n *\r\n * @ignore Exclude from docs\r\n * @todo Description\r\n * @param axis [description]\r\n * @return [description]\r\n */\n\n\n Series.prototype.getAxisField = function (axis) {\n return;\n };\n /**\r\n * Shows the tooltip at specific position.\r\n *\r\n * @ignore Exclude from docs\r\n * @param xPosition X\r\n * @param yPosition Y\r\n */\n\n\n Series.prototype.showTooltipAtPosition = function (xPosition, yPosition) {// Placeholder method for extending classes to override.\n };\n\n Object.defineProperty(Series.prototype, \"minBulletDistance\", {\n /**\r\n * @return Distance (px)\r\n */\n get: function get() {\n return this.getPropertyValue(\"minBulletDistance\");\n },\n\n /**\r\n * Minimal distance between data points in pixels.\r\n *\r\n * If distance gets smaller than this, bullets are turned off to avoid\r\n * overlapping.\r\n *\r\n * `0` (zero) disables this behavior.\r\n *\r\n * IMPORTANT: This setting will work only when Series' base axis\r\n * is [[CategoryAxis]] or [[DateAxis]]. If base axis is [[ValueAxis]] the\r\n * setting will be ignored, because it would be a huge overhead to measure\r\n * distance between each and every bullet.\r\n *\r\n * @default 0\r\n * @param value Distance (px)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"minBulletDistance\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Series.prototype, \"bullets\", {\n /**\r\n * A list of bullets that will be added to each and every items in the\r\n * series.\r\n *\r\n * You can push any object that is a descendant of a [[Sprite]] here. All\r\n * items added to this list will be copied and used as a bullet on all data\r\n * items, including their properties, events, etc.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/bullets/} for more info about the concept of Bullets\r\n * @return List of bullets.\r\n */\n get: function get() {\n if (!this._bullets) {\n this._bullets = new ListTemplate(new Bullet());\n this._bullets.template.virtualParent = this;\n\n this._bullets.events.on(\"inserted\", this.processBullet, this, false);\n\n this._bullets.events.on(\"removed\", this.removeBullet, this, false);\n\n this._disposers.push(new ListDisposer(this._bullets));\n\n this._disposers.push(this._bullets.template);\n }\n\n return this._bullets;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Binds related legend data item's visual settings to this series' visual\r\n * settings.\r\n *\r\n * @ignore Exclude from docs\r\n * @param marker Legend item container\r\n */\n\n Series.prototype.createLegendMarker = function (marker) {// This is a placeholder method for extending classes to override.\n };\n\n Object.defineProperty(Series.prototype, \"hiddenInLegend\", {\n /**\r\n * @return Hidden in legend?\r\n */\n get: function get() {\n return this.getPropertyValue(\"hiddenInLegend\");\n },\n\n /**\r\n * Should the series be hidden in legend?\r\n *\r\n * @param value Hidden in legend?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"hiddenInLegend\", value)) {\n if (this.chart) {\n this.chart.feedLegend();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Series.prototype, \"name\", {\n /**\r\n * @return Name\r\n */\n get: function get() {\n return this.getPropertyValue(\"name\");\n },\n\n /**\r\n * Series' name.\r\n *\r\n * @param value Name\r\n */\n set: function set(value) {\n this.setPropertyValue(\"name\", value);\n var legendDataItem = this.legendDataItem;\n\n if (legendDataItem) {\n legendDataItem.component.invalidate();\n legendDataItem.component.invalidateRawData();\n }\n\n this.readerTitle = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Series.prototype, \"itemReaderText\", {\n /**\r\n * @return Screen reader text template\r\n */\n get: function get() {\n // Get explicitly set reader text\n var readerText = this._itemReaderText; // Not set? Let's try something else\n\n if (!readerText) {\n // Tooltip text?\n if (this.tooltipText) {\n readerText = $utils.plainText(this.tooltipText);\n } else if (this.tooltipHTML) {\n readerText = $utils.plainText(this.tooltipHTML);\n }\n }\n\n if (!this._adapterO) {\n return readerText;\n } else {\n return this._adapterO.apply(\"itemReaderText\", readerText);\n }\n },\n\n /**\r\n * Screen reader text to be applied to each individual data item, such\r\n * as bullets, columns or slices.\r\n *\r\n * The template can contain field reference meta codes, i.e. `{dateX}`,\r\n * `{valueY}`, etc.\r\n *\r\n * Any text formatting options, e.g. `[bold]` will be ignored.\r\n *\r\n * @param value Screen reader text template\r\n */\n set: function set(value) {\n this._itemReaderText = value;\n this._itemReaderTextChanged = true;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns if number of data items in the series are beyond non-focusable\r\n * count and should not be available for TAB-through.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Items focusable?\r\n */\n\n Series.prototype.itemsFocusable = function () {\n return this.dataItems.length >= this.skipFocusThreshold ? false : true;\n };\n\n Object.defineProperty(Series.prototype, \"legendDataItem\", {\n /**\r\n * @return Data item\r\n */\n get: function get() {\n return this._legendDataItem;\n },\n\n /**\r\n * Legend data item that corresponds to this series.\r\n *\r\n * @param value Data item\r\n */\n set: function set(value) {\n this._legendDataItem = value;\n\n this._legendDataItem.itemContainer.deepInvalidate();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates corresponding legend data item with current values.\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem Data item\r\n */\n\n Series.prototype.updateLegendValue = function (dataItem, notRange) {\n // if this series has legend item\n if (this.legendDataItem) {\n var legendSettings = this.legendSettings;\n var legendDataItem = this.legendDataItem;\n var label = legendDataItem.label;\n var valueLabel = legendDataItem.valueLabel; // update legend\n\n if (dataItem && !dataItem.isDisposed() || notRange) {\n if (valueLabel) {\n if (legendSettings.itemValueText) {\n valueLabel.text = legendSettings.itemValueText;\n }\n\n valueLabel.dataItem = dataItem;\n }\n\n if (label) {\n if (legendSettings.itemLabelText) {\n label.text = legendSettings.itemLabelText;\n }\n\n label.dataItem = dataItem;\n }\n } else {\n if (label) {\n // if itemLabelText is set, means we have to reset label even if labelText is not set\n if (legendSettings.labelText || legendSettings.itemLabelText != undefined) {\n label.text = legendSettings.labelText;\n }\n\n label.dataItem = this.dataItem;\n }\n\n if (valueLabel) {\n if (legendSettings.valueText || legendSettings.itemValueText != undefined) {\n valueLabel.text = legendSettings.valueText;\n }\n\n valueLabel.dataItem = this.dataItem;\n }\n }\n }\n };\n /**\r\n * Copies all properties from another instance of [[Series]].\r\n *\r\n * @param source Source series\r\n */\n\n\n Series.prototype.copyFrom = function (source) {\n this.bullets.copyFrom(source.bullets);\n this.bulletsContainer.copyFrom(source.bulletsContainer);\n this.calculatePercent = source.calculatePercent;\n this.usePercentHack = source.usePercentHack;\n this.simplifiedProcessing = source.simplifiedProcessing;\n\n _super.prototype.copyFrom.call(this, source);\n };\n /**\r\n * Displays a modal or console message with error, and halts any further\r\n * processing of this element.\r\n *\r\n * @param e Error\r\n */\n\n\n Series.prototype.raiseCriticalError = function (e) {\n if (this._chart && this._chart.modal) {\n this._chart.modal.content = this._chart.adapter.apply(\"criticalError\", e).message;\n this._chart.modal.closable = false;\n\n if (!options.suppressErrors) {\n this._chart.modal.open();\n }\n\n this._chart.disabled = true;\n }\n\n if (options.verbose) {\n console.log(e);\n }\n };\n /**\r\n * Applies filters to the element.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n Series.prototype.applyFilters = function () {\n var _this = this;\n\n _super.prototype.applyFilters.call(this);\n\n this.bulletsContainer.filters.clear(); // copyFrom of a list copies, does not clone\n\n $iter.each(this.filters.iterator(), function (filter) {\n _this.bulletsContainer.filters.push(filter.clone());\n });\n };\n\n Object.defineProperty(Series.prototype, \"heatRules\", {\n /**\r\n * A list of heat rules to apply to series' elements based on the value\r\n * of the data item.\r\n *\r\n * Heat rules can be any \"numeric\" (including `Color`) property, and can also\r\n * be applied to child objects of series, like columns, bullets, etc.\r\n *\r\n * E.g.:\r\n *\r\n * ```TypeScript\r\n * series.heatRules.push({\r\n * \"target\": series.columns.template,\r\n * \"property\": \"fill\",\r\n * \"min\": am4core.color(\"#F5DBCB\"),\r\n * \"max\": am4core.color(\"#ED7B84\"),\r\n * \"dataField\": \"valueY\"\r\n *});\r\n *```\r\n * ```Javacript\r\n * series.heatRules.push({\r\n * \"target\": series.columns.template,\r\n * \"property\": \"fill\",\r\n * \"min\": am4core.color(\"#F5DBCB\"),\r\n * \"max\": am4core.color(\"#ED7B84\"),\r\n * \"dataField\": \"valueY\"\r\n *});\r\n *```\r\n *```JSON\r\n *{\r\n * // ...\r\n * \"series\": [{\r\n * \"type\": \"ColumnSeries\",\r\n * \"heatRules\": [{\r\n * \"target\": \"columns.template\",\r\n * \"property\": \"fill\",\r\n * \"min\": \"#F5DBCB\",\r\n * \"max\": \"#ED7B84\",\r\n * \"dataField\": \"valueY\"\r\n * }]\r\n * }]\r\n *}\r\n *```\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/concepts/series/#Heat_maps} for more about heat rules\r\n * @return Heat rules\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._heatRules) {\n this._heatRules = new List();\n\n this._heatRules.events.on(\"inserted\", function (event) {\n var heatRule = event.newValue;\n var target = heatRule.target;\n\n if (target) {\n var dataField_1 = heatRule.dataField;\n\n if (!$type.hasValue(dataField_1)) {\n dataField_1 = \"value\";\n }\n\n var seriesDataItem_1 = _this.dataItem;\n var property_1 = heatRule.property;\n var minValue = $type.toNumber(heatRule.minValue);\n var maxValue = $type.toNumber(heatRule.maxValue);\n\n if (!$type.isNumber(minValue) && !$type.isNumber(maxValue)) {\n _this.dataItem.events.on(\"calculatedvaluechanged\", function (event) {\n if (event.property == dataField_1) {\n $iter.each(_this.dataItems.iterator(), function (dataItem) {\n var foundSprite = false;\n $array.each(dataItem.sprites, function (sprite) {\n if (sprite.clonedFrom == target) {\n var anySprite = sprite;\n anySprite[property_1] = anySprite[property_1];\n foundSprite = true;\n }\n });\n\n if (!foundSprite) {\n $array.each(dataItem.sprites, function (sprite) {\n if (sprite instanceof Container) {\n $iter.each(sprite.children.iterator(), function (child) {\n if (child.className == target.className) {\n var anyChild = child;\n anyChild[property_1] = anyChild[property_1];\n } // giveup here\n else if (child instanceof Container) {\n child.deepInvalidate();\n }\n });\n }\n });\n }\n });\n }\n });\n }\n\n _this.dataItems.template.events.on(\"workingvaluechanged\", function (event) {\n if (event.property == dataField_1) {\n var dataItem = event.target;\n var foundSprite_1 = false;\n $array.each(dataItem.sprites, function (sprite) {\n if (sprite.clonedFrom == target) {\n var anySprite = sprite;\n anySprite[property_1] = anySprite[property_1];\n foundSprite_1 = true;\n }\n });\n\n if (!foundSprite_1) {\n $array.each(dataItem.sprites, function (sprite) {\n if (sprite instanceof Container) {\n $iter.each(sprite.children.iterator(), function (child) {\n if (child.className == target.className) {\n var anyChild = child;\n anyChild[property_1] = anyChild[property_1];\n } // givup here\n else if (child instanceof Container) {\n child.deepInvalidate();\n }\n });\n }\n });\n }\n }\n });\n\n target.adapter.add(property_1, function (value, ruleTarget, property) {\n var minValue = $type.toNumber(heatRule.minValue);\n var maxValue = $type.toNumber(heatRule.maxValue);\n var min = heatRule.min;\n var max = heatRule.max;\n\n if (ruleTarget instanceof Sprite) {\n var anySprite = ruleTarget;\n var propertyField = anySprite.propertyFields[property];\n\n if (propertyField && ruleTarget.dataItem) {\n var dataContext = ruleTarget.dataItem.dataContext;\n\n if (dataContext && $type.hasValue(dataContext[propertyField])) {\n return value;\n }\n }\n }\n\n var dataItem = ruleTarget.dataItem;\n\n if (!$type.isNumber(minValue)) {\n minValue = seriesDataItem_1.values[dataField_1].low;\n }\n\n if (!$type.isNumber(maxValue)) {\n maxValue = seriesDataItem_1.values[dataField_1].high;\n }\n\n if (dataItem) {\n var fieldValues = dataItem.values[dataField_1];\n\n if (fieldValues) {\n var workingValue = dataItem.getActualWorkingValue(dataField_1);\n\n if ($type.hasValue(min) && $type.hasValue(max) && $type.isNumber(minValue) && $type.isNumber(maxValue) && $type.isNumber(workingValue)) {\n var percent = void 0;\n\n if (heatRule.logarithmic) {\n percent = (Math.log(workingValue) * Math.LOG10E - Math.log(minValue) * Math.LOG10E) / (Math.log(maxValue) * Math.LOG10E - Math.log(minValue) * Math.LOG10E);\n } else {\n percent = (workingValue - minValue) / (maxValue - minValue);\n }\n\n if ($type.isNumber(workingValue) && (!$type.isNumber(percent) || Math.abs(percent) == Infinity)) {\n percent = 0.5;\n } // fixes problems if all values are the same\n\n\n if ($type.isNumber(min)) {\n return min + (max - min) * percent;\n } else if (min instanceof Color) {\n return new Color($colors.interpolate(min.rgb, max.rgb, percent));\n }\n }\n }\n }\n\n return value;\n });\n }\n });\n }\n\n return this._heatRules;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n Series.prototype.processConfig = function (config) {\n var heatRules;\n\n if (config) {\n // Set up bullets\n if ($type.hasValue(config.bullets) && $type.isArray(config.bullets)) {\n for (var i = 0, len = config.bullets.length; i < len; i++) {\n var bullets = config.bullets[i];\n\n if (!$type.hasValue(bullets.type)) {\n bullets.type = \"Bullet\";\n }\n }\n } // Let's take heatRules out of the config, so that we can process\n // them later, when bullets are already there\n\n\n if ($type.hasValue(config.heatRules) && $type.isArray(config.heatRules)) {\n heatRules = config.heatRules;\n delete config.heatRules;\n }\n }\n\n _super.prototype.processConfig.call(this, config); // Process heat rules again, when all other elements are ready\n\n\n if (heatRules) {\n for (var i = 0, len = heatRules.length; i < len; i++) {\n var rule = heatRules[i]; // Resolve target\n\n var target = this;\n\n if ($type.hasValue(rule.target) && $type.isString(rule.target)) {\n // Check if we can find this element by id\n if (this.map.hasKey(rule.target)) {\n target = this.map.getKey(rule.target);\n } else {\n var parts = rule.target.split(\".\");\n\n for (var x = 0; x < parts.length; x++) {\n if (target instanceof List) {\n var listitem = target.getIndex($type.toNumber(parts[x]));\n\n if (!listitem) {\n target = target[parts[x]];\n } else {\n target = listitem;\n }\n } else {\n var maybeIndex = parts[x].match(/^(.*)\\[([0-9]+)\\]/);\n\n if (maybeIndex) {\n if (target[maybeIndex[1]] instanceof List) {\n target = target[maybeIndex[1]].getIndex($type.toNumber(maybeIndex[2]));\n } else {\n target = target[maybeIndex[1]][$type.toNumber(maybeIndex[2])];\n }\n } else {\n target = target[parts[x]];\n }\n }\n }\n }\n }\n\n rule.target = target; // Resolve colors and percents\n\n if ($type.hasValue(rule.min)) {\n rule.min = this.maybeColorOrPercent(rule.min);\n }\n\n if ($type.hasValue(rule.max)) {\n rule.max = this.maybeColorOrPercent(rule.max);\n }\n }\n\n _super.prototype.processConfig.call(this, {\n heatRules: heatRules\n });\n }\n };\n /**\r\n * Returns visibility value\r\n * @ignore\r\n */\n\n /*\r\n protected getVisibility(): boolean {\r\n let hidden = this.getPropertyValue(\"hidden\");\r\n if (hidden) {\r\n return false;\r\n }\r\n else {\r\n return super.getVisibility();\r\n }\r\n }*/\n\n /**\r\n * This function is used to sort element's JSON config properties, so that\r\n * some properties that absolutely need to be processed last, can be put at\r\n * the end.\r\n *\r\n * @ignore Exclude from docs\r\n * @param a Element 1\r\n * @param b Element 2\r\n * @return Sorting number\r\n */\n\n\n Series.prototype.configOrder = function (a, b) {\n if (a == b) {\n return 0;\n } // Must come last\n else if (a == \"heatRules\") {\n return 1;\n } else if (b == \"heatRules\") {\n return -1;\n } else {\n return _super.prototype.configOrder.call(this, a, b);\n }\n };\n /**\r\n * Sets `visibility` property:\r\n *\r\n * * `true` - visible\r\n * * `false` - hidden\r\n *\r\n * @param value true - visible, false - hidden\r\n * @return Current visibility\r\n */\n\n\n Series.prototype.setVisibility = function (value) {\n _super.prototype.setVisibility.call(this, value);\n\n this.bulletsContainer.visible = value;\n };\n\n return Series;\n}(Component);\n\nexport { Series };\n/**\r\n * Register class, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Series\"] = Series;\nregistry.registeredClasses[\"SeriesDataItem\"] = SeriesDataItem;","/**\r\n * Serial chart module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Chart, ChartDataItem } from \"../Chart\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { Container } from \"../../core/Container\";\nimport { Series } from \"../series/Series\";\nimport { percent } from \"../../core/utils/Percent\";\nimport { ColorSet } from \"../../core/utils/ColorSet\";\nimport { registry } from \"../../core/Registry\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $array from \"../../core/utils/Array\";\nimport { Disposer } from \"../../core/utils/Disposer\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[SerialChart]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar SerialChartDataItem =\n/** @class */\nfunction (_super) {\n __extends(SerialChartDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function SerialChartDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"SerialChartDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n return SerialChartDataItem;\n}(ChartDataItem);\n\nexport { SerialChartDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for all series-based charts, like XY, Pie, etc.\r\n *\r\n * Is not useful on its own.\r\n *\r\n * @see {@link ISerialChartEvents} for a list of available Events\r\n * @see {@link ISerialChartAdapters} for a list of available Adapters\r\n */\n\nvar SerialChart =\n/** @class */\nfunction (_super) {\n __extends(SerialChart, _super);\n /**\r\n * Constructor\r\n */\n\n\n function SerialChart() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"SerialChart\";\n _this.colors = new ColorSet();\n _this._usesData = false; // Create a container for series\n\n var seriesContainer = _this.chartContainer.createChild(Container);\n\n seriesContainer.shouldClone = false;\n seriesContainer.width = percent(100);\n seriesContainer.height = percent(100);\n seriesContainer.isMeasured = false;\n seriesContainer.layout = \"none\";\n seriesContainer.zIndex = 2;\n _this.seriesContainer = seriesContainer; // Create a container for bullets\n\n var bulletsContainer = _this.chartContainer.createChild(Container);\n\n bulletsContainer.shouldClone = false;\n bulletsContainer.width = percent(100);\n bulletsContainer.height = percent(100);\n bulletsContainer.isMeasured = false;\n bulletsContainer.zIndex = 3;\n bulletsContainer.layout = \"none\";\n _this.bulletsContainer = bulletsContainer; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n\n SerialChart.prototype.dispose = function () {\n _super.prototype.dispose.call(this);\n\n if (this.colors) {\n this.colors.dispose();\n }\n\n if (this.patterns) {\n this.patterns.dispose();\n }\n };\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor\r\n */\n\n\n SerialChart.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this); // Add a default screen reader title for accessibility\n // This will be overridden in screen reader if there are any `titles` set\n\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Serial chart\");\n }\n };\n\n Object.defineProperty(SerialChart.prototype, \"series\", {\n /**\r\n * A list of chart's series.\r\n *\r\n * @return Chart's series\r\n */\n get: function get() {\n if (!this._series) {\n this._series = new ListTemplate(this.createSeries());\n\n this._series.events.on(\"inserted\", this.handleSeriesAdded, this, false);\n\n this._series.events.on(\"removed\", this.handleSeriesRemoved, this, false);\n\n this._disposers.push(new ListDisposer(this._series, false));\n\n this._disposers.push(this._series.template);\n }\n\n return this._series;\n },\n enumerable: true,\n configurable: true\n });\n\n SerialChart.prototype.handleSeriesRemoved = function (event) {\n var series = event.oldValue;\n this.dataUsers.removeValue(series);\n this.dataUsers.each(function (dataUser) {\n dataUser.invalidateDataItems();\n });\n\n if (series.autoDispose) {\n series.dispose();\n } else {\n series.parent = undefined;\n series.bulletsContainer.parent = undefined;\n } //this.feedLegend();\n\n\n var legend = this.legend;\n\n if (legend) {\n var dataItems = this.legend.dataItems;\n\n for (var i = dataItems.length - 1; i >= 0; i--) {\n var dataItem = dataItems.getIndex(i);\n\n if (dataItem && dataItem.dataContext == series) {\n legend.dataItems.remove(dataItem);\n }\n }\n\n for (var i = legend.data.length - 1; i >= 0; i--) {\n var di = legend.data[i];\n\n if (di && di == series) {\n $array.remove(legend.data, di);\n }\n }\n }\n };\n /**\r\n * Decorates a new [[Series]] object with required parameters when it is\r\n * added to the chart.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n SerialChart.prototype.handleSeriesAdded = function (event) {\n var _this = this;\n\n var series = event.newValue;\n\n if (series.isDisposed()) {\n return;\n }\n\n series.chart = this;\n series.parent = this.seriesContainer;\n series.bulletsContainer.parent = this.bulletsContainer;\n\n this._dataUsers.moveValue(series);\n\n series.addDisposer(new Disposer(function () {\n _this.dataUsers.removeValue(series);\n }));\n this.handleSeriesAdded2(series);\n this.handleLegendSeriesAdded(series);\n };\n\n SerialChart.prototype.handleLegendSeriesAdded = function (series) {\n if (!series.hiddenInLegend) {\n if (this.legend) {\n this.legend.addData(series);\n }\n }\n };\n\n SerialChart.prototype.handleSeriesAdded2 = function (series) {\n var _this = this;\n\n if (!this.dataInvalid) {\n this._disposers.push( // on exit only as data is usually passed after push\n registry.events.once(\"exitframe\", function () {\n if (!series.data || series.data.length == 0) {\n series.data = _this.data;\n\n if (series.showOnInit) {\n series.reinit();\n series.setPropertyValue(\"showOnInit\", false);\n series.showOnInit = true;\n }\n\n if (!series.isDisposed()) {\n series.events.once(\"datavalidated\", function () {\n if (series.data == _this.data) {\n series._data = [];\n }\n });\n }\n }\n }));\n }\n };\n /**\r\n * Setups the legend to use the chart's data.\r\n * @ignore\r\n */\n\n\n SerialChart.prototype.feedLegend = function () {\n var legend = this.legend;\n\n if (legend) {\n var legendData_1 = [];\n $iter.each(this.series.iterator(), function (series) {\n if (!series.hiddenInLegend) {\n legendData_1.push(series);\n }\n });\n legend.dataFields.name = \"name\";\n legend.data = legendData_1;\n }\n };\n /**\r\n * Creates and returns a new Series, suitable for this chart type.\r\n *\r\n * @return New series\r\n */\n\n\n SerialChart.prototype.createSeries = function () {\n return new Series();\n };\n\n Object.defineProperty(SerialChart.prototype, \"colors\", {\n /**\r\n * @return Color list\r\n */\n get: function get() {\n return this.getPropertyValue(\"colors\");\n },\n\n /**\r\n * Chart's color list.\r\n *\r\n * This list can be used by a number of serial items, like applying a new\r\n * color for each Series added. Or, applying a new color for each slice\r\n * of a Pie chart.\r\n *\r\n * Please see [[ColorSet]] for information on how you can set up to generate\r\n * unique colors.\r\n *\r\n * A theme you are using may override default pre-defined colors.\r\n *\r\n * @param value Color list\r\n */\n set: function set(value) {\n this.setPropertyValue(\"colors\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SerialChart.prototype, \"patterns\", {\n /**\r\n * @return Pattern set\r\n */\n get: function get() {\n return this.getPropertyValue(\"patterns\");\n },\n\n /**\r\n * A [[PatternSet]] to use when creating patterned fills for slices.\r\n *\r\n * @since 4.7.5\r\n * @param value Pattern set\r\n */\n set: function set(value) {\n this.setPropertyValue(\"patterns\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies all parameters from another [[SerialChart]].\r\n *\r\n * @param source Source SerialChart\r\n */\n\n SerialChart.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.series.copyFrom(source.series);\n };\n /**\r\n * Hides the chart instantly and then shows it. If defaultState.transitionDuration > 0, this will result an animation in which properties of hidden state will animate to properties of visible state.\r\n */\n\n\n SerialChart.prototype.appear = function () {\n _super.prototype.appear.call(this);\n\n this.series.each(function (series) {\n if (series.showOnInit && series.inited) {\n series.appear();\n }\n });\n };\n\n return SerialChart;\n}(Chart);\n\nexport { SerialChart };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"SerialChart\"] = SerialChart;","function _createForOfIteratorHelper(o, allowArrayLike) { var it = typeof Symbol !== \"undefined\" && o[Symbol.iterator] || o[\"@@iterator\"]; if (!it) { if (Array.isArray(o) || (it = _unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === \"number\") { if (it) o = it; var i = 0; var F = function F() {}; return { s: F, n: function n() { if (i >= o.length) return { done: true }; return { done: false, value: o[i++] }; }, e: function e(_e) { throw _e; }, f: F }; } throw new TypeError(\"Invalid attempt to iterate non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); } var normalCompletion = true, didErr = false, err; return { s: function s() { it = it.call(o); }, n: function n() { var step = it.next(); normalCompletion = step.done; return step; }, e: function e(_e2) { didErr = true; err = _e2; }, f: function f() { try { if (!normalCompletion && it.return != null) it.return(); } finally { if (didErr) throw err; } } }; }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nfunction _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if (\"value\" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } }\n\nfunction _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); Object.defineProperty(Constructor, \"prototype\", { writable: false }); return Constructor; }\n\n// https://github.com/python/cpython/blob/a74eea238f5baba15797e2e8b570d153bc8690a7/Modules/mathmodule.c#L1423\nexport var Adder = /*#__PURE__*/function () {\n function Adder() {\n _classCallCheck(this, Adder);\n\n this._partials = new Float64Array(32);\n this._n = 0;\n }\n\n _createClass(Adder, [{\n key: \"add\",\n value: function add(x) {\n var p = this._partials;\n var i = 0;\n\n for (var j = 0; j < this._n && j < 32; j++) {\n var y = p[j],\n hi = x + y,\n lo = Math.abs(x) < Math.abs(y) ? x - (hi - y) : y - (hi - x);\n if (lo) p[i++] = lo;\n x = hi;\n }\n\n p[i] = x;\n this._n = i + 1;\n return this;\n }\n }, {\n key: \"valueOf\",\n value: function valueOf() {\n var p = this._partials;\n var n = this._n,\n x,\n y,\n lo,\n hi = 0;\n\n if (n > 0) {\n hi = p[--n];\n\n while (n > 0) {\n x = hi;\n y = p[--n];\n hi = x + y;\n lo = y - (hi - x);\n if (lo) break;\n }\n\n if (n > 0 && (lo < 0 && p[n - 1] < 0 || lo > 0 && p[n - 1] > 0)) {\n y = lo * 2;\n x = hi + y;\n if (y == x - hi) hi = x;\n }\n }\n\n return hi;\n }\n }]);\n\n return Adder;\n}();\nexport function fsum(values, valueof) {\n var adder = new Adder();\n\n if (valueof === undefined) {\n var _iterator = _createForOfIteratorHelper(values),\n _step;\n\n try {\n for (_iterator.s(); !(_step = _iterator.n()).done;) {\n var value = _step.value;\n\n if (value = +value) {\n adder.add(value);\n }\n }\n } catch (err) {\n _iterator.e(err);\n } finally {\n _iterator.f();\n }\n } else {\n var index = -1;\n\n var _iterator2 = _createForOfIteratorHelper(values),\n _step2;\n\n try {\n for (_iterator2.s(); !(_step2 = _iterator2.n()).done;) {\n var _value = _step2.value;\n\n if (_value = +valueof(_value, ++index, values)) {\n adder.add(_value);\n }\n }\n } catch (err) {\n _iterator2.e(err);\n } finally {\n _iterator2.f();\n }\n }\n\n return +adder;\n}\nexport function fcumsum(values, valueof) {\n var adder = new Adder();\n var index = -1;\n return Float64Array.from(values, valueof === undefined ? function (v) {\n return adder.add(+v || 0);\n } : function (v) {\n return adder.add(+valueof(v, ++index, values) || 0);\n });\n}","export var epsilon = 1e-6;\nexport var epsilon2 = 1e-12;\nexport var pi = Math.PI;\nexport var halfPi = pi / 2;\nexport var quarterPi = pi / 4;\nexport var tau = pi * 2;\nexport var degrees = 180 / pi;\nexport var radians = pi / 180;\nexport var abs = Math.abs;\nexport var atan = Math.atan;\nexport var atan2 = Math.atan2;\nexport var cos = Math.cos;\nexport var ceil = Math.ceil;\nexport var exp = Math.exp;\nexport var floor = Math.floor;\nexport var hypot = Math.hypot;\nexport var log = Math.log;\nexport var pow = Math.pow;\nexport var sin = Math.sin;\nexport var sign = Math.sign || function (x) {\n return x > 0 ? 1 : x < 0 ? -1 : 0;\n};\nexport var sqrt = Math.sqrt;\nexport var tan = Math.tan;\nexport function acos(x) {\n return x > 1 ? 0 : x < -1 ? pi : Math.acos(x);\n}\nexport function asin(x) {\n return x > 1 ? halfPi : x < -1 ? -halfPi : Math.asin(x);\n}\nexport function haversin(x) {\n return (x = sin(x / 2)) * x;\n}","export default function noop() {}","function streamGeometry(geometry, stream) {\n if (geometry && streamGeometryType.hasOwnProperty(geometry.type)) {\n streamGeometryType[geometry.type](geometry, stream);\n }\n}\n\nvar streamObjectType = {\n Feature: function Feature(object, stream) {\n streamGeometry(object.geometry, stream);\n },\n FeatureCollection: function FeatureCollection(object, stream) {\n var features = object.features,\n i = -1,\n n = features.length;\n\n while (++i < n) {\n streamGeometry(features[i].geometry, stream);\n }\n }\n};\nvar streamGeometryType = {\n Sphere: function Sphere(object, stream) {\n stream.sphere();\n },\n Point: function Point(object, stream) {\n object = object.coordinates;\n stream.point(object[0], object[1], object[2]);\n },\n MultiPoint: function MultiPoint(object, stream) {\n var coordinates = object.coordinates,\n i = -1,\n n = coordinates.length;\n\n while (++i < n) {\n object = coordinates[i], stream.point(object[0], object[1], object[2]);\n }\n },\n LineString: function LineString(object, stream) {\n streamLine(object.coordinates, stream, 0);\n },\n MultiLineString: function MultiLineString(object, stream) {\n var coordinates = object.coordinates,\n i = -1,\n n = coordinates.length;\n\n while (++i < n) {\n streamLine(coordinates[i], stream, 0);\n }\n },\n Polygon: function Polygon(object, stream) {\n streamPolygon(object.coordinates, stream);\n },\n MultiPolygon: function MultiPolygon(object, stream) {\n var coordinates = object.coordinates,\n i = -1,\n n = coordinates.length;\n\n while (++i < n) {\n streamPolygon(coordinates[i], stream);\n }\n },\n GeometryCollection: function GeometryCollection(object, stream) {\n var geometries = object.geometries,\n i = -1,\n n = geometries.length;\n\n while (++i < n) {\n streamGeometry(geometries[i], stream);\n }\n }\n};\n\nfunction streamLine(coordinates, stream, closed) {\n var i = -1,\n n = coordinates.length - closed,\n coordinate;\n stream.lineStart();\n\n while (++i < n) {\n coordinate = coordinates[i], stream.point(coordinate[0], coordinate[1], coordinate[2]);\n }\n\n stream.lineEnd();\n}\n\nfunction streamPolygon(coordinates, stream) {\n var i = -1,\n n = coordinates.length;\n stream.polygonStart();\n\n while (++i < n) {\n streamLine(coordinates[i], stream, 1);\n }\n\n stream.polygonEnd();\n}\n\nexport default function (object, stream) {\n if (object && streamObjectType.hasOwnProperty(object.type)) {\n streamObjectType[object.type](object, stream);\n } else {\n streamGeometry(object, stream);\n }\n}","import { Adder } from \"d3-array\";\nimport { atan2, cos, quarterPi, radians, sin, tau } from \"./math.js\";\nimport noop from \"./noop.js\";\nimport stream from \"./stream.js\";\nexport var areaRingSum = new Adder(); // hello?\n\nvar areaSum = new Adder(),\n lambda00,\n phi00,\n lambda0,\n cosPhi0,\n sinPhi0;\nexport var areaStream = {\n point: noop,\n lineStart: noop,\n lineEnd: noop,\n polygonStart: function polygonStart() {\n areaRingSum = new Adder();\n areaStream.lineStart = areaRingStart;\n areaStream.lineEnd = areaRingEnd;\n },\n polygonEnd: function polygonEnd() {\n var areaRing = +areaRingSum;\n areaSum.add(areaRing < 0 ? tau + areaRing : areaRing);\n this.lineStart = this.lineEnd = this.point = noop;\n },\n sphere: function sphere() {\n areaSum.add(tau);\n }\n};\n\nfunction areaRingStart() {\n areaStream.point = areaPointFirst;\n}\n\nfunction areaRingEnd() {\n areaPoint(lambda00, phi00);\n}\n\nfunction areaPointFirst(lambda, phi) {\n areaStream.point = areaPoint;\n lambda00 = lambda, phi00 = phi;\n lambda *= radians, phi *= radians;\n lambda0 = lambda, cosPhi0 = cos(phi = phi / 2 + quarterPi), sinPhi0 = sin(phi);\n}\n\nfunction areaPoint(lambda, phi) {\n lambda *= radians, phi *= radians;\n phi = phi / 2 + quarterPi; // half the angular distance from south pole\n // Spherical excess E for a spherical triangle with vertices: south pole,\n // previous point, current point. Uses a formula derived from Cagnoli’s\n // theorem. See Todhunter, Spherical Trig. (1871), Sec. 103, Eq. (2).\n\n var dLambda = lambda - lambda0,\n sdLambda = dLambda >= 0 ? 1 : -1,\n adLambda = sdLambda * dLambda,\n cosPhi = cos(phi),\n sinPhi = sin(phi),\n k = sinPhi0 * sinPhi,\n u = cosPhi0 * cosPhi + k * cos(adLambda),\n v = k * sdLambda * sin(adLambda);\n areaRingSum.add(atan2(v, u)); // Advance the previous points.\n\n lambda0 = lambda, cosPhi0 = cosPhi, sinPhi0 = sinPhi;\n}\n\nexport default function (object) {\n areaSum = new Adder();\n stream(object, areaStream);\n return areaSum * 2;\n}","import { Adder } from \"d3-array\";\nimport { areaStream, areaRingSum } from \"./area.js\";\nimport { cartesian, cartesianCross, cartesianNormalizeInPlace, spherical } from \"./cartesian.js\";\nimport { abs, degrees, epsilon, radians } from \"./math.js\";\nimport stream from \"./stream.js\";\nvar lambda0, phi0, lambda1, phi1, // bounds\nlambda2, // previous lambda-coordinate\nlambda00, phi00, // first point\np0, // previous 3D point\ndeltaSum, ranges, range;\nvar boundsStream = {\n point: boundsPoint,\n lineStart: boundsLineStart,\n lineEnd: boundsLineEnd,\n polygonStart: function polygonStart() {\n boundsStream.point = boundsRingPoint;\n boundsStream.lineStart = boundsRingStart;\n boundsStream.lineEnd = boundsRingEnd;\n deltaSum = new Adder();\n areaStream.polygonStart();\n },\n polygonEnd: function polygonEnd() {\n areaStream.polygonEnd();\n boundsStream.point = boundsPoint;\n boundsStream.lineStart = boundsLineStart;\n boundsStream.lineEnd = boundsLineEnd;\n if (areaRingSum < 0) lambda0 = -(lambda1 = 180), phi0 = -(phi1 = 90);else if (deltaSum > epsilon) phi1 = 90;else if (deltaSum < -epsilon) phi0 = -90;\n range[0] = lambda0, range[1] = lambda1;\n },\n sphere: function sphere() {\n lambda0 = -(lambda1 = 180), phi0 = -(phi1 = 90);\n }\n};\n\nfunction boundsPoint(lambda, phi) {\n ranges.push(range = [lambda0 = lambda, lambda1 = lambda]);\n if (phi < phi0) phi0 = phi;\n if (phi > phi1) phi1 = phi;\n}\n\nfunction linePoint(lambda, phi) {\n var p = cartesian([lambda * radians, phi * radians]);\n\n if (p0) {\n var normal = cartesianCross(p0, p),\n equatorial = [normal[1], -normal[0], 0],\n inflection = cartesianCross(equatorial, normal);\n cartesianNormalizeInPlace(inflection);\n inflection = spherical(inflection);\n var delta = lambda - lambda2,\n sign = delta > 0 ? 1 : -1,\n lambdai = inflection[0] * degrees * sign,\n phii,\n antimeridian = abs(delta) > 180;\n\n if (antimeridian ^ (sign * lambda2 < lambdai && lambdai < sign * lambda)) {\n phii = inflection[1] * degrees;\n if (phii > phi1) phi1 = phii;\n } else if (lambdai = (lambdai + 360) % 360 - 180, antimeridian ^ (sign * lambda2 < lambdai && lambdai < sign * lambda)) {\n phii = -inflection[1] * degrees;\n if (phii < phi0) phi0 = phii;\n } else {\n if (phi < phi0) phi0 = phi;\n if (phi > phi1) phi1 = phi;\n }\n\n if (antimeridian) {\n if (lambda < lambda2) {\n if (angle(lambda0, lambda) > angle(lambda0, lambda1)) lambda1 = lambda;\n } else {\n if (angle(lambda, lambda1) > angle(lambda0, lambda1)) lambda0 = lambda;\n }\n } else {\n if (lambda1 >= lambda0) {\n if (lambda < lambda0) lambda0 = lambda;\n if (lambda > lambda1) lambda1 = lambda;\n } else {\n if (lambda > lambda2) {\n if (angle(lambda0, lambda) > angle(lambda0, lambda1)) lambda1 = lambda;\n } else {\n if (angle(lambda, lambda1) > angle(lambda0, lambda1)) lambda0 = lambda;\n }\n }\n }\n } else {\n ranges.push(range = [lambda0 = lambda, lambda1 = lambda]);\n }\n\n if (phi < phi0) phi0 = phi;\n if (phi > phi1) phi1 = phi;\n p0 = p, lambda2 = lambda;\n}\n\nfunction boundsLineStart() {\n boundsStream.point = linePoint;\n}\n\nfunction boundsLineEnd() {\n range[0] = lambda0, range[1] = lambda1;\n boundsStream.point = boundsPoint;\n p0 = null;\n}\n\nfunction boundsRingPoint(lambda, phi) {\n if (p0) {\n var delta = lambda - lambda2;\n deltaSum.add(abs(delta) > 180 ? delta + (delta > 0 ? 360 : -360) : delta);\n } else {\n lambda00 = lambda, phi00 = phi;\n }\n\n areaStream.point(lambda, phi);\n linePoint(lambda, phi);\n}\n\nfunction boundsRingStart() {\n areaStream.lineStart();\n}\n\nfunction boundsRingEnd() {\n boundsRingPoint(lambda00, phi00);\n areaStream.lineEnd();\n if (abs(deltaSum) > epsilon) lambda0 = -(lambda1 = 180);\n range[0] = lambda0, range[1] = lambda1;\n p0 = null;\n} // Finds the left-right distance between two longitudes.\n// This is almost the same as (lambda1 - lambda0 + 360°) % 360°, except that we want\n// the distance between ±180° to be 360°.\n\n\nfunction angle(lambda0, lambda1) {\n return (lambda1 -= lambda0) < 0 ? lambda1 + 360 : lambda1;\n}\n\nfunction rangeCompare(a, b) {\n return a[0] - b[0];\n}\n\nfunction rangeContains(range, x) {\n return range[0] <= range[1] ? range[0] <= x && x <= range[1] : x < range[0] || range[1] < x;\n}\n\nexport default function (feature) {\n var i, n, a, b, merged, deltaMax, delta;\n phi1 = lambda1 = -(lambda0 = phi0 = Infinity);\n ranges = [];\n stream(feature, boundsStream); // First, sort ranges by their minimum longitudes.\n\n if (n = ranges.length) {\n ranges.sort(rangeCompare); // Then, merge any ranges that overlap.\n\n for (i = 1, a = ranges[0], merged = [a]; i < n; ++i) {\n b = ranges[i];\n\n if (rangeContains(a, b[0]) || rangeContains(a, b[1])) {\n if (angle(a[0], b[1]) > angle(a[0], a[1])) a[1] = b[1];\n if (angle(b[0], a[1]) > angle(a[0], a[1])) a[0] = b[0];\n } else {\n merged.push(a = b);\n }\n } // Finally, find the largest gap between the merged ranges.\n // The final bounding box will be the inverse of this gap.\n\n\n for (deltaMax = -Infinity, n = merged.length - 1, i = 0, a = merged[n]; i <= n; a = b, ++i) {\n b = merged[i];\n if ((delta = angle(a[1], b[0])) > deltaMax) deltaMax = delta, lambda0 = b[0], lambda1 = a[1];\n }\n }\n\n ranges = range = null;\n return lambda0 === Infinity || phi0 === Infinity ? [[NaN, NaN], [NaN, NaN]] : [[lambda0, phi0], [lambda1, phi1]];\n}","import { asin, atan2, cos, sin, sqrt } from \"./math.js\";\nexport function spherical(cartesian) {\n return [atan2(cartesian[1], cartesian[0]), asin(cartesian[2])];\n}\nexport function cartesian(spherical) {\n var lambda = spherical[0],\n phi = spherical[1],\n cosPhi = cos(phi);\n return [cosPhi * cos(lambda), cosPhi * sin(lambda), sin(phi)];\n}\nexport function cartesianDot(a, b) {\n return a[0] * b[0] + a[1] * b[1] + a[2] * b[2];\n}\nexport function cartesianCross(a, b) {\n return [a[1] * b[2] - a[2] * b[1], a[2] * b[0] - a[0] * b[2], a[0] * b[1] - a[1] * b[0]];\n} // TODO return a\n\nexport function cartesianAddInPlace(a, b) {\n a[0] += b[0], a[1] += b[1], a[2] += b[2];\n}\nexport function cartesianScale(vector, k) {\n return [vector[0] * k, vector[1] * k, vector[2] * k];\n} // TODO return d\n\nexport function cartesianNormalizeInPlace(d) {\n var l = sqrt(d[0] * d[0] + d[1] * d[1] + d[2] * d[2]);\n d[0] /= l, d[1] /= l, d[2] /= l;\n}","/**\r\n * Map series module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Series, SeriesDataItem } from \"../series/Series\";\nimport { registry } from \"../../core/Registry\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapSeries]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar MapSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapSeriesDataItem\";\n _this.values.value = {};\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(MapSeriesDataItem.prototype, \"value\", {\n /**\r\n * @return Value\r\n */\n get: function get() {\n return this.values.value.value;\n },\n\n /**\r\n * Numeric value of the data item.\r\n *\r\n * Value may be used in heat-map calculations.\r\n *\r\n * @param value Value\r\n */\n set: function set(value) {\n this.setValue(\"value\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeriesDataItem.prototype, \"zoomLevel\", {\n /**\r\n * @return Zoom level\r\n */\n get: function get() {\n return this.properties[\"zoomLevel\"];\n },\n\n /**\r\n * When `zoomToMapObject()` is called the map will either calculate suitable\r\n * zoom level itself or use object's `zoomLevel` if set.\r\n *\r\n * @param value Zoom level\r\n */\n set: function set(value) {\n this.setProperty(\"zoomLevel\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeriesDataItem.prototype, \"zoomGeoPoint\", {\n /**\r\n * @return Zoom geo point\r\n */\n get: function get() {\n return this.properties[\"zoomGeoPoint\"];\n },\n\n /**\r\n * When `zoomToMapObject()` is called the map will either calculate suitable\r\n * center position itself or use object's `zoomGeoPoint` if set.\r\n *\r\n * @param value Zoom geo point\r\n */\n set: function set(value) {\n this.setProperty(\"zoomGeoPoint\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeriesDataItem.prototype, \"east\", {\n /**\r\n * Longitude of the East-most point of the element.\r\n */\n get: function get() {\n return this._east;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeriesDataItem.prototype, \"west\", {\n /**\r\n * Longitude of the West-most point of the element.\r\n */\n get: function get() {\n return this._west;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeriesDataItem.prototype, \"south\", {\n /**\r\n * Latitude of the South-most point of the element.\r\n */\n get: function get() {\n return this._south;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeriesDataItem.prototype, \"north\", {\n /**\r\n * Latitude of the North-most point of the element.\r\n */\n get: function get() {\n return this._north;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates the item's bounding coordinates: coordinates of the East, West,\r\n * North, and South-most points.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n MapSeriesDataItem.prototype.updateExtremes = function () {\n var geometry = this.getFeature().geometry;\n\n if (geometry) {\n var bounds = d3geo.geoBounds(geometry);\n var west = bounds[0][0];\n var south = bounds[0][1];\n var north = bounds[1][1];\n var east = bounds[1][0];\n var changed = false;\n\n if (north != this.north) {\n this._north = $math.round(north, 6);\n changed = true;\n }\n\n if (south != this.south) {\n this._south = $math.round(south, 6);\n changed = true;\n }\n\n if (east != this.east) {\n this._east = $math.round(east, 6);\n changed = true;\n }\n\n if (west != this.west) {\n this._west = $math.round(west, 6);\n changed = true;\n } // solves single russia prob\n\n\n if (this._east < this._west) {\n this._east = 180;\n this._west = -180;\n }\n\n if (changed) {\n this.component.invalidateDataItems();\n }\n }\n };\n\n MapSeriesDataItem.prototype.getFeature = function () {\n return {};\n };\n\n return MapSeriesDataItem;\n}(SeriesDataItem);\n\nexport { MapSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for series of map objects.\r\n *\r\n * @see {@link IMapSeriesEvents} for a list of available Events\r\n * @see {@link IMapSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar MapSeries =\n/** @class */\nfunction (_super) {\n __extends(MapSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapSeries() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"MapSeries\"; // Set defaults\n\n _this.isMeasured = false;\n _this.nonScalingStroke = true; // Set data fields\n\n _this.dataFields.value = \"value\";\n _this.ignoreBounds = false;\n\n if (_this.tooltip) {\n _this.tooltip.showInViewport = true;\n } // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n MapSeries.prototype.createDataItem = function () {\n return new MapSeriesDataItem();\n };\n /**\r\n * Checks whether object should be included in series.\r\n *\r\n * @param includes A list of explicitly included ids\r\n * @param excludes A list of explicitly excluded ids\r\n * @param id Id of the object\r\n * @return Include?\r\n */\n\n\n MapSeries.prototype.checkInclude = function (includes, excludes, id) {\n if (includes) {\n if (includes.length == 0) {\n return false;\n } else {\n if (includes.indexOf(id) == -1) {\n return false;\n }\n }\n }\n\n if (excludes && excludes.length > 0) {\n if (excludes.indexOf(id) != -1) {\n return false;\n }\n }\n\n return true;\n };\n\n Object.defineProperty(MapSeries.prototype, \"useGeodata\", {\n /**\r\n * @return Use GeoJSON data?\r\n */\n get: function get() {\n return this.getPropertyValue(\"useGeodata\");\n },\n\n /**\r\n * Should the map extract all the data about element from the GeoJSON?\r\n *\r\n * This is especially relevant for [[MapPolygonSeries]]. If not set to `true`\r\n * polygon series will need to contain geographical data in itself in order\r\n * to be drawn.\r\n *\r\n * If this is set to `true`, series will try to extract data for its objects\r\n * from either chart-level `geodata` or from series' `geodata` which holds\r\n * map infor in GeoJSON format.\r\n *\r\n * @default false\r\n * @param value Use GeoJSON data?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"useGeodata\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"include\", {\n /**\r\n * @return Included objects\r\n */\n get: function get() {\n return this.getPropertyValue(\"include\");\n },\n\n /**\r\n * A list of object ids that should be explictly included in the series.\r\n *\r\n * If this is not set, the series will automatically include all of the\r\n * objects, available in the GeoJSON map. (minus the ones listed in\r\n * `exclude`)\r\n *\r\n * If you need to display only specific objects, use `include`. E.g.:\r\n *\r\n * `include = [\"FR\", \"ES\", \"DE\"];`\r\n *\r\n * The above will show only France, Spain, and Germany out of the whole map.\r\n *\r\n * @param value Included objects\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"include\", value)) {\n this.processIncExc();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n MapSeries.prototype.processIncExc = function () {\n //this.data = [];\n this.invalidateData();\n };\n\n Object.defineProperty(MapSeries.prototype, \"ignoreBounds\", {\n /**\r\n * @return Ignore bounds?\r\n */\n get: function get() {\n return this.getPropertyValue(\"ignoreBounds\");\n },\n\n /**\r\n * Should this series be included when calculating bounds of the map?\r\n *\r\n * This affects initial zoom as well as limits for zoom/pan.\r\n *\r\n * By default, `MapPolygonSeries` included (true), while `MapImageSeries` and\r\n * `MapLineSeries` are not (`false`).\r\n *\r\n * @since 4.3.0\r\n * @param value Ignore bounds?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"ignoreBounds\", value)) {\n if (this.chart) {\n this.chart.updateExtremes();\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"exclude\", {\n /**\r\n * @return Excluded ids\r\n */\n get: function get() {\n return this.getPropertyValue(\"exclude\");\n },\n\n /**\r\n * A list of object ids that should be excluded from the series.\r\n *\r\n * E.g. you want to include all of the areas from a GeoJSON map, except\r\n * Antarctica.\r\n *\r\n * You'd leave `include` empty, and set `exclude = [\"AQ\"]`.\r\n *\r\n * @param value Excluded ids\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"exclude\", value)) {\n this.processIncExc();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Decorates a newly added object.\r\n *\r\n * @param event [description]\r\n */\n\n MapSeries.prototype.handleObjectAdded = function (event) {\n var mapObject = event.newValue;\n mapObject.parent = this;\n mapObject.series = this;\n mapObject.strokeWidth = mapObject.strokeWidth;\n };\n\n Object.defineProperty(MapSeries.prototype, \"geodata\", {\n /**\r\n * @return GeoJSON data\r\n */\n get: function get() {\n return this._geodata;\n },\n\n /**\r\n * Map data in GeoJSON format.\r\n *\r\n * The series supports the following GeoJSON objects: `Point`, `LineString`,\r\n * `Polygon`, `MultiPoint`, `MultiLineString`, and `MultiPolygon`.\r\n *\r\n * @see {@link http://geojson.org/} Official GeoJSON format specification\r\n * @param geoJSON GeoJSON data\r\n */\n set: function set(geodata) {\n if (geodata != this._geodata) {\n this._geodata = geodata;\n\n if (this.reverseGeodata) {\n this.chart.processReverseGeodata(this._geodata);\n }\n\n for (var i = this.data.length - 1; i >= 0; i--) {\n if (this.data[i].madeFromGeoData == true) {\n this.data.splice(i, 1);\n }\n }\n\n this.disposeData();\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"reverseGeodata\", {\n /**\r\n * @returns Reverse the order of geodata coordinates?\r\n */\n get: function get() {\n return this.getPropertyValue(\"reverseGeodata\");\n },\n\n /**\r\n * Indicates whether GeoJSON geodata supplied to the chart uses\r\n * ESRI (clockwise) or non-ESRI (counter-clockwise) order of the polygon\r\n * coordinates.\r\n *\r\n * `MapChart` supports only ESRI standard, so if your custom maps appears\r\n * garbled, try setting `reverseGeodata = true`.\r\n *\r\n * @default false\r\n * @since 4.10.11\r\n * @param value Reverse the order of geodata coordinates?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"reverseGeodata\", value) && this._geodata) {\n this.chart.processReverseGeodata(this._geodata);\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"geodataSource\", {\n /**\r\n * Returns a [[DataSource]] specifically for loading Component's data.\r\n *\r\n * @return Data source\r\n */\n get: function get() {\n if (!this._dataSources[\"geodata\"]) {\n this.getDataSource(\"geodata\");\n }\n\n return this._dataSources[\"geodata\"];\n },\n\n /**\r\n * Sets a [[DataSource]] to be used for loading Component's data.\r\n *\r\n * @param value Data source\r\n */\n set: function set(value) {\n var _this = this;\n\n if (this._dataSources[\"geodata\"]) {\n this.removeDispose(this._dataSources[\"geodata\"]);\n }\n\n this._dataSources[\"geodata\"] = value;\n this._dataSources[\"geodata\"].component = this;\n this.events.on(\"inited\", function () {\n _this.loadData(\"geodata\");\n }, undefined, false);\n this.setDataSourceEvents(value, \"geodata\");\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n MapSeries.prototype.getFeatures = function () {\n return;\n };\n /**\r\n * @ignore\r\n */\n\n\n MapSeries.prototype.validateDataItems = function () {\n _super.prototype.validateDataItems.call(this);\n\n this.updateExtremes();\n };\n /**\r\n * @ignore\r\n */\n\n\n MapSeries.prototype.updateExtremes = function () {\n var north;\n var south;\n var east;\n var west;\n this.dataItems.each(function (dataItem) {\n if (dataItem.north > north || !$type.isNumber(north)) {\n north = dataItem.north;\n }\n\n if (dataItem.south < south || !$type.isNumber(south)) {\n south = dataItem.south;\n }\n\n if (dataItem.west < west || !$type.isNumber(west)) {\n west = dataItem.west;\n }\n\n if (dataItem.east > east || !$type.isNumber(east)) {\n east = dataItem.east;\n }\n });\n\n if (this._mapObjects) {\n this._mapObjects.each(function (mapObject) {\n if (mapObject.north > north || !$type.isNumber(north)) {\n north = mapObject.north;\n }\n\n if (mapObject.south < south || !$type.isNumber(south)) {\n south = mapObject.south;\n }\n\n if (mapObject.west < west || !$type.isNumber(west)) {\n west = mapObject.west;\n }\n\n if (mapObject.east > east || !$type.isNumber(east)) {\n east = mapObject.east;\n }\n });\n }\n\n if (this.north != north || this.east != east || this.south != south || this.west != west) {\n this._north = north;\n this._east = east;\n this._west = west;\n this._south = south;\n this.dispatch(\"geoBoundsChanged\");\n\n if (!this.ignoreBounds) {\n this.chart.updateExtremes();\n }\n }\n };\n\n Object.defineProperty(MapSeries.prototype, \"north\", {\n /**\r\n * @return Latitude\r\n */\n get: function get() {\n if ($type.isNumber(this._northDefined)) {\n return this._northDefined;\n }\n\n return this._north;\n },\n\n /**\r\n * North-most latitude of the series.\r\n *\r\n * By default, this holds auto-calculated latitude of the extremity.\r\n *\r\n * It can be overridden manually.\r\n *\r\n * @param value Latitude\r\n */\n set: function set(value) {\n this._northDefined = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"south\", {\n /**\r\n * @return Latitude\r\n */\n get: function get() {\n if ($type.isNumber(this._southDefined)) {\n return this._southDefined;\n }\n\n return this._south;\n },\n\n /**\r\n * South-most latitude of the series.\r\n *\r\n * By default, this holds auto-calculated latitude of the extremity.\r\n *\r\n * It can be overridden manually.\r\n *\r\n * @param value Latitude\r\n */\n set: function set(value) {\n this._southDefined = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"west\", {\n /**\r\n * @return Longitude\r\n */\n get: function get() {\n if ($type.isNumber(this._westDefined)) {\n return this._westDefined;\n }\n\n return this._west;\n },\n\n /**\r\n * West-most longitude of the series.\r\n *\r\n * By default, this holds auto-calculated longitude of the extremity.\r\n *\r\n * It can be overridden manually.\r\n *\r\n * @param value Longitude\r\n */\n set: function set(value) {\n this._westDefined = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapSeries.prototype, \"east\", {\n /**\r\n * @return Longitude\r\n */\n get: function get() {\n if ($type.isNumber(this._eastDefined)) {\n return this._eastDefined;\n }\n\n return this._east;\n },\n\n /**\r\n * East-most longitude of the series.\r\n *\r\n * By default, this holds auto-calculated longitude of the extremity.\r\n *\r\n * It can be overridden manually.\r\n *\r\n * @param value Longitude\r\n */\n set: function set(value) {\n this._eastDefined = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n MapSeries.prototype.processConfig = function (config) {\n if ($type.hasValue(config[\"geodata\"]) && $type.isString(config[\"geodata\"])) {\n var name_1 = config[\"geodata\"]; // Check if there's a map loaded by such name\n\n if ($type.hasValue(window[\"am4geodata_\" + config[\"geodata\"]])) {\n config[\"geodata\"] = window[\"am4geodata_\" + config[\"geodata\"]];\n } // Nope. Let's try maybe we got JSON as string?\n else {\n try {\n config[\"geodata\"] = JSON.parse(config[\"geodata\"]);\n } catch (e) {\n // No go again. Error out.\n throw Error(\"MapChart error: Geodata `\" + name_1 + \"` is not loaded or is incorrect.\");\n }\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n /**\r\n * Adds `projection` to \"as is\" fields.\r\n *\r\n * @param field Field name\r\n * @return Assign as is?\r\n */\n\n\n MapSeries.prototype.asIs = function (field) {\n return field == \"geodata\" || _super.prototype.asIs.call(this, field);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapSeries.prototype.updateTooltipBounds = function () {\n if (this.tooltip && this.topParent) {\n this.tooltip.setBounds({\n x: 10,\n y: 10,\n width: this.topParent.maxWidth - 20,\n height: this.topParent.maxHeight - 20\n });\n }\n };\n\n return MapSeries;\n}(Series);\n\nexport { MapSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapSeries\"] = MapSeries;\nregistry.registeredClasses[\"MapSeriesDataItem\"] = MapSeriesDataItem;","/**\r\n * Map object module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { registry } from \"../../core/Registry\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as d3geo from \"d3-geo\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A base class for all map objects: lines, images, etc.\r\n *\r\n * @see {@link IMapObjectEvents} for a list of available events\r\n * @see {@link IMapObjectAdapters} for a list of available Adapters\r\n */\n\nvar MapObject =\n/** @class */\nfunction (_super) {\n __extends(MapObject, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapObject() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"MapObject\"; // Set defaults\n\n _this.isMeasured = false;\n _this.layout = \"none\";\n _this.clickable = true; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * (Re)validates this object, forcing it to redraw.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapObject.prototype.validate = function () {\n if (this.series && this.series.itemReaderText) {\n this.readerTitle = this.series.itemReaderText;\n }\n\n _super.prototype.validate.call(this);\n };\n /**\r\n * Updates the item's bounding coordinates: coordinates of the East, West,\r\n * North, and South-most points.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapObject.prototype.updateExtremes = function () {\n var feature = this.getFeature();\n\n if (feature) {\n var geometry = feature.geometry;\n\n if (geometry) {\n var bounds = d3geo.geoBounds(geometry);\n var west = bounds[0][0];\n var south = bounds[0][1];\n var north = bounds[1][1];\n var east = bounds[1][0];\n var changed = false;\n\n if (north != this.north) {\n this._north = $math.round(north, 8);\n changed = true;\n }\n\n if (south != this.south) {\n this._south = $math.round(south);\n changed = true;\n }\n\n if (east != this.east) {\n this._east = $math.round(east);\n changed = true;\n }\n\n if (west != this.west) {\n this._west = $math.round(west);\n changed = true;\n }\n\n if (changed) {\n this.dispatch(\"geoBoundsChanged\");\n\n if (this.series) {\n this.series.invalidateDataItems();\n }\n }\n }\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n MapObject.prototype.getFeature = function () {\n return {};\n };\n\n Object.defineProperty(MapObject.prototype, \"east\", {\n /**\r\n * Longitude of the East-most point of the element.\r\n */\n get: function get() {\n if ($type.isNumber(this._east)) {\n return this._east;\n } else if (this.dataItem) {\n return this.dataItem.east;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapObject.prototype, \"west\", {\n /**\r\n * Longitude of the West-most point of the element.\r\n */\n get: function get() {\n if ($type.isNumber(this._west)) {\n return this._west;\n } else if (this.dataItem) {\n return this.dataItem.west;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapObject.prototype, \"south\", {\n /**\r\n * Latitude of the South-most point of the element.\r\n */\n get: function get() {\n if ($type.isNumber(this._south)) {\n return this._south;\n } else if (this.dataItem) {\n return this.dataItem.south;\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapObject.prototype, \"north\", {\n /**\r\n * Latitude of the North-most point of the element.\r\n */\n get: function get() {\n if ($type.isNumber(this._north)) {\n return this._north;\n } else if (this.dataItem) {\n return this.dataItem.north;\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Shows the element's [[Tooltip]].\r\n *\r\n * A tooltip will be populated using text templates in either `tooltipHTML` or\r\n * `tooltipText` as well as data in `tooltipDataItem`.\r\n *\r\n * @see {@link Tooltip}\r\n * @param optional point (sprite-related) to which tooltip must point.\r\n * @return returns true if the tooltip was shown and false if it wasn't (no text was found)\r\n */\n\n MapObject.prototype.showTooltip = function (point) {\n var res = _super.prototype.showTooltip.call(this, point);\n\n if (res && this.showTooltipOn == \"always\" && !this.series.chart.events.has(\"mappositionchanged\", this.handleTooltipMove, this)) {\n this.addDisposer(this.series.chart.events.on(\"mappositionchanged\", this.handleTooltipMove, this));\n }\n\n return res;\n };\n\n MapObject.prototype.handleTooltipMove = function (ev) {\n if (!this.tooltip.isHidden) {\n this.showTooltip();\n }\n };\n /**\r\n * Sets a [[DataItem]].\r\n * @param dataItem DataItem\r\n */\n\n\n MapObject.prototype.setDataItem = function (dataItem) {\n _super.prototype.setDataItem.call(this, dataItem);\n\n this.applyAccessibility();\n };\n\n return MapObject;\n}(Container);\n\nexport { MapObject };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapObject\"] = MapObject;","/**\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapObject } from \"./MapObject\";\nimport { registry } from \"../../core/Registry\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to place an image on the map.\r\n *\r\n * @see {@link IMapImageEvents} for a list of available events\r\n * @see {@link IMapImageAdapters} for a list of available Adapters\r\n */\n\nvar MapImage =\n/** @class */\nfunction (_super) {\n __extends(MapImage, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapImage() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapImage\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(MapImage.prototype, \"latitude\", {\n /**\r\n * @return Latitude\r\n */\n get: function get() {\n var latitude = this.getPropertyValue(\"latitude\");\n\n if (!$type.isNumber(latitude) && this.dataItem && this.dataItem.geoPoint) {\n latitude = this.dataItem.geoPoint.latitude;\n }\n\n return latitude;\n },\n\n /**\r\n * Latitude image is placed at.\r\n *\r\n * @param value Latitude\r\n */\n set: function set(value) {\n this.setPropertyValue(\"latitude\", value, false, true);\n this.updateExtremes();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapImage.prototype, \"longitude\", {\n /**\r\n * @return Longitude\r\n */\n get: function get() {\n var longitude = this.getPropertyValue(\"longitude\");\n\n if (!$type.isNumber(longitude) && this.dataItem && this.dataItem.geoPoint) {\n longitude = this.dataItem.geoPoint.longitude;\n }\n\n return longitude;\n },\n\n /**\r\n * Longitude image is placed on.\r\n *\r\n * @param value Longitude\r\n */\n set: function set(value) {\n this.setPropertyValue(\"longitude\", value, false, true);\n this.updateExtremes();\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Repositions the image to it's current position.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n MapImage.prototype.validatePosition = function () {\n if ($type.isNumber(this.latitude) && $type.isNumber(this.longitude)) {\n //this.moveTo(this.series.chart.projection.convert({ latitude: this.latitude, longitude: this.longitude }));\n var p = this.series.chart.projection.d3Projection([this.longitude, this.latitude]);\n var visible = this.series.chart.projection.d3Path({\n type: 'Point',\n coordinates: [this.longitude, this.latitude]\n });\n\n if (!visible) {\n this.__disabled = true;\n } else {\n this.__disabled = false;\n }\n\n this.moveTo({\n x: p[0],\n y: p[1]\n });\n }\n\n _super.prototype.validatePosition.call(this);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapImage.prototype.getFeature = function () {\n return {\n \"type\": \"Feature\",\n geometry: {\n type: \"Point\",\n coordinates: [this.longitude, this.latitude]\n }\n };\n };\n\n return MapImage;\n}(MapObject);\n\nexport { MapImage };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapImage\"] = MapImage;","export default function (a, b) {\n function compose(x, y) {\n return x = a(x, y), b(x[0], x[1]);\n }\n\n if (a.invert && b.invert) compose.invert = function (x, y) {\n return x = b.invert(x, y), x && a.invert(x[0], x[1]);\n };\n return compose;\n}","import compose from \"./compose.js\";\nimport { abs, asin, atan2, cos, degrees, pi, radians, sin, tau } from \"./math.js\";\n\nfunction rotationIdentity(lambda, phi) {\n return [abs(lambda) > pi ? lambda + Math.round(-lambda / tau) * tau : lambda, phi];\n}\n\nrotationIdentity.invert = rotationIdentity;\nexport function rotateRadians(deltaLambda, deltaPhi, deltaGamma) {\n return (deltaLambda %= tau) ? deltaPhi || deltaGamma ? compose(rotationLambda(deltaLambda), rotationPhiGamma(deltaPhi, deltaGamma)) : rotationLambda(deltaLambda) : deltaPhi || deltaGamma ? rotationPhiGamma(deltaPhi, deltaGamma) : rotationIdentity;\n}\n\nfunction forwardRotationLambda(deltaLambda) {\n return function (lambda, phi) {\n return lambda += deltaLambda, [lambda > pi ? lambda - tau : lambda < -pi ? lambda + tau : lambda, phi];\n };\n}\n\nfunction rotationLambda(deltaLambda) {\n var rotation = forwardRotationLambda(deltaLambda);\n rotation.invert = forwardRotationLambda(-deltaLambda);\n return rotation;\n}\n\nfunction rotationPhiGamma(deltaPhi, deltaGamma) {\n var cosDeltaPhi = cos(deltaPhi),\n sinDeltaPhi = sin(deltaPhi),\n cosDeltaGamma = cos(deltaGamma),\n sinDeltaGamma = sin(deltaGamma);\n\n function rotation(lambda, phi) {\n var cosPhi = cos(phi),\n x = cos(lambda) * cosPhi,\n y = sin(lambda) * cosPhi,\n z = sin(phi),\n k = z * cosDeltaPhi + x * sinDeltaPhi;\n return [atan2(y * cosDeltaGamma - k * sinDeltaGamma, x * cosDeltaPhi - z * sinDeltaPhi), asin(k * cosDeltaGamma + y * sinDeltaGamma)];\n }\n\n rotation.invert = function (lambda, phi) {\n var cosPhi = cos(phi),\n x = cos(lambda) * cosPhi,\n y = sin(lambda) * cosPhi,\n z = sin(phi),\n k = z * cosDeltaGamma - y * sinDeltaGamma;\n return [atan2(y * cosDeltaGamma + z * sinDeltaGamma, x * cosDeltaPhi + k * sinDeltaPhi), asin(k * cosDeltaPhi - x * sinDeltaPhi)];\n };\n\n return rotation;\n}\n\nexport default function (rotate) {\n rotate = rotateRadians(rotate[0] * radians, rotate[1] * radians, rotate.length > 2 ? rotate[2] * radians : 0);\n\n function forward(coordinates) {\n coordinates = rotate(coordinates[0] * radians, coordinates[1] * radians);\n return coordinates[0] *= degrees, coordinates[1] *= degrees, coordinates;\n }\n\n forward.invert = function (coordinates) {\n coordinates = rotate.invert(coordinates[0] * radians, coordinates[1] * radians);\n return coordinates[0] *= degrees, coordinates[1] *= degrees, coordinates;\n };\n\n return forward;\n}","import { cartesian, cartesianNormalizeInPlace, spherical } from \"./cartesian.js\";\nimport constant from \"./constant.js\";\nimport { acos, cos, degrees, epsilon, radians, sin, tau } from \"./math.js\";\nimport { rotateRadians } from \"./rotation.js\"; // Generates a circle centered at [0°, 0°], with a given radius and precision.\n\nexport function circleStream(stream, radius, delta, direction, t0, t1) {\n if (!delta) return;\n var cosRadius = cos(radius),\n sinRadius = sin(radius),\n step = direction * delta;\n\n if (t0 == null) {\n t0 = radius + direction * tau;\n t1 = radius - step / 2;\n } else {\n t0 = circleRadius(cosRadius, t0);\n t1 = circleRadius(cosRadius, t1);\n if (direction > 0 ? t0 < t1 : t0 > t1) t0 += direction * tau;\n }\n\n for (var point, t = t0; direction > 0 ? t > t1 : t < t1; t -= step) {\n point = spherical([cosRadius, -sinRadius * cos(t), -sinRadius * sin(t)]);\n stream.point(point[0], point[1]);\n }\n} // Returns the signed angle of a cartesian point relative to [cosRadius, 0, 0].\n\nfunction circleRadius(cosRadius, point) {\n point = cartesian(point), point[0] -= cosRadius;\n cartesianNormalizeInPlace(point);\n var radius = acos(-point[1]);\n return ((-point[2] < 0 ? -radius : radius) + tau - epsilon) % tau;\n}\n\nexport default function () {\n var center = constant([0, 0]),\n radius = constant(90),\n precision = constant(6),\n ring,\n rotate,\n stream = {\n point: point\n };\n\n function point(x, y) {\n ring.push(x = rotate(x, y));\n x[0] *= degrees, x[1] *= degrees;\n }\n\n function circle() {\n var c = center.apply(this, arguments),\n r = radius.apply(this, arguments) * radians,\n p = precision.apply(this, arguments) * radians;\n ring = [];\n rotate = rotateRadians(-c[0] * radians, -c[1] * radians, 0).invert;\n circleStream(stream, r, p, 1);\n c = {\n type: \"Polygon\",\n coordinates: [ring]\n };\n ring = rotate = null;\n return c;\n }\n\n circle.center = function (_) {\n return arguments.length ? (center = typeof _ === \"function\" ? _ : constant([+_[0], +_[1]]), circle) : center;\n };\n\n circle.radius = function (_) {\n return arguments.length ? (radius = typeof _ === \"function\" ? _ : constant(+_), circle) : radius;\n };\n\n circle.precision = function (_) {\n return arguments.length ? (precision = typeof _ === \"function\" ? _ : constant(+_), circle) : precision;\n };\n\n return circle;\n}","/**\r\n * A collection of Map-related utility functions.\r\n */\nimport * as $array from \"../../core/utils/Array\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Converts a multi-part polygon in X/Y coordinates to a geo-multipolygon in\r\n * geo-points (lat/long).\r\n *\r\n * @param multiPolygon Source multi-polygon\r\n * @return Geo-multipolygon\r\n */\n\nexport function multiPolygonToGeo(multiPolygon) {\n return $array.map(multiPolygon, function (polygon) {\n var surface = polygon[0];\n var hole = polygon[1]; //let holePoints: Array<IGeoPoint> = [];\n\n var geoArea = [];\n\n if (surface) {\n geoArea.push(multiPointToGeo(surface));\n }\n\n if (hole) {\n geoArea.push(multiPointToGeo(hole));\n }\n\n return geoArea;\n });\n}\n/**\r\n * Converts a multiline in X/Y coordinates to a geo-multiline in geo-points\r\n * (lat/long).\r\n *\r\n * @param multiLine Source multiline\r\n * @return Geo-multiline\r\n */\n\nexport function multiLineToGeo(multiLine) {\n return $array.map(multiLine, function (multiLine) {\n return multiPointToGeo(multiLine);\n });\n}\n/**\r\n * Converts multiple X/Y points into a lat/long geo-points.\r\n *\r\n * @param points Source points\r\n * @return Geo-points\r\n */\n\nexport function multiPointToGeo(points) {\n return $array.map(points, function (point) {\n return pointToGeo(point);\n });\n}\n/**\r\n * Converts multiple X/Y points into a lat/long geo-points.\r\n *\r\n * @param points Source points\r\n * @return Geo-points\r\n */\n\nexport function multiGeoToPoint(geoPoints) {\n return $array.map(geoPoints, geoToPoint);\n}\n/**\r\n * Converts X/Y point into a lat/long geo-point.\r\n *\r\n * @param point Source point\r\n * @return Geo-point\r\n */\n\nexport function pointToGeo(point) {\n return {\n longitude: point[0],\n latitude: point[1]\n };\n}\n/**\r\n * Converts lat/long geo-point into a X/Y point.\r\n *\r\n * @param point Source geo-point\r\n * @return X/Y point\r\n */\n\nexport function geoToPoint(geoPoint) {\n return [geoPoint.longitude, geoPoint.latitude];\n}\n/**\r\n * Converts geo line (collection of lat/long coordinates) to screen line (x/y).\r\n *\r\n * @param multiGeoLine Source geo line\r\n * @return Screen line\r\n */\n\nexport function multiGeoLineToMultiLine(multiGeoLine) {\n return $array.map(multiGeoLine, function (segment) {\n return $array.map(segment, geoToPoint);\n });\n}\n/**\r\n * Converts a geo polygon (collection of lat/long coordinates) to screen\r\n * polygon (x/y).\r\n *\r\n * @param multiGeoPolygon Source polygon\r\n * @return Screen polygon\r\n */\n\nexport function multiGeoPolygonToMultipolygon(multiGeoPolygon) {\n return $array.map(multiGeoPolygon, function (geoPolygon) {\n var surface = geoPolygon[0];\n var hole = geoPolygon[1];\n var multiPolygon = [];\n\n if (surface) {\n multiPolygon.push(multiGeoToPoint(surface));\n }\n\n if (hole) {\n multiPolygon.push(multiGeoToPoint(hole));\n }\n\n return multiPolygon;\n });\n}\n/**\r\n * Returns a set of geographical coordinates for the circle with a center\r\n * at specific lat/long coordinates and radius (in degrees).\r\n *\r\n * @since 4.3.0\r\n * @param longitude Center longitude\r\n * @param latitude Center latitude\r\n * @param radius Radius (degrees)\r\n * @return Circle coordinates\r\n */\n\nexport function getCircle(longitude, latitude, radius) {\n return [d3geo.geoCircle().center([longitude, latitude]).radius(radius)().coordinates];\n}\n/**\r\n * Returns a set of screen coordinates that represents a \"background\" area\r\n * between provided extremities.\r\n *\r\n * @since 4.3.0\r\n * @param north North latitude\r\n * @param east East longitude\r\n * @param south South latitude\r\n * @param west West longitude\r\n * @return Polygon\r\n */\n\nexport function getBackground(north, east, south, west) {\n var multiPolygon = [];\n\n if (west == -180) {\n west = -179.9999;\n }\n\n if (south == -90) {\n south = -89.9999;\n }\n\n if (north == 90) {\n north = 89.9999;\n }\n\n if (east == 180) {\n east = 179.9999;\n }\n\n var stepLong = Math.min(90, (east - west) / Math.ceil((east - west) / 90));\n var stepLat = (north - south) / Math.ceil((north - south) / 90);\n\n for (var ln = west; ln < east; ln = ln + stepLong) {\n var surface = [];\n multiPolygon.push([surface]);\n\n if (ln + stepLong > east) {\n stepLong = east - ln;\n }\n\n for (var ll = ln; ll <= ln + stepLong; ll = ll + 5) {\n surface.push([ll, north]);\n }\n\n for (var lt = north; lt >= south; lt = lt - stepLat) {\n surface.push([ln + stepLong, lt]);\n }\n\n for (var ll = ln + stepLong; ll >= ln; ll = ll - 5) {\n surface.push([ll, south]);\n }\n\n for (var lt = south; lt <= north; lt = lt + stepLat) {\n surface.push([ln, lt]);\n }\n }\n\n return multiPolygon;\n}","/**\r\n * Map polygon module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapObject } from \"./MapObject\";\nimport { Polygon } from \"../../core/elements/Polygon\";\nimport { registry } from \"../../core/Registry\";\nimport * as $type from \"../../core/utils/Type\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport $polylabel from \"polylabel\";\nimport * as $mapUtils from \"./MapUtils\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a polygon on the map.\r\n *\r\n * @see {@link IMapPolygonEvents} for a list of available events\r\n * @see {@link IMapPolygonAdapters} for a list of available Adapters\r\n */\n\nvar MapPolygon =\n/** @class */\nfunction (_super) {\n __extends(MapPolygon, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapPolygon() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapPolygon\";\n _this.polygon = _this.createChild(Polygon);\n _this.polygon.shouldClone = false;\n _this.polygon.applyOnClones = true;\n\n _this.setPropertyValue(\"precision\", 0.5);\n\n var interfaceColors = new InterfaceColorSet();\n _this.fill = interfaceColors.getFor(\"secondaryButton\");\n _this.stroke = interfaceColors.getFor(\"secondaryButtonStroke\");\n _this.strokeOpacity = 1;\n _this.tooltipPosition = \"pointer\";\n _this.nonScalingStroke = true;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapPolygon.prototype.getFeature = function () {\n if (this.multiPolygon && this.multiPolygon.length > 0) {\n return {\n \"type\": \"Feature\",\n geometry: {\n type: \"MultiPolygon\",\n coordinates: this.multiPolygon\n }\n };\n }\n };\n\n Object.defineProperty(MapPolygon.prototype, \"multiGeoPolygon\", {\n /**\r\n * @return Polygon coordinates\r\n */\n get: function get() {\n var multiGeoPolygon = this.getPropertyValue(\"multiGeoPolygon\");\n\n if (!multiGeoPolygon && this.dataItem) {\n multiGeoPolygon = this.dataItem.multiGeoPolygon;\n }\n\n return multiGeoPolygon;\n },\n\n /**\r\n * Set of coordinates for the polygon.\r\n *\r\n * @param multiGeoPolygon Polygon coordinates\r\n */\n set: function set(multiGeoPolygon) {\n this.setPropertyValue(\"multiGeoPolygon\", multiGeoPolygon, true);\n this.multiPolygon = $mapUtils.multiGeoPolygonToMultipolygon(multiGeoPolygon);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygon.prototype, \"multiPolygon\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n var multiPolygon = this.getPropertyValue(\"multiPolygon\");\n\n if (!multiPolygon && this.dataItem) {\n multiPolygon = this.dataItem.multiPolygon;\n }\n\n return multiPolygon;\n },\n\n /**\r\n * A collection of X/Y coordinates for a multi-part polygon. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * // Part 1\r\n * [\r\n * [\r\n * [ 100, 150 ],\r\n * [ 120, 200 ],\r\n * [ 150, 220 ],\r\n * [ 170, 240 ],\r\n * [ 100, 150 ]\r\n * ]\r\n * ],\r\n *\r\n * // Part 2\r\n * [\r\n * [\r\n * [ 300, 350 ],\r\n * [ 320, 400 ],\r\n * [ 350, 420 ],\r\n * [ 370, 440 ],\r\n * [ 300, 350 ]\r\n * ]\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @param multiPolygon Coordinates\r\n */\n set: function set(multiPolygon) {\n if (this.setPropertyValue(\"multiPolygon\", multiPolygon)) {\n this.updateExtremes();\n this.invalidate();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * (Re)validates the polygon, effectively redrawing it.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n MapPolygon.prototype.validate = function () {\n if (this.series) {\n var projection = this.series.chart.projection;\n var pathGenerator = projection.d3Path;\n\n if (this.multiPolygon) {\n if (this.series) {\n var feature = {\n type: \"MultiPolygon\",\n coordinates: this.multiPolygon\n };\n projection.d3Projection.precision(this.precision);\n this.polygon.path = pathGenerator(feature);\n }\n\n if (this.series.calculateVisualCenter) {\n var biggestArea = 0;\n var biggestPolygon = this.multiPolygon[0];\n\n if (this.multiPolygon.length > 1) {\n for (var i = 0; i < this.multiPolygon.length; i++) {\n var polygon = this.multiPolygon[i];\n var area = d3geo.geoArea({\n type: \"Polygon\",\n coordinates: polygon\n });\n\n if (area > biggestArea) {\n biggestPolygon = polygon;\n biggestArea = area;\n }\n }\n }\n\n var center = $polylabel(biggestPolygon);\n this._visualLongitude = center[0];\n this._visualLatitude = center[1];\n } else {\n this._visualLongitude = this.longitude;\n this._visualLatitude = this.latitude;\n }\n }\n }\n\n _super.prototype.validate.call(this);\n };\n /**\r\n * @ignore Exclude from docs\r\n */\n\n\n MapPolygon.prototype.measureElement = function () {// Overriding, just to avoid extra measure\n };\n\n Object.defineProperty(MapPolygon.prototype, \"latitude\", {\n /**\r\n * Latitude of the geometrical center of the polygon.\r\n *\r\n * @readonly\r\n * @return Center latitude\r\n */\n get: function get() {\n return this.north + (this.south - this.north) / 2;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygon.prototype, \"longitude\", {\n /**\r\n * Longitude of the geometrical center of the polygon.\r\n *\r\n * @readonly\r\n * @return Center longitude\r\n */\n get: function get() {\n return this.east + (this.west - this.east) / 2;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygon.prototype, \"visualLatitude\", {\n /**\r\n * @return Latitude\r\n */\n get: function get() {\n var latitude = this.getPropertyValue(\"visualLatitude\");\n\n if ($type.isNumber(latitude)) {\n return latitude;\n }\n\n if (!this._adapterO) {\n return this._visualLatitude;\n } else {\n return this._adapterO.apply(\"visualLatitude\", this._visualLatitude);\n }\n },\n\n /**\r\n * Latitude of the visual center of the polygon.\r\n *\r\n * It may (and probably won't) coincide with geometrical center.\r\n *\r\n * @since 4.3.0\r\n * @param value Latitude\r\n */\n set: function set(value) {\n this.setPropertyValue(\"visualLatitude\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygon.prototype, \"visualLongitude\", {\n /**\r\n * @return Longitude\r\n */\n get: function get() {\n var longitude = this.getPropertyValue(\"visualLongitude\");\n\n if ($type.isNumber(longitude)) {\n return longitude;\n }\n\n if (!this._adapterO) {\n return this._visualLongitude;\n } else {\n return this._adapterO.apply(\"visualLongitude\", this._visualLongitude);\n }\n },\n\n /**\r\n * Longitude of the visual center of the polygon.\r\n *\r\n * It may (and probably won't) coincide with geometrical center.\r\n *\r\n * @since 4.3.0\r\n * @param value Longitude\r\n */\n set: function set(value) {\n this.setPropertyValue(\"visualLongitude\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygon.prototype, \"pixelWidth\", {\n /**\r\n * Not 100% sure about this, as if we add something to MapPolygon this\r\n * won't be true, but otherwise we will get all 0 and the tooltip won't\r\n * be positioned properly\r\n * @hidden\r\n */\n\n /**\r\n * Element's width in pixels.\r\n *\r\n * @readonly\r\n * @return Width (px)\r\n */\n get: function get() {\n return this.polygon.pixelWidth;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygon.prototype, \"pixelHeight\", {\n /**\r\n * Element's height in pixels.\r\n *\r\n * @readonly\r\n * @return Width (px)\r\n */\n get: function get() {\n return this.polygon.pixelHeight;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies all properties from another instance of [[MapPolygon]].\r\n *\r\n * @param source Source series\r\n */\n\n MapPolygon.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.polygon.copyFrom(source.polygon);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapPolygon.prototype.updateExtremes = function () {\n _super.prototype.updateExtremes.call(this);\n };\n\n Object.defineProperty(MapPolygon.prototype, \"boxArea\", {\n /**\r\n * @ignore\r\n * used to sorth polygons from big to small\r\n */\n get: function get() {\n return (this.north - this.south) * (this.east - this.west);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * X coordinate for the slice tooltip.\r\n *\r\n * @ignore\r\n * @return X\r\n */\n\n MapPolygon.prototype.getTooltipX = function () {\n return this.series.chart.projection.convert({\n longitude: this.visualLongitude,\n latitude: this.visualLatitude\n }).x;\n };\n /**\r\n * Y coordinate for the slice tooltip.\r\n *\r\n * @ignore\r\n * @return Y\r\n */\n\n\n MapPolygon.prototype.getTooltipY = function () {\n return this.series.chart.projection.convert({\n longitude: this.visualLongitude,\n latitude: this.visualLatitude\n }).y;\n };\n\n Object.defineProperty(MapPolygon.prototype, \"precision\", {\n get: function get() {\n return this.getPropertyValue(\"precision\");\n },\n\n /**\r\n * When polygon's sides are plotted, they are bent according to the used\r\n * projection.\r\n *\r\n * `precision` introduces a setting which can control when such bending\r\n * occurs.\r\n *\r\n * If the distance (in degrees) between two points of polygon's side is less\r\n * than `precision`, no bending will take place and the line will be straight.\r\n *\r\n * Set to large number (e.g. 10000) for perfectly straight lines on all\r\n * polygon's sides.\r\n *\r\n * @since 4.9.1\r\n * @default 0.5\r\n * @param value Precision\r\n */\n set: function set(value) {\n this.setPropertyValue(\"precision\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return MapPolygon;\n}(MapObject);\n\nexport { MapPolygon };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapPolygon\"] = MapPolygon;","/**\r\n * Map polygon series module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapSeries, MapSeriesDataItem } from \"./MapSeries\";\nimport { MapPolygon } from \"./MapPolygon\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { registry } from \"../../core/Registry\";\nimport * as $mapUtils from \"./MapUtils\";\nimport * as $array from \"../../core/utils/Array\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport { Disposer } from \"../../core/utils/Disposer\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapPolygonSeries]]\r\n * @see {@link DataItem}\r\n */\n\nvar MapPolygonSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapPolygonSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapPolygonSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapPolygonSeriesDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapPolygonSeriesDataItem.prototype.getFeature = function () {\n if (this.multiPolygon && this.multiPolygon.length > 0) {\n return {\n \"type\": \"Feature\",\n geometry: {\n type: \"MultiPolygon\",\n coordinates: this.multiPolygon\n }\n };\n }\n };\n\n Object.defineProperty(MapPolygonSeriesDataItem.prototype, \"mapPolygon\", {\n /**\r\n * A [[MapPolygon]] element related to this data item.\r\n *\r\n * @readonly\r\n * @return Element\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._mapPolygon) {\n var mapPolygon_1 = this.component.mapPolygons.create();\n this._mapPolygon = mapPolygon_1;\n this.addSprite(mapPolygon_1);\n\n this._disposers.push(new Disposer(function () {\n if (_this.component) {\n _this.component.mapPolygons.removeValue(mapPolygon_1);\n }\n }));\n\n this.mapObject = mapPolygon_1;\n }\n\n return this._mapPolygon;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygonSeriesDataItem.prototype, \"polygon\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._polygon;\n },\n\n /**\r\n * A collection of X/Y coordinates for a single polygon. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * [\r\n * [ 100, 150 ],\r\n * [ 120, 200 ],\r\n * [ 150, 200 ],\r\n * [ 170, 240 ],\r\n * [ 100, 150 ]\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @param polygon Coordinates\r\n */\n set: function set(polygon) {\n this._polygon = polygon;\n this.multiPolygon = [polygon];\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygonSeriesDataItem.prototype, \"multiPolygon\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._multiPolygon;\n },\n\n /**\r\n * A collection of X/Y coordinates for a multi-part polygon. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * // Part 1\r\n * [\r\n * [\r\n * [ 100, 150 ],\r\n * [ 120, 200 ],\r\n * [ 150, 220 ],\r\n * [ 170, 240 ],\r\n * [ 100, 150 ]\r\n * ]\r\n * ],\r\n *\r\n * // Part 2\r\n * [\r\n * [\r\n * [ 300, 350 ],\r\n * [ 320, 400 ],\r\n * [ 350, 420 ],\r\n * [ 370, 440 ],\r\n * [ 300, 350 ]\r\n * ]\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @param multiPolygon Coordinates\r\n */\n set: function set(multiPolygon) {\n this._multiPolygon = multiPolygon;\n this.updateExtremes();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygonSeriesDataItem.prototype, \"geoPolygon\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._geoPolygon;\n },\n\n /**\r\n * A collection of lat/long coordinates for a single polygon. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * [\r\n * { latitude: -10.0, longitude: -10.0 },\r\n * { latitude: 10.0, longitude: -10.0 },\r\n * { latitude: 10.0, longitude: 10.0 },\r\n * { latitude: -10.0, longitude: -10.0 }\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @see {@link https://tools.ietf.org/html/rfc7946#section-3.1.6} GeoJSON Polygon reference\r\n * @param geoPolygon Coordinates\r\n */\n set: function set(geoPolygon) {\n this._geoPolygon = geoPolygon;\n this.multiGeoPolygon = [geoPolygon];\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygonSeriesDataItem.prototype, \"multiGeoPolygon\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._multiGeoPolygon;\n },\n\n /**\r\n * A collection of lat/long coordinates for a multi-part polygon. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * [\r\n * [\r\n * { longitude: 180.0, latitude: 40.0 },\r\n * { longitude: 180.0, latitude: 50.0 },\r\n * { longitude: 170.0, latitude: 50.0 },\r\n * { longitude: 170.0, latitude: 40.0 },\r\n * { longitude: 180.0, latitude: 40.0 }\r\n * ]\r\n * ],\r\n * [\r\n * [\r\n * { longitude: -170.0, latitude: 40.0 },\r\n * { longitude: -170.0, latitude: 50.0 },\r\n * { longitude: -180.0, latitude: 50.0 },\r\n * { longitude: -180.0, latitude: 40.0 },\r\n * { longitude: -170.0, latitude: 40.0 }\r\n * ]\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @see {@link https://tools.ietf.org/html/rfc7946#section-3.1.7} GeoJSON MultiPolygon reference\r\n * @param multiGeoPolygon Coordinates\r\n */\n set: function set(multiGeoPolygon) {\n this._multiGeoPolygon = multiGeoPolygon;\n this.multiPolygon = $mapUtils.multiGeoPolygonToMultipolygon(multiGeoPolygon);\n },\n enumerable: true,\n configurable: true\n });\n return MapPolygonSeriesDataItem;\n}(MapSeriesDataItem);\n\nexport { MapPolygonSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A series of map polygon elements.\r\n *\r\n * @see {@link IMapPolygonSeriesEvents} for a list of available Events\r\n * @see {@link IMapPolygonSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar MapPolygonSeries =\n/** @class */\nfunction (_super) {\n __extends(MapPolygonSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapPolygonSeries() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * Indicates if series should automatically calculate visual center of the\r\n * polygons (accessible via `visualLongitude` and `visualLatitude` properties\r\n * of the [[MapPolygon]]).\r\n *\r\n * @default false\r\n * @since 4.3.0\r\n */\n\n\n _this.calculateVisualCenter = false;\n _this.className = \"MapPolygonSeries\"; // Set data fields\n\n _this.dataFields.multiPolygon = \"multiPolygon\";\n _this.dataFields.polygon = \"polygon\";\n _this.dataFields.geoPolygon = \"geoPolygon\";\n _this.dataFields.multiGeoPolygon = \"multiGeoPolygon\";\n\n _this.setPropertyValue(\"sortPolygonsBy\", \"area\");\n\n _this.setPropertyValue(\"sortPolygonsReversed\", false); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n MapPolygonSeries.prototype.createDataItem = function () {\n return new MapPolygonSeriesDataItem();\n };\n /**\r\n * @ignore\r\n */\n\n\n MapPolygonSeries.prototype.processIncExc = function () {\n this.mapPolygons.clear();\n\n _super.prototype.processIncExc.call(this);\n };\n /**\r\n * (Re)validates series data, effectively causing the whole series to be\r\n * redrawn.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapPolygonSeries.prototype.validateData = function () {\n // process geoJSON and created map objects\n if (this.useGeodata || this.geodata) {\n var geoJSON = !this._dataSources[\"geodata\"] ? this.chart.geodata : undefined;\n\n if (this.geodata) {\n geoJSON = this.geodata;\n }\n\n if (geoJSON) {\n var features = void 0;\n\n if (geoJSON.type == \"FeatureCollection\") {\n features = geoJSON.features;\n } else if (geoJSON.type == \"Feature\") {\n features = [geoJSON];\n } else if ([\"Point\", \"LineString\", \"Polygon\", \"MultiPoint\", \"MultiLineString\", \"MultiPolygon\"].indexOf(geoJSON.type) != -1) {\n features = [{\n geometry: geoJSON\n }];\n } else {\n console.log(\"nothing found in geoJSON\");\n }\n\n if (features) {\n var _loop_1 = function _loop_1(i, len) {\n var feature = features[i];\n var geometry = feature.geometry;\n\n if (geometry) {\n var type = geometry.type;\n var id_1 = feature.id;\n\n if (this_1.chart.geodataNames && this_1.chart.geodataNames[id_1]) {\n feature.properties.name = this_1.chart.geodataNames[id_1];\n }\n\n if (type == \"Polygon\" || type == \"MultiPolygon\") {\n if (!this_1.checkInclude(this_1.include, this_1.exclude, id_1)) {\n return \"continue\";\n }\n\n var coordinates = geometry.coordinates;\n\n if (coordinates) {\n // make the same as MultiPolygon\n if (type == \"Polygon\") {\n coordinates = [coordinates];\n }\n } // find data object in user-provided data\n\n\n var dataObject = $array.find(this_1.data, function (value, i) {\n return value.id == id_1;\n }); // create one if not found\n\n if (!dataObject) {\n dataObject = {\n multiPolygon: coordinates,\n id: id_1,\n madeFromGeoData: true\n };\n this_1.data.push(dataObject);\n } // in case found\n else {\n // if user-provided object doesn't have points data provided in any way:\n if (!dataObject.multiPolygon) {\n dataObject.multiPolygon = coordinates;\n }\n } // copy properties data to datacontext\n\n\n $utils.softCopyProperties(feature.properties, dataObject);\n }\n }\n };\n\n var this_1 = this;\n\n for (var i = 0, len = features.length; i < len; i++) {\n _loop_1(i, len);\n }\n }\n }\n }\n\n _super.prototype.validateData.call(this);\n };\n /**\r\n * (Re)validates the series\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapPolygonSeries.prototype.validate = function () {\n _super.prototype.validate.call(this);\n\n this.dataItems.each(function (dataItem) {\n $utils.used(dataItem.mapPolygon);\n });\n\n if (this.sortPolygonsBy != \"none\") {\n var sortBy_1 = this.sortPolygonsBy;\n var reversed_1 = this.sortPolygonsReversed;\n this.mapPolygons.sort(function (a, b) {\n var valA = \"\";\n var valB = \"\";\n var dirA = -1;\n var dirB = 1;\n\n switch (sortBy_1) {\n case \"area\":\n valA = a.boxArea;\n valB = b.boxArea;\n dirA = -1;\n dirB = 1;\n break;\n\n case \"name\":\n valA = a.dataItem.dataContext.name || \"\";\n valB = b.dataItem.dataContext.name || \"\";\n dirA = 1;\n dirB = -1;\n break;\n\n case \"id\":\n valA = a.dataItem.dataContext.id || \"\";\n valB = b.dataItem.dataContext.id || \"\";\n dirA = 1;\n dirB = -1;\n break;\n\n case \"latitude\":\n valA = reversed_1 ? a.south : a.north;\n valB = reversed_1 ? b.south : b.north;\n dirA = -1;\n dirB = 1;\n break;\n\n case \"longitude\":\n valA = reversed_1 ? a.east : a.west;\n valB = reversed_1 ? b.east : b.west;\n dirA = 1;\n dirB = -1;\n break;\n }\n\n if (valA < valB) {\n return reversed_1 ? dirB : dirA;\n }\n\n if (valA > valB) {\n return reversed_1 ? dirA : dirB;\n }\n\n return 0;\n });\n this.mapPolygons.each(function (mapPolygon, index) {\n mapPolygon.validate(); // makes small go first to avoid hover problems with IE\n\n if (!mapPolygon.zIndex && !mapPolygon.propertyFields.zIndex) {\n mapPolygon.zIndex = 1000000 - index;\n }\n });\n }\n };\n\n Object.defineProperty(MapPolygonSeries.prototype, \"mapPolygons\", {\n /**\r\n * List of polygon elements in the series.\r\n *\r\n * @return Polygon list\r\n */\n get: function get() {\n if (!this._mapPolygons) {\n var polygonTemplate = new MapPolygon();\n var mapPolygons = new ListTemplate(polygonTemplate);\n\n this._disposers.push(new ListDisposer(mapPolygons));\n\n this._disposers.push(mapPolygons.template);\n\n mapPolygons.template.focusable = true;\n mapPolygons.events.on(\"inserted\", this.handleObjectAdded, this, false);\n this._mapPolygons = mapPolygons;\n this._mapObjects = mapPolygons;\n }\n\n return this._mapPolygons;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * returns MapPolygon by id in geoJSON file\r\n * @param polygon id\r\n * @return {MapPolygon}\r\n */\n\n MapPolygonSeries.prototype.getPolygonById = function (id) {\n return $iter.find(this.mapPolygons.iterator(), function (mapPolygon) {\n var dataContext = mapPolygon.dataItem.dataContext;\n return dataContext.id == id;\n });\n };\n /**\r\n * Copies all properties from another instance of [[Series]].\r\n *\r\n * @param source Source series\r\n */\n\n\n MapPolygonSeries.prototype.copyFrom = function (source) {\n this.mapPolygons.template.copyFrom(source.mapPolygons.template);\n\n _super.prototype.copyFrom.call(this, source);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapPolygonSeries.prototype.getFeatures = function () {\n var _this = this;\n\n var features = [];\n this.dataItems.each(function (dataItem) {\n var feature = dataItem.getFeature();\n\n if (feature) {\n features.push(feature);\n }\n });\n this.mapPolygons.each(function (mapPolygon) {\n if (_this.dataItems.indexOf(mapPolygon._dataItem) == -1) {\n var feature = mapPolygon.getFeature();\n\n if (feature) {\n features.push(feature);\n }\n }\n });\n return features;\n };\n\n Object.defineProperty(MapPolygonSeries.prototype, \"sortPolygonsBy\", {\n /**\r\n * @return How to sort map polygons\r\n */\n get: function get() {\n return this.getPropertyValue(\"sortPolygonsBy\");\n },\n\n /**\r\n * How to order polygons in actual SVG document. Affects selection order\r\n * using TAB key.\r\n *\r\n * Available options: `\"area\"` (default), `\"name\"`, `\"longitude\"`,\r\n * `\"latitude\"`, `\"id\"`, and `\"none\"`.\r\n *\r\n * @default area\r\n * @since 4.9.36\r\n * @param value How to sort map polygons\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"sortPolygonsBy\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapPolygonSeries.prototype, \"sortPolygonsReversed\", {\n /**\r\n * @return Reverse polygon sort direction\r\n */\n get: function get() {\n return this.getPropertyValue(\"sortPolygonsReversed\");\n },\n\n /**\r\n * If `sortPolygonsBy` is set to something other than `\"none\"`, polygons\r\n * will be sorted by the given parameter, using natural sort direction.\r\n *\r\n * Setting `sortPolygonsReversed = true` will reverse this direction.\r\n *\r\n * @default false\r\n * @since 4.9.36\r\n * @param value Reverse polygon sort direction\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"sortPolygonsReversed\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n return MapPolygonSeries;\n}(MapSeries);\n\nexport { MapPolygonSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapPolygonSeries\"] = MapPolygonSeries;\nregistry.registeredClasses[\"MapPolygonSeriesDataItem\"] = MapPolygonSeriesDataItem;","import noop from \"../noop.js\";\nexport default function () {\n var lines = [],\n line;\n return {\n point: function point(x, y, m) {\n line.push([x, y, m]);\n },\n lineStart: function lineStart() {\n lines.push(line = []);\n },\n lineEnd: noop,\n rejoin: function rejoin() {\n if (lines.length > 1) lines.push(lines.pop().concat(lines.shift()));\n },\n result: function result() {\n var result = lines;\n lines = [];\n line = null;\n return result;\n }\n };\n}","import { abs, epsilon } from \"./math.js\";\nexport default function (a, b) {\n return abs(a[0] - b[0]) < epsilon && abs(a[1] - b[1]) < epsilon;\n}","import pointEqual from \"../pointEqual.js\";\nimport { epsilon } from \"../math.js\";\n\nfunction Intersection(point, points, other, entry) {\n this.x = point;\n this.z = points;\n this.o = other; // another intersection\n\n this.e = entry; // is an entry?\n\n this.v = false; // visited\n\n this.n = this.p = null; // next & previous\n} // A generalized polygon clipping algorithm: given a polygon that has been cut\n// into its visible line segments, and rejoins the segments by interpolating\n// along the clip edge.\n\n\nexport default function (segments, compareIntersection, startInside, interpolate, stream) {\n var subject = [],\n clip = [],\n i,\n n;\n segments.forEach(function (segment) {\n if ((n = segment.length - 1) <= 0) return;\n var n,\n p0 = segment[0],\n p1 = segment[n],\n x;\n\n if (pointEqual(p0, p1)) {\n if (!p0[2] && !p1[2]) {\n stream.lineStart();\n\n for (i = 0; i < n; ++i) {\n stream.point((p0 = segment[i])[0], p0[1]);\n }\n\n stream.lineEnd();\n return;\n } // handle degenerate cases by moving the point\n\n\n p1[0] += 2 * epsilon;\n }\n\n subject.push(x = new Intersection(p0, segment, null, true));\n clip.push(x.o = new Intersection(p0, null, x, false));\n subject.push(x = new Intersection(p1, segment, null, false));\n clip.push(x.o = new Intersection(p1, null, x, true));\n });\n if (!subject.length) return;\n clip.sort(compareIntersection);\n link(subject);\n link(clip);\n\n for (i = 0, n = clip.length; i < n; ++i) {\n clip[i].e = startInside = !startInside;\n }\n\n var start = subject[0],\n points,\n point;\n\n while (1) {\n // Find first unvisited intersection.\n var current = start,\n isSubject = true;\n\n while (current.v) {\n if ((current = current.n) === start) return;\n }\n\n points = current.z;\n stream.lineStart();\n\n do {\n current.v = current.o.v = true;\n\n if (current.e) {\n if (isSubject) {\n for (i = 0, n = points.length; i < n; ++i) {\n stream.point((point = points[i])[0], point[1]);\n }\n } else {\n interpolate(current.x, current.n.x, 1, stream);\n }\n\n current = current.n;\n } else {\n if (isSubject) {\n points = current.p.z;\n\n for (i = points.length - 1; i >= 0; --i) {\n stream.point((point = points[i])[0], point[1]);\n }\n } else {\n interpolate(current.x, current.p.x, -1, stream);\n }\n\n current = current.p;\n }\n\n current = current.o;\n points = current.z;\n isSubject = !isSubject;\n } while (!current.v);\n\n stream.lineEnd();\n }\n}\n\nfunction link(array) {\n if (!(n = array.length)) return;\n var n,\n i = 0,\n a = array[0],\n b;\n\n while (++i < n) {\n a.n = b = array[i];\n b.p = a;\n a = b;\n }\n\n a.n = b = array[0];\n b.p = a;\n}","import { Adder } from \"d3-array\";\nimport { cartesian, cartesianCross, cartesianNormalizeInPlace } from \"./cartesian.js\";\nimport { abs, asin, atan2, cos, epsilon, epsilon2, halfPi, pi, quarterPi, sign, sin, tau } from \"./math.js\";\n\nfunction longitude(point) {\n if (abs(point[0]) <= pi) return point[0];else return sign(point[0]) * ((abs(point[0]) + pi) % tau - pi);\n}\n\nexport default function (polygon, point) {\n var lambda = longitude(point),\n phi = point[1],\n sinPhi = sin(phi),\n normal = [sin(lambda), -cos(lambda), 0],\n angle = 0,\n winding = 0;\n var sum = new Adder();\n if (sinPhi === 1) phi = halfPi + epsilon;else if (sinPhi === -1) phi = -halfPi - epsilon;\n\n for (var i = 0, n = polygon.length; i < n; ++i) {\n if (!(m = (ring = polygon[i]).length)) continue;\n var ring,\n m,\n point0 = ring[m - 1],\n lambda0 = longitude(point0),\n phi0 = point0[1] / 2 + quarterPi,\n sinPhi0 = sin(phi0),\n cosPhi0 = cos(phi0);\n\n for (var j = 0; j < m; ++j, lambda0 = lambda1, sinPhi0 = sinPhi1, cosPhi0 = cosPhi1, point0 = point1) {\n var point1 = ring[j],\n lambda1 = longitude(point1),\n phi1 = point1[1] / 2 + quarterPi,\n sinPhi1 = sin(phi1),\n cosPhi1 = cos(phi1),\n delta = lambda1 - lambda0,\n sign = delta >= 0 ? 1 : -1,\n absDelta = sign * delta,\n antimeridian = absDelta > pi,\n k = sinPhi0 * sinPhi1;\n sum.add(atan2(k * sign * sin(absDelta), cosPhi0 * cosPhi1 + k * cos(absDelta)));\n angle += antimeridian ? delta + sign * tau : delta; // Are the longitudes either side of the point’s meridian (lambda),\n // and are the latitudes smaller than the parallel (phi)?\n\n if (antimeridian ^ lambda0 >= lambda ^ lambda1 >= lambda) {\n var arc = cartesianCross(cartesian(point0), cartesian(point1));\n cartesianNormalizeInPlace(arc);\n var intersection = cartesianCross(normal, arc);\n cartesianNormalizeInPlace(intersection);\n var phiArc = (antimeridian ^ delta >= 0 ? -1 : 1) * asin(intersection[2]);\n\n if (phi > phiArc || phi === phiArc && (arc[0] || arc[1])) {\n winding += antimeridian ^ delta >= 0 ? 1 : -1;\n }\n }\n }\n } // First, determine whether the South pole is inside or outside:\n //\n // It is inside if:\n // * the polygon winds around it in a clockwise direction.\n // * the polygon does not (cumulatively) wind around it, but has a negative\n // (counter-clockwise) area.\n //\n // Second, count the (signed) number of times a segment crosses a lambda\n // from the point to the South pole. If it is zero, then the point is the\n // same side as the South pole.\n\n\n return (angle < -epsilon || angle < epsilon && sum < -epsilon2) ^ winding & 1;\n}","import _regeneratorRuntime from \"@babel/runtime/regenerator\";\n\nvar _marked = /*#__PURE__*/_regeneratorRuntime.mark(flatten);\n\nfunction _createForOfIteratorHelper(o, allowArrayLike) { var it = typeof Symbol !== \"undefined\" && o[Symbol.iterator] || o[\"@@iterator\"]; if (!it) { if (Array.isArray(o) || (it = _unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === \"number\") { if (it) o = it; var i = 0; var F = function F() {}; return { s: F, n: function n() { if (i >= o.length) return { done: true }; return { done: false, value: o[i++] }; }, e: function e(_e) { throw _e; }, f: F }; } throw new TypeError(\"Invalid attempt to iterate non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); } var normalCompletion = true, didErr = false, err; return { s: function s() { it = it.call(o); }, n: function n() { var step = it.next(); normalCompletion = step.done; return step; }, e: function e(_e2) { didErr = true; err = _e2; }, f: function f() { try { if (!normalCompletion && it.return != null) it.return(); } finally { if (didErr) throw err; } } }; }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction flatten(arrays) {\n var _iterator, _step, array;\n\n return _regeneratorRuntime.wrap(function flatten$(_context) {\n while (1) {\n switch (_context.prev = _context.next) {\n case 0:\n _iterator = _createForOfIteratorHelper(arrays);\n _context.prev = 1;\n\n _iterator.s();\n\n case 3:\n if ((_step = _iterator.n()).done) {\n _context.next = 8;\n break;\n }\n\n array = _step.value;\n return _context.delegateYield(array, \"t0\", 6);\n\n case 6:\n _context.next = 3;\n break;\n\n case 8:\n _context.next = 13;\n break;\n\n case 10:\n _context.prev = 10;\n _context.t1 = _context[\"catch\"](1);\n\n _iterator.e(_context.t1);\n\n case 13:\n _context.prev = 13;\n\n _iterator.f();\n\n return _context.finish(13);\n\n case 16:\n case \"end\":\n return _context.stop();\n }\n }\n }, _marked, null, [[1, 10, 13, 16]]);\n}\n\nexport default function merge(arrays) {\n return Array.from(flatten(arrays));\n}","import clipBuffer from \"./buffer.js\";\nimport clipRejoin from \"./rejoin.js\";\nimport { epsilon, halfPi } from \"../math.js\";\nimport polygonContains from \"../polygonContains.js\";\nimport { merge } from \"d3-array\";\nexport default function (pointVisible, clipLine, interpolate, start) {\n return function (sink) {\n var line = clipLine(sink),\n ringBuffer = clipBuffer(),\n ringSink = clipLine(ringBuffer),\n polygonStarted = false,\n polygon,\n segments,\n ring;\n var clip = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: function polygonStart() {\n clip.point = pointRing;\n clip.lineStart = ringStart;\n clip.lineEnd = ringEnd;\n segments = [];\n polygon = [];\n },\n polygonEnd: function polygonEnd() {\n clip.point = point;\n clip.lineStart = lineStart;\n clip.lineEnd = lineEnd;\n segments = merge(segments);\n var startInside = polygonContains(polygon, start);\n\n if (segments.length) {\n if (!polygonStarted) sink.polygonStart(), polygonStarted = true;\n clipRejoin(segments, compareIntersection, startInside, interpolate, sink);\n } else if (startInside) {\n if (!polygonStarted) sink.polygonStart(), polygonStarted = true;\n sink.lineStart();\n interpolate(null, null, 1, sink);\n sink.lineEnd();\n }\n\n if (polygonStarted) sink.polygonEnd(), polygonStarted = false;\n segments = polygon = null;\n },\n sphere: function sphere() {\n sink.polygonStart();\n sink.lineStart();\n interpolate(null, null, 1, sink);\n sink.lineEnd();\n sink.polygonEnd();\n }\n };\n\n function point(lambda, phi) {\n if (pointVisible(lambda, phi)) sink.point(lambda, phi);\n }\n\n function pointLine(lambda, phi) {\n line.point(lambda, phi);\n }\n\n function lineStart() {\n clip.point = pointLine;\n line.lineStart();\n }\n\n function lineEnd() {\n clip.point = point;\n line.lineEnd();\n }\n\n function pointRing(lambda, phi) {\n ring.push([lambda, phi]);\n ringSink.point(lambda, phi);\n }\n\n function ringStart() {\n ringSink.lineStart();\n ring = [];\n }\n\n function ringEnd() {\n pointRing(ring[0][0], ring[0][1]);\n ringSink.lineEnd();\n var clean = ringSink.clean(),\n ringSegments = ringBuffer.result(),\n i,\n n = ringSegments.length,\n m,\n segment,\n point;\n ring.pop();\n polygon.push(ring);\n ring = null;\n if (!n) return; // No intersections.\n\n if (clean & 1) {\n segment = ringSegments[0];\n\n if ((m = segment.length - 1) > 0) {\n if (!polygonStarted) sink.polygonStart(), polygonStarted = true;\n sink.lineStart();\n\n for (i = 0; i < m; ++i) {\n sink.point((point = segment[i])[0], point[1]);\n }\n\n sink.lineEnd();\n }\n\n return;\n } // Rejoin connected segments.\n // TODO reuse ringBuffer.rejoin()?\n\n\n if (n > 1 && clean & 2) ringSegments.push(ringSegments.pop().concat(ringSegments.shift()));\n segments.push(ringSegments.filter(validSegment));\n }\n\n return clip;\n };\n}\n\nfunction validSegment(segment) {\n return segment.length > 1;\n} // Intersections are sorted along the clip edge. For both antimeridian cutting\n// and circle clipping, the same comparison is used.\n\n\nfunction compareIntersection(a, b) {\n return ((a = a.x)[0] < 0 ? a[1] - halfPi - epsilon : halfPi - a[1]) - ((b = b.x)[0] < 0 ? b[1] - halfPi - epsilon : halfPi - b[1]);\n}","import clip from \"./index.js\";\nimport { abs, atan, cos, epsilon, halfPi, pi, sin } from \"../math.js\";\nexport default clip(function () {\n return true;\n}, clipAntimeridianLine, clipAntimeridianInterpolate, [-pi, -halfPi]); // Takes a line and cuts into visible segments. Return values: 0 - there were\n// intersections or the line was empty; 1 - no intersections; 2 - there were\n// intersections, and the first and last segments should be rejoined.\n\nfunction clipAntimeridianLine(stream) {\n var lambda0 = NaN,\n phi0 = NaN,\n sign0 = NaN,\n _clean; // no intersections\n\n\n return {\n lineStart: function lineStart() {\n stream.lineStart();\n _clean = 1;\n },\n point: function point(lambda1, phi1) {\n var sign1 = lambda1 > 0 ? pi : -pi,\n delta = abs(lambda1 - lambda0);\n\n if (abs(delta - pi) < epsilon) {\n // line crosses a pole\n stream.point(lambda0, phi0 = (phi0 + phi1) / 2 > 0 ? halfPi : -halfPi);\n stream.point(sign0, phi0);\n stream.lineEnd();\n stream.lineStart();\n stream.point(sign1, phi0);\n stream.point(lambda1, phi0);\n _clean = 0;\n } else if (sign0 !== sign1 && delta >= pi) {\n // line crosses antimeridian\n if (abs(lambda0 - sign0) < epsilon) lambda0 -= sign0 * epsilon; // handle degeneracies\n\n if (abs(lambda1 - sign1) < epsilon) lambda1 -= sign1 * epsilon;\n phi0 = clipAntimeridianIntersect(lambda0, phi0, lambda1, phi1);\n stream.point(sign0, phi0);\n stream.lineEnd();\n stream.lineStart();\n stream.point(sign1, phi0);\n _clean = 0;\n }\n\n stream.point(lambda0 = lambda1, phi0 = phi1);\n sign0 = sign1;\n },\n lineEnd: function lineEnd() {\n stream.lineEnd();\n lambda0 = phi0 = NaN;\n },\n clean: function clean() {\n return 2 - _clean; // if intersections, rejoin first and last segments\n }\n };\n}\n\nfunction clipAntimeridianIntersect(lambda0, phi0, lambda1, phi1) {\n var cosPhi0,\n cosPhi1,\n sinLambda0Lambda1 = sin(lambda0 - lambda1);\n return abs(sinLambda0Lambda1) > epsilon ? atan((sin(phi0) * (cosPhi1 = cos(phi1)) * sin(lambda1) - sin(phi1) * (cosPhi0 = cos(phi0)) * sin(lambda0)) / (cosPhi0 * cosPhi1 * sinLambda0Lambda1)) : (phi0 + phi1) / 2;\n}\n\nfunction clipAntimeridianInterpolate(from, to, direction, stream) {\n var phi;\n\n if (from == null) {\n phi = direction * halfPi;\n stream.point(-pi, phi);\n stream.point(0, phi);\n stream.point(pi, phi);\n stream.point(pi, 0);\n stream.point(pi, -phi);\n stream.point(0, -phi);\n stream.point(-pi, -phi);\n stream.point(-pi, 0);\n stream.point(-pi, phi);\n } else if (abs(from[0] - to[0]) > epsilon) {\n var lambda = from[0] < to[0] ? pi : -pi;\n phi = direction * lambda / 2;\n stream.point(-lambda, phi);\n stream.point(0, phi);\n stream.point(lambda, phi);\n } else {\n stream.point(to[0], to[1]);\n }\n}","import { cartesian, cartesianAddInPlace, cartesianCross, cartesianDot, cartesianScale, spherical } from \"../cartesian.js\";\nimport { circleStream } from \"../circle.js\";\nimport { abs, cos, epsilon, pi, radians, sqrt } from \"../math.js\";\nimport pointEqual from \"../pointEqual.js\";\nimport clip from \"./index.js\";\nexport default function (radius) {\n var cr = cos(radius),\n delta = 6 * radians,\n smallRadius = cr > 0,\n notHemisphere = abs(cr) > epsilon; // TODO optimise for this common case\n\n function interpolate(from, to, direction, stream) {\n circleStream(stream, radius, delta, direction, from, to);\n }\n\n function visible(lambda, phi) {\n return cos(lambda) * cos(phi) > cr;\n } // Takes a line and cuts into visible segments. Return values used for polygon\n // clipping: 0 - there were intersections or the line was empty; 1 - no\n // intersections 2 - there were intersections, and the first and last segments\n // should be rejoined.\n\n\n function clipLine(stream) {\n var point0, // previous point\n c0, // code for previous point\n v0, // visibility of previous point\n v00, // visibility of first point\n _clean; // no intersections\n\n\n return {\n lineStart: function lineStart() {\n v00 = v0 = false;\n _clean = 1;\n },\n point: function point(lambda, phi) {\n var point1 = [lambda, phi],\n point2,\n v = visible(lambda, phi),\n c = smallRadius ? v ? 0 : code(lambda, phi) : v ? code(lambda + (lambda < 0 ? pi : -pi), phi) : 0;\n if (!point0 && (v00 = v0 = v)) stream.lineStart();\n\n if (v !== v0) {\n point2 = intersect(point0, point1);\n if (!point2 || pointEqual(point0, point2) || pointEqual(point1, point2)) point1[2] = 1;\n }\n\n if (v !== v0) {\n _clean = 0;\n\n if (v) {\n // outside going in\n stream.lineStart();\n point2 = intersect(point1, point0);\n stream.point(point2[0], point2[1]);\n } else {\n // inside going out\n point2 = intersect(point0, point1);\n stream.point(point2[0], point2[1], 2);\n stream.lineEnd();\n }\n\n point0 = point2;\n } else if (notHemisphere && point0 && smallRadius ^ v) {\n var t; // If the codes for two points are different, or are both zero,\n // and there this segment intersects with the small circle.\n\n if (!(c & c0) && (t = intersect(point1, point0, true))) {\n _clean = 0;\n\n if (smallRadius) {\n stream.lineStart();\n stream.point(t[0][0], t[0][1]);\n stream.point(t[1][0], t[1][1]);\n stream.lineEnd();\n } else {\n stream.point(t[1][0], t[1][1]);\n stream.lineEnd();\n stream.lineStart();\n stream.point(t[0][0], t[0][1], 3);\n }\n }\n }\n\n if (v && (!point0 || !pointEqual(point0, point1))) {\n stream.point(point1[0], point1[1]);\n }\n\n point0 = point1, v0 = v, c0 = c;\n },\n lineEnd: function lineEnd() {\n if (v0) stream.lineEnd();\n point0 = null;\n },\n // Rejoin first and last segments if there were intersections and the first\n // and last points were visible.\n clean: function clean() {\n return _clean | (v00 && v0) << 1;\n }\n };\n } // Intersects the great circle between a and b with the clip circle.\n\n\n function intersect(a, b, two) {\n var pa = cartesian(a),\n pb = cartesian(b); // We have two planes, n1.p = d1 and n2.p = d2.\n // Find intersection line p(t) = c1 n1 + c2 n2 + t (n1 ⨯ n2).\n\n var n1 = [1, 0, 0],\n // normal\n n2 = cartesianCross(pa, pb),\n n2n2 = cartesianDot(n2, n2),\n n1n2 = n2[0],\n // cartesianDot(n1, n2),\n determinant = n2n2 - n1n2 * n1n2; // Two polar points.\n\n if (!determinant) return !two && a;\n var c1 = cr * n2n2 / determinant,\n c2 = -cr * n1n2 / determinant,\n n1xn2 = cartesianCross(n1, n2),\n A = cartesianScale(n1, c1),\n B = cartesianScale(n2, c2);\n cartesianAddInPlace(A, B); // Solve |p(t)|^2 = 1.\n\n var u = n1xn2,\n w = cartesianDot(A, u),\n uu = cartesianDot(u, u),\n t2 = w * w - uu * (cartesianDot(A, A) - 1);\n if (t2 < 0) return;\n var t = sqrt(t2),\n q = cartesianScale(u, (-w - t) / uu);\n cartesianAddInPlace(q, A);\n q = spherical(q);\n if (!two) return q; // Two intersection points.\n\n var lambda0 = a[0],\n lambda1 = b[0],\n phi0 = a[1],\n phi1 = b[1],\n z;\n if (lambda1 < lambda0) z = lambda0, lambda0 = lambda1, lambda1 = z;\n var delta = lambda1 - lambda0,\n polar = abs(delta - pi) < epsilon,\n meridian = polar || delta < epsilon;\n if (!polar && phi1 < phi0) z = phi0, phi0 = phi1, phi1 = z; // Check that the first point is between a and b.\n\n if (meridian ? polar ? phi0 + phi1 > 0 ^ q[1] < (abs(q[0] - lambda0) < epsilon ? phi0 : phi1) : phi0 <= q[1] && q[1] <= phi1 : delta > pi ^ (lambda0 <= q[0] && q[0] <= lambda1)) {\n var q1 = cartesianScale(u, (-w + t) / uu);\n cartesianAddInPlace(q1, A);\n return [q, spherical(q1)];\n }\n } // Generates a 4-bit vector representing the location of a point relative to\n // the small circle's bounding box.\n\n\n function code(lambda, phi) {\n var r = smallRadius ? radius : pi - radius,\n code = 0;\n if (lambda < -r) code |= 1; // left\n else if (lambda > r) code |= 2; // right\n\n if (phi < -r) code |= 4; // below\n else if (phi > r) code |= 8; // above\n\n return code;\n }\n\n return clip(visible, clipLine, interpolate, smallRadius ? [0, -radius] : [-pi, radius - pi]);\n}","import { abs, epsilon } from \"../math.js\";\nimport clipBuffer from \"./buffer.js\";\nimport clipLine from \"./line.js\";\nimport clipRejoin from \"./rejoin.js\";\nimport { merge } from \"d3-array\";\nvar clipMax = 1e9,\n clipMin = -clipMax; // TODO Use d3-polygon’s polygonContains here for the ring check?\n// TODO Eliminate duplicate buffering in clipBuffer and polygon.push?\n\nexport default function clipRectangle(x0, y0, x1, y1) {\n function visible(x, y) {\n return x0 <= x && x <= x1 && y0 <= y && y <= y1;\n }\n\n function interpolate(from, to, direction, stream) {\n var a = 0,\n a1 = 0;\n\n if (from == null || (a = corner(from, direction)) !== (a1 = corner(to, direction)) || comparePoint(from, to) < 0 ^ direction > 0) {\n do {\n stream.point(a === 0 || a === 3 ? x0 : x1, a > 1 ? y1 : y0);\n } while ((a = (a + direction + 4) % 4) !== a1);\n } else {\n stream.point(to[0], to[1]);\n }\n }\n\n function corner(p, direction) {\n return abs(p[0] - x0) < epsilon ? direction > 0 ? 0 : 3 : abs(p[0] - x1) < epsilon ? direction > 0 ? 2 : 1 : abs(p[1] - y0) < epsilon ? direction > 0 ? 1 : 0 : direction > 0 ? 3 : 2; // abs(p[1] - y1) < epsilon\n }\n\n function compareIntersection(a, b) {\n return comparePoint(a.x, b.x);\n }\n\n function comparePoint(a, b) {\n var ca = corner(a, 1),\n cb = corner(b, 1);\n return ca !== cb ? ca - cb : ca === 0 ? b[1] - a[1] : ca === 1 ? a[0] - b[0] : ca === 2 ? a[1] - b[1] : b[0] - a[0];\n }\n\n return function (stream) {\n var activeStream = stream,\n bufferStream = clipBuffer(),\n segments,\n polygon,\n ring,\n x__,\n y__,\n v__,\n // first point\n x_,\n y_,\n v_,\n // previous point\n first,\n clean;\n var clipStream = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: polygonStart,\n polygonEnd: polygonEnd\n };\n\n function point(x, y) {\n if (visible(x, y)) activeStream.point(x, y);\n }\n\n function polygonInside() {\n var winding = 0;\n\n for (var i = 0, n = polygon.length; i < n; ++i) {\n for (var ring = polygon[i], j = 1, m = ring.length, point = ring[0], a0, a1, b0 = point[0], b1 = point[1]; j < m; ++j) {\n a0 = b0, a1 = b1, point = ring[j], b0 = point[0], b1 = point[1];\n\n if (a1 <= y1) {\n if (b1 > y1 && (b0 - a0) * (y1 - a1) > (b1 - a1) * (x0 - a0)) ++winding;\n } else {\n if (b1 <= y1 && (b0 - a0) * (y1 - a1) < (b1 - a1) * (x0 - a0)) --winding;\n }\n }\n }\n\n return winding;\n } // Buffer geometry within a polygon and then clip it en masse.\n\n\n function polygonStart() {\n activeStream = bufferStream, segments = [], polygon = [], clean = true;\n }\n\n function polygonEnd() {\n var startInside = polygonInside(),\n cleanInside = clean && startInside,\n visible = (segments = merge(segments)).length;\n\n if (cleanInside || visible) {\n stream.polygonStart();\n\n if (cleanInside) {\n stream.lineStart();\n interpolate(null, null, 1, stream);\n stream.lineEnd();\n }\n\n if (visible) {\n clipRejoin(segments, compareIntersection, startInside, interpolate, stream);\n }\n\n stream.polygonEnd();\n }\n\n activeStream = stream, segments = polygon = ring = null;\n }\n\n function lineStart() {\n clipStream.point = linePoint;\n if (polygon) polygon.push(ring = []);\n first = true;\n v_ = false;\n x_ = y_ = NaN;\n } // TODO rather than special-case polygons, simply handle them separately.\n // Ideally, coincident intersection points should be jittered to avoid\n // clipping issues.\n\n\n function lineEnd() {\n if (segments) {\n linePoint(x__, y__);\n if (v__ && v_) bufferStream.rejoin();\n segments.push(bufferStream.result());\n }\n\n clipStream.point = point;\n if (v_) activeStream.lineEnd();\n }\n\n function linePoint(x, y) {\n var v = visible(x, y);\n if (polygon) ring.push([x, y]);\n\n if (first) {\n x__ = x, y__ = y, v__ = v;\n first = false;\n\n if (v) {\n activeStream.lineStart();\n activeStream.point(x, y);\n }\n } else {\n if (v && v_) activeStream.point(x, y);else {\n var a = [x_ = Math.max(clipMin, Math.min(clipMax, x_)), y_ = Math.max(clipMin, Math.min(clipMax, y_))],\n b = [x = Math.max(clipMin, Math.min(clipMax, x)), y = Math.max(clipMin, Math.min(clipMax, y))];\n\n if (clipLine(a, b, x0, y0, x1, y1)) {\n if (!v_) {\n activeStream.lineStart();\n activeStream.point(a[0], a[1]);\n }\n\n activeStream.point(b[0], b[1]);\n if (!v) activeStream.lineEnd();\n clean = false;\n } else if (v) {\n activeStream.lineStart();\n activeStream.point(x, y);\n clean = false;\n }\n }\n }\n\n x_ = x, y_ = y, v_ = v;\n }\n\n return clipStream;\n };\n}","export default function (a, b, x0, y0, x1, y1) {\n var ax = a[0],\n ay = a[1],\n bx = b[0],\n by = b[1],\n t0 = 0,\n t1 = 1,\n dx = bx - ax,\n dy = by - ay,\n r;\n r = x0 - ax;\n if (!dx && r > 0) return;\n r /= dx;\n\n if (dx < 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n } else if (dx > 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n }\n\n r = x1 - ax;\n if (!dx && r < 0) return;\n r /= dx;\n\n if (dx < 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n } else if (dx > 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n }\n\n r = y0 - ay;\n if (!dy && r > 0) return;\n r /= dy;\n\n if (dy < 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n } else if (dy > 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n }\n\n r = y1 - ay;\n if (!dy && r < 0) return;\n r /= dy;\n\n if (dy < 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n } else if (dy > 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n }\n\n if (t0 > 0) a[0] = ax + t0 * dx, a[1] = ay + t0 * dy;\n if (t1 < 1) b[0] = ax + t1 * dx, b[1] = ay + t1 * dy;\n return true;\n}","export default (function (x) {\n return x;\n});","export default function (methods) {\n return {\n stream: transformer(methods)\n };\n}\nexport function transformer(methods) {\n return function (stream) {\n var s = new TransformStream();\n\n for (var key in methods) {\n s[key] = methods[key];\n }\n\n s.stream = stream;\n return s;\n };\n}\n\nfunction TransformStream() {}\n\nTransformStream.prototype = {\n constructor: TransformStream,\n point: function point(x, y) {\n this.stream.point(x, y);\n },\n sphere: function sphere() {\n this.stream.sphere();\n },\n lineStart: function lineStart() {\n this.stream.lineStart();\n },\n lineEnd: function lineEnd() {\n this.stream.lineEnd();\n },\n polygonStart: function polygonStart() {\n this.stream.polygonStart();\n },\n polygonEnd: function polygonEnd() {\n this.stream.polygonEnd();\n }\n};","import noop from \"../noop.js\";\nvar x0 = Infinity,\n y0 = x0,\n x1 = -x0,\n y1 = x1;\nvar boundsStream = {\n point: boundsPoint,\n lineStart: noop,\n lineEnd: noop,\n polygonStart: noop,\n polygonEnd: noop,\n result: function result() {\n var bounds = [[x0, y0], [x1, y1]];\n x1 = y1 = -(y0 = x0 = Infinity);\n return bounds;\n }\n};\n\nfunction boundsPoint(x, y) {\n if (x < x0) x0 = x;\n if (x > x1) x1 = x;\n if (y < y0) y0 = y;\n if (y > y1) y1 = y;\n}\n\nexport default boundsStream;","import { default as geoStream } from \"../stream.js\";\nimport boundsStream from \"../path/bounds.js\";\n\nfunction fit(projection, fitBounds, object) {\n var clip = projection.clipExtent && projection.clipExtent();\n projection.scale(150).translate([0, 0]);\n if (clip != null) projection.clipExtent(null);\n geoStream(object, projection.stream(boundsStream));\n fitBounds(boundsStream.result());\n if (clip != null) projection.clipExtent(clip);\n return projection;\n}\n\nexport function fitExtent(projection, extent, object) {\n return fit(projection, function (b) {\n var w = extent[1][0] - extent[0][0],\n h = extent[1][1] - extent[0][1],\n k = Math.min(w / (b[1][0] - b[0][0]), h / (b[1][1] - b[0][1])),\n x = +extent[0][0] + (w - k * (b[1][0] + b[0][0])) / 2,\n y = +extent[0][1] + (h - k * (b[1][1] + b[0][1])) / 2;\n projection.scale(150 * k).translate([x, y]);\n }, object);\n}\nexport function fitSize(projection, size, object) {\n return fitExtent(projection, [[0, 0], size], object);\n}\nexport function fitWidth(projection, width, object) {\n return fit(projection, function (b) {\n var w = +width,\n k = w / (b[1][0] - b[0][0]),\n x = (w - k * (b[1][0] + b[0][0])) / 2,\n y = -k * b[0][1];\n projection.scale(150 * k).translate([x, y]);\n }, object);\n}\nexport function fitHeight(projection, height, object) {\n return fit(projection, function (b) {\n var h = +height,\n k = h / (b[1][1] - b[0][1]),\n x = -k * b[0][0],\n y = (h - k * (b[1][1] + b[0][1])) / 2;\n projection.scale(150 * k).translate([x, y]);\n }, object);\n}","import { cartesian } from \"../cartesian.js\";\nimport { abs, asin, atan2, cos, epsilon, radians, sqrt } from \"../math.js\";\nimport { transformer } from \"../transform.js\";\nvar maxDepth = 16,\n // maximum depth of subdivision\ncosMinDistance = cos(30 * radians); // cos(minimum angular distance)\n\nexport default function (project, delta2) {\n return +delta2 ? resample(project, delta2) : resampleNone(project);\n}\n\nfunction resampleNone(project) {\n return transformer({\n point: function point(x, y) {\n x = project(x, y);\n this.stream.point(x[0], x[1]);\n }\n });\n}\n\nfunction resample(project, delta2) {\n function resampleLineTo(x0, y0, lambda0, a0, b0, c0, x1, y1, lambda1, a1, b1, c1, depth, stream) {\n var dx = x1 - x0,\n dy = y1 - y0,\n d2 = dx * dx + dy * dy;\n\n if (d2 > 4 * delta2 && depth--) {\n var a = a0 + a1,\n b = b0 + b1,\n c = c0 + c1,\n m = sqrt(a * a + b * b + c * c),\n phi2 = asin(c /= m),\n lambda2 = abs(abs(c) - 1) < epsilon || abs(lambda0 - lambda1) < epsilon ? (lambda0 + lambda1) / 2 : atan2(b, a),\n p = project(lambda2, phi2),\n x2 = p[0],\n y2 = p[1],\n dx2 = x2 - x0,\n dy2 = y2 - y0,\n dz = dy * dx2 - dx * dy2;\n\n if (dz * dz / d2 > delta2 // perpendicular projected distance\n || abs((dx * dx2 + dy * dy2) / d2 - 0.5) > 0.3 // midpoint close to an end\n || a0 * a1 + b0 * b1 + c0 * c1 < cosMinDistance) {\n // angular distance\n resampleLineTo(x0, y0, lambda0, a0, b0, c0, x2, y2, lambda2, a /= m, b /= m, c, depth, stream);\n stream.point(x2, y2);\n resampleLineTo(x2, y2, lambda2, a, b, c, x1, y1, lambda1, a1, b1, c1, depth, stream);\n }\n }\n }\n\n return function (stream) {\n var lambda00, x00, y00, a00, b00, c00, // first point\n lambda0, x0, y0, a0, b0, c0; // previous point\n\n var resampleStream = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: function polygonStart() {\n stream.polygonStart();\n resampleStream.lineStart = ringStart;\n },\n polygonEnd: function polygonEnd() {\n stream.polygonEnd();\n resampleStream.lineStart = lineStart;\n }\n };\n\n function point(x, y) {\n x = project(x, y);\n stream.point(x[0], x[1]);\n }\n\n function lineStart() {\n x0 = NaN;\n resampleStream.point = linePoint;\n stream.lineStart();\n }\n\n function linePoint(lambda, phi) {\n var c = cartesian([lambda, phi]),\n p = project(lambda, phi);\n resampleLineTo(x0, y0, lambda0, a0, b0, c0, x0 = p[0], y0 = p[1], lambda0 = lambda, a0 = c[0], b0 = c[1], c0 = c[2], maxDepth, stream);\n stream.point(x0, y0);\n }\n\n function lineEnd() {\n resampleStream.point = point;\n stream.lineEnd();\n }\n\n function ringStart() {\n lineStart();\n resampleStream.point = ringPoint;\n resampleStream.lineEnd = ringEnd;\n }\n\n function ringPoint(lambda, phi) {\n linePoint(lambda00 = lambda, phi), x00 = x0, y00 = y0, a00 = a0, b00 = b0, c00 = c0;\n resampleStream.point = linePoint;\n }\n\n function ringEnd() {\n resampleLineTo(x0, y0, lambda0, a0, b0, c0, x00, y00, lambda00, a00, b00, c00, maxDepth, stream);\n resampleStream.lineEnd = lineEnd;\n lineEnd();\n }\n\n return resampleStream;\n };\n}","import clipAntimeridian from \"../clip/antimeridian.js\";\nimport clipCircle from \"../clip/circle.js\";\nimport clipRectangle from \"../clip/rectangle.js\";\nimport compose from \"../compose.js\";\nimport identity from \"../identity.js\";\nimport { cos, degrees, radians, sin, sqrt } from \"../math.js\";\nimport { rotateRadians } from \"../rotation.js\";\nimport { transformer } from \"../transform.js\";\nimport { fitExtent, fitSize, fitWidth, fitHeight } from \"./fit.js\";\nimport resample from \"./resample.js\";\nvar transformRadians = transformer({\n point: function point(x, y) {\n this.stream.point(x * radians, y * radians);\n }\n});\n\nfunction transformRotate(rotate) {\n return transformer({\n point: function point(x, y) {\n var r = rotate(x, y);\n return this.stream.point(r[0], r[1]);\n }\n });\n}\n\nfunction scaleTranslate(k, dx, dy, sx, sy) {\n function transform(x, y) {\n x *= sx;\n y *= sy;\n return [dx + k * x, dy - k * y];\n }\n\n transform.invert = function (x, y) {\n return [(x - dx) / k * sx, (dy - y) / k * sy];\n };\n\n return transform;\n}\n\nfunction scaleTranslateRotate(k, dx, dy, sx, sy, alpha) {\n if (!alpha) return scaleTranslate(k, dx, dy, sx, sy);\n var cosAlpha = cos(alpha),\n sinAlpha = sin(alpha),\n a = cosAlpha * k,\n b = sinAlpha * k,\n ai = cosAlpha / k,\n bi = sinAlpha / k,\n ci = (sinAlpha * dy - cosAlpha * dx) / k,\n fi = (sinAlpha * dx + cosAlpha * dy) / k;\n\n function transform(x, y) {\n x *= sx;\n y *= sy;\n return [a * x - b * y + dx, dy - b * x - a * y];\n }\n\n transform.invert = function (x, y) {\n return [sx * (ai * x - bi * y + ci), sy * (fi - bi * x - ai * y)];\n };\n\n return transform;\n}\n\nexport default function projection(project) {\n return projectionMutator(function () {\n return project;\n })();\n}\nexport function projectionMutator(projectAt) {\n var project,\n k = 150,\n // scale\n x = 480,\n y = 250,\n // translate\n lambda = 0,\n phi = 0,\n // center\n deltaLambda = 0,\n deltaPhi = 0,\n deltaGamma = 0,\n rotate,\n // pre-rotate\n alpha = 0,\n // post-rotate angle\n sx = 1,\n // reflectX\n sy = 1,\n // reflectX\n theta = null,\n preclip = clipAntimeridian,\n // pre-clip angle\n x0 = null,\n y0,\n x1,\n y1,\n postclip = identity,\n // post-clip extent\n delta2 = 0.5,\n // precision\n projectResample,\n projectTransform,\n projectRotateTransform,\n cache,\n cacheStream;\n\n function projection(point) {\n return projectRotateTransform(point[0] * radians, point[1] * radians);\n }\n\n function invert(point) {\n point = projectRotateTransform.invert(point[0], point[1]);\n return point && [point[0] * degrees, point[1] * degrees];\n }\n\n projection.stream = function (stream) {\n return cache && cacheStream === stream ? cache : cache = transformRadians(transformRotate(rotate)(preclip(projectResample(postclip(cacheStream = stream)))));\n };\n\n projection.preclip = function (_) {\n return arguments.length ? (preclip = _, theta = undefined, reset()) : preclip;\n };\n\n projection.postclip = function (_) {\n return arguments.length ? (postclip = _, x0 = y0 = x1 = y1 = null, reset()) : postclip;\n };\n\n projection.clipAngle = function (_) {\n return arguments.length ? (preclip = +_ ? clipCircle(theta = _ * radians) : (theta = null, clipAntimeridian), reset()) : theta * degrees;\n };\n\n projection.clipExtent = function (_) {\n return arguments.length ? (postclip = _ == null ? (x0 = y0 = x1 = y1 = null, identity) : clipRectangle(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reset()) : x0 == null ? null : [[x0, y0], [x1, y1]];\n };\n\n projection.scale = function (_) {\n return arguments.length ? (k = +_, recenter()) : k;\n };\n\n projection.translate = function (_) {\n return arguments.length ? (x = +_[0], y = +_[1], recenter()) : [x, y];\n };\n\n projection.center = function (_) {\n return arguments.length ? (lambda = _[0] % 360 * radians, phi = _[1] % 360 * radians, recenter()) : [lambda * degrees, phi * degrees];\n };\n\n projection.rotate = function (_) {\n return arguments.length ? (deltaLambda = _[0] % 360 * radians, deltaPhi = _[1] % 360 * radians, deltaGamma = _.length > 2 ? _[2] % 360 * radians : 0, recenter()) : [deltaLambda * degrees, deltaPhi * degrees, deltaGamma * degrees];\n };\n\n projection.angle = function (_) {\n return arguments.length ? (alpha = _ % 360 * radians, recenter()) : alpha * degrees;\n };\n\n projection.reflectX = function (_) {\n return arguments.length ? (sx = _ ? -1 : 1, recenter()) : sx < 0;\n };\n\n projection.reflectY = function (_) {\n return arguments.length ? (sy = _ ? -1 : 1, recenter()) : sy < 0;\n };\n\n projection.precision = function (_) {\n return arguments.length ? (projectResample = resample(projectTransform, delta2 = _ * _), reset()) : sqrt(delta2);\n };\n\n projection.fitExtent = function (extent, object) {\n return fitExtent(projection, extent, object);\n };\n\n projection.fitSize = function (size, object) {\n return fitSize(projection, size, object);\n };\n\n projection.fitWidth = function (width, object) {\n return fitWidth(projection, width, object);\n };\n\n projection.fitHeight = function (height, object) {\n return fitHeight(projection, height, object);\n };\n\n function recenter() {\n var center = scaleTranslateRotate(k, 0, 0, sx, sy, alpha).apply(null, project(lambda, phi)),\n transform = scaleTranslateRotate(k, x - center[0], y - center[1], sx, sy, alpha);\n rotate = rotateRadians(deltaLambda, deltaPhi, deltaGamma);\n projectTransform = compose(project, transform);\n projectRotateTransform = compose(rotate, projectTransform);\n projectResample = resample(projectTransform, delta2);\n return reset();\n }\n\n function reset() {\n cache = cacheStream = null;\n return projection;\n }\n\n return function () {\n project = projectAt.apply(this, arguments);\n projection.invert = project.invert && invert;\n return recenter();\n };\n}","import projection from \"./index.js\";\nexport function equirectangularRaw(lambda, phi) {\n return [lambda, phi];\n}\nequirectangularRaw.invert = equirectangularRaw;\nexport default function () {\n return projection(equirectangularRaw).scale(152.63);\n}","import { Adder } from \"d3-array\";\nimport { abs } from \"../math.js\";\nimport noop from \"../noop.js\";\nvar areaSum = new Adder(),\n areaRingSum = new Adder(),\n x00,\n y00,\n x0,\n y0;\nvar areaStream = {\n point: noop,\n lineStart: noop,\n lineEnd: noop,\n polygonStart: function polygonStart() {\n areaStream.lineStart = areaRingStart;\n areaStream.lineEnd = areaRingEnd;\n },\n polygonEnd: function polygonEnd() {\n areaStream.lineStart = areaStream.lineEnd = areaStream.point = noop;\n areaSum.add(abs(areaRingSum));\n areaRingSum = new Adder();\n },\n result: function result() {\n var area = areaSum / 2;\n areaSum = new Adder();\n return area;\n }\n};\n\nfunction areaRingStart() {\n areaStream.point = areaPointFirst;\n}\n\nfunction areaPointFirst(x, y) {\n areaStream.point = areaPoint;\n x00 = x0 = x, y00 = y0 = y;\n}\n\nfunction areaPoint(x, y) {\n areaRingSum.add(y0 * x - x0 * y);\n x0 = x, y0 = y;\n}\n\nfunction areaRingEnd() {\n areaPoint(x00, y00);\n}\n\nexport default areaStream;","import { sqrt } from \"../math.js\"; // TODO Enforce positive area for exterior, negative area for interior?\n\nvar X0 = 0,\n Y0 = 0,\n Z0 = 0,\n X1 = 0,\n Y1 = 0,\n Z1 = 0,\n X2 = 0,\n Y2 = 0,\n Z2 = 0,\n x00,\n y00,\n x0,\n y0;\nvar centroidStream = {\n point: centroidPoint,\n lineStart: centroidLineStart,\n lineEnd: centroidLineEnd,\n polygonStart: function polygonStart() {\n centroidStream.lineStart = centroidRingStart;\n centroidStream.lineEnd = centroidRingEnd;\n },\n polygonEnd: function polygonEnd() {\n centroidStream.point = centroidPoint;\n centroidStream.lineStart = centroidLineStart;\n centroidStream.lineEnd = centroidLineEnd;\n },\n result: function result() {\n var centroid = Z2 ? [X2 / Z2, Y2 / Z2] : Z1 ? [X1 / Z1, Y1 / Z1] : Z0 ? [X0 / Z0, Y0 / Z0] : [NaN, NaN];\n X0 = Y0 = Z0 = X1 = Y1 = Z1 = X2 = Y2 = Z2 = 0;\n return centroid;\n }\n};\n\nfunction centroidPoint(x, y) {\n X0 += x;\n Y0 += y;\n ++Z0;\n}\n\nfunction centroidLineStart() {\n centroidStream.point = centroidPointFirstLine;\n}\n\nfunction centroidPointFirstLine(x, y) {\n centroidStream.point = centroidPointLine;\n centroidPoint(x0 = x, y0 = y);\n}\n\nfunction centroidPointLine(x, y) {\n var dx = x - x0,\n dy = y - y0,\n z = sqrt(dx * dx + dy * dy);\n X1 += z * (x0 + x) / 2;\n Y1 += z * (y0 + y) / 2;\n Z1 += z;\n centroidPoint(x0 = x, y0 = y);\n}\n\nfunction centroidLineEnd() {\n centroidStream.point = centroidPoint;\n}\n\nfunction centroidRingStart() {\n centroidStream.point = centroidPointFirstRing;\n}\n\nfunction centroidRingEnd() {\n centroidPointRing(x00, y00);\n}\n\nfunction centroidPointFirstRing(x, y) {\n centroidStream.point = centroidPointRing;\n centroidPoint(x00 = x0 = x, y00 = y0 = y);\n}\n\nfunction centroidPointRing(x, y) {\n var dx = x - x0,\n dy = y - y0,\n z = sqrt(dx * dx + dy * dy);\n X1 += z * (x0 + x) / 2;\n Y1 += z * (y0 + y) / 2;\n Z1 += z;\n z = y0 * x - x0 * y;\n X2 += z * (x0 + x);\n Y2 += z * (y0 + y);\n Z2 += z * 3;\n centroidPoint(x0 = x, y0 = y);\n}\n\nexport default centroidStream;","import { tau } from \"../math.js\";\nimport noop from \"../noop.js\";\nexport default function PathContext(context) {\n this._context = context;\n}\nPathContext.prototype = {\n _radius: 4.5,\n pointRadius: function pointRadius(_) {\n return this._radius = _, this;\n },\n polygonStart: function polygonStart() {\n this._line = 0;\n },\n polygonEnd: function polygonEnd() {\n this._line = NaN;\n },\n lineStart: function lineStart() {\n this._point = 0;\n },\n lineEnd: function lineEnd() {\n if (this._line === 0) this._context.closePath();\n this._point = NaN;\n },\n point: function point(x, y) {\n switch (this._point) {\n case 0:\n {\n this._context.moveTo(x, y);\n\n this._point = 1;\n break;\n }\n\n case 1:\n {\n this._context.lineTo(x, y);\n\n break;\n }\n\n default:\n {\n this._context.moveTo(x + this._radius, y);\n\n this._context.arc(x, y, this._radius, 0, tau);\n\n break;\n }\n }\n },\n result: noop\n};","import { Adder } from \"d3-array\";\nimport { sqrt } from \"../math.js\";\nimport noop from \"../noop.js\";\nvar lengthSum = new Adder(),\n lengthRing,\n x00,\n y00,\n x0,\n y0;\nvar lengthStream = {\n point: noop,\n lineStart: function lineStart() {\n lengthStream.point = lengthPointFirst;\n },\n lineEnd: function lineEnd() {\n if (lengthRing) lengthPoint(x00, y00);\n lengthStream.point = noop;\n },\n polygonStart: function polygonStart() {\n lengthRing = true;\n },\n polygonEnd: function polygonEnd() {\n lengthRing = null;\n },\n result: function result() {\n var length = +lengthSum;\n lengthSum = new Adder();\n return length;\n }\n};\n\nfunction lengthPointFirst(x, y) {\n lengthStream.point = lengthPoint;\n x00 = x0 = x, y00 = y0 = y;\n}\n\nfunction lengthPoint(x, y) {\n x0 -= x, y0 -= y;\n lengthSum.add(sqrt(x0 * x0 + y0 * y0));\n x0 = x, y0 = y;\n}\n\nexport default lengthStream;","export default function PathString() {\n this._string = [];\n}\nPathString.prototype = {\n _radius: 4.5,\n _circle: circle(4.5),\n pointRadius: function pointRadius(_) {\n if ((_ = +_) !== this._radius) this._radius = _, this._circle = null;\n return this;\n },\n polygonStart: function polygonStart() {\n this._line = 0;\n },\n polygonEnd: function polygonEnd() {\n this._line = NaN;\n },\n lineStart: function lineStart() {\n this._point = 0;\n },\n lineEnd: function lineEnd() {\n if (this._line === 0) this._string.push(\"Z\");\n this._point = NaN;\n },\n point: function point(x, y) {\n switch (this._point) {\n case 0:\n {\n this._string.push(\"M\", x, \",\", y);\n\n this._point = 1;\n break;\n }\n\n case 1:\n {\n this._string.push(\"L\", x, \",\", y);\n\n break;\n }\n\n default:\n {\n if (this._circle == null) this._circle = circle(this._radius);\n\n this._string.push(\"M\", x, \",\", y, this._circle);\n\n break;\n }\n }\n },\n result: function result() {\n if (this._string.length) {\n var result = this._string.join(\"\");\n\n this._string = [];\n return result;\n } else {\n return null;\n }\n }\n};\n\nfunction circle(radius) {\n return \"m0,\" + radius + \"a\" + radius + \",\" + radius + \" 0 1,1 0,\" + -2 * radius + \"a\" + radius + \",\" + radius + \" 0 1,1 0,\" + 2 * radius + \"z\";\n}","import identity from \"../identity.js\";\nimport stream from \"../stream.js\";\nimport pathArea from \"./area.js\";\nimport pathBounds from \"./bounds.js\";\nimport pathCentroid from \"./centroid.js\";\nimport PathContext from \"./context.js\";\nimport pathMeasure from \"./measure.js\";\nimport PathString from \"./string.js\";\nexport default function (projection, context) {\n var pointRadius = 4.5,\n projectionStream,\n contextStream;\n\n function path(object) {\n if (object) {\n if (typeof pointRadius === \"function\") contextStream.pointRadius(+pointRadius.apply(this, arguments));\n stream(object, projectionStream(contextStream));\n }\n\n return contextStream.result();\n }\n\n path.area = function (object) {\n stream(object, projectionStream(pathArea));\n return pathArea.result();\n };\n\n path.measure = function (object) {\n stream(object, projectionStream(pathMeasure));\n return pathMeasure.result();\n };\n\n path.bounds = function (object) {\n stream(object, projectionStream(pathBounds));\n return pathBounds.result();\n };\n\n path.centroid = function (object) {\n stream(object, projectionStream(pathCentroid));\n return pathCentroid.result();\n };\n\n path.projection = function (_) {\n return arguments.length ? (projectionStream = _ == null ? (projection = null, identity) : (projection = _).stream, path) : projection;\n };\n\n path.context = function (_) {\n if (!arguments.length) return context;\n contextStream = _ == null ? (context = null, new PathString()) : new PathContext(context = _);\n if (typeof pointRadius !== \"function\") contextStream.pointRadius(pointRadius);\n return path;\n };\n\n path.pointRadius = function (_) {\n if (!arguments.length) return pointRadius;\n pointRadius = typeof _ === \"function\" ? _ : (contextStream.pointRadius(+_), +_);\n return path;\n };\n\n return path.projection(projection).context(context);\n}","import { Adder } from \"d3-array\";\nimport { abs, atan2, cos, radians, sin, sqrt } from \"./math.js\";\nimport noop from \"./noop.js\";\nimport stream from \"./stream.js\";\nvar lengthSum, lambda0, sinPhi0, cosPhi0;\nvar lengthStream = {\n sphere: noop,\n point: noop,\n lineStart: lengthLineStart,\n lineEnd: noop,\n polygonStart: noop,\n polygonEnd: noop\n};\n\nfunction lengthLineStart() {\n lengthStream.point = lengthPointFirst;\n lengthStream.lineEnd = lengthLineEnd;\n}\n\nfunction lengthLineEnd() {\n lengthStream.point = lengthStream.lineEnd = noop;\n}\n\nfunction lengthPointFirst(lambda, phi) {\n lambda *= radians, phi *= radians;\n lambda0 = lambda, sinPhi0 = sin(phi), cosPhi0 = cos(phi);\n lengthStream.point = lengthPoint;\n}\n\nfunction lengthPoint(lambda, phi) {\n lambda *= radians, phi *= radians;\n var sinPhi = sin(phi),\n cosPhi = cos(phi),\n delta = abs(lambda - lambda0),\n cosDelta = cos(delta),\n sinDelta = sin(delta),\n x = cosPhi * sinDelta,\n y = cosPhi0 * sinPhi - sinPhi0 * cosPhi * cosDelta,\n z = sinPhi0 * sinPhi + cosPhi0 * cosPhi * cosDelta;\n lengthSum.add(atan2(sqrt(x * x + y * y), z));\n lambda0 = lambda, sinPhi0 = sinPhi, cosPhi0 = cosPhi;\n}\n\nexport default function (object) {\n lengthSum = new Adder();\n stream(object, lengthStream);\n return +lengthSum;\n}","import length from \"./length.js\";\nvar coordinates = [null, null],\n object = {\n type: \"LineString\",\n coordinates: coordinates\n};\nexport default function (a, b) {\n coordinates[0] = a;\n coordinates[1] = b;\n return length(object);\n}","/**\r\n * This module contains funcitonality related to geographical projections\r\n */\nimport { registry } from \"../../../core/Registry\";\nimport * as $math from \"../../../core/utils/Math\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This is a base class for a geographical projection.\r\n */\n\nvar Projection =\n/** @class */\nfunction () {\n function Projection() {\n this.d3Projection = d3geo.geoEquirectangular();\n }\n\n Object.defineProperty(Projection.prototype, \"d3Projection\", {\n /**\r\n * d3 projection\r\n */\n get: function get() {\n return this._d3Projection;\n },\n\n /**\r\n * d3 projection\r\n */\n set: function set(projection) {\n this._d3Projection = projection;\n projection.precision(0.1);\n this._d3Path = d3geo.geoPath().projection(projection);\n\n if (this.chart) {\n this.chart.invalidateProjection();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Projection.prototype, \"d3Path\", {\n /**\r\n * d3 path generator method\r\n * @ignore\r\n */\n get: function get() {\n return this._d3Path;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(Projection.prototype, \"scale\", {\n /**\r\n * @ignore\r\n */\n get: function get() {\n return this.d3Projection.scale() / 100;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Converts a geographical point (lat/long) to a screen point (x/y)\r\n * @param geoPoint Geo point (lat/long)\r\n * @return Screen point (x/y)\r\n */\n\n Projection.prototype.convert = function (geoPoint) {\n /*\r\n geoPoint = $geo.normalizePoint(geoPoint);\r\n geoPoint = this.rotate(geoPoint, this.deltaLongitude, this.deltaLatitude, this.deltaGama);\r\n let pointInRadians: IPoint = this.project(geoPoint.longitude * $math.RADIANS, geoPoint.latitude * $math.RADIANS);\r\n return {\r\n x: $math.round(pointInRadians.x * $math.DEGREES - this.centerPoint.x, 4) * this.scale,\r\n y: $math.round(-pointInRadians.y * $math.DEGREES - this.centerPoint.y, 4) * this.scale\r\n };*/\n var p = this.d3Projection([geoPoint.longitude, geoPoint.latitude]);\n\n if (p) {\n return {\n x: p[0],\n y: p[1]\n };\n }\n };\n /**\r\n * Converts a screen point (x/y) to a geographical point (lat/long)\r\n * @param point Screen point (x/y)\r\n * @return Geo point (lat/long)\r\n */\n\n\n Projection.prototype.invert = function (point) {\n /*\r\n let pointInRadians: IGeoPoint = this.unproject((point.x / this.scale + this.centerPoint.x) * $math.RADIANS, (-point.y / this.scale - this.centerPoint.y) * $math.RADIANS);\r\n let geoPoint = { longitude: pointInRadians.longitude * $math.DEGREES, latitude: pointInRadians.latitude * $math.DEGREES };\r\n geoPoint = this.unrotate(geoPoint, this.deltaLongitude, this.deltaLatitude, this.deltaGama);\r\n */\n var p = this.d3Projection.invert([point.x, point.y]);\n\n if (p) {\n return {\n longitude: p[0],\n latitude: p[1]\n };\n }\n };\n /**\r\n * Returns X/Y coordinates.\r\n * Individual projections will override this method to apply their own\r\n * projection logic.\r\n * @deprecated\r\n * @param lambda [description]\r\n * @param phi [description]\r\n * @return X/Y coordinates\r\n * @todo Needs description\r\n */\n\n\n Projection.prototype.project = function (lambda, phi) {\n return this.convert({\n longitude: lambda * $math.DEGREES,\n latitude: phi * $math.DEGREES\n });\n };\n /**\r\n * Returns geographical coordinates (lat/long).\r\n * Individual projections will override this method to apply their own\r\n * projection logic.\r\n * @deprecated\r\n * @param x X coordinate\r\n * @param y Y coordinate\r\n * @return Geographical point\r\n * @todo Needs description\r\n */\n\n\n Projection.prototype.unproject = function (x, y) {\n return this.invert({\n x: x,\n y: y\n });\n };\n /**\r\n * @ignore\r\n * @deprecated\r\n */\n\n\n Projection.prototype.rotate = function (geoPoint, deltaLongitude, deltaLatitude, deltaGamma) {\n var deltaLambda = deltaLongitude * $math.RADIANS;\n var deltaPhi = deltaLatitude * $math.RADIANS;\n deltaGamma = deltaGamma * $math.RADIANS;\n var lambda = geoPoint.longitude * $math.RADIANS + deltaLambda;\n var phi = geoPoint.latitude * $math.RADIANS;\n var cosDeltaPhi = Math.cos(deltaPhi);\n var sinDeltaPhi = Math.sin(deltaPhi);\n var cosDeltaGamma = Math.cos(deltaGamma);\n var sinDeltaGamma = Math.sin(deltaGamma);\n var cosPhi = Math.cos(phi);\n var x = Math.cos(lambda) * cosPhi;\n var y = Math.sin(lambda) * cosPhi;\n var z = Math.sin(phi);\n var k = z * cosDeltaPhi + x * sinDeltaPhi;\n return {\n longitude: $math.DEGREES * Math.atan2(y * cosDeltaGamma - k * sinDeltaGamma, x * cosDeltaPhi - z * sinDeltaPhi),\n latitude: $math.DEGREES * Math.asin(k * cosDeltaGamma + y * sinDeltaGamma)\n };\n };\n /**\r\n * @ignore\r\n * @deprecated\r\n */\n\n\n Projection.prototype.unrotate = function (geoPoint, deltaLongitude, deltaLatitude, deltaGamma) {\n var deltaLambda = deltaLongitude * $math.RADIANS;\n var deltaPhi = deltaLatitude * $math.RADIANS;\n deltaGamma = deltaGamma * $math.RADIANS;\n var lambda = geoPoint.longitude * $math.RADIANS - deltaLambda;\n var phi = geoPoint.latitude * $math.RADIANS;\n var cosDeltaPhi = Math.cos(deltaPhi);\n var sinDeltaPhi = Math.sin(deltaPhi);\n var cosDeltaGamma = Math.cos(deltaGamma);\n var sinDeltaGamma = Math.sin(deltaGamma);\n var cosPhi = Math.cos(phi);\n var x = Math.cos(lambda) * cosPhi;\n var y = Math.sin(lambda) * cosPhi;\n var z = Math.sin(phi);\n var k = z * cosDeltaGamma - y * sinDeltaGamma;\n return {\n longitude: $math.DEGREES * Math.atan2(y * cosDeltaGamma + z * sinDeltaGamma, x * cosDeltaPhi + k * sinDeltaPhi),\n latitude: $math.DEGREES * Math.asin(k * cosDeltaPhi - x * sinDeltaPhi)\n };\n }; //@todo: move to some utils?\n //@todo: add credits to: https://www.movable-type.co.uk/scripts/latlong.html\n\n\n Projection.prototype.intermediatePoint = function (pointA, pointB, position) {\n var p = d3geo.geoInterpolate([pointA.longitude, pointA.latitude], [pointB.longitude, pointB.latitude])(position);\n return {\n longitude: p[0],\n latitude: p[1]\n };\n };\n\n ; // returns radians\n\n Projection.prototype.multiDistance = function (multiGeoLine) {\n var distance = 0;\n\n for (var s = 0; s < multiGeoLine.length; s++) {\n var points = multiGeoLine[s];\n\n if (points.length > 1) {\n for (var p = 1; p < points.length; p++) {\n var pointA = points[p - 1];\n var pointB = points[p];\n distance += this.distance(pointA, pointB);\n }\n }\n }\n\n return distance;\n }; // returns radians\n\n\n Projection.prototype.distance = function (pointA, pointB) {\n return d3geo.geoDistance([pointA.longitude, pointA.latitude], [pointB.longitude, pointB.latitude]);\n };\n /**\r\n * Converts relative position along the line (0-1) into pixel coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinates\r\n */\n\n\n Projection.prototype.positionToPoint = function (multiGeoLine, position) {\n if (multiGeoLine) {\n var intermediatePoint = this.positionToGeoPoint(multiGeoLine, position);\n var intermediatePointA = this.positionToGeoPoint(multiGeoLine, position - 0.01);\n var intermediatePointB = this.positionToGeoPoint(multiGeoLine, position + 0.01);\n\n if (intermediatePointA && intermediatePointB) {\n var point = this.convert(intermediatePoint);\n var pa = this.convert(intermediatePointA);\n var pb = this.convert(intermediatePointB);\n return {\n x: point.x,\n y: point.y,\n angle: $math.getAngle(pa, pb)\n };\n }\n }\n\n return {\n x: 0,\n y: 0,\n angle: 0\n };\n };\n /**\r\n * Converts relative position along the line (0-1) into pixel coordinates.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinates\r\n */\n\n\n Projection.prototype.positionToGeoPoint = function (multiGeoLine, position) {\n if (multiGeoLine) {\n var totalDistance = this.multiDistance(multiGeoLine);\n var currentDistance = 0;\n var distanceAB = void 0;\n var positionA = 0;\n var positionB = 0;\n var pointA = void 0;\n var pointB = void 0;\n\n for (var s = 0; s < multiGeoLine.length; s++) {\n var points = multiGeoLine[s];\n\n if (points.length > 1) {\n for (var p = 1; p < points.length; p++) {\n pointA = points[p - 1];\n pointB = points[p];\n positionA = currentDistance / totalDistance;\n distanceAB = this.distance(pointA, pointB);\n currentDistance += distanceAB;\n positionB = currentDistance / totalDistance;\n\n if (positionA <= position && positionB > position) {\n s = multiGeoLine.length;\n break;\n }\n }\n } else if (points.length == 1) {\n pointA = points[0];\n pointB = points[0];\n positionA = 0;\n positionB = 1;\n }\n }\n\n if (pointA && pointB) {\n var positionAB = (position - positionA) / (positionB - positionA);\n return this.intermediatePoint(pointA, pointB, positionAB);\n }\n }\n\n return {\n longitude: 0,\n latitude: 0\n };\n };\n\n return Projection;\n}();\n\nexport { Projection };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Projection\"] = Projection;","import { asin, atan2, cos, degrees, haversin, radians, sin, sqrt } from \"./math.js\";\nexport default function (a, b) {\n var x0 = a[0] * radians,\n y0 = a[1] * radians,\n x1 = b[0] * radians,\n y1 = b[1] * radians,\n cy0 = cos(y0),\n sy0 = sin(y0),\n cy1 = cos(y1),\n sy1 = sin(y1),\n kx0 = cy0 * cos(x0),\n ky0 = cy0 * sin(x0),\n kx1 = cy1 * cos(x1),\n ky1 = cy1 * sin(x1),\n d = 2 * asin(sqrt(haversin(y1 - y0) + cy0 * cy1 * haversin(x1 - x0))),\n k = sin(d);\n var interpolate = d ? function (t) {\n var B = sin(t *= d) / k,\n A = sin(d - t) / k,\n x = A * kx0 + B * kx1,\n y = A * ky0 + B * ky1,\n z = A * sy0 + B * sy1;\n return [atan2(y, x) * degrees, atan2(z, sqrt(x * x + y * y)) * degrees];\n } : function () {\n return [x0 * degrees, y0 * degrees];\n };\n interpolate.distance = d;\n return interpolate;\n}","/**\r\n * A module for the mini-map control.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { Rectangle } from \"../../core/elements/Rectangle\";\nimport { List } from \"../../core/utils/List\";\nimport { MutableValueDisposer, MultiDisposer } from \"../../core/utils/Disposer\";\nimport { registry } from \"../../core/Registry\";\nimport { color } from \"../../core/utils/Color\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $type from \"../../core/utils/Type\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a \"bird's eye\" view of the whole map.\r\n *\r\n * This control creates a mini-map with the whole of the map, highlighting\r\n * the area which is in the current viewport of the map map.\r\n *\r\n * @see {@link ISmallMapEvents} for a list of available events\r\n * @see {@link ISmallMapAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar SmallMap =\n/** @class */\nfunction (_super) {\n __extends(SmallMap, _super);\n /**\r\n * Constructor\r\n */\n\n\n function SmallMap() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * A target map.\r\n */\n\n\n _this._chart = new MutableValueDisposer();\n _this.className = \"SmallMap\"; // Set defaults\n\n _this.align = \"left\";\n _this.valign = \"bottom\";\n _this.percentHeight = 20;\n _this.percentWidth = 20;\n\n _this.margin(5, 5, 5, 5);\n\n var interfaceColors = new InterfaceColorSet(); // Set background defailts\n\n _this.background.fillOpacity = 0.9;\n _this.background.fill = interfaceColors.getFor(\"background\"); // Set up events\n\n _this.events.on(\"hit\", _this.moveToPosition, _this, false);\n\n _this.events.on(\"maxsizechanged\", _this.updateMapSize, _this, false); // Create a container\n\n\n _this.seriesContainer = _this.createChild(Container);\n _this.seriesContainer.shouldClone = false; // Create an outline rectangle\n\n var rectangle = _this.createChild(Rectangle);\n\n rectangle.shouldClone = false;\n rectangle.stroke = interfaceColors.getFor(\"alternativeBackground\");\n rectangle.strokeWidth = 1;\n rectangle.strokeOpacity = 0.5;\n rectangle.fill = color(); //\"none\";\n\n rectangle.verticalCenter = \"middle\";\n rectangle.horizontalCenter = \"middle\";\n rectangle.isMeasured = false;\n rectangle.visible = false;\n _this.rectangle = rectangle;\n\n _this._disposers.push(_this._chart); // Apply theme\n\n\n _this.applyTheme();\n\n return _this;\n }\n\n Object.defineProperty(SmallMap.prototype, \"series\", {\n /**\r\n * A list of map series used to draw the mini-map.\r\n *\r\n * @readonly\r\n * @return Series\r\n */\n get: function get() {\n if (!this._series) {\n this._series = new List();\n\n this._series.events.on(\"inserted\", this.handleSeriesAdded, this, false);\n\n this._series.events.on(\"removed\", this.handleSeriesRemoved, this, false);\n }\n\n return this._series;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Decorates a new series when they are pushed into a `series` list.\r\n *\r\n * @param event Event\r\n */\n\n SmallMap.prototype.handleSeriesAdded = function (event) {\n var series = event.newValue;\n\n if (this.chart.series.contains(series)) {\n var newSeries = series.clone();\n\n this._series.removeValue(series);\n\n this._series.push(newSeries);\n\n series = newSeries;\n this.chart.dataUsers.push(newSeries);\n }\n\n series.chart = this.chart;\n series.parent = this.seriesContainer;\n series.interactionsEnabled = false;\n series.events.on(\"inited\", this.updateMapSize, this, false);\n series.hidden = false;\n };\n /**\r\n * Cleans up after series are removed from Scrollbar.\r\n *\r\n * @param event Event\r\n */\n\n\n SmallMap.prototype.handleSeriesRemoved = function (event) {\n //let sourceSeries: MapSeries = event.oldValue;\n this.invalidate();\n };\n /**\r\n * Moves main map pan position after click on the small map.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n SmallMap.prototype.moveToPosition = function (event) {\n var rectPoint = $utils.spritePointToSprite(event.spritePoint, this, this.seriesContainer);\n var geoPoint = this.chart.seriesPointToGeo(rectPoint);\n this.chart.zoomToGeoPoint(geoPoint, this.chart.zoomLevel, true);\n };\n\n Object.defineProperty(SmallMap.prototype, \"chart\", {\n /**\r\n * @return Chart/map\r\n */\n get: function get() {\n return this._chart.get();\n },\n\n /**\r\n * A chart/map that this control is meant for.\r\n *\r\n * @param chart Chart/map\r\n */\n set: function set(chart) {\n if (this.chart != chart) {\n this._chart.set(chart, new MultiDisposer([//chart.events.on(\"zoomlevelchanged\", this.updateRectangle, this, false),\n chart.events.on(\"mappositionchanged\", this.updateRectangle, this, false), chart.events.on(\"scaleratiochanged\", this.updateMapSize, this, false)]));\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates the viewport recangle as per current map zoom/pan position.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n SmallMap.prototype.updateRectangle = function () {\n var chart = this.chart;\n var zoomLevel = chart.zoomLevel;\n var rectangle = this.rectangle;\n rectangle.width = this.pixelWidth / zoomLevel;\n rectangle.height = this.pixelHeight / zoomLevel;\n var scale = Math.min(this.percentWidth, this.percentHeight) / 100;\n var seriesContainer = chart.seriesContainer;\n rectangle.x = Math.ceil(-seriesContainer.pixelX * scale / zoomLevel) + this.seriesContainer.pixelX;\n rectangle.y = Math.ceil(-seriesContainer.pixelY * scale / zoomLevel) + this.seriesContainer.pixelY;\n rectangle.validate();\n };\n /**\r\n * Update map size so that internal elements can redraw themselves after\r\n * the size of the small map changes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n SmallMap.prototype.updateMapSize = function () {\n if (this.chart) {\n var scale = this.chart.scaleRatio * Math.min(this.percentWidth, this.percentHeight) / 100;\n this.seriesContainer.scale = scale;\n var bbox = {\n width: 0,\n height: 0,\n x: 0,\n y: 0\n };\n\n try {\n // Add exception catching to tame FF\n bbox = this.seriesContainer.group.node.getBBox();\n } catch (err) {}\n\n if (bbox.width > 0) {\n this.rectangle.visible = true;\n }\n\n this.seriesContainer.x = this.pixelWidth / 2 - bbox.x * scale - bbox.width / 2 * scale;\n this.seriesContainer.y = this.pixelHeight / 2 - bbox.y * scale - bbox.height / 2 * scale;\n this.updateRectangle();\n this.afterDraw();\n }\n };\n /**\r\n * Update elements after drawing the small map.\r\n */\n\n\n SmallMap.prototype.afterDraw = function () {\n _super.prototype.afterDraw.call(this); //this.seriesContainer.moveTo({ x: this.pixelWidth / 2, y: this.pixelHeight / 2 });\n\n\n this.rectangle.maskRectangle = {\n x: -1,\n y: -1,\n width: Math.ceil(this.pixelWidth + 2),\n height: Math.ceil(this.pixelHeight + 2)\n };\n };\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n\n SmallMap.prototype.processConfig = function (config) {\n if (config) {\n // Set up series\n if ($type.hasValue(config.series) && $type.isArray(config.series)) {\n for (var i = 0, len = config.series.length; i < len; i++) {\n var series = config.series[i];\n\n if ($type.hasValue(series) && $type.isString(series) && this.map.hasKey(series)) {\n config.series[i] = this.map.getKey(series);\n }\n }\n }\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n\n return SmallMap;\n}(Container);\n\nexport { SmallMap };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"SmallMap\"] = SmallMap;","/**\r\n * A collection of GeoJSON format-related utility functions.\r\n */\nimport * as $math from \"../../core/utils/Math\";\nimport * as $array from \"../../core/utils/Array\";\n/**\r\n * Normalizes a geo-point.\r\n *\r\n * @ignore Exclude from docs\r\n * @param geoPoint Source geo-point\r\n * @return Normalized geo-point\r\n */\n\nexport function normalizePoint(geoPoint) {\n var longitude = wrapAngleTo180(geoPoint.longitude);\n var latitude = Math.asin(Math.sin(geoPoint.latitude * $math.RADIANS)) * $math.DEGREES;\n var latitude180 = wrapAngleTo180(geoPoint.latitude);\n\n if (Math.abs(latitude180) > 90) {\n longitude = wrapAngleTo180(longitude + 180);\n }\n\n geoPoint.longitude = longitude;\n geoPoint.latitude = latitude;\n return geoPoint;\n}\n/**\r\n * Normalizes all points of a geo-line.\r\n *\r\n * @ignore Exclude from docs\r\n * @param multiline Source geo-line\r\n * @return Normalized geo-line\r\n */\n\nexport function normalizeMultiline(multiline) {\n $array.each(multiline, function (segment) {\n $array.each(segment, function (point) {\n normalizePoint(point);\n });\n });\n return multiline;\n}\n/**\r\n * [wrapAngleTo180 description]\r\n *\r\n * @todo Description\r\n * @ignore Exclude from docs\r\n * @param angle Angle\r\n * @return Angle\r\n */\n\nexport function wrapAngleTo180(angle) {\n angle = angle % 360;\n\n if (angle > 180) {\n angle -= 360;\n }\n\n if (angle < -180) {\n angle += 360;\n }\n\n return angle;\n}\n/**\r\n * Converts a geo point to a regular point object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param geoPoint Source geo point\r\n * @return Point\r\n */\n\nexport function geoToPoint(geoPoint) {\n return {\n x: geoPoint.longitude,\n y: geoPoint.latitude\n };\n}","/**\r\n * Map line module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Draws a line on the map.\r\n *\r\n * @see {@link IMapLineObjectEvents} for a list of available events\r\n * @see {@link IMapLineObjectAdapters} for a list of available Adapters\r\n */\n\nvar MapLineObject =\n/** @class */\nfunction (_super) {\n __extends(MapLineObject, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapLineObject() {\n var _this = _super.call(this) || this;\n\n _this.adjustRotation = true;\n _this.className = \"MapLineObject\";\n _this.isMeasured = false;\n _this.layout = \"none\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * (Re)validates element's position.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapLineObject.prototype.validatePosition = function () {\n var mapLine = this.mapLine;\n\n if (mapLine) {\n var point = mapLine.positionToPoint(this.position);\n this.x = point.x;\n this.y = point.y;\n\n if (this.adjustRotation) {\n this.rotation = point.angle;\n }\n\n var dataItem = this.mapLine.dataItem;\n\n if (dataItem) {\n var series = this.mapLine.dataItem.component;\n this.scale = 1 / series.scale;\n } // hide out of bounds\n\n\n if (mapLine.shortestDistance) {\n var projection = this.mapLine.series.chart.projection;\n var geoPoint = projection.positionToGeoPoint(mapLine.multiGeoLine, this.position);\n var visible = projection.d3Path({\n type: 'Point',\n coordinates: [geoPoint.longitude, geoPoint.latitude]\n });\n\n if (!visible) {\n this.__disabled = true;\n } else {\n this.__disabled = false;\n }\n }\n }\n\n _super.prototype.validatePosition.call(this);\n };\n\n Object.defineProperty(MapLineObject.prototype, \"position\", {\n /**\r\n * @return Position within the line\r\n */\n get: function get() {\n return this.getPropertyValue(\"position\");\n },\n\n /**\r\n * Sets object's relative position (0-1) within the line.\r\n *\r\n * `0` will place the object at the beginning of the line. `1` - at the end.\r\n *\r\n * Any intermediate number will place the object at some point within the\r\n * line.\r\n *\r\n * @param value Position within the line (0-1)\r\n */\n set: function set(value) {\n this.setPropertyValue(\"position\", value, false, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLineObject.prototype, \"adjustRotation\", {\n /**\r\n * @return Auto-rotate\r\n */\n get: function get() {\n return this.getPropertyValue(\"adjustRotation\");\n },\n\n /**\r\n * If set to `true`, the object will be automatically rotated to face the\r\n * direction of the line at the specific position.\r\n *\r\n * This allows creating images that has its \"front\" always facing the logical\r\n * direction of the line.\r\n *\r\n * @default false\r\n * @param value Auto-rotate\r\n */\n set: function set(value) {\n this.setPropertyValue(\"adjustRotation\", value, false, true);\n },\n enumerable: true,\n configurable: true\n });\n return MapLineObject;\n}(Container);\n\nexport { MapLineObject };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapLineObject\"] = MapLineObject;","/**\r\n * Map image series module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapSeries, MapSeriesDataItem } from \"./MapSeries\";\nimport { MapImage } from \"./MapImage\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { registry } from \"../../core/Registry\";\nimport * as $array from \"../../core/utils/Array\";\nimport * as $mapUtils from \"./MapUtils\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $type from \"../../core/utils/Type\";\nimport { Disposer } from \"../../core/utils/Disposer\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapImageSeries]]\r\n * @see {@link DataItem}\r\n */\n\nvar MapImageSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapImageSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapImageSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapImageSeriesDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapImageSeriesDataItem.prototype.getFeature = function () {\n return {\n \"type\": \"Feature\",\n geometry: {\n type: \"Point\",\n coordinates: this.point\n }\n };\n };\n\n Object.defineProperty(MapImageSeriesDataItem.prototype, \"mapImage\", {\n /**\r\n * A [[MapImage]] element related to this data item.\r\n *\r\n * @return Element\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._mapImage) {\n var mapImage_1 = this.component.mapImages.create();\n this.addSprite(mapImage_1);\n this._mapImage = mapImage_1;\n\n this._disposers.push(mapImage_1);\n\n this._disposers.push(new Disposer(function () {\n if (_this.component) {\n _this.component.mapImages.removeValue(mapImage_1);\n }\n }));\n\n this.mapObject = mapImage_1;\n }\n\n return this._mapImage;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapImageSeriesDataItem.prototype, \"point\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return this._point;\n },\n\n /**\r\n * [point description]\r\n *\r\n * @todo Description\r\n * @param point [description]\r\n */\n set: function set(point) {\n this._point = point;\n this._geoPoint = $mapUtils.pointToGeo(point);\n this.updateExtremes();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapImageSeriesDataItem.prototype, \"multiPoint\", {\n /**\r\n * @return [description]\r\n */\n get: function get() {\n return [this._point];\n },\n\n /**\r\n * [point description]\r\n *\r\n * @todo Description\r\n * @param point [description]\r\n */\n set: function set(multiPoint) {\n this._point = multiPoint[0];\n this._geoPoint = $mapUtils.pointToGeo(this._point);\n this.updateExtremes();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapImageSeriesDataItem.prototype, \"geoPoint\", {\n /**\r\n * @return Image coordinates\r\n */\n get: function get() {\n return this._geoPoint;\n },\n\n /**\r\n * Geographical coordinates (lat/long) image is placed at.\r\n *\r\n * @param geoPoint Image coordinates\r\n */\n set: function set(geoPoint) {\n this._geoPoint = geoPoint;\n this.point = [geoPoint.longitude, geoPoint.latitude];\n },\n enumerable: true,\n configurable: true\n });\n return MapImageSeriesDataItem;\n}(MapSeriesDataItem);\n\nexport { MapImageSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A series of map image (marker) elements.\r\n *\r\n * @see {@link IMapImageSeriesEvents} for a list of available Events\r\n * @see {@link IMapImageSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar MapImageSeries =\n/** @class */\nfunction (_super) {\n __extends(MapImageSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapImageSeries() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"MapImageSeries\"; // Set data fields\n\n _this.dataFields.multiPoint = \"multiPoint\";\n _this.dataFields.point = \"point\";\n _this.dataFields.geoPoint = \"geoPoint\";\n _this.dataFields.multiGeoPoint = \"multiGeoPoint\";\n _this.ignoreBounds = true; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n MapImageSeries.prototype.createDataItem = function () {\n return new MapImageSeriesDataItem();\n };\n /**\r\n * (Re)validates the data of the sries, effectively forcing it to redraw\r\n * all of its elements.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapImageSeries.prototype.validateData = function () {\n var _this = this;\n\n if (this.data.length > 0 && this._parseDataFrom == 0) {\n this.mapImages.clear();\n } // process geoJSON and created map objects\n\n\n if (this.useGeodata) {\n if (this.useGeodata || this.geodata) {\n var geoJSON = this.chart.geodata;\n var features = void 0;\n\n if (geoJSON.type == \"FeatureCollection\") {\n features = geoJSON.features;\n } else if (geoJSON.type == \"Feature\") {\n features = [geoJSON];\n } else if ([\"Point\", \"LineString\", \"Polygon\", \"MultiPoint\", \"MultiLineString\", \"MultiPolygon\"].indexOf(geoJSON.type) != -1) {\n features = [{\n geometry: geoJSON\n }];\n } else {\n console.log(\"nothing found in geoJSON\");\n }\n\n if (features) {\n var _loop_1 = function _loop_1(i, len) {\n var feature = features[i];\n var geometry = feature.geometry;\n\n if (geometry) {\n var type = geometry.type;\n var id_1 = feature.id;\n\n if (type == \"Point\" || type == \"MultiPoint\") {\n // todo: we don't support multipoints at the moment actually\n if (!this_1.checkInclude(this_1.include, this_1.exclude, id_1)) {\n return \"continue\";\n }\n\n var coordinates = geometry.coordinates; // make the same as MultiPoint\n\n if (type == \"Point\") {\n coordinates = [coordinates];\n }\n\n var dataObject = $array.find(this_1.data, function (value, i) {\n return value.id == id_1;\n });\n\n if (!dataObject) {\n dataObject = {\n multiPoint: coordinates,\n id: id_1,\n madeFromGeoData: true\n };\n this_1.data.push(dataObject);\n } else {\n if (!dataObject.multiPoint) {\n dataObject.multiPoint = coordinates;\n }\n } // copy properties data to datacontext\n\n\n $utils.softCopyProperties(feature.properties, dataObject);\n }\n }\n };\n\n var this_1 = this;\n\n for (var i = 0, len = features.length; i < len; i++) {\n _loop_1(i, len);\n }\n }\n }\n }\n\n _super.prototype.validateData.call(this); // important! this should go after super.validateData\n // if data is parsed in chunks, images list is corrupted, fix it here\n\n\n $iter.each(this.dataItems.iterator(), function (dataItem) {\n var mapImage = dataItem.mapImage;\n\n if (!mapImage.isDisposed()) {\n _this.mapImages.moveValue(mapImage);\n\n if ($type.isNumber(mapImage.latitude) && $type.isNumber(mapImage.latitude)) {\n dataItem.geoPoint = {\n latitude: mapImage.latitude,\n longitude: mapImage.longitude\n };\n }\n }\n });\n };\n\n Object.defineProperty(MapImageSeries.prototype, \"mapImages\", {\n /**\r\n * A list of map images in the series.\r\n *\r\n * @return Map images\r\n */\n get: function get() {\n if (!this._mapImages) {\n var template = new MapImage();\n var mapImages = new ListTemplate(template);\n\n this._disposers.push(new ListDisposer(mapImages));\n\n this._disposers.push(mapImages.template);\n\n mapImages.template.focusable = true;\n mapImages.events.on(\"inserted\", this.handleObjectAdded, this, false);\n this._mapImages = mapImages;\n this._mapObjects = mapImages;\n }\n\n return this._mapImages;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * (Re)validates data element, effectively triggering its redrawal.\r\n *\r\n * @ignore Exclude from docs\r\n * @param dataItem Data item\r\n */\n\n MapImageSeries.prototype.validateDataElement = function (dataItem) {\n _super.prototype.validateDataElement.call(this, dataItem);\n\n dataItem.mapImage.invalidate();\n };\n /**\r\n * (Re)validates the series\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapImageSeries.prototype.validate = function () {\n _super.prototype.validate.call(this);\n\n $iter.each(this.mapImages.iterator(), function (mapImage) {\n mapImage.validatePosition();\n });\n };\n /**\r\n * Copies all properties from another instance of [[Series]].\r\n *\r\n * @param source Source series\r\n */\n\n\n MapImageSeries.prototype.copyFrom = function (source) {\n this.mapImages.template.copyFrom(source.mapImages.template);\n\n _super.prototype.copyFrom.call(this, source);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapImageSeries.prototype.getFeatures = function () {\n var _this = this;\n\n var features = [];\n this.dataItems.each(function (dataItem) {\n var feature = dataItem.getFeature();\n\n if (feature) {\n features.push(feature);\n }\n });\n this.mapImages.each(function (mapImage) {\n if (_this.dataItems.indexOf(mapImage._dataItem) == -1) {\n var feature = mapImage.getFeature();\n\n if (feature) {\n features.push(feature);\n }\n }\n });\n return features;\n };\n /**\r\n * returns MapImage by id\r\n * @param image id\r\n * @return {MapImage}\r\n */\n\n\n MapImageSeries.prototype.getImageById = function (id) {\n return $iter.find(this.mapImages.iterator(), function (mapImage) {\n var dataContext = mapImage.dataItem.dataContext;\n\n if (mapImage.id == id || dataContext && dataContext.id == id) {\n return true;\n }\n });\n };\n\n return MapImageSeries;\n}(MapSeries);\n\nexport { MapImageSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapImageSeries\"] = MapImageSeries;\nregistry.registeredClasses[\"MapImageSeriesDataItem\"] = MapImageSeriesDataItem;","/**\r\n * Map line module\r\n */\nimport { __extends, __values } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapObject } from \"./MapObject\";\nimport { MapLineObject } from \"./MapLineObject\";\nimport { MapImage } from \"./MapImage\";\nimport { MapImageSeries } from \"./MapImageSeries\";\nimport { Triangle } from \"../../core/elements/Triangle\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { Polyline } from \"../../core/elements/Polyline\";\nimport { registry } from \"../../core/Registry\";\nimport { color } from \"../../core/utils/Color\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { percent, Percent } from \"../../core/utils/Percent\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $geo from \"./Geo\";\nimport * as $mapUtils from \"./MapUtils\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a line on the map.\r\n *\r\n * @see {@link IMapLineEvents} for a list of available events\r\n * @see {@link IMapLineAdapters} for a list of available Adapters\r\n */\n\nvar MapLine =\n/** @class */\nfunction (_super) {\n __extends(MapLine, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapLine() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * A list of event disposers for images.\r\n */\n\n\n _this._imageListeners = {};\n _this.className = \"MapLine\";\n\n _this.createLine();\n\n _this.line.stroke = color();\n _this.line.parent = _this;\n _this.strokeOpacity = 1;\n\n _this.setPropertyValue(\"precision\", 0.1);\n\n var interfaceColors = new InterfaceColorSet();\n _this.stroke = interfaceColors.getFor(\"grid\");\n _this.shortestDistance = true; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapLine.prototype.createLine = function () {\n this.line = new Polyline();\n };\n /**\r\n * Converts a position within the line (0-1) to a physical point\r\n * coordinates.\r\n *\r\n * 0 indicates start of the line, 0.5 - middle, while 1 indicates the end.\r\n *\r\n * @param position Position (0-1)\r\n * @return Coordinates\r\n */\n\n\n MapLine.prototype.positionToPoint = function (position) {\n if (this.shortestDistance) {\n return this.series.chart.projection.positionToPoint(this.multiGeoLine, position);\n } else {\n if (this.line) {\n return this.line.positionToPoint(position);\n }\n }\n\n return {\n x: 0,\n y: 0,\n angle: 0\n };\n };\n\n Object.defineProperty(MapLine.prototype, \"multiGeoLine\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n var multiGeoLine = this.getPropertyValue(\"multiGeoLine\");\n\n if (!multiGeoLine && this.dataItem && this.dataItem.multiGeoLine) {\n multiGeoLine = this.dataItem.multiGeoLine;\n }\n\n return multiGeoLine;\n },\n\n /**\r\n * A collection of X/Y coordinates for a multi-segment line. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * // Segment 1\r\n * [\r\n * { longitude: 3.121, latitude: 0.58 },\r\n * { longitude: -5.199, latitude: 21.223 }\r\n * ],\r\n *\r\n * // Segment 2\r\n * [\r\n * { longitude: -5.199, latitude: 21.223 },\r\n * { longitude: -12.9, latitude: 25.85 }\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @see {@link https://tools.ietf.org/html/rfc7946#section-3.1.5} GeoJSON MultiLineString reference\r\n * @param multiGeoLine Coordinates\r\n */\n set: function set(multiGeoLine) {\n if (multiGeoLine && multiGeoLine.length > 0) {\n this.setPropertyValue(\"multiGeoLine\", $geo.normalizeMultiline(multiGeoLine), true);\n var multiLine = $mapUtils.multiGeoLineToMultiLine(multiGeoLine);\n this.setPropertyValue(\"multiLine\", multiLine);\n this.updateExtremes();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLine.prototype, \"multiLine\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n var multiLine = this.getPropertyValue(\"multiLine\");\n\n if (!multiLine && this.dataItem && this.dataItem.multiLine) {\n multiLine = this.dataItem.multiLine;\n }\n\n return multiLine;\n },\n\n /**\r\n * A collection of X/Y coordinates for a multi-segment line. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * // Segment 1\r\n * [\r\n * [ 100, 150 ],\r\n * [ 120, 200 ]\r\n * ],\r\n *\r\n * // Segment 2\r\n * [\r\n * [ 120, 200 ],\r\n * [ 150, 100 ]\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @param multiLine Coordinates\r\n */\n set: function set(multiLine) {\n this.setPropertyValue(\"multiLine\", multiLine);\n this.multiGeoLine = $mapUtils.multiLineToGeo(multiLine);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLine.prototype, \"imagesToConnect\", {\n /**\r\n * @return {MapImages[]}\r\n */\n get: function get() {\n return this.getPropertyValue(\"imagesToConnect\");\n },\n\n /**\r\n * Instead of setting longitudes/latitudes you can set an array of images\r\n * which will be connected by the line.\r\n *\r\n * Parameter is an array that can hold string `id`'s to of the images, or\r\n * references to actual [[MapImage]] objects.\r\n *\r\n * @param images Images\r\n */\n set: function set(images) {\n var _this = this;\n\n this.setPropertyValue(\"imagesToConnect\", images, true);\n this.handleImagesToConnect();\n\n if (this.series) {\n var chart = this.series.chart;\n\n if (chart) {\n chart.series.each(function (series) {\n if (series instanceof MapImageSeries) {\n if (!series.isReady()) {\n _this._disposers.push(series.events.on(\"ready\", _this.handleImagesToConnect, _this, false));\n }\n }\n });\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n\n MapLine.prototype.handleImagesToConnect = function () {\n var e_1, _a;\n\n var _this = this;\n\n if (this.imagesToConnect) {\n var segment = [];\n var multiGeoLine = [segment];\n\n var _loop_1 = function _loop_1(image) {\n if ($type.isString(image)) {\n var chart = this_1.series.chart;\n\n if (chart) {\n chart.series.each(function (series) {\n if (series instanceof MapImageSeries) {\n var img = series.getImageById(image);\n\n if (img) {\n image = img;\n }\n }\n });\n }\n }\n\n if (image instanceof MapImage) {\n segment.push({\n longitude: image.longitude,\n latitude: image.latitude\n });\n\n if (!this_1._imageListeners[image.uid]) {\n var disposer = image.events.on(\"propertychanged\", function (event) {\n if (event.property == \"longitude\" || event.property == \"latitude\") {\n _this.handleImagesToConnect();\n\n _this.invalidate();\n }\n }, this_1, false);\n this_1._imageListeners[image.uid] = disposer;\n\n this_1._disposers.push(disposer);\n }\n }\n };\n\n var this_1 = this;\n\n try {\n for (var _b = __values(this.imagesToConnect), _c = _b.next(); !_c.done; _c = _b.next()) {\n var image = _c.value;\n\n _loop_1(image);\n }\n } catch (e_1_1) {\n e_1 = {\n error: e_1_1\n };\n } finally {\n try {\n if (_c && !_c.done && (_a = _b.return)) _a.call(_b);\n } finally {\n if (e_1) throw e_1.error;\n }\n }\n\n this.multiGeoLine = multiGeoLine;\n }\n };\n /**\r\n * (Re)validates the line, effectively forcing it to redraw.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapLine.prototype.validate = function () {\n var chart = this.series.chart;\n\n if (this.multiLine) {\n if (!this.shortestDistance) {\n var convertedPoints = [];\n\n for (var i = 0, len = this.multiLine.length; i < len; i++) {\n var segment = this.multiLine[i];\n var convertedSegmentPoints = [];\n\n for (var s = 0, slen = segment.length; s < slen; s++) {\n var geoPoint = segment[s];\n var point = this.series.chart.projection.convert({\n longitude: geoPoint[0],\n latitude: geoPoint[1]\n });\n convertedSegmentPoints.push(point);\n }\n\n convertedPoints.push(convertedSegmentPoints);\n }\n\n this.line.segments = convertedPoints;\n } else {\n chart.projection.d3Projection.precision(this.precision);\n this.line.path = chart.projection.d3Path(this.getFeature());\n }\n\n if (this._arrow) {\n this._arrow.validatePosition();\n }\n\n $iter.each(this.lineObjects.iterator(), function (x) {\n x.validatePosition();\n });\n this.handleGlobalScale();\n } else if (this.imagesToConnect) {\n this.handleImagesToConnect();\n }\n\n _super.prototype.validate.call(this);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapLine.prototype.getFeature = function () {\n if (this.multiLine && this.multiLine.length > 0 && this.multiLine[0] && this.multiLine[0].length > 0) {\n return {\n \"type\": \"Feature\",\n geometry: {\n type: \"MultiLineString\",\n coordinates: this.multiLine\n }\n };\n }\n };\n /**\r\n * @ignore Exclude from docs\r\n */\n\n\n MapLine.prototype.measureElement = function () {// Overriding, just to avoid extra measure\n };\n\n Object.defineProperty(MapLine.prototype, \"shortestDistance\", {\n /**\r\n * @return Real path?\r\n */\n get: function get() {\n return this.getPropertyValue(\"shortestDistance\");\n },\n\n /**\r\n * The line should take the shortest path over the globe.\r\n *\r\n * Enabling this will make the line look differently in different\r\n * projections. Only `MapLine` supports this setting, `MapArc` and\r\n * `MapSplice` don't.\r\n *\r\n * @default true\r\n * @param value Real path?\r\n */\n set: function set(value) {\n this.setPropertyValue(\"shortestDistance\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLine.prototype, \"lineObjects\", {\n /**\r\n * List of separate line objects the line consists of.\r\n *\r\n * @readonly\r\n * @return List of line objects\r\n */\n get: function get() {\n if (!this._lineObjects) {\n this._lineObjects = new ListTemplate(new MapLineObject());\n\n this._lineObjects.events.on(\"inserted\", this.handleLineObjectAdded, this, false);\n\n this._disposers.push(new ListDisposer(this._lineObjects));\n\n this._disposers.push(this._lineObjects.template);\n }\n\n return this._lineObjects;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Decorate a [[LineObject]] when it is added to the line.\r\n *\r\n * @param event Event\r\n */\n\n MapLine.prototype.handleLineObjectAdded = function (event) {\n var mapLineObject = event.newValue;\n mapLineObject.mapLine = this;\n mapLineObject.shouldClone = false;\n mapLineObject.parent = this;\n };\n\n Object.defineProperty(MapLine.prototype, \"arrow\", {\n /**\r\n * @return Arrow element\r\n */\n get: function get() {\n if (!this._arrow) {\n var arrow = this.createChild(MapLineObject);\n arrow.shouldClone = false;\n arrow.width = 8;\n arrow.height = 10;\n arrow.mapLine = this;\n arrow.position = 0.5;\n var triangle = arrow.createChild(Triangle); //triangle.shouldClone = false;\n\n triangle.fillOpacity = 1;\n triangle.width = percent(100);\n triangle.height = percent(100);\n triangle.rotation = 90;\n triangle.horizontalCenter = \"middle\";\n triangle.verticalCenter = \"middle\";\n this._arrow = arrow;\n }\n\n return this._arrow;\n },\n\n /**\r\n * A [[MapLineObject]] to use as an option arrowhead on the line.\r\n *\r\n * Just accessing this property will create a default arrowhead on the line\r\n * automatically.\r\n *\r\n * @param arrow Arrow element\r\n */\n set: function set(arrow) {\n this._arrow = arrow;\n arrow.mapLine = this;\n arrow.parent = this;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Copies line properties and other attributes, like arrow, from another\r\n * instance of [[MapLine]].\r\n *\r\n * @param source Source map line\r\n */\n\n MapLine.prototype.copyFrom = function (source) {\n _super.prototype.copyFrom.call(this, source);\n\n this.line.copyFrom(source.line);\n this.lineObjects.copyFrom(source.lineObjects);\n\n if (source._arrow) {\n this.arrow = source.arrow.clone();\n }\n };\n\n Object.defineProperty(MapLine.prototype, \"latitude\", {\n /**\r\n * Latitude of the line center.\r\n *\r\n * @readonly\r\n * @return Latitude\r\n */\n get: function get() {\n return this.north + (this.south - this.north) / 2;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLine.prototype, \"longitude\", {\n /**\r\n * Longitude of the line center.\r\n *\r\n * @readonly\r\n * @return Latitude\r\n */\n get: function get() {\n return this.east + (this.west - this.east) / 2;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * X coordinate for the slice tooltip.\r\n *\r\n * @ignore\r\n * @return X\r\n */\n\n MapLine.prototype.getTooltipX = function () {\n var x = this.getPropertyValue(\"tooltipX\");\n\n if (!(x instanceof Percent)) {\n x = percent(50);\n }\n\n if (x instanceof Percent) {\n return this.positionToPoint(x.value).x;\n } else {\n return 0;\n }\n };\n /**\r\n * Y coordinate for the slice tooltip.\r\n *\r\n * @ignore\r\n * @return Y\r\n */\n\n\n MapLine.prototype.getTooltipY = function () {\n var y = this.getPropertyValue(\"tooltipY\");\n\n if (!(y instanceof Percent)) {\n y = percent(50);\n }\n\n if (y instanceof Percent) {\n return this.positionToPoint(y.value).y;\n } else {\n return 0;\n }\n };\n\n Object.defineProperty(MapLine.prototype, \"precision\", {\n /**\r\n * @return Precision\r\n */\n get: function get() {\n return this.getPropertyValue(\"precision\");\n },\n\n /**\r\n * When line is plotted, if its `shortestDistance` is set to `true` it is\r\n * bent according to the used projection, to depict the shortest distance how\r\n * it would go on the actual land.\r\n *\r\n * `precision` introduces a setting which can control when such bending\r\n * occurs.\r\n *\r\n * If the distance (in degrees) between line start and end points\r\n * is less than `precision`, no bending will take place and the line will be\r\n * straight.\r\n *\r\n * Set to large number (e.g. 10000) for perfectly straight line.\r\n *\r\n * @since 4.9.1\r\n * @default 0.1\r\n * @param value Precision\r\n */\n set: function set(value) {\n this.setPropertyValue(\"precision\", value, true);\n },\n enumerable: true,\n configurable: true\n });\n return MapLine;\n}(MapObject);\n\nexport { MapLine };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapLine\"] = MapLine;","/**\r\n * Map line series module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapSeries, MapSeriesDataItem } from \"./MapSeries\";\nimport { MapLine } from \"./MapLine\";\nimport { ListTemplate, ListDisposer } from \"../../core/utils/List\";\nimport { registry } from \"../../core/Registry\";\nimport * as $mapUtils from \"./MapUtils\";\nimport * as $array from \"../../core/utils/Array\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport { Disposer } from \"../../core/utils/Disposer\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapLineSeries]]\r\n * @see {@link DataItem}\r\n */\n\nvar MapLineSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapLineSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapLineSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapLineSeriesDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n MapLineSeriesDataItem.prototype.getFeature = function () {\n if (this.multiLine && this.multiLine.length > 0) {\n return {\n \"type\": \"Feature\",\n geometry: {\n type: \"MultiLineString\",\n coordinates: this.multiLine\n }\n };\n }\n };\n\n Object.defineProperty(MapLineSeriesDataItem.prototype, \"mapLine\", {\n /**\r\n * A [[MapLine]] element related to this data item.\r\n *\r\n * @readonly\r\n * @return Element\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._mapLine) {\n var mapLine_1 = this.component.mapLines.create();\n this._mapLine = mapLine_1;\n this.addSprite(mapLine_1);\n\n this._disposers.push(mapLine_1);\n\n this._disposers.push(new Disposer(function () {\n if (_this.component) {\n _this.component.mapLines.removeValue(mapLine_1);\n }\n }));\n\n this.mapObject = mapLine_1;\n }\n\n return this._mapLine;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLineSeriesDataItem.prototype, \"line\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._line;\n },\n\n /**\r\n * A collection of X/Y coordinates for a single-segment line. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * [ 100, 150 ],\r\n * [ 120, 200 ]\r\n * ]\r\n * ```\r\n *\r\n * @param line Coordinates\r\n */\n set: function set(line) {\n this._line = line;\n this.multiLine = [line];\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLineSeriesDataItem.prototype, \"multiLine\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._multiLine;\n },\n\n /**\r\n * A collection of X/Y coordinates for a multi-segment line. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * // Segment 1\r\n * [\r\n * [ 100, 150 ],\r\n * [ 120, 200 ]\r\n * ],\r\n *\r\n * // Segment 2\r\n * [\r\n * [ 120, 200 ],\r\n * [ 150, 100 ]\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @param multiLine Coordinates\r\n */\n set: function set(multiLine) {\n this._multiLine = multiLine;\n this._multiGeoLine = $mapUtils.multiLineToGeo(multiLine);\n this.updateExtremes();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLineSeriesDataItem.prototype, \"geoLine\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._geoLine;\n },\n\n /**\r\n * A collection of lat/long coordinates for a single-segment line. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * { longitude: 3.121, latitude: 0.58 },\r\n * { longitude: -5.199, latitude: 21.223 }\r\n * ]\r\n * ```\r\n *\r\n * @see {@link https://tools.ietf.org/html/rfc7946#section-3.1.4} GeoJSON LineString reference\r\n * @param geoLine Coordinates\r\n */\n set: function set(geoLine) {\n this._geoLine = geoLine;\n this.multiLine = $mapUtils.multiGeoLineToMultiLine([geoLine]);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapLineSeriesDataItem.prototype, \"multiGeoLine\", {\n /**\r\n * @return Coordinates\r\n */\n get: function get() {\n return this._multiGeoLine;\n },\n\n /**\r\n * A collection of X/Y coordinates for a multi-segment line. E.g.:\r\n *\r\n * ```JSON\r\n * [\r\n * // Segment 1\r\n * [\r\n * { longitude: 3.121, latitude: 0.58 },\r\n * { longitude: -5.199, latitude: 21.223 }\r\n * ],\r\n *\r\n * // Segment 2\r\n * [\r\n * { longitude: -5.199, latitude: 21.223 },\r\n * { longitude: -12.9, latitude: 25.85 }\r\n * ]\r\n * ]\r\n * ```\r\n *\r\n * @see {@link https://tools.ietf.org/html/rfc7946#section-3.1.5} GeoJSON MultiLineString reference\r\n * @param multiGeoLine Coordinates\r\n */\n set: function set(multiGeoLine) {\n this._multiGeoLine = multiGeoLine;\n this.multiLine = $mapUtils.multiGeoLineToMultiLine(multiGeoLine);\n },\n enumerable: true,\n configurable: true\n });\n return MapLineSeriesDataItem;\n}(MapSeriesDataItem);\n\nexport { MapLineSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A series of map line series.\r\n *\r\n * @see {@link IMapLineSeriesEvents} for a list of available Events\r\n * @see {@link IMapLineSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar MapLineSeries =\n/** @class */\nfunction (_super) {\n __extends(MapLineSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapLineSeries() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"MapLineSeries\"; // Set data fields\n\n _this.dataFields.multiLine = \"multiLine\";\n _this.dataFields.line = \"line\";\n _this.dataFields.geoLine = \"geoLine\";\n _this.dataFields.multiGeoLine = \"multiGeoLine\";\n _this.ignoreBounds = true; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n MapLineSeries.prototype.createDataItem = function () {\n return new MapLineSeriesDataItem();\n };\n /**\r\n * (Re)validates series data, effectively causing the whole series to be\r\n * redrawn.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapLineSeries.prototype.validateData = function () {\n // process geoJSON and created map objects\n if (this.useGeodata || this.geodata) {\n var geoJSON = this.chart.geodata;\n\n if (geoJSON) {\n var features = void 0;\n\n if (geoJSON.type == \"FeatureCollection\") {\n features = geoJSON.features;\n } else if (geoJSON.type == \"Feature\") {\n features = [geoJSON];\n } else if ([\"Point\", \"LineString\", \"Polygon\", \"MultiPoint\", \"MultiLineString\", \"MultiPolygon\"].indexOf(geoJSON.type) != -1) {\n features = [{\n geometry: geoJSON\n }];\n } else {\n console.log(\"nothing found in geoJSON\");\n }\n\n if (features) {\n var _loop_1 = function _loop_1(i, len) {\n var feature = features[i];\n var geometry = feature.geometry;\n\n if (geometry) {\n var type = geometry.type;\n var id_1 = feature.id;\n\n if (type == \"LineString\" || type == \"MultiLineString\") {\n if (!this_1.checkInclude(this_1.include, this_1.exclude, id_1)) {\n return \"continue\";\n }\n\n var coordinates = geometry.coordinates;\n var dataObject = $array.find(this_1.data, function (value, i) {\n return value.id == id_1;\n });\n\n if (type == \"LineString\") {\n coordinates = [coordinates];\n }\n\n if (!dataObject) {\n dataObject = {\n multiLine: coordinates,\n id: id_1,\n madeFromGeoData: true\n };\n this_1.data.push(dataObject);\n } else {\n if (!dataObject.multiLine) {\n dataObject.multiLine = coordinates;\n }\n } // copy properties data to datacontext\n\n\n $utils.softCopyProperties(feature.properties, dataObject);\n }\n }\n };\n\n var this_1 = this;\n\n for (var i = 0, len = features.length; i < len; i++) {\n _loop_1(i, len);\n }\n }\n }\n }\n\n _super.prototype.validateData.call(this);\n };\n\n Object.defineProperty(MapLineSeries.prototype, \"mapLines\", {\n /**\r\n * A list of lines in the series.\r\n *\r\n * @return Lines\r\n */\n get: function get() {\n if (!this._mapLines) {\n var lineTemplate = this.createLine();\n var mapLines = new ListTemplate(lineTemplate);\n\n this._disposers.push(new ListDisposer(mapLines));\n\n this._disposers.push(mapLines.template);\n\n mapLines.events.on(\"inserted\", this.handleObjectAdded, this, false);\n this._mapLines = mapLines;\n this._mapObjects = mapLines;\n }\n\n return this._mapLines;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Returns a new line instance of suitable type.\r\n *\r\n * @return New line\r\n */\n\n MapLineSeries.prototype.createLine = function () {\n return new MapLine();\n };\n /**\r\n * (Re)validates the series\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapLineSeries.prototype.validate = function () {\n this.dataItems.each(function (dataItem) {\n $utils.used(dataItem.mapLine);\n });\n\n _super.prototype.validate.call(this);\n\n this.mapLines.each(function (mapLine) {\n mapLine.validate();\n });\n };\n /**\r\n * Copies all properties from another instance of [[Series]].\r\n *\r\n * @param source Source series\r\n */\n\n\n MapLineSeries.prototype.copyFrom = function (source) {\n this.mapLines.template.copyFrom(source.mapLines.template);\n\n _super.prototype.copyFrom.call(this, source);\n };\n /**\r\n * @ignore\r\n */\n\n\n MapLineSeries.prototype.getFeatures = function () {\n var _this = this;\n\n var features = [];\n this.dataItems.each(function (dataItem) {\n var feature = dataItem.getFeature();\n\n if (feature) {\n features.push(feature);\n }\n });\n this.mapLines.each(function (mapLine) {\n if (_this.dataItems.indexOf(mapLine._dataItem) == -1) {\n var feature = mapLine.getFeature();\n\n if (feature) {\n features.push(feature);\n }\n }\n });\n return features;\n };\n /**\r\n * returns MapLine by id\r\n * @param line id\r\n * @return {MapLine}\r\n */\n\n\n MapLineSeries.prototype.getLineById = function (id) {\n return $iter.find(this.mapLines.iterator(), function (mapLine) {\n var dataContext = mapLine.dataItem.dataContext;\n return dataContext.id == id;\n });\n };\n\n return MapLineSeries;\n}(MapSeries);\n\nexport { MapLineSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapLineSeries\"] = MapLineSeries;\nregistry.registeredClasses[\"MapLineSeriesDataItem\"] = MapLineSeriesDataItem;","/**\r\n * Graticule (map grid line).\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapLine } from \"./MapLine\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Graticule is a map line spanning from the poles or around the globe.\r\n *\r\n * @since 4.3.0\r\n * @see {@link IGraticuleEvents} for a list of available events\r\n * @see {@link IGraticuleAdapters} for a list of available Adapters\r\n */\n\nvar Graticule =\n/** @class */\nfunction (_super) {\n __extends(Graticule, _super);\n /**\r\n * Constructor\r\n */\n\n\n function Graticule() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"Graticule\"; // Apply theme\n\n _this.applyTheme();\n\n _this.shortestDistance = true;\n return _this;\n }\n\n return Graticule;\n}(MapLine);\n\nexport { Graticule };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Graticule\"] = Graticule;","export default function (start, stop, step) {\n start = +start, stop = +stop, step = (n = arguments.length) < 2 ? (stop = start, start = 0, 1) : n < 3 ? 1 : +step;\n var i = -1,\n n = Math.max(0, Math.ceil((stop - start) / step)) | 0,\n range = new Array(n);\n\n while (++i < n) {\n range[i] = start + i * step;\n }\n\n return range;\n}","import { range } from \"d3-array\";\nimport { abs, ceil, epsilon } from \"./math.js\";\n\nfunction graticuleX(y0, y1, dy) {\n var y = range(y0, y1 - epsilon, dy).concat(y1);\n return function (x) {\n return y.map(function (y) {\n return [x, y];\n });\n };\n}\n\nfunction graticuleY(x0, x1, dx) {\n var x = range(x0, x1 - epsilon, dx).concat(x1);\n return function (y) {\n return x.map(function (x) {\n return [x, y];\n });\n };\n}\n\nexport default function graticule() {\n var x1,\n x0,\n X1,\n X0,\n y1,\n y0,\n Y1,\n Y0,\n dx = 10,\n dy = dx,\n DX = 90,\n DY = 360,\n x,\n y,\n X,\n Y,\n precision = 2.5;\n\n function graticule() {\n return {\n type: \"MultiLineString\",\n coordinates: lines()\n };\n }\n\n function lines() {\n return range(ceil(X0 / DX) * DX, X1, DX).map(X).concat(range(ceil(Y0 / DY) * DY, Y1, DY).map(Y)).concat(range(ceil(x0 / dx) * dx, x1, dx).filter(function (x) {\n return abs(x % DX) > epsilon;\n }).map(x)).concat(range(ceil(y0 / dy) * dy, y1, dy).filter(function (y) {\n return abs(y % DY) > epsilon;\n }).map(y));\n }\n\n graticule.lines = function () {\n return lines().map(function (coordinates) {\n return {\n type: \"LineString\",\n coordinates: coordinates\n };\n });\n };\n\n graticule.outline = function () {\n return {\n type: \"Polygon\",\n coordinates: [X(X0).concat(Y(Y1).slice(1), X(X1).reverse().slice(1), Y(Y0).reverse().slice(1))]\n };\n };\n\n graticule.extent = function (_) {\n if (!arguments.length) return graticule.extentMinor();\n return graticule.extentMajor(_).extentMinor(_);\n };\n\n graticule.extentMajor = function (_) {\n if (!arguments.length) return [[X0, Y0], [X1, Y1]];\n X0 = +_[0][0], X1 = +_[1][0];\n Y0 = +_[0][1], Y1 = +_[1][1];\n if (X0 > X1) _ = X0, X0 = X1, X1 = _;\n if (Y0 > Y1) _ = Y0, Y0 = Y1, Y1 = _;\n return graticule.precision(precision);\n };\n\n graticule.extentMinor = function (_) {\n if (!arguments.length) return [[x0, y0], [x1, y1]];\n x0 = +_[0][0], x1 = +_[1][0];\n y0 = +_[0][1], y1 = +_[1][1];\n if (x0 > x1) _ = x0, x0 = x1, x1 = _;\n if (y0 > y1) _ = y0, y0 = y1, y1 = _;\n return graticule.precision(precision);\n };\n\n graticule.step = function (_) {\n if (!arguments.length) return graticule.stepMinor();\n return graticule.stepMajor(_).stepMinor(_);\n };\n\n graticule.stepMajor = function (_) {\n if (!arguments.length) return [DX, DY];\n DX = +_[0], DY = +_[1];\n return graticule;\n };\n\n graticule.stepMinor = function (_) {\n if (!arguments.length) return [dx, dy];\n dx = +_[0], dy = +_[1];\n return graticule;\n };\n\n graticule.precision = function (_) {\n if (!arguments.length) return precision;\n precision = +_;\n x = graticuleX(y0, y1, 90);\n y = graticuleY(x0, x1, precision);\n X = graticuleX(Y0, Y1, 90);\n Y = graticuleY(X0, X1, precision);\n return graticule;\n };\n\n return graticule.extentMajor([[-180, -90 + epsilon], [180, 90 - epsilon]]).extentMinor([[-180, -80 - epsilon], [180, 80 + epsilon]]);\n}\nexport function graticule10() {\n return graticule()();\n}","/**\r\n * Graticule (map grid) series functionality.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapLineSeries, MapLineSeriesDataItem } from \"./MapLineSeries\";\nimport { Graticule } from \"./Graticule\";\nimport { registry } from \"../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\nimport * as $array from \"../../core/utils/Array\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[GraticuleSeries]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar GraticuleSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(GraticuleSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function GraticuleSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"GraticuleSeriesDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n return GraticuleSeriesDataItem;\n}(MapLineSeriesDataItem);\n\nexport { GraticuleSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * This class is used to create a set of graticules (map grid).\r\n *\r\n * To enable, create like you would create any regular map series:\r\n *\r\n * ```TypeScript\r\n * let graticule = chart.series.push(new am4maps.GraticuleSeries())\r\n * graticule.mapLines.template.line.stroke = am4core.color(\"#000000\");\r\n * graticule.mapLines.template.line.strokeOpacity = 0.1;\r\n * ```\r\n * ```JavaScript\r\n * var graticule = chart.series.push(new am4maps.GraticuleSeries())\r\n * graticule.mapLines.template.line.stroke = am4core.color(\"#000000\");\r\n * graticule.mapLines.template.line.strokeOpacity = 0.1;\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"series\": [{\r\n * \"type\": \"GraticuleSeries\",\r\n * \"mapLines\": {\r\n * \"line\": {\r\n * \"stroke\": \"#000000\",\r\n * \"strokeOpacity\": 0.1\r\n * }\r\n * }\r\n * }]\r\n * }\r\n * ```\r\n *\r\n * @since 4.3.0\r\n * @see {@link IGraticuleSeriesEvents} for a list of available Events\r\n * @see {@link IGraticuleSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar GraticuleSeries =\n/** @class */\nfunction (_super) {\n __extends(GraticuleSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function GraticuleSeries() {\n var _this = _super.call(this) || this;\n\n _this.className = \"GraticuleSeries\";\n _this.longitudeStep = 10;\n _this.latitudeStep = 10;\n _this.north = 90;\n _this.south = -90;\n _this.east = -180;\n _this.west = 180; //this.majorLatitudeStep = 90;\n //this.majorLongitudeStep = 360;\n\n _this.fitExtent = true;\n _this.singleSprite = true;\n\n _this.events.disableType(\"geoBoundsChanged\");\n\n _this.mapLines.template.line.strokeOpacity = 0.08;\n _this.ignoreBounds = false;\n _this.hiddenInLegend = true;\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n GraticuleSeries.prototype.createDataItem = function () {\n return new GraticuleSeriesDataItem();\n };\n\n GraticuleSeries.prototype.validateData = function () {\n var _this = this;\n\n _super.prototype.validateData.call(this);\n\n this.mapLines.clear();\n var graticule = d3geo.geoGraticule();\n\n if (graticule) {\n graticule.stepMinor([this.longitudeStep, this.latitudeStep]);\n graticule.stepMajor([360, 360]);\n var chart = this.chart;\n\n if (this.fitExtent) {\n graticule.extent([[chart.east, chart.north], [chart.west, chart.south]]);\n } else {\n graticule.extent([[this.east, this.north], [this.west, this.south]]);\n }\n\n if (this.singleSprite) {\n var mapLine = this.mapLines.create();\n mapLine.multiLine = graticule().coordinates;\n } else {\n var lineStrings = graticule.lines();\n $array.each(lineStrings, function (lineString) {\n var mapLine = _this.mapLines.create();\n\n mapLine.multiLine = [lineString.coordinates];\n });\n }\n }\n };\n /**\r\n * Returns a new line instance of suitable type.\r\n *\r\n * @return New line\r\n */\n\n\n GraticuleSeries.prototype.createLine = function () {\n return new Graticule();\n };\n\n Object.defineProperty(GraticuleSeries.prototype, \"latitudeStep\", {\n /**\r\n * @return Step\r\n */\n get: function get() {\n return this.getPropertyValue(\"latitudeStep\");\n },\n\n /**\r\n * Draw a graticule (grid) every X degrees of latitude.\r\n *\r\n * @default 10\r\n * @param value Step\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"latitudeStep\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GraticuleSeries.prototype, \"longitudeStep\", {\n /**\r\n * @return Step\r\n */\n get: function get() {\n return this.getPropertyValue(\"longitudeStep\");\n },\n\n /**\r\n * Draw a graticule (grid) every X degrees of longitude.\r\n *\r\n * @default 10\r\n * @param value Step\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"longitudeStep\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GraticuleSeries.prototype, \"fitExtent\", {\n /**\r\n * @return Fit?\r\n */\n get: function get() {\n return this.getPropertyValue(\"fitExtent\");\n },\n\n /**\r\n * Draw a thicker (major) graticule every X degrees of latitude.\r\n *\r\n * @default 90\r\n * @param value Step\r\n */\n // public set majorLatitudeStep(value: number) {\n // \tif (this.setPropertyValue(\"majorLatitudeStep\", value)) {\n // \t\tthis.invalidateData();\n // \t}\n // }\n\n /**\r\n * @return Step\r\n */\n // public get majorLatitudeStep(): number {\n // \treturn this.getPropertyValue(\"majorLatitudeStep\");\n // }\n\n /**\r\n * Draw a thicker (major) graticule every X degrees of longitude.\r\n *\r\n * @default 360\r\n * @param value Step\r\n */\n // public set majorLongitudeStep(value: number) {\n // \tif (this.setPropertyValue(\"majorLongitudeStep\", value)) {\n // \t\tthis.invalidateData();\n // \t}\n // }\n\n /**\r\n * @return Step\r\n */\n // public get majorLongitudeStep(): number {\n // \treturn this.getPropertyValue(\"majorLongitudeStep\");\n // }\n\n /**\r\n * Whether to cap graticules (grid) to actual span of the map (`true`), e.g.\r\n * where there are polygons, or draw full-world grid (`false`).\r\n *\r\n * For world maps, using `false` makes sense. For smaller maps - not so much.\r\n *\r\n * If set to `false`, the grid will be drawn from this series `east` to\r\n * `west`, and from `south` to `north` (default values: `east = -180`;\r\n * `west = 180`; `south =-90`; `north =90`).\r\n *\r\n * These can be overridden by setting `GraticuleSeries`' respective\r\n * properties.\r\n *\r\n * @default true\r\n * @param value Fit?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"fitExtent\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GraticuleSeries.prototype, \"singleSprite\", {\n /**\r\n * @return Use single sprite?\r\n */\n get: function get() {\n return this.getPropertyValue(\"singleSprite\");\n },\n\n /**\r\n * Whether to draw all the grid as a single element or as separate lines.\r\n *\r\n * Setting `true` (default) will result in better performance, whereas\r\n * `false` allows setting visual properties of each line individually.\r\n *\r\n * @default true\r\n * @param value Use single sprite?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"singleSprite\", value)) {\n this.invalidateData();\n }\n },\n enumerable: true,\n configurable: true\n });\n return GraticuleSeries;\n}(MapLineSeries);\n\nexport { GraticuleSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"GraticuleSeries\"] = GraticuleSeries;\nregistry.registeredClasses[\"GraticuleSeriesDataItem\"] = GraticuleSeriesDataItem;","/**\r\n * Map module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { SerialChart, SerialChartDataItem } from \"./SerialChart\";\nimport { Disposer } from \"../../core/utils/Disposer\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\nimport { MapSeries } from \"../map/MapSeries\";\nimport { MapImage } from \"../map/MapImage\";\nimport { MapPolygon } from \"../map/MapPolygon\";\nimport { MapPolygonSeries } from \"../map/MapPolygonSeries\";\nimport { Projection } from \"../map/projections/Projection\";\nimport { Circle } from \"../../core/elements/Circle\";\nimport { SmallMap } from \"../map/SmallMap\";\nimport * as $mapUtils from \"../map/MapUtils\";\nimport { keyboard } from \"../../core/utils/Keyboard\";\nimport { registry } from \"../../core/Registry\";\nimport { options } from \"../../core/Options\";\nimport * as $math from \"../../core/utils/Math\";\nimport * as $utils from \"../../core/utils/Utils\";\nimport * as $ease from \"../../core/utils/Ease\";\nimport * as $iter from \"../../core/utils/Iterator\";\nimport * as $type from \"../../core/utils/Type\";\nimport * as $geo from \"../map/Geo\";\nimport { GraticuleSeries } from \"../map/GraticuleSeries\";\nimport { getInteraction } from \"../../core/interaction/Interaction\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapChart]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar MapChartDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapChartDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapChartDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapChartDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n return MapChartDataItem;\n}(SerialChartDataItem);\n\nexport { MapChartDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a map.\r\n *\r\n * @see {@link IMapChartEvents} for a list of available Events\r\n * @see {@link IMapChartAdapters} for a list of available Adapters\r\n * @see {@link https://www.amcharts.com/docs/v4/chart-types/map/} for documentation\r\n */\n\nvar MapChart =\n/** @class */\nfunction (_super) {\n __extends(MapChart, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapChart() {\n var _this = // Init\n _super.call(this) || this;\n /**\r\n * A ratio to be used when scaling the map shapes.\r\n *\r\n * @readonly\r\n */\n\n\n _this.scaleRatio = 1;\n /**\r\n * Default duration of zoom animations (ms).\r\n */\n\n _this.zoomDuration = 1000;\n /**\r\n * Default zooming animation easing function.\r\n */\n\n _this.zoomEasing = $ease.cubicOut;\n /**\r\n * Smallest available zoom level. The map will not allow to zoom out past\r\n * this setting.\r\n *\r\n * NOTE: Should be power of 2.\r\n *\r\n * @default 1\r\n */\n\n _this.minZoomLevel = 1;\n /**\r\n * Biggest available zoom level. The map will not allow to zoom in past\r\n * this setting.\r\n *\r\n * NOTE: Should be power of 2.\r\n *\r\n * @default 32\r\n */\n\n _this.maxZoomLevel = 32;\n /**\r\n * [_prevZoomGeoPoint description]\r\n *\r\n * @todo Description\r\n */\n\n _this._prevZoomGeoPoint = {\n latitude: 0,\n longitude: 0\n };\n _this.className = \"MapChart\"; // Set default projection\n\n _this.projection = new Projection();\n\n _this.setPropertyValue(\"deltaLatitude\", 0);\n\n _this.setPropertyValue(\"deltaLongitude\", 0);\n\n _this.setPropertyValue(\"deltaGamma\", 0);\n\n _this.maxPanOut = 0.7;\n _this.homeZoomLevel = 1;\n _this.zoomStep = 2;\n _this.layout = \"absolute\";\n _this.centerMapOnZoomOut = true; // Set padding\n\n _this.padding(0, 0, 0, 0);\n\n $utils.used(_this.backgroundSeries); // so that the map would render in a hidden div too\n\n _this.minWidth = 10;\n _this.minHeight = 10;\n\n _this.events.once(\"inited\", _this.handleAllInited, _this, false); // Create a container for map series\n\n\n var seriesContainer = _this.seriesContainer;\n seriesContainer.visible = false;\n seriesContainer.inert = true;\n seriesContainer.resizable = true;\n seriesContainer.events.on(\"transformed\", _this.handleMapTransform, _this, false);\n seriesContainer.events.on(\"doublehit\", _this.handleDoubleHit, _this, false);\n seriesContainer.events.on(\"dragged\", _this.handleDrag, _this, false);\n seriesContainer.zIndex = 0;\n seriesContainer.dragWhileResize = true; //seriesContainer.background.fillOpacity = 0;\n\n seriesContainer.adapter.add(\"scale\", function (scale, target) {\n return $math.fitToRange(scale, _this.minZoomLevel, _this.maxZoomLevel);\n }); // Set up events\n //this.events.on(\"validated\", this.updateExtremes, this);\n //this.events.on(\"datavalidated\", this.handleAllValidated, this, false);\n //this.events.on(\"datavalidated\", this.updateExtremes, this, false);\n\n _this.events.on(\"maxsizechanged\", function (event) {\n if (event.previousWidth == 0 || event.previousHeight == 0) {\n _this.updateExtremes();\n\n _this.updateCenterGeoPoint();\n }\n }, undefined, false); // Set up main chart container, e.g. set backgrounds and events to monitor\n // size changes, etc.\n\n\n var chartContainer = _this.chartContainer;\n chartContainer.parent = _this;\n chartContainer.zIndex = -1;\n\n _this._disposers.push(_this.events.on(\"maxsizechanged\", function () {\n if (_this.inited) {\n if (_this._mapAnimation) {\n _this._mapAnimation.stop();\n }\n\n var allInited_1 = true;\n\n _this.series.each(function (series) {\n series.updateTooltipBounds();\n\n if (!series.inited || series.dataInvalid) {\n allInited_1 = false;\n }\n });\n\n if (allInited_1) {\n _this.updateScaleRatio();\n }\n\n _this.zoomToGeoPoint(_this._zoomGeoPointReal, _this.zoomLevel, true, 0);\n }\n }, undefined, false));\n\n var chartContainerBg = chartContainer.background;\n chartContainerBg.fillOpacity = 0;\n chartContainerBg.events.on(\"down\", function (e) {\n _this.seriesContainer.dragStart(e.target.interactions.downPointers.getIndex(0));\n }, _this);\n chartContainerBg.events.on(\"up\", function (e) {\n _this.seriesContainer.dragStop();\n }, _this);\n chartContainerBg.events.on(\"doublehit\", _this.handleDoubleHit, _this);\n chartContainerBg.focusable = true;\n chartContainer.events.on(\"down\", _this.handleMapDown, _this, false);\n\n _this.addDisposer(seriesContainer.events.on(\"down\", function () {\n // Cancel any move inertia if there is one\n var inertia = _this.seriesContainer.interactions.inertias.getKey(\"move\");\n\n if (inertia) {\n inertia.done();\n }\n })); // Add description to background\n\n\n _this.background.fillOpacity = 0; // Add keyboard events for panning\n\n _this._disposers.push(getInteraction().body.events.on(\"keyup\", function (ev) {\n if (_this.topParent.hasFocused) {\n var key = keyboard.getEventKey(ev.event);\n\n if (!_this._zoomControl || !_this._zoomControl.thumb.isFocused) {\n switch (key) {\n case \"up\":\n _this.pan({\n x: 0,\n y: 0.1\n });\n\n break;\n\n case \"down\":\n _this.pan({\n x: 0,\n y: -0.1\n });\n\n break;\n\n case \"left\":\n _this.pan({\n x: 0.1,\n y: 0\n });\n\n break;\n\n case \"right\":\n _this.pan({\n x: -0.1,\n y: 0\n });\n\n break;\n }\n }\n }\n }, _this));\n\n _this.mouseWheelBehavior = \"zoom\";\n var interaction = getInteraction();\n\n _this._disposers.push(interaction.body.events.on(\"down\", _this.handlePanDown, _this));\n\n _this._disposers.push(interaction.body.events.on(\"up\", _this.handlePanUp, _this)); //this._disposers.push(interaction.body.events.on(\"track\", this.handlePanMove, this));\n\n\n var panSprite = _this.seriesContainer.createChild(Circle);\n\n panSprite.radius = 10;\n panSprite.inert = true;\n panSprite.isMeasured = false;\n panSprite.events.on(\"transformed\", _this.handlePanMove, _this, false);\n panSprite.interactionsEnabled = false;\n panSprite.opacity = 0;\n panSprite.x = 0;\n panSprite.y = 0;\n _this.panSprite = panSprite;\n _this.panBehavior = \"move\";\n /*\r\n this.panSprite.inertiaOptions.setKey(\"move\", {\r\n \"time\": 100,\r\n \"duration\": 1000,\r\n \"factor\": 3,\r\n \"easing\": $ease.sinOut\r\n });*/\n // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapChart.prototype.handlePanDown = function (event) {\n var svgPoint = $utils.documentPointToSvg(event.pointer.point, this.htmlContainer);\n\n if (svgPoint.x > 0 && svgPoint.y > 0 && svgPoint.x < this.svgContainer.width && svgPoint.y < this.svgContainer.height) {\n // Get local point\n this._downPointOrig = $utils.documentPointToSprite(event.pointer.point, this.seriesContainer);\n this.panSprite.moveTo(this._downPointOrig);\n this.panSprite.dragStart(event.pointer);\n this._downDeltaLongitude = this.deltaLongitude;\n this._downDeltaLatitude = this.deltaLatitude;\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n MapChart.prototype.handlePanUp = function (event) {\n if (this._downPointOrig) {\n this.panSprite.dragStop(event.pointer, true);\n }\n\n this._downPointOrig = undefined;\n };\n /**\r\n * @ignore\r\n */\n\n\n MapChart.prototype.handlePanMove = function () {\n if (!this.seriesContainer.isResized) {\n if (getInteraction().areTransformed([this.panSprite.interactions, this.seriesContainer.interactions])) {\n return;\n }\n\n var d3Projection = this.projection.d3Projection;\n var panBehavior = this.panBehavior;\n\n if (panBehavior != \"move\" && panBehavior != \"none\" && this._downPointOrig && d3Projection.rotate) {\n var rotation = d3Projection.rotate();\n var dln = rotation[0];\n var dlt = rotation[1];\n var dlg = rotation[2];\n d3Projection.rotate([0, 0, 0]);\n var downGeoLocal = this.projection.invert(this._downPointOrig);\n var local = {\n x: this.panSprite.pixelX,\n y: this.panSprite.pixelY\n };\n var geoLocal = void 0;\n\n if (local) {\n geoLocal = this.projection.invert(local);\n }\n\n d3Projection.rotate([dln, dlt, dlg]);\n\n if (geoLocal) {\n if (panBehavior == \"rotateLat\" || panBehavior == \"rotateLongLat\") {\n this.deltaLatitude = this._downDeltaLatitude + geoLocal.latitude - downGeoLocal.latitude;\n }\n\n if (panBehavior == \"rotateLong\" || panBehavior == \"rotateLongLat\") {\n this.deltaLongitude = this._downDeltaLongitude + geoLocal.longitude - downGeoLocal.longitude;\n }\n }\n }\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n MapChart.prototype.handleAllInited = function () {\n var _this = this;\n\n var inited = true;\n this.seriesContainer.visible = true;\n this.series.each(function (series) {\n if (!series.inited || series.dataInvalid) {\n inited = false;\n }\n });\n\n if (inited) {\n this.updateCenterGeoPoint();\n this.updateScaleRatio();\n this.goHome(0);\n } else {\n // TODO verify that this is correct\n var disposer_1 = registry.events.once(\"exitframe\", function () {\n _this.removeDispose(disposer_1);\n\n _this.handleAllInited();\n }, this, false);\n this.addDisposer(disposer_1);\n }\n };\n /**\r\n * @ignore\r\n */\n\n\n MapChart.prototype.updateZoomGeoPoint = function () {\n var seriesPoint = $utils.svgPointToSprite({\n x: this.innerWidth / 2 + this.pixelPaddingLeft,\n y: this.innerHeight / 2 + this.pixelPaddingTop\n }, this.series.getIndex(0));\n var geoPoint = this.projection.invert(seriesPoint);\n this._zoomGeoPointReal = geoPoint;\n };\n /**\r\n * @ignore\r\n */\n\n\n MapChart.prototype.updateCenterGeoPoint = function () {\n var maxLeft;\n var maxRight;\n var maxTop;\n var maxBottom;\n\n if (this.backgroundSeries) {\n var features = this.backgroundSeries.getFeatures();\n\n if (features.length > 0) {\n var bounds = this.projection.d3Path.bounds(features[0].geometry);\n maxLeft = bounds[0][0];\n maxTop = bounds[0][1];\n maxRight = bounds[1][0];\n maxBottom = bounds[1][1];\n }\n } else {\n this.series.each(function (series) {\n var bbox = series.group.node.getBBox();\n\n if (maxLeft > bbox.x || !$type.isNumber(maxLeft)) {\n maxLeft = bbox.x;\n }\n\n if (maxRight < bbox.x + bbox.width || !$type.isNumber(maxRight)) {\n maxRight = bbox.x + bbox.width;\n }\n\n if (maxTop > bbox.y || !$type.isNumber(maxTop)) {\n maxTop = bbox.y;\n }\n\n if (maxBottom < bbox.y + bbox.height || !$type.isNumber(maxBottom)) {\n maxBottom = bbox.y + bbox.height;\n }\n });\n }\n\n this.seriesMaxLeft = maxLeft;\n this.seriesMaxRight = maxRight;\n this.seriesMaxTop = maxTop;\n this.seriesMaxBottom = maxBottom;\n this.seriesWidth = maxRight - maxLeft;\n this.seriesHeight = maxBottom - maxTop;\n\n if (this.seriesWidth > 0 && this.seriesHeight > 0) {\n this.chartContainer.visible = true;\n this._centerGeoPoint = this.projection.invert({\n x: maxLeft + (maxRight - maxLeft) / 2,\n y: maxTop + (maxBottom - maxTop) / 2\n });\n\n if (!this._zoomGeoPointReal || !$type.isNumber(this._zoomGeoPointReal.latitude)) {\n this._zoomGeoPointReal = this._centerGeoPoint;\n }\n } else {\n this.chartContainer.visible = false;\n }\n };\n /**\r\n * Prevents map to be dragged out of the container area\r\n * @ignore\r\n */\n\n\n MapChart.prototype.handleDrag = function () {\n var d = this.zoomLevel * this.scaleRatio;\n var ww = this.seriesWidth * d;\n var hh = this.seriesHeight * d;\n var seriesContainer = this.seriesContainer;\n var maxLeft = this.seriesMaxLeft * d;\n var maxRight = this.seriesMaxRight * d;\n var maxTop = this.seriesMaxTop * d;\n var maxBottom = this.seriesMaxBottom * d;\n var x = seriesContainer.pixelX;\n var y = seriesContainer.pixelY;\n var maxPanOut = this.maxPanOut;\n var minX = Math.min(this.maxWidth * (1 - maxPanOut) - ww - maxLeft, -maxLeft);\n\n if (x < minX) {\n x = minX;\n }\n\n var maxX = Math.max(this.maxWidth * maxPanOut - maxLeft, this.maxWidth - maxRight);\n\n if (x > maxX) {\n x = maxX;\n }\n\n var minY = Math.min(this.maxHeight * (1 - maxPanOut) - hh - maxTop, -maxTop);\n\n if (y < minY) {\n y = minY;\n }\n\n var maxY = Math.max(this.maxHeight * maxPanOut - maxTop, this.maxHeight - maxBottom);\n\n if (y > maxY) {\n y = maxY;\n }\n\n seriesContainer.moveTo({\n x: x,\n y: y\n }, undefined, undefined, true);\n this._zoomGeoPointReal = this.zoomGeoPoint;\n };\n /**\r\n * Sets defaults that instantiate some objects that rely on parent, so they\r\n * cannot be set in constructor.\r\n */\n\n\n MapChart.prototype.applyInternalDefaults = function () {\n _super.prototype.applyInternalDefaults.call(this); // Add a default screen reader title for accessibility\n // This will be overridden in screen reader if there are any `titles` set\n\n\n if (!$type.hasValue(this.readerTitle)) {\n this.readerTitle = this.language.translate(\"Map\");\n }\n\n if (!$type.hasValue(this.background.readerTitle)) {\n this.background.readerTitle = this.language.translate(\"Use plus and minus keys on your keyboard to zoom in and out\");\n }\n };\n /**\r\n * Handles event when a pointer presses down on the map, e.g. user presses\r\n * down mouse or touches the map on a screen.\r\n *\r\n * Stops all animations currently going on.\r\n */\n\n\n MapChart.prototype.handleMapDown = function () {\n if (this._mapAnimation) {\n this._mapAnimation.stop();\n }\n };\n /**\r\n * Handles the event when user doubleclicks or dooubletaps the map: zooms\r\n * in on the reference point.\r\n *\r\n * @param event Original event\r\n */\n\n\n MapChart.prototype.handleDoubleHit = function (event) {\n var svgPoint = $utils.documentPointToSvg(event.point, this.htmlContainer, this.svgContainer.cssScale);\n var geoPoint = this.svgPointToGeo(svgPoint);\n this.zoomIn(geoPoint);\n };\n /**\r\n * Handles mouse wheel event, e.g. user rotates mouse wheel while over the\r\n * map: zooms in or out depending on the direction of the wheel turn.\r\n *\r\n * @param event Original event\r\n */\n\n\n MapChart.prototype.handleWheel = function (event) {\n // Cancel any move inertia if there is one\n var inertia = this.seriesContainer.interactions.inertias.getKey(\"move\");\n\n if (inertia) {\n inertia.done();\n }\n\n var svgPoint = $utils.documentPointToSvg(event.point, this.htmlContainer, this.svgContainer.cssScale);\n var geoPoint = this.svgPointToGeo(svgPoint);\n\n if (event.shift.y < 0) {\n this.zoomIn(geoPoint, undefined, this.interactions.mouseOptions.sensitivity);\n } else {\n this.zoomOut(geoPoint, undefined, this.interactions.mouseOptions.sensitivity);\n }\n };\n\n Object.defineProperty(MapChart.prototype, \"mouseWheelBehavior\", {\n /**\r\n * @return mouse wheel behavior\r\n */\n get: function get() {\n return this.getPropertyValue(\"mouseWheelBehavior\");\n },\n\n /**\r\n * Specifies what should chart do if when mouse wheel is rotated.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/reference/sprite/#mouseOptions_property} More information about `mouseOptions`\r\n * @param mouse wheel behavior\r\n * @default zoomX\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"mouseWheelBehavior\", value)) {\n if (value != \"none\") {\n this._mouseWheelDisposer = this.chartContainer.events.on(\"wheel\", this.handleWheel, this, false);\n\n this._disposers.push(this._mouseWheelDisposer);\n } else {\n if (this._mouseWheelDisposer) {\n this._mouseWheelDisposer.dispose();\n }\n\n this.chartContainer.wheelable = false;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"panBehavior\", {\n /**\r\n * @returns Behavior\r\n */\n get: function get() {\n return this.getPropertyValue(\"panBehavior\");\n },\n\n /**\r\n * What \"dragging\" map does.\r\n *\r\n * Available values:\r\n * * `\"move\"` (default): changes position of the map.\r\n * * `\"rotateLat\"`: changes `deltaLatitude` (rotates the globe vertically).\r\n * * `\"rotateLong\"`: changes `deltaLongitude` (rotates the globe horizontally).\r\n * * `\"rotateLongLat\"`: changes both `deltaLongitude` and `deltaLatitude` (rotates the globe in any direction).\r\n *\r\n * @default \"move\"\r\n * @since 4.3.0\r\n * @param value Behavior\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"panBehavior\", value)) {\n var seriesContainer = this.seriesContainer;\n this.panSprite.draggable = false;\n seriesContainer.draggable = false;\n\n switch (value) {\n case \"move\":\n seriesContainer.draggable = true;\n break;\n\n default:\n this.panSprite.draggable = true;\n break;\n }\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"centerMapOnZoomOut\", {\n /**\r\n * @returns If the map should be centered when zooming out.\r\n */\n get: function get() {\n return this.getPropertyValue(\"centerMapOnZoomOut\");\n },\n\n /**\r\n * Specifies if the map should be centered when zooming out\r\n * @default true\r\n * @since 4.7.12\r\n */\n set: function set(value) {\n this.setPropertyValue(\"centerMapOnZoomOut\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"projection\", {\n /**\r\n * @return Projection\r\n */\n get: function get() {\n return this.getPropertyValue(\"projection\");\n },\n\n /**\r\n * Projection to use for the map.\r\n *\r\n * Available projections:\r\n * * Albers\r\n * * AlbersUSA\r\n * * AzimuthalEqualArea\r\n * * Eckert6\r\n * * EqualEarth\r\n * * Mercator\r\n * * Miller\r\n * * NaturalEarth\r\n * * Orthographic\r\n * * Stereographic\r\n *\r\n * ```TypeScript\r\n * map.projection = new am4maps.projections.Mercator();\r\n * ```\r\n * ```JavaScript\r\n * map.projection = new am4maps.projections.Mercator();\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"projection\": \"Mercator\"\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/chart-types/map/#Setting_projection} More about projections\r\n * @param projection Projection\r\n */\n set: function set(projection) {\n var _this = this;\n\n if (this.setPropertyValue(\"projection\", projection)) {\n this.invalidateProjection();\n projection.chart = this;\n\n if (this._backgroundSeries) {\n this._backgroundSeries.invalidate();\n }\n\n if (this.inited) {\n this.updateExtremes();\n }\n\n this.series.each(function (series) {\n series.events.once(\"validated\", function () {\n _this.updateCenterGeoPoint();\n\n _this.updateScaleRatio();\n\n _this.goHome(0);\n });\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Validates (processes) data items.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n MapChart.prototype.validateDataItems = function () {\n _super.prototype.validateDataItems.call(this);\n\n this.updateExtremes();\n };\n /**\r\n * Calculates the longitudes and latitudes of the most distant points from\r\n * the center in all four directions: West, East, North, and South.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n MapChart.prototype.updateExtremes = function () {\n var east;\n var north;\n var west;\n var south;\n this.series.each(function (series) {\n if (series.ignoreBounds || series instanceof GraticuleSeries && series.fitExtent) {} else {\n if (series.north > north || !$type.isNumber(north)) {\n north = series.north;\n }\n\n if (series.south < south || !$type.isNumber(south)) {\n south = series.south;\n }\n\n if (series.west < west || !$type.isNumber(west)) {\n west = series.west;\n }\n\n if (series.east > east || !$type.isNumber(east)) {\n east = series.east;\n }\n }\n });\n var features = [];\n var foundGraticule = false; // if we gave graticule, get features of these series only for faster fitSize\n\n this.series.each(function (series) {\n if (series instanceof GraticuleSeries && !series.fitExtent) {\n features = series.getFeatures();\n foundGraticule = true;\n }\n });\n\n if (!foundGraticule) {\n this.series.each(function (series) {\n if (series.ignoreBounds || series instanceof GraticuleSeries && series.fitExtent) {} else {\n features = features.concat(series.getFeatures());\n }\n });\n }\n\n var w = $math.max(50, this.innerWidth);\n var h = $math.max(50, this.innerHeight);\n var d3Projection = this.projection.d3Projection;\n\n if (features.length > 0 && d3Projection && (this.east != east || this.west != west || this.north != north || this.south != south)) {\n this.east = east;\n this.west = west;\n this.north = north;\n this.south = south;\n\n if (d3Projection.rotate) {\n var rotation = d3Projection.rotate();\n var deltaLong = rotation[0];\n var deltaLat = rotation[1];\n var deltaGamma = rotation[2];\n this.deltaLongitude = deltaLong;\n this.deltaLatitude = deltaLat;\n this.deltaGamma = deltaGamma;\n }\n\n var geoJSON = {\n \"type\": \"FeatureCollection\",\n features: features\n };\n var initialScale = d3Projection.scale();\n d3Projection.fitSize([w, h], geoJSON);\n\n if (d3Projection.scale() != initialScale) {\n this.invalidateDataUsers();\n }\n\n this.series.each(function (series) {\n if (series instanceof GraticuleSeries) {\n series.invalidateData();\n }\n });\n\n if (this._backgroundSeries) {\n var polygon = this._backgroundSeries.mapPolygons.getIndex(0);\n\n if (polygon) {\n polygon.multiPolygon = $mapUtils.getBackground(this.north, this.east, this.south, this.west);\n }\n }\n\n this._fitWidth = w;\n this._fitHeight = h;\n }\n\n if (!this._zoomGeoPointReal || !$type.isNumber(this._zoomGeoPointReal.latitude)) {\n this.goHome(0);\n }\n };\n /**\r\n * (Re)calculates a ratio which should be used to scale the actual map so\r\n * that it fits perfectly into available space. Helps to avoid redrawing of all the map if container size changes\r\n * @ignore\r\n */\n\n\n MapChart.prototype.updateScaleRatio = function () {\n var scaleRatio;\n this.updateCenterGeoPoint();\n var hScale = this.innerWidth / this.seriesWidth;\n var vScale = this.innerHeight / this.seriesHeight;\n scaleRatio = $math.min(hScale, vScale);\n\n if ($type.isNaN(scaleRatio) || scaleRatio == Infinity) {\n scaleRatio = 1;\n }\n\n if (scaleRatio != this.scaleRatio) {\n this.scaleRatio = scaleRatio;\n $iter.each(this.series.iterator(), function (series) {\n series.scale = scaleRatio;\n series.updateTooltipBounds();\n });\n this.backgroundSeries.scale = scaleRatio;\n this.dispatch(\"scaleratiochanged\");\n }\n };\n /**\r\n * Converts a point within map container to geographical (lat/long)\r\n * coordinates.\r\n *\r\n * @param point Source point\r\n * @return Geo-point\r\n */\n\n\n MapChart.prototype.svgPointToGeo = function (point) {\n var series = this.series.getIndex(0);\n\n if (series) {\n var seriesPoint = $utils.svgPointToSprite(point, series);\n return this.seriesPointToGeo(seriesPoint);\n }\n };\n /**\r\n * Converts geographical (lat/long) coordinates to an X/Y point within map's\r\n * container.\r\n *\r\n * @param point Source geo-point\r\n * @return Point\r\n */\n\n\n MapChart.prototype.geoPointToSVG = function (point) {\n var series = this.series.getIndex(0);\n\n if (series) {\n var seriesPoint = this.geoPointToSeries(point);\n return $utils.spritePointToSvg(seriesPoint, series);\n }\n };\n /**\r\n * Converts a point (X/Y) within actual objects of the map to geographical\r\n * (lat/long) coordinates.\r\n *\r\n * @param point Source point\r\n * @return Geo-point\r\n */\n\n\n MapChart.prototype.seriesPointToGeo = function (point) {\n return this.projection.invert(point);\n };\n /**\r\n * Converts geographical (lat/long) coordinates to an X/Y point within\r\n * actual elements/objects of the maps.\r\n *\r\n * @param point Source geo-point\r\n * @return Point\r\n */\n\n\n MapChart.prototype.geoPointToSeries = function (point) {\n return this.projection.convert(point);\n };\n\n Object.defineProperty(MapChart.prototype, \"geodata\", {\n /**\r\n * @return GeoJSON data\r\n */\n get: function get() {\n return this._geodata;\n },\n\n /**\r\n * Map data in GeoJSON format.\r\n *\r\n * The Map supports the following GeoJSON objects: `Point`, `LineString`,\r\n * `Polygon`, `MultiPoint`, `MultiLineString`, and `MultiPolygon`.\r\n *\r\n * @see {@link http://geojson.org/} Official GeoJSON format specification\r\n * @param geoJSON GeoJSON data\r\n */\n set: function set(geodata) {\n if (geodata != this._geodata) {\n this._geodata = geodata;\n\n if (this.reverseGeodata) {\n this.processReverseGeodata(this._geodata);\n }\n\n this.invalidateData();\n this.dataUsers.each(function (dataUser) {\n for (var i = dataUser.data.length - 1; i >= 0; i--) {\n if (dataUser.data[i].madeFromGeoData == true) {\n dataUser.data.splice(i, 1);\n }\n }\n\n dataUser.disposeData();\n dataUser.invalidateData();\n });\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"reverseGeodata\", {\n /**\r\n * @returns Reverse the order of geodata coordinates?\r\n */\n get: function get() {\n return this.getPropertyValue(\"reverseGeodata\");\n },\n\n /**\r\n * Indicates whether GeoJSON geodata supplied to the chart uses\r\n * ESRI (clockwise) or non-ESRI (counter-clockwise) order of the polygon\r\n * coordinates.\r\n *\r\n * `MapChart` supports only ESRI standard, so if your custom maps appears\r\n * garbled, try setting `reverseGeodata = true`.\r\n *\r\n * @default false\r\n * @since 4.10.11\r\n * @param value Reverse the order of geodata coordinates?\r\n */\n set: function set(value) {\n if (this.setPropertyValue(\"reverseGeodata\", value) && this._geodata) {\n this.processReverseGeodata(this._geodata);\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Reverses the order of polygons on a GeoJSON data.\r\n *\r\n * @since 4.10.11\r\n * @param geodata Source geodata\r\n */\n\n MapChart.prototype.processReverseGeodata = function (geodata) {\n for (var i = 0; i < geodata.features.length; i++) {\n var feature = geodata.features[i];\n\n for (var x = 0; x < feature.geometry.coordinates.length; x++) {\n if (feature.geometry.type == \"MultiPolygon\") {\n for (var y = 0; y < feature.geometry.coordinates[x].length; y++) {\n feature.geometry.coordinates[x][y].reverse();\n }\n } else {\n feature.geometry.coordinates[x].reverse();\n }\n }\n }\n };\n /**\r\n * Zooms the map to particular zoom level and centers on a latitude/longitude\r\n * coordinate.\r\n *\r\n * @param point Center coordinate\r\n * @param zoomLevel Zoom level\r\n * @param center Center on the given coordinate?\r\n * @param duration Duration for zoom animation (ms)\r\n * @return Zoom animation\r\n */\n\n\n MapChart.prototype.zoomToGeoPoint = function (point, zoomLevel, center, duration, mapObject) {\n var _this = this;\n\n if (!point) {\n var hasData_1 = false;\n this.series.each(function (series) {\n if (series.dataItems.length > 0) {\n hasData_1 = true;\n }\n });\n\n if (hasData_1) {\n point = this.zoomGeoPoint;\n } else {\n return;\n }\n }\n\n if (!point || !$type.isNumber(point.longitude) || !$type.isNumber(point.latitude)) {\n return;\n }\n\n this._zoomGeoPointReal = point;\n zoomLevel = $math.fitToRange(zoomLevel, this.minZoomLevel, this.maxZoomLevel);\n var seriesPoint = this.projection.convert(point);\n\n if (seriesPoint) {\n var svgPoint = this.geoPointToSVG(point);\n var mapPoint = $utils.svgPointToSprite(svgPoint, this);\n\n if (center) {\n mapPoint = {\n x: this.innerWidth / 2,\n y: this.innerHeight / 2\n };\n }\n\n if (!$type.isNumber(duration)) {\n duration = this.zoomDuration;\n }\n\n var x = mapPoint.x - seriesPoint.x * zoomLevel * this.scaleRatio;\n var y = mapPoint.y - seriesPoint.y * zoomLevel * this.scaleRatio;\n\n if (!mapObject && zoomLevel < this.zoomLevel && this.centerMapOnZoomOut && zoomLevel < 1.5) {\n x = this.innerWidth / 2 - (this.seriesMaxLeft + (this.seriesMaxRight - this.seriesMaxLeft) / 2) * zoomLevel * this.scaleRatio;\n y = this.innerHeight / 2 - (this.seriesMaxTop + (this.seriesMaxBottom - this.seriesMaxTop) / 2) * zoomLevel * this.scaleRatio;\n }\n\n this._mapAnimation = this.seriesContainer.animate([{\n property: \"scale\",\n to: zoomLevel\n }, {\n property: \"x\",\n from: this.seriesContainer.pixelX,\n to: x\n }, {\n property: \"y\",\n from: this.seriesContainer.pixelY,\n to: y\n }], duration, this.zoomEasing);\n\n this._disposers.push(this._mapAnimation.events.on(\"animationended\", function () {\n _this._zoomGeoPointReal = _this.zoomGeoPoint;\n }));\n\n this.seriesContainer.validatePosition();\n return this._mapAnimation;\n }\n };\n /**\r\n * Zooms the map to a particular map object.\r\n *\r\n * @param mapObject Target map object\r\n * @param zoomLevel Zoom level\r\n * @param center Center on the given coordinate?\r\n * @param duration Duration for zoom animation (ms)\r\n * @return Zoom animation\r\n */\n\n\n MapChart.prototype.zoomToMapObject = function (mapObject, zoomLevel, center, duration) {\n if (center == undefined) {\n center = true;\n }\n\n var inertia = this.seriesContainer.interactions.inertias.getKey(\"move\");\n\n if (inertia) {\n inertia.done();\n }\n\n if (mapObject instanceof MapImage) {\n if ($type.isNaN(zoomLevel)) {\n zoomLevel = 5;\n }\n\n return this.zoomToGeoPoint({\n latitude: mapObject.latitude,\n longitude: mapObject.longitude\n }, zoomLevel, center, duration, true);\n }\n\n var dataItem = mapObject.dataItem;\n\n if (dataItem && $type.isNumber(dataItem.zoomLevel)) {\n zoomLevel = dataItem.zoomLevel;\n }\n\n if (mapObject instanceof MapPolygon) {\n var dataItem_1 = mapObject.dataItem;\n var bbox = mapObject.polygon.bbox;\n\n if (bbox.width == 0 || bbox.height == 0) {\n bbox = mapObject.polygon.group.getBBox();\n }\n\n if (!$type.isNumber(zoomLevel)) {\n zoomLevel = Math.min(this.seriesWidth / bbox.width, this.seriesHeight / bbox.height);\n }\n\n var geoPoint = void 0;\n\n if (dataItem_1 && $type.hasValue(dataItem_1.zoomGeoPoint)) {\n geoPoint = dataItem_1.zoomGeoPoint;\n } else {\n // this is more accurate\n var polygonPoint = {\n x: bbox.x + bbox.width / 2,\n y: bbox.y + bbox.height / 2\n };\n var seriesPoint = $utils.spritePointToSprite(polygonPoint, mapObject.polygon, mapObject.series);\n geoPoint = this.seriesPointToGeo(seriesPoint);\n }\n\n return this.zoomToGeoPoint(geoPoint, zoomLevel, true, duration, true);\n }\n };\n /**\r\n * Zooms the map to a particular viewport.\r\n *\r\n * The `north`, `east`, `south`, and `west` define boundaries of the\r\n * imaginary viewort we want to zoom the map to.\r\n *\r\n * `level` is not actual zoom level. The map will determine the zoom level\r\n * required to accommodated such zoom, and will adjust it by `level` if set.\r\n *\r\n * @param north Latitude of the North-most boundary\r\n * @param east Longitude of the East-most boundary\r\n * @param south Latitude of the South-most boundary\r\n * @param west Longitude of the West-most boundary\r\n * @param level Adjust zoom level\r\n * @param center Center on the given coordinate?\r\n * @param duration Duration for zoom animation (ms)\r\n * @return Zoom animation\r\n */\n\n\n MapChart.prototype.zoomToRectangle = function (north, east, south, west, level, center, duration) {\n if ($type.isNaN(level)) {\n level = 1;\n }\n\n var w = $math.min(west, east);\n var e = $math.max(west, east);\n west = w;\n east = e;\n var splitLongitude = $math.normalizeAngle(180 - this.deltaLongitude);\n\n if (splitLongitude > 180) {\n splitLongitude -= 360;\n }\n\n var newLong = west + (east - west) / 2;\n var d = west - east;\n\n if (west < splitLongitude && east > splitLongitude) {\n newLong += 180;\n d = $math.normalizeAngle(east - west - 360);\n }\n\n var zoomLevel = level * Math.min((this.south - this.north) / (south - north), Math.abs((this.west - this.east) / d));\n return this.zoomToGeoPoint({\n latitude: north + (south - north) / 2,\n longitude: newLong\n }, zoomLevel, center, duration, true);\n };\n /**\r\n * Zooms in the map, optionally centering on particular latitude/longitude\r\n * point.\r\n *\r\n * @param geoPoint Optional center point\r\n * @param duration Duration for zoom animation (ms)\r\n * @return Zoom animation\r\n */\n\n\n MapChart.prototype.zoomIn = function (geoPoint, duration, sensitivity) {\n if (sensitivity === void 0) {\n sensitivity = 1;\n }\n\n var step = 1 + (this.zoomStep - 1) * sensitivity;\n\n if (step < 1) {\n step = 1;\n }\n\n return this.zoomToGeoPoint(geoPoint, this.zoomLevel * step, false, duration);\n };\n /**\r\n * Zooms out the map, optionally centering on particular latitude/longitude\r\n * point.\r\n *\r\n * @param geoPoint Optional center point\r\n * @param duration Duration for zoom animation (ms)\r\n * @return Zoom animation\r\n */\n\n\n MapChart.prototype.zoomOut = function (geoPoint, duration, sensitivity) {\n if (sensitivity === void 0) {\n sensitivity = 1;\n }\n\n var step = 1 + (this.zoomStep - 1) * sensitivity;\n\n if (step < 1) {\n step = 1;\n }\n\n return this.zoomToGeoPoint(geoPoint, this.zoomLevel / step, false, duration);\n };\n /**\r\n * Pans the maps using relative coordinates. E.g.:\r\n *\r\n * ```JSON\r\n * {\r\n * x: 0.1,\r\n * y: -0.1\r\n * }\r\n * ```\r\n *\r\n * The above will move the map by 10% to the right, and by 10% upwards.\r\n *\r\n * @param shift Vertical and horizontal shift\r\n * @param duration Pan animation duration (ms)\r\n */\n\n\n MapChart.prototype.pan = function (shift, duration) {\n var point = this.geoPointToSVG(this.zoomGeoPoint);\n point.x += this.pixelWidth * shift.x;\n point.y += this.pixelHeight * shift.y;\n this.zoomToGeoPoint(this.svgPointToGeo(point), this.zoomLevel, true, duration, true);\n };\n\n Object.defineProperty(MapChart.prototype, \"zoomGeoPoint\", {\n /**\r\n * Current lat/long coordinates for the center of the viewport. (default\r\n * zoom reference point)\r\n *\r\n * @readonly\r\n * @return Coordinates\r\n */\n get: function get() {\n var point = $utils.spritePointToSvg({\n x: this.pixelWidth / 2,\n y: this.pixelHeight / 2\n }, this);\n return this.svgPointToGeo(point);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"zoomLevel\", {\n /**\r\n * @return Zoom level\r\n */\n get: function get() {\n return this.seriesContainer.scale;\n },\n\n /**\r\n * Current zoom level.\r\n *\r\n * @readonly\r\n * @return Zoom level\r\n */\n set: function set(value) {\n this.seriesContainer.scale = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Dispatches events after some map transformation, like pan or zoom.\r\n *\r\n * @ignore\r\n */\n\n MapChart.prototype.handleMapTransform = function () {\n if (this.zoomLevel != this._prevZoomLevel) {\n this.dispatch(\"zoomlevelchanged\");\n this._prevZoomLevel = this.zoomLevel;\n this.svgContainer.readerAlert(this.language.translate(\"Zoom level changed to %1\", this.language.locale, $type.castString(this.zoomLevel)));\n }\n\n if (this.zoomGeoPoint && (this._prevZoomGeoPoint.latitude != this.zoomGeoPoint.latitude || this._prevZoomGeoPoint.longitude != this.zoomGeoPoint.longitude)) {\n this.dispatch(\"mappositionchanged\");\n }\n };\n\n Object.defineProperty(MapChart.prototype, \"smallMap\", {\n /**\r\n * @return Small map\r\n */\n get: function get() {\n if (!this._smallMap) {\n var smallMap = new SmallMap();\n this.smallMap = smallMap;\n }\n\n return this._smallMap;\n },\n\n /**\r\n * A [[SmallMap]] to be used on the map.\r\n *\r\n * Please note, that accessing this property will NOT create a small map\r\n * if it has not yet been created. (except in JSON)\r\n *\r\n * ```TypeScript\r\n * // Create a small map\r\n * map.smallMap = new am4maps.SmallMap();\r\n * ```\r\n * ```JavaScript\r\n * // Create a small map\r\n * map.smallMap = new am4maps.SmallMap();\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"smallMap\": {}\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @param smallMap Small map\r\n */\n set: function set(smallMap) {\n if (this._smallMap) {\n this.removeDispose(this._smallMap);\n }\n\n this._smallMap = smallMap;\n this._smallMap.chart = this;\n smallMap.parent = this.chartContainer;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"zoomControl\", {\n /**\r\n * @return Zoom control\r\n */\n get: function get() {\n return this._zoomControl;\n },\n\n /**\r\n * A [[ZoomControl]] to be used on the map.\r\n *\r\n * Please note, that accessing this property will NOT create a zoom control\r\n * if it has not yet been created. (except in JSON)\r\n *\r\n * ```TypeScript\r\n * // Create a zoom control\r\n * map.zoomControl = new am4maps.ZoomControl();\r\n * ```\r\n * ```JavaScript\r\n * // Create a zoom control\r\n * map.zoomControl = new am4maps.ZoomControl();\r\n * ```\r\n * ```JSON\r\n * {\r\n * // ...\r\n * \"zoomControl\": {}\r\n * // ...\r\n * }\r\n * ```\r\n *\r\n * @param zoomControl Zoom control\r\n */\n set: function set(zoomControl) {\n if (this._zoomControl) {\n this.removeDispose(this._zoomControl);\n }\n\n this._zoomControl = zoomControl;\n zoomControl.chart = this;\n zoomControl.parent = this.chartContainer;\n zoomControl.plusButton.exportable = false;\n zoomControl.minusButton.exportable = false;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates and returns a map series of appropriate type.\r\n *\r\n * @return Map series\r\n */\n\n MapChart.prototype.createSeries = function () {\n return new MapSeries();\n };\n\n Object.defineProperty(MapChart.prototype, \"deltaLongitude\", {\n /**\r\n * @return Rotation\r\n */\n get: function get() {\n return this.getPropertyValue(\"deltaLongitude\");\n },\n\n /**\r\n * Degrees to rotate the map around vertical axis (Y).\r\n *\r\n * E.g. if set to -160, the longitude 20 will become a new center, creating\r\n * a Pacific-centered map.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/chart-types/map/#Map_rotation} For more info on map rotation.\r\n * @param value Rotation\r\n */\n set: function set(value) {\n value = $math.round(value, 3);\n\n if (this.setPropertyValue(\"deltaLongitude\", $geo.wrapAngleTo180(value))) {\n this.rotateMap();\n this.updateZoomGeoPoint();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"deltaLatitude\", {\n /**\r\n * @return Rotation\r\n */\n get: function get() {\n return this.getPropertyValue(\"deltaLatitude\");\n },\n\n /**\r\n * Degrees to rotate the map around horizontal axis (X).\r\n *\r\n * E.g. setting this to 90 will put Antarctica directly in the center of\r\n * the map.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/chart-types/map/#Map_rotation} For more info on map rotation.\r\n * @since 4.3.0\r\n * @param value Rotation\r\n */\n set: function set(value) {\n value = $math.round(value, 3);\n\n if (this.setPropertyValue(\"deltaLatitude\", value)) {\n this.rotateMap();\n this.updateZoomGeoPoint();\n }\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"deltaGamma\", {\n /**\r\n * @return Rotation\r\n */\n get: function get() {\n return this.getPropertyValue(\"deltaGamma\");\n },\n\n /**\r\n * Degrees to rotate the map around \"Z\" axis. This is the axis that pierces\r\n * the globe directly from the viewer's point of view.\r\n *\r\n * @see {@link https://www.amcharts.com/docs/v4/chart-types/map/#Map_rotation} For more info on map rotation.\r\n * @since 4.3.0\r\n * @param value Rotation\r\n */\n set: function set(value) {\n value = $math.round(value, 3);\n\n if (this.setPropertyValue(\"deltaGamma\", value)) {\n this.rotateMap();\n this.updateZoomGeoPoint();\n }\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * @ignore\r\n */\n\n MapChart.prototype.rotateMap = function () {\n if (this.projection.d3Projection) {\n if (this.projection.d3Projection.rotate) {\n this.projection.d3Projection.rotate([this.deltaLongitude, this.deltaLatitude, this.deltaGamma]);\n this.invalidateProjection(); //this.updateExtremes(); // removal fixes #3292\n }\n }\n };\n\n Object.defineProperty(MapChart.prototype, \"maxPanOut\", {\n /**\r\n * @return Max pan out\r\n */\n get: function get() {\n return this.getPropertyValue(\"maxPanOut\");\n },\n\n /**\r\n * Maximum portion of the map's width/height to allow panning \"off screen\".\r\n *\r\n * A value of 0 (zero) will prevent any portion of the the map to be panned\r\n * outside the viewport.\r\n *\r\n * 0.5 will allow half of the map to be outside viewable area.\r\n *\r\n * @default 0.7\r\n * @param value Max pan out\r\n */\n set: function set(value) {\n this.setPropertyValue(\"maxPanOut\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"homeGeoPoint\", {\n /**\r\n * @return Home geo point\r\n */\n get: function get() {\n return this.getPropertyValue(\"homeGeoPoint\");\n },\n\n /**\r\n * The geographical point to center map on when it is first loaded.\r\n *\r\n * The map will also be centered to this point when you call `goHome()`\r\n * method.\r\n *\r\n * @param value Home geo point\r\n */\n set: function set(value) {\n this.setPropertyValue(\"homeGeoPoint\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"homeZoomLevel\", {\n /**\r\n * @return Home zoom level\r\n */\n get: function get() {\n return this.getPropertyValue(\"homeZoomLevel\");\n },\n\n /**\r\n * The zoom level to put the map in when it is first loaded.\r\n *\r\n * The map will also be set to this zoom level when you call `goHome()`\r\n * method.\r\n *\r\n * @param value Home zoom level\r\n */\n set: function set(value) {\n this.setPropertyValue(\"homeZoomLevel\", value);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(MapChart.prototype, \"zoomStep\", {\n /**\r\n * @return Zoom factor\r\n */\n get: function get() {\n return this.getPropertyValue(\"zoomStep\");\n },\n\n /**\r\n * When user zooms in or out current zoom level is multiplied or divided\r\n * by value of this setting.\r\n *\r\n * @default 2\r\n * @param value Zoom factor\r\n */\n set: function set(value) {\n this.setPropertyValue(\"zoomStep\", value);\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Invalidates projection, causing all series to be redrawn.\r\n *\r\n * Call this after changing projection or its settings.\r\n */\n\n MapChart.prototype.invalidateProjection = function () {\n this.east = undefined;\n this.invalidateDataUsers();\n this.updateCenterGeoPoint();\n };\n\n Object.defineProperty(MapChart.prototype, \"geodataSource\", {\n /**\r\n * Returns a [[DataSource]] specifically for loading Component's data.\r\n *\r\n * @return Data source\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._dataSources[\"geodata\"]) {\n var dataSource = this.getDataSource(\"geodata\");\n dataSource.events.on(\"parseended\", function () {\n _this.events.once(\"datavalidated\", function () {\n _this.goHome(0);\n });\n });\n }\n\n return this._dataSources[\"geodata\"];\n },\n\n /**\r\n * Sets a [[DataSource]] to be used for loading Component's data.\r\n *\r\n * @param value Data source\r\n */\n set: function set(value) {\n var _this = this;\n\n if (this._dataSources[\"geodata\"]) {\n this.removeDispose(this._dataSources[\"geodata\"]);\n }\n\n this._dataSources[\"geodata\"] = value;\n this._dataSources[\"geodata\"].component = this;\n this.events.on(\"inited\", function () {\n _this.loadData(\"geodata\");\n }, this, false);\n this.setDataSourceEvents(value, \"geodata\");\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Processes JSON-based config before it is applied to the object.\r\n *\r\n * @ignore Exclude from docs\r\n * @param config Config\r\n */\n\n MapChart.prototype.processConfig = function (config) {\n if ($type.hasValue(config[\"geodata\"]) && $type.isString(config[\"geodata\"])) {\n var name_1 = config[\"geodata\"]; // Check if there's a map loaded by such name\n\n if ($type.hasValue(window[\"am4geodata_\" + config[\"geodata\"]])) {\n config[\"geodata\"] = window[\"am4geodata_\" + config[\"geodata\"]];\n } // Nope. Let's try maybe we got JSON as string?\n else {\n try {\n config[\"geodata\"] = JSON.parse(config[\"geodata\"]);\n } catch (e) {\n // No go again. Error out.\n this.raiseCriticalError(Error(\"MapChart error: Geodata `\" + name_1 + \"` is not loaded or is incorrect.\"), true);\n }\n }\n } // Instantiate projection\n\n\n if ($type.hasValue(config[\"projection\"]) && $type.isString(config[\"projection\"])) {\n config[\"projection\"] = this.createClassInstance(config[\"projection\"]);\n } // Set up small map\n\n\n if ($type.hasValue(config.smallMap) && !$type.hasValue(config.smallMap.type)) {\n config.smallMap.type = \"SmallMap\";\n } // Set up zoom control\n\n\n if ($type.hasValue(config.zoomControl) && !$type.hasValue(config.zoomControl.type)) {\n config.zoomControl.type = \"ZoomControl\";\n }\n\n _super.prototype.processConfig.call(this, config);\n };\n /**\r\n * Decorates a new [[Series]] object with required parameters when it is\r\n * added to the chart.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n MapChart.prototype.handleSeriesAdded = function (event) {\n _super.prototype.handleSeriesAdded.call(this, event);\n\n var series = event.newValue;\n series.scale = this.scaleRatio;\n series.events.on(\"validated\", this.updateCenterGeoPoint, this, false);\n };\n /**\r\n * This function is used to sort element's JSON config properties, so that\r\n * some properties that absolutely need to be processed last, can be put at\r\n * the end.\r\n *\r\n * @ignore Exclude from docs\r\n * @param a Element 1\r\n * @param b Element 2\r\n * @return Sorting number\r\n */\n\n\n MapChart.prototype.configOrder = function (a, b) {\n if (a == b) {\n return 0;\n } // Must come last\n else if (a == \"smallMap\") {\n return 1;\n } else if (b == \"smallMap\") {\n return -1;\n } else if (a == \"series\") {\n return 1;\n } else if (b == \"series\") {\n return -1;\n } else {\n return _super.prototype.configOrder.call(this, a, b);\n }\n };\n /**\r\n * Adds `projection` to \"as is\" fields.\r\n *\r\n * @param field Field name\r\n * @return Assign as is?\r\n */\n\n\n MapChart.prototype.asIs = function (field) {\n return field == \"projection\" || field == \"geodata\" || _super.prototype.asIs.call(this, field);\n };\n\n Object.defineProperty(MapChart.prototype, \"centerGeoPoint\", {\n /**\r\n * Geo point of map center\r\n *\r\n * @readonly\r\n */\n get: function get() {\n return this._centerGeoPoint;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Resets the map to its original position and zoom level.\r\n *\r\n * Use the only parameter to set number of milliseconds for the zoom\r\n * animation to play.\r\n *\r\n * @param duration Duration (ms)\r\n */\n\n MapChart.prototype.goHome = function (duration) {\n var homeGeoPoint = this.homeGeoPoint;\n\n if (!homeGeoPoint) {\n homeGeoPoint = this.centerGeoPoint;\n }\n\n if (homeGeoPoint) {\n this.zoomToGeoPoint(homeGeoPoint, this.homeZoomLevel, true, duration, true);\n }\n };\n /**\r\n * Sets [[Paper]] instance to use to draw elements.\r\n *\r\n * @ignore\r\n * @param paper Paper\r\n * @return true if paper was changed, false, if it's the same\r\n */\n\n\n MapChart.prototype.setPaper = function (paper) {\n if (this.svgContainer) {\n this.svgContainer.hideOverflow = true;\n }\n\n return _super.prototype.setPaper.call(this, paper);\n };\n\n Object.defineProperty(MapChart.prototype, \"backgroundSeries\", {\n /**\r\n * Background series will create polygons that will fill all the map area\r\n * with some color (or other fill).\r\n *\r\n * This might be useful with non-rectangular projections, like Orthographic,\r\n * Albers, etc.\r\n *\r\n * To change background color/opacity access polygon template.\r\n *\r\n * ```TypeScript\r\n * chart.backgroundSeries.mapPolygons.template.polygon.fill = am4core.color(\"#fff\");\r\n * chart.backgroundSeries.mapPolygons.template.polygon.fillOpacity = 0.1;\r\n * ```\r\n * ```JavaScript\r\n * chart.backgroundSeries.mapPolygons.template.polygon.fill = am4core.color(\"#fff\");\r\n * chart.backgroundSeries.mapPolygons.template.polygon.fillOpacity = 0.1;\r\n * ```\r\n * ```JSON\r\n * {\r\n * \"backgroundSeries\": {\r\n * \"mapPolygons\": {\r\n * \"polygon\": {\r\n * \"fill\": \"#fff\",\r\n * \"fillOpacity\": 0.1\r\n * }\r\n * }\r\n * }\r\n * }\r\n * ```\r\n *\r\n * @since 4.3.0\r\n */\n get: function get() {\n var _this = this;\n\n if (!this._backgroundSeries) {\n var backgroundSeries = new MapPolygonSeries();\n backgroundSeries.parent = this.seriesContainer;\n backgroundSeries.chart = this;\n backgroundSeries.hiddenInLegend = true;\n backgroundSeries.mapPolygons.template.focusable = false;\n backgroundSeries.addDisposer(new Disposer(function () {\n _this._backgroundSeries = undefined;\n }));\n\n this._disposers.push(backgroundSeries);\n\n var interfaceColors = new InterfaceColorSet();\n var color = interfaceColors.getFor(\"background\");\n var polygonTemplate = backgroundSeries.mapPolygons.template.polygon;\n polygonTemplate.stroke = color;\n polygonTemplate.fill = color;\n polygonTemplate.fillOpacity = 0;\n polygonTemplate.strokeOpacity = 0; //polygonTemplate.focusable = false;\n\n backgroundSeries.mapPolygons.create();\n this._backgroundSeries = backgroundSeries;\n }\n\n return this._backgroundSeries;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Prepares the legend instance for use in this chart.\r\n *\r\n * @param legend Legend\r\n */\n\n MapChart.prototype.setLegend = function (legend) {\n _super.prototype.setLegend.call(this, legend);\n\n if (legend) {\n legend.parent = this;\n }\n };\n /**\r\n * @param value Tap to activate?\r\n */\n\n\n MapChart.prototype.setTapToActivate = function (value) {\n _super.prototype.setTapToActivate.call(this, value); // setup other containers\n\n\n this.seriesContainer.interactions.isTouchProtected = true;\n this.panSprite.interactions.isTouchProtected = true;\n };\n\n MapChart.prototype.handleTapToActivate = function () {\n _super.prototype.handleTapToActivate.call(this);\n\n this.seriesContainer.interactions.isTouchProtected = false;\n this.panSprite.interactions.isTouchProtected = false;\n };\n\n MapChart.prototype.handleTapToActivateDeactivation = function () {\n _super.prototype.handleTapToActivateDeactivation.call(this);\n\n this.seriesContainer.interactions.isTouchProtected = true;\n this.panSprite.interactions.isTouchProtected = true;\n };\n /**\r\n * Adds easing functions to \"function\" fields.\r\n *\r\n * @param field Field name\r\n * @return Assign as function?\r\n */\n\n\n MapChart.prototype.asFunction = function (field) {\n return field == \"zoomEasing\" || _super.prototype.asIs.call(this, field);\n };\n /**\r\n * @ignore\r\n * @return Has license?\r\n */\n\n\n MapChart.prototype.hasLicense = function () {\n if (options.commercialLicense) {\n return true;\n }\n\n if (!_super.prototype.hasLicense.call(this)) {\n return false;\n }\n\n for (var i = 0; i < options.licenses.length; i++) {\n if (options.licenses[i].match(/^MP.{5,}/i)) {\n return true;\n }\n }\n\n return false;\n };\n\n return MapChart;\n}(SerialChart);\n\nexport { MapChart };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapChart\"] = MapChart;","/**\r\n * Map spline module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapLine } from \"./MapLine\";\nimport { Polyspline } from \"../../core/elements/Polyspline\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw a spline on the map.\r\n *\r\n * @see {@link IMapSplineEvents} for a list of available events\r\n * @see {@link IMapSplineAdapters} for a list of available Adapters\r\n */\n\nvar MapSpline =\n/** @class */\nfunction (_super) {\n __extends(MapSpline, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapSpline() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"MapSpline\"; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapSpline.prototype.createLine = function () {\n this.line = new Polyspline();\n this.line.tensionX = 0.8;\n this.line.tensionY = 0.8;\n };\n\n Object.defineProperty(MapSpline.prototype, \"shortestDistance\", {\n /**\r\n * ShortestDistance = true is not supported by MapSpline, only MapLine does support it\r\n * @default false\r\n * @param value\r\n * @todo: review description\r\n */\n get: function get() {\n return false;\n },\n set: function set(value) {},\n enumerable: true,\n configurable: true\n });\n return MapSpline;\n}(MapLine);\n\nexport { MapSpline };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapSpline\"] = MapSpline;","/**\r\n * Map arched line module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapLine } from \"./MapLine\";\nimport { Polyarc } from \"../../core/elements/Polyarc\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Used to draw an arched line on the map.\r\n *\r\n * @see {@link IMapArcEvents} for a list of available events\r\n * @see {@link IMapArcAdapters} for a list of available Adapters\r\n */\n\nvar MapArc =\n/** @class */\nfunction (_super) {\n __extends(MapArc, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapArc() {\n var _this = // Init\n _super.call(this) || this;\n\n _this.className = \"MapArc\"; // Apply theme\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n MapArc.prototype.createLine = function () {\n this.line = new Polyarc();\n };\n\n Object.defineProperty(MapArc.prototype, \"shortestDistance\", {\n get: function get() {\n return false;\n },\n\n /**\r\n * `shortestDistance = true` is not supported by `MapArc`.\r\n *\r\n * Only [[MapLine]] supports it.\r\n *\r\n * @default false\r\n * @param value\r\n */\n set: function set(value) {},\n enumerable: true,\n configurable: true\n });\n return MapArc;\n}(MapLine);\n\nexport { MapArc };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapArc\"] = MapArc;","/**\r\n * Map spline series module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapLineSeries, MapLineSeriesDataItem } from \"./MapLineSeries\";\nimport { MapSpline } from \"./MapSpline\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapSplineSeries]]\r\n * @see {@link DataItem}\r\n */\n\nvar MapSplineSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapSplineSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapSplineSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapSplineSeriesDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n return MapSplineSeriesDataItem;\n}(MapLineSeriesDataItem);\n\nexport { MapSplineSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A series of map spline elements.\r\n *\r\n * @see {@link IMapSplineSeriesEvents} for a list of available Events\r\n * @see {@link IMapSplineSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar MapSplineSeries =\n/** @class */\nfunction (_super) {\n __extends(MapSplineSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapSplineSeries() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapSplineSeries\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n MapSplineSeries.prototype.createDataItem = function () {\n return new MapSplineSeriesDataItem();\n };\n /**\r\n * Returns a new line instance of suitable type.\r\n *\r\n * @return New line\r\n */\n\n\n MapSplineSeries.prototype.createLine = function () {\n return new MapSpline();\n };\n\n return MapSplineSeries;\n}(MapLineSeries);\n\nexport { MapSplineSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapSplineSeries\"] = MapSplineSeries;\nregistry.registeredClasses[\"MapSplineSeriesDataItem\"] = MapSplineSeriesDataItem;","/**\r\n * Map arc series module.\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { MapLineSeries, MapLineSeriesDataItem } from \"./MapLineSeries\";\nimport { MapArc } from \"./MapArc\";\nimport { registry } from \"../../core/Registry\";\n/**\r\n * ============================================================================\r\n * DATA ITEM\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Defines a [[DataItem]] for [[MapArcSeries]].\r\n *\r\n * @see {@link DataItem}\r\n */\n\nvar MapArcSeriesDataItem =\n/** @class */\nfunction (_super) {\n __extends(MapArcSeriesDataItem, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapArcSeriesDataItem() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapArcSeriesDataItem\";\n\n _this.applyTheme();\n\n return _this;\n }\n\n return MapArcSeriesDataItem;\n}(MapLineSeriesDataItem);\n\nexport { MapArcSeriesDataItem };\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * A series of arc elements. (curved lines)\r\n *\r\n * @see {@link IMapArcSeriesEvents} for a list of available Events\r\n * @see {@link IMapArcSeriesAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar MapArcSeries =\n/** @class */\nfunction (_super) {\n __extends(MapArcSeries, _super);\n /**\r\n * Constructor\r\n */\n\n\n function MapArcSeries() {\n var _this = _super.call(this) || this;\n\n _this.className = \"MapArcSeries\";\n\n _this.applyTheme();\n\n return _this;\n }\n /**\r\n * Returns a new/empty DataItem of the type appropriate for this object.\r\n *\r\n * @see {@link DataItem}\r\n * @return Data Item\r\n */\n\n\n MapArcSeries.prototype.createDataItem = function () {\n return new MapArcSeriesDataItem();\n };\n /**\r\n * Returns a new line instance of suitable type.\r\n *\r\n * @return New line\r\n */\n\n\n MapArcSeries.prototype.createLine = function () {\n return new MapArc();\n };\n\n return MapArcSeries;\n}(MapLineSeries);\n\nexport { MapArcSeries };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"MapArcSeries\"] = MapArcSeries;\nregistry.registeredClasses[\"MapArcSeriesDataItem\"] = MapArcSeriesDataItem;","/**\r\n * Zoom control module\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Container } from \"../../core/Container\";\nimport { Button } from \"../../core/elements/Button\";\nimport { RoundedRectangle } from \"../../core/elements/RoundedRectangle\";\nimport { MutableValueDisposer, MultiDisposer } from \"../../core/utils/Disposer\";\nimport { keyboard } from \"../../core/utils/Keyboard\";\nimport { getInteraction } from \"../../core/interaction/Interaction\";\nimport { percent } from \"../../core/utils/Percent\";\nimport { registry } from \"../../core/Registry\";\nimport { InterfaceColorSet } from \"../../core/utils/InterfaceColorSet\";\n/**\r\n * ============================================================================\r\n * MAIN CLASS\r\n * ============================================================================\r\n * @hidden\r\n */\n\n/**\r\n * Creates a control for zooming the map.\r\n *\r\n * @see {@link IZoomControlEvents} for a list of available events\r\n * @see {@link IZoomControlAdapters} for a list of available Adapters\r\n * @important\r\n */\n\nvar ZoomControl =\n/** @class */\nfunction (_super) {\n __extends(ZoomControl, _super);\n /**\r\n * Constructor\r\n */\n\n\n function ZoomControl() {\n var _this = _super.call(this) || this;\n /**\r\n * A target map.\r\n */\n\n\n _this._chart = new MutableValueDisposer();\n _this.className = \"ZoomControl\";\n _this.align = \"right\";\n _this.valign = \"bottom\";\n _this.layout = \"vertical\";\n\n _this.padding(5, 5, 5, 5);\n\n var interfaceColors = new InterfaceColorSet();\n\n var plusButton = _this.createChild(Button);\n\n plusButton.shouldClone = false;\n plusButton.label.text = \"+\"; //plusButton.fontFamily = \"Verdana\";\n\n _this.plusButton = plusButton;\n\n var slider = _this.createChild(Container);\n\n slider.shouldClone = false;\n slider.background.fill = interfaceColors.getFor(\"alternativeBackground\");\n slider.background.fillOpacity = 0.05;\n slider.background.events.on(\"hit\", _this.handleBackgroundClick, _this, false);\n slider.events.on(\"sizechanged\", _this.updateThumbSize, _this, false);\n _this.slider = slider;\n var thumb = slider.createChild(Button);\n thumb.shouldClone = false;\n thumb.padding(0, 0, 0, 0);\n thumb.draggable = true;\n thumb.events.on(\"drag\", _this.handleThumbDrag, _this, false);\n _this.thumb = thumb;\n\n var minusButton = _this.createChild(Button);\n\n minusButton.shouldClone = false;\n minusButton.label.text = \"-\"; //minusButton.fontFamily = \"Verdana\";\n\n _this.minusButton = minusButton; // Set roles\n\n _this.thumb.role = \"slider\";\n _this.thumb.readerLive = \"polite\"; // Set reader text\n\n _this.thumb.readerTitle = _this.language.translate(\"Use arrow keys to zoom in and out\");\n _this.minusButton.readerTitle = _this.language.translate(\"Press ENTER to zoom in\");\n _this.plusButton.readerTitle = _this.language.translate(\"Press ENTER to zoom out\");\n\n _this.applyTheme();\n\n _this.events.on(\"propertychanged\", function (event) {\n if (event.property == \"layout\") {\n _this.fixLayout();\n }\n }, undefined, false);\n\n _this._disposers.push(_this._chart);\n\n _this.fixLayout();\n\n return _this;\n }\n /**\r\n * @ignore\r\n */\n\n\n ZoomControl.prototype.fixLayout = function () {\n var plusButton = this.plusButton;\n var minusButton = this.minusButton;\n var thumb = this.thumb;\n var slider = this.slider;\n plusButton.x = undefined;\n plusButton.y = undefined;\n minusButton.x = undefined;\n minusButton.y = undefined;\n thumb.x = undefined;\n thumb.y = undefined;\n slider.x = undefined;\n slider.y = undefined;\n plusButton.padding(6, 10, 6, 10);\n minusButton.padding(6, 10, 6, 10);\n minusButton.label.align = \"center\";\n minusButton.label.valign = \"middle\";\n plusButton.label.align = \"center\";\n plusButton.label.valign = \"middle\";\n\n if (this.layout == \"vertical\") {\n this.width = 40;\n this.height = undefined;\n minusButton.width = percent(100);\n minusButton.height = undefined;\n thumb.width = percent(100);\n thumb.height = undefined;\n plusButton.width = percent(100);\n plusButton.height = undefined;\n slider.width = percent(100);\n minusButton.marginTop = 1;\n plusButton.marginBottom = 2;\n slider.height = 0;\n minusButton.toFront();\n plusButton.toBack();\n thumb.minX = 0;\n thumb.maxX = 0;\n thumb.minY = 0;\n } else if (this.layout == \"horizontal\") {\n this.height = 40;\n this.width = undefined;\n minusButton.height = percent(100);\n minusButton.width = undefined;\n plusButton.height = percent(100);\n plusButton.width = undefined;\n thumb.height = percent(100);\n thumb.width = undefined;\n thumb.minX = 0;\n thumb.minY = 0;\n thumb.maxY = 0;\n slider.height = percent(100);\n slider.width = 0;\n minusButton.toBack();\n plusButton.toFront();\n }\n };\n /**\r\n * Handles zoom operation after clicking on the slider background.\r\n *\r\n * @ignore Exclude from docs\r\n * @param event Event\r\n */\n\n\n ZoomControl.prototype.handleBackgroundClick = function (event) {\n var sprite = event.target;\n var y = event.spritePoint.y;\n var chart = this.chart;\n var maxPower = Math.log(chart.maxZoomLevel) / Math.LN2;\n var minPower = Math.log(chart.minZoomLevel) / Math.LN2;\n var power = (sprite.pixelHeight - y) / sprite.pixelHeight * (minPower + (maxPower - minPower));\n var zoomLevel = Math.pow(2, power);\n chart.zoomToGeoPoint(chart.zoomGeoPoint, zoomLevel);\n };\n\n Object.defineProperty(ZoomControl.prototype, \"chart\", {\n /**\r\n * @return Map/chart\r\n */\n get: function get() {\n return this._chart.get();\n },\n\n /**\r\n * A main chart/map that this zoom control is for.\r\n *\r\n * @param chart Map/chart\r\n */\n set: function set(chart) {\n var _this = this;\n\n this._chart.set(chart, new MultiDisposer([chart.events.on(\"maxsizechanged\", this.updateThumbSize, this, false), chart.events.on(\"zoomlevelchanged\", this.updateThumb, this, false), this.minusButton.events.on(\"hit\", function () {\n chart.zoomOut(chart.zoomGeoPoint);\n }, chart, false), getInteraction().body.events.on(\"keyup\", function (ev) {\n if (_this.topParent.hasFocused) {\n // ENTER is now handled globally\n if (keyboard.isKey(ev.event, \"plus\")) {\n chart.zoomIn();\n } else if (keyboard.isKey(ev.event, \"minus\")) {\n chart.zoomOut();\n }\n }\n }, chart), this.plusButton.events.on(\"hit\", function () {\n chart.zoomIn(chart.zoomGeoPoint);\n }, chart, false)]));\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Updates the slider's thumb size based on the available zoom space.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n ZoomControl.prototype.updateThumbSize = function () {\n var chart = this.chart;\n\n if (chart) {\n var slider = this.slider;\n var thumb = this.thumb;\n\n if (this.layout == \"vertical\") {\n thumb.minHeight = Math.min(this.slider.pixelHeight, 20);\n thumb.height = slider.pixelHeight / this.stepCount;\n thumb.maxY = slider.pixelHeight - thumb.pixelHeight;\n\n if (thumb.pixelHeight <= 1) {\n thumb.visible = false;\n } else {\n thumb.visible = true;\n }\n } else {\n thumb.minWidth = Math.min(this.slider.pixelWidth, 20);\n thumb.width = slider.pixelWidth / this.stepCount;\n thumb.maxX = slider.pixelWidth - thumb.pixelWidth;\n\n if (thumb.pixelWidth <= 1) {\n thumb.visible = false;\n } else {\n thumb.visible = true;\n }\n }\n }\n };\n /**\r\n * Updates thumb according to current zoom position from map.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n ZoomControl.prototype.updateThumb = function () {\n var slider = this.slider;\n var chart = this.chart;\n var thumb = this.thumb;\n\n if (!thumb.isDown) {\n var step = (Math.log(chart.zoomLevel) - Math.log(this.chart.minZoomLevel)) / Math.LN2;\n\n if (this.layout == \"vertical\") {\n thumb.y = slider.pixelHeight - (slider.pixelHeight - thumb.pixelHeight) * step / this.stepCount - thumb.pixelHeight;\n } else {\n thumb.x = slider.pixelWidth * step / this.stepCount;\n }\n }\n };\n /**\r\n * Zooms the actual map when slider position changes.\r\n *\r\n * @ignore Exclude from docs\r\n */\n\n\n ZoomControl.prototype.handleThumbDrag = function () {\n var slider = this.slider;\n var chart = this.chart;\n var thumb = this.thumb;\n var step;\n var minStep = Math.log(this.chart.minZoomLevel) / Math.LN2;\n\n if (this.layout == \"vertical\") {\n step = this.stepCount * (slider.pixelHeight - thumb.pixelY - thumb.pixelHeight) / (slider.pixelHeight - thumb.pixelHeight);\n } else {\n step = this.stepCount * thumb.pixelX / slider.pixelWidth;\n }\n\n step = minStep + step;\n var zoomLevel = Math.pow(2, step);\n chart.zoomToGeoPoint(undefined, zoomLevel, false, 0);\n };\n\n Object.defineProperty(ZoomControl.prototype, \"stepCount\", {\n /**\r\n * Returns the step countfor the slider grid according to map's min and max\r\n * zoom level settings.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Step count\r\n */\n get: function get() {\n return Math.log(this.chart.maxZoomLevel) / Math.LN2 - Math.log(this.chart.minZoomLevel) / Math.LN2;\n },\n enumerable: true,\n configurable: true\n });\n /**\r\n * Creates a background element for slider control.\r\n *\r\n * @ignore Exclude from docs\r\n * @return Background\r\n */\n\n ZoomControl.prototype.createBackground = function () {\n return new RoundedRectangle();\n };\n\n return ZoomControl;\n}(Container);\n\nexport { ZoomControl };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"ZoomControl\"] = ZoomControl;","import { atan, exp, halfPi, log, pi, tan, tau } from \"../math.js\";\nimport rotation from \"../rotation.js\";\nimport projection from \"./index.js\";\nexport function mercatorRaw(lambda, phi) {\n return [lambda, log(tan((halfPi + phi) / 2))];\n}\n\nmercatorRaw.invert = function (x, y) {\n return [x, 2 * atan(exp(y)) - halfPi];\n};\n\nexport default function () {\n return mercatorProjection(mercatorRaw).scale(961 / tau);\n}\nexport function mercatorProjection(project) {\n var m = projection(project),\n center = m.center,\n scale = m.scale,\n translate = m.translate,\n clipExtent = m.clipExtent,\n x0 = null,\n y0,\n x1,\n y1; // clip extent\n\n m.scale = function (_) {\n return arguments.length ? (scale(_), reclip()) : scale();\n };\n\n m.translate = function (_) {\n return arguments.length ? (translate(_), reclip()) : translate();\n };\n\n m.center = function (_) {\n return arguments.length ? (center(_), reclip()) : center();\n };\n\n m.clipExtent = function (_) {\n return arguments.length ? (_ == null ? x0 = y0 = x1 = y1 = null : (x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reclip()) : x0 == null ? null : [[x0, y0], [x1, y1]];\n };\n\n function reclip() {\n var k = pi * scale(),\n t = m(rotation(m.rotate()).invert([0, 0]));\n return clipExtent(x0 == null ? [[t[0] - k, t[1] - k], [t[0] + k, t[1] + k]] : project === mercatorRaw ? [[Math.max(t[0] - k, x0), y0], [Math.min(t[0] + k, x1), y1]] : [[x0, Math.max(t[1] - k, y0)], [x1, Math.min(t[1] + k, y1)]]);\n }\n\n return reclip();\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Mercator projection.\r\n */\n\nvar Mercator =\n/** @class */\nfunction (_super) {\n __extends(Mercator, _super);\n\n function Mercator() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoMercator();\n return _this;\n }\n\n return Mercator;\n}(Projection);\n\nexport { Mercator };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Mercator\"] = Mercator;","export var abs = Math.abs;\nexport var atan = Math.atan;\nexport var atan2 = Math.atan2;\nexport var ceil = Math.ceil;\nexport var cos = Math.cos;\nexport var exp = Math.exp;\nexport var floor = Math.floor;\nexport var log = Math.log;\nexport var max = Math.max;\nexport var min = Math.min;\nexport var pow = Math.pow;\nexport var round = Math.round;\nexport var sign = Math.sign || function (x) {\n return x > 0 ? 1 : x < 0 ? -1 : 0;\n};\nexport var sin = Math.sin;\nexport var tan = Math.tan;\nexport var epsilon = 1e-6;\nexport var epsilon2 = 1e-12;\nexport var pi = Math.PI;\nexport var halfPi = pi / 2;\nexport var quarterPi = pi / 4;\nexport var sqrt1_2 = Math.SQRT1_2;\nexport var sqrt2 = sqrt(2);\nexport var sqrtPi = sqrt(pi);\nexport var tau = pi * 2;\nexport var degrees = 180 / pi;\nexport var radians = pi / 180;\nexport function sinci(x) {\n return x ? x / Math.sin(x) : 1;\n}\nexport function asin(x) {\n return x > 1 ? halfPi : x < -1 ? -halfPi : Math.asin(x);\n}\nexport function acos(x) {\n return x > 1 ? 0 : x < -1 ? pi : Math.acos(x);\n}\nexport function sqrt(x) {\n return x > 0 ? Math.sqrt(x) : 0;\n}\nexport function tanh(x) {\n x = exp(2 * x);\n return (x - 1) / (x + 1);\n}\nexport function sinh(x) {\n return (exp(x) - exp(-x)) / 2;\n}\nexport function cosh(x) {\n return (exp(x) + exp(-x)) / 2;\n}\nexport function arsinh(x) {\n return log(x + sqrt(x * x + 1));\n}\nexport function arcosh(x) {\n return log(x + sqrt(x * x - 1));\n}","import { geoProjection as projection } from \"d3-geo\";\nimport { atan, exp, log, quarterPi, pi, tan } from \"./math.js\";\nexport function millerRaw(lambda, phi) {\n return [lambda, 1.25 * log(tan(quarterPi + 0.4 * phi))];\n}\n\nmillerRaw.invert = function (x, y) {\n return [x, 2.5 * atan(exp(0.8 * y)) - 0.625 * pi];\n};\n\nexport default function () {\n return projection(millerRaw).scale(108.318);\n}","/**\r\n * Functionality for Miller projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\"; // @ts-ignore\n\nimport * as d3geoprojection from \"d3-geo-projection\";\n/**\r\n * Miller projection.\r\n */\n\nvar Miller =\n/** @class */\nfunction (_super) {\n __extends(Miller, _super);\n\n function Miller() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geoprojection.geoMiller();\n return _this;\n }\n\n return Miller;\n}(Projection);\n\nexport { Miller };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Miller\"] = Miller;","import { geoProjection as projection } from \"d3-geo\";\nimport { abs, asin, cos, epsilon, halfPi, pi, sin, sqrt } from \"./math.js\";\nexport function eckert6Raw(lambda, phi) {\n var k = (1 + halfPi) * sin(phi);\n\n for (var i = 0, delta = Infinity; i < 10 && abs(delta) > epsilon; i++) {\n phi -= delta = (phi + sin(phi) - k) / (1 + cos(phi));\n }\n\n k = sqrt(2 + pi);\n return [lambda * (1 + cos(phi)) / k, 2 * phi / k];\n}\n\neckert6Raw.invert = function (x, y) {\n var j = 1 + halfPi,\n k = sqrt(j / 2);\n return [x * 2 * k / (1 + cos(y *= k)), asin((y + sin(y)) / j)];\n};\n\nexport default function () {\n return projection(eckert6Raw).scale(173.044);\n}","/**\r\n * Functionality for Eckert6 projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\"; // @ts-ignore\n\nimport * as d3geoprojection from \"d3-geo-projection\";\n/**\r\n * Eckert6 projection.\r\n */\n\nvar Eckert6 =\n/** @class */\nfunction (_super) {\n __extends(Eckert6, _super);\n\n function Eckert6() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geoprojection.geoEckert6();\n return _this;\n }\n\n return Eckert6;\n}(Projection);\n\nexport { Eckert6 };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Eckert6\"] = Eckert6;","import { asin, atan2, cos, sin, sqrt } from \"../math.js\";\nexport function azimuthalRaw(scale) {\n return function (x, y) {\n var cx = cos(x),\n cy = cos(y),\n k = scale(cx * cy);\n if (k === Infinity) return [2, 0];\n return [k * cy * sin(x), k * sin(y)];\n };\n}\nexport function azimuthalInvert(angle) {\n return function (x, y) {\n var z = sqrt(x * x + y * y),\n c = angle(z),\n sc = sin(c),\n cc = cos(c);\n return [atan2(x * sc, z * cc), asin(z && y * sc / z)];\n };\n}","import { asin, cos, epsilon, sin } from \"../math.js\";\nimport { azimuthalInvert } from \"./azimuthal.js\";\nimport projection from \"./index.js\";\nexport function orthographicRaw(x, y) {\n return [cos(y) * sin(x), sin(y)];\n}\northographicRaw.invert = azimuthalInvert(asin);\nexport default function () {\n return projection(orthographicRaw).scale(249.5).clipAngle(90 + epsilon);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar Orthographic =\n/** @class */\nfunction (_super) {\n __extends(Orthographic, _super);\n\n function Orthographic() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoOrthographic();\n return _this;\n }\n\n return Orthographic;\n}(Projection);\n\nexport { Orthographic };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Orthographic\"] = Orthographic;","import { atan, cos, sin } from \"../math.js\";\nimport { azimuthalInvert } from \"./azimuthal.js\";\nimport projection from \"./index.js\";\nexport function stereographicRaw(x, y) {\n var cy = cos(y),\n k = 1 + cos(x) * cy;\n return [cy * sin(x) / k, sin(y) / k];\n}\nstereographicRaw.invert = azimuthalInvert(function (z) {\n return 2 * atan(z);\n});\nexport default function () {\n return projection(stereographicRaw).scale(250).clipAngle(142);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar Stereographic =\n/** @class */\nfunction (_super) {\n __extends(Stereographic, _super);\n\n function Stereographic() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoStereographic();\n return _this;\n }\n\n return Stereographic;\n}(Projection);\n\nexport { Stereographic };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Stereographic\"] = Stereographic;","import { abs, asin, atan2, cos, epsilon, pi, sign, sin, sqrt } from \"../math.js\";\nimport { conicProjection } from \"./conic.js\";\nimport { cylindricalEqualAreaRaw } from \"./cylindricalEqualArea.js\";\nexport function conicEqualAreaRaw(y0, y1) {\n var sy0 = sin(y0),\n n = (sy0 + sin(y1)) / 2; // Are the parallels symmetrical around the Equator?\n\n if (abs(n) < epsilon) return cylindricalEqualAreaRaw(y0);\n var c = 1 + sy0 * (2 * n - sy0),\n r0 = sqrt(c) / n;\n\n function project(x, y) {\n var r = sqrt(c - 2 * n * sin(y)) / n;\n return [r * sin(x *= n), r0 - r * cos(x)];\n }\n\n project.invert = function (x, y) {\n var r0y = r0 - y,\n l = atan2(x, abs(r0y)) * sign(r0y);\n if (r0y * n < 0) l -= pi * sign(x) * sign(r0y);\n return [l / n, asin((c - (x * x + r0y * r0y) * n * n) / (2 * n))];\n };\n\n return project;\n}\nexport default function () {\n return conicProjection(conicEqualAreaRaw).scale(155.424).center([0, 33.6442]);\n}","import { asin, cos, sin } from \"../math.js\";\nexport function cylindricalEqualAreaRaw(phi0) {\n var cosPhi0 = cos(phi0);\n\n function forward(lambda, phi) {\n return [lambda * cosPhi0, sin(phi) / cosPhi0];\n }\n\n forward.invert = function (x, y) {\n return [x / cosPhi0, asin(y * cosPhi0)];\n };\n\n return forward;\n}","import { degrees, pi, radians } from \"../math.js\";\nimport { projectionMutator } from \"./index.js\";\nexport function conicProjection(projectAt) {\n var phi0 = 0,\n phi1 = pi / 3,\n m = projectionMutator(projectAt),\n p = m(phi0, phi1);\n\n p.parallels = function (_) {\n return arguments.length ? m(phi0 = _[0] * radians, phi1 = _[1] * radians) : [phi0 * degrees, phi1 * degrees];\n };\n\n return p;\n}","import conicEqualArea from \"./conicEqualArea.js\";\nexport default function () {\n return conicEqualArea().parallels([29.5, 45.5]).scale(1070).translate([480, 250]).rotate([96, 0]).center([-0.6, 38.7]);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar Albers =\n/** @class */\nfunction (_super) {\n __extends(Albers, _super);\n\n function Albers() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoAlbers();\n return _this;\n }\n\n return Albers;\n}(Projection);\n\nexport { Albers };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"Albers\"] = Albers;","import { epsilon } from \"../math.js\";\nimport albers from \"./albers.js\";\nimport conicEqualArea from \"./conicEqualArea.js\";\nimport { fitExtent, fitSize, fitWidth, fitHeight } from \"./fit.js\"; // The projections must have mutually exclusive clip regions on the sphere,\n// as this will avoid emitting interleaving lines and polygons.\n\nfunction multiplex(streams) {\n var n = streams.length;\n return {\n point: function point(x, y) {\n var i = -1;\n\n while (++i < n) {\n streams[i].point(x, y);\n }\n },\n sphere: function sphere() {\n var i = -1;\n\n while (++i < n) {\n streams[i].sphere();\n }\n },\n lineStart: function lineStart() {\n var i = -1;\n\n while (++i < n) {\n streams[i].lineStart();\n }\n },\n lineEnd: function lineEnd() {\n var i = -1;\n\n while (++i < n) {\n streams[i].lineEnd();\n }\n },\n polygonStart: function polygonStart() {\n var i = -1;\n\n while (++i < n) {\n streams[i].polygonStart();\n }\n },\n polygonEnd: function polygonEnd() {\n var i = -1;\n\n while (++i < n) {\n streams[i].polygonEnd();\n }\n }\n };\n} // A composite projection for the United States, configured by default for\n// 960×500. The projection also works quite well at 960×600 if you change the\n// scale to 1285 and adjust the translate accordingly. The set of standard\n// parallels for each region comes from USGS, which is published here:\n// http://egsc.usgs.gov/isb/pubs/MapProjections/projections.html#albers\n\n\nexport default function () {\n var cache,\n cacheStream,\n lower48 = albers(),\n lower48Point,\n alaska = conicEqualArea().rotate([154, 0]).center([-2, 58.5]).parallels([55, 65]),\n alaskaPoint,\n // EPSG:3338\n hawaii = conicEqualArea().rotate([157, 0]).center([-3, 19.9]).parallels([8, 18]),\n hawaiiPoint,\n // ESRI:102007\n _point,\n pointStream = {\n point: function point(x, y) {\n _point = [x, y];\n }\n };\n\n function albersUsa(coordinates) {\n var x = coordinates[0],\n y = coordinates[1];\n return _point = null, (lower48Point.point(x, y), _point) || (alaskaPoint.point(x, y), _point) || (hawaiiPoint.point(x, y), _point);\n }\n\n albersUsa.invert = function (coordinates) {\n var k = lower48.scale(),\n t = lower48.translate(),\n x = (coordinates[0] - t[0]) / k,\n y = (coordinates[1] - t[1]) / k;\n return (y >= 0.120 && y < 0.234 && x >= -0.425 && x < -0.214 ? alaska : y >= 0.166 && y < 0.234 && x >= -0.214 && x < -0.115 ? hawaii : lower48).invert(coordinates);\n };\n\n albersUsa.stream = function (stream) {\n return cache && cacheStream === stream ? cache : cache = multiplex([lower48.stream(cacheStream = stream), alaska.stream(stream), hawaii.stream(stream)]);\n };\n\n albersUsa.precision = function (_) {\n if (!arguments.length) return lower48.precision();\n lower48.precision(_), alaska.precision(_), hawaii.precision(_);\n return reset();\n };\n\n albersUsa.scale = function (_) {\n if (!arguments.length) return lower48.scale();\n lower48.scale(_), alaska.scale(_ * 0.35), hawaii.scale(_);\n return albersUsa.translate(lower48.translate());\n };\n\n albersUsa.translate = function (_) {\n if (!arguments.length) return lower48.translate();\n var k = lower48.scale(),\n x = +_[0],\n y = +_[1];\n lower48Point = lower48.translate(_).clipExtent([[x - 0.455 * k, y - 0.238 * k], [x + 0.455 * k, y + 0.238 * k]]).stream(pointStream);\n alaskaPoint = alaska.translate([x - 0.307 * k, y + 0.201 * k]).clipExtent([[x - 0.425 * k + epsilon, y + 0.120 * k + epsilon], [x - 0.214 * k - epsilon, y + 0.234 * k - epsilon]]).stream(pointStream);\n hawaiiPoint = hawaii.translate([x - 0.205 * k, y + 0.212 * k]).clipExtent([[x - 0.214 * k + epsilon, y + 0.166 * k + epsilon], [x - 0.115 * k - epsilon, y + 0.234 * k - epsilon]]).stream(pointStream);\n return reset();\n };\n\n albersUsa.fitExtent = function (extent, object) {\n return fitExtent(albersUsa, extent, object);\n };\n\n albersUsa.fitSize = function (size, object) {\n return fitSize(albersUsa, size, object);\n };\n\n albersUsa.fitWidth = function (width, object) {\n return fitWidth(albersUsa, width, object);\n };\n\n albersUsa.fitHeight = function (height, object) {\n return fitHeight(albersUsa, height, object);\n };\n\n function reset() {\n cache = cacheStream = null;\n return albersUsa;\n }\n\n return albersUsa.scale(1070);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar AlbersUsa =\n/** @class */\nfunction (_super) {\n __extends(AlbersUsa, _super);\n\n function AlbersUsa() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoAlbersUsa();\n return _this;\n }\n\n return AlbersUsa;\n}(Projection);\n\nexport { AlbersUsa };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AlbersUsa\"] = AlbersUsa;","import projection from \"./index.js\";\nimport { abs, epsilon } from \"../math.js\";\nexport function naturalEarth1Raw(lambda, phi) {\n var phi2 = phi * phi,\n phi4 = phi2 * phi2;\n return [lambda * (0.8707 - 0.131979 * phi2 + phi4 * (-0.013791 + phi4 * (0.003971 * phi2 - 0.001529 * phi4))), phi * (1.007226 + phi2 * (0.015085 + phi4 * (-0.044475 + 0.028874 * phi2 - 0.005916 * phi4)))];\n}\n\nnaturalEarth1Raw.invert = function (x, y) {\n var phi = y,\n i = 25,\n delta;\n\n do {\n var phi2 = phi * phi,\n phi4 = phi2 * phi2;\n phi -= delta = (phi * (1.007226 + phi2 * (0.015085 + phi4 * (-0.044475 + 0.028874 * phi2 - 0.005916 * phi4))) - y) / (1.007226 + phi2 * (0.015085 * 3 + phi4 * (-0.044475 * 7 + 0.028874 * 9 * phi2 - 0.005916 * 11 * phi4)));\n } while (abs(delta) > epsilon && --i > 0);\n\n return [x / (0.8707 + (phi2 = phi * phi) * (-0.131979 + phi2 * (-0.013791 + phi2 * phi2 * phi2 * (0.003971 - 0.001529 * phi2)))), phi];\n};\n\nexport default function () {\n return projection(naturalEarth1Raw).scale(175.295);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar NaturalEarth1 =\n/** @class */\nfunction (_super) {\n __extends(NaturalEarth1, _super);\n\n function NaturalEarth1() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoNaturalEarth1();\n return _this;\n }\n\n return NaturalEarth1;\n}(Projection);\n\nexport { NaturalEarth1 };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"NaturalEarth1\"] = NaturalEarth1;","import { asin, sqrt } from \"../math.js\";\nimport { azimuthalRaw, azimuthalInvert } from \"./azimuthal.js\";\nimport projection from \"./index.js\";\nexport var azimuthalEqualAreaRaw = azimuthalRaw(function (cxcy) {\n return sqrt(2 / (1 + cxcy));\n});\nazimuthalEqualAreaRaw.invert = azimuthalInvert(function (z) {\n return 2 * asin(z / 2);\n});\nexport default function () {\n return projection(azimuthalEqualAreaRaw).scale(124.75).clipAngle(180 - 1e-3);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar AzimuthalEqualArea =\n/** @class */\nfunction (_super) {\n __extends(AzimuthalEqualArea, _super);\n\n function AzimuthalEqualArea() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoAzimuthalEqualArea();\n return _this;\n }\n\n return AzimuthalEqualArea;\n}(Projection);\n\nexport { AzimuthalEqualArea };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"AzimuthalEqualArea\"] = AzimuthalEqualArea;","import projection from \"./index.js\";\nimport { abs, asin, cos, epsilon2, sin, sqrt } from \"../math.js\";\nvar A1 = 1.340264,\n A2 = -0.081106,\n A3 = 0.000893,\n A4 = 0.003796,\n M = sqrt(3) / 2,\n iterations = 12;\nexport function equalEarthRaw(lambda, phi) {\n var l = asin(M * sin(phi)),\n l2 = l * l,\n l6 = l2 * l2 * l2;\n return [lambda * cos(l) / (M * (A1 + 3 * A2 * l2 + l6 * (7 * A3 + 9 * A4 * l2))), l * (A1 + A2 * l2 + l6 * (A3 + A4 * l2))];\n}\n\nequalEarthRaw.invert = function (x, y) {\n var l = y,\n l2 = l * l,\n l6 = l2 * l2 * l2;\n\n for (var i = 0, delta, fy, fpy; i < iterations; ++i) {\n fy = l * (A1 + A2 * l2 + l6 * (A3 + A4 * l2)) - y;\n fpy = A1 + 3 * A2 * l2 + l6 * (7 * A3 + 9 * A4 * l2);\n l -= delta = fy / fpy, l2 = l * l, l6 = l2 * l2 * l2;\n if (abs(delta) < epsilon2) break;\n }\n\n return [M * x * (A1 + 3 * A2 * l2 + l6 * (7 * A3 + 9 * A4 * l2)) / cos(l), asin(sin(l) / M)];\n};\n\nexport default function () {\n return projection(equalEarthRaw).scale(177.158);\n}","/**\r\n * Functionality for Mercator projection\r\n *\r\n * The function(s) below are from D3.js library (https://d3js.org/)\r\n *\r\n * ```\r\n * Copyright 2017 Mike Bostock\r\n *\r\n * Redistribution and use in source and binary forms, with or without\r\n * modification, are permitted provided that the following conditions are met:\r\n *\r\n * 1. Redistributions of source code must retain the above copyright notice,\r\n * this list of conditions and the following disclaimer.\r\n *\r\n * 2. Redistributions in binary form must reproduce the above copyright notice,\r\n * this list of conditions and the following disclaimer in the documentation\r\n * and/or other materials provided with the distribution.\r\n *\r\n * 3. Neither the name of the copyright holder nor the names of its\r\n * contributors may be used to endorse or promote products derived from this\r\n * software without specific prior written permission.\r\n *\r\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS \"AS IS\"\r\n * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\r\n * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\r\n * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE\r\n * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR\r\n * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF\r\n * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS\r\n * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN\r\n * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)\r\n * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE\r\n * POSSIBILITY OF SUCH DAMAGE.\r\n * ```\r\n */\nimport { __extends } from \"tslib\";\n/**\r\n * ============================================================================\r\n * IMPORTS\r\n * ============================================================================\r\n * @hidden\r\n */\n\nimport { Projection } from \"./Projection\";\nimport { registry } from \"../../../core/Registry\";\nimport * as d3geo from \"d3-geo\";\n/**\r\n * Orthographic projection.\r\n */\n\nvar EqualEarth =\n/** @class */\nfunction (_super) {\n __extends(EqualEarth, _super);\n\n function EqualEarth() {\n var _this = _super.call(this) || this;\n\n _this.d3Projection = d3geo.geoEqualEarth();\n return _this;\n }\n\n return EqualEarth;\n}(Projection);\n\nexport { EqualEarth };\n/**\r\n * Register class in system, so that it can be instantiated using its name from\r\n * anywhere.\r\n *\r\n * @ignore\r\n */\n\nregistry.registeredClasses[\"EqualEarth\"] = EqualEarth;","var map = {\n \"type\": \"FeatureCollection\",\n \"features\": [{\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-134.6803, 58.1617], [-134.2401, 58.1441], [-134.3069, 58.0344], [-134.2671, 57.8845], [-133.937, 57.5816], [-133.9737, 57.4513], [-133.9253, 57.3368], [-134.1, 57.3001], [-134.2602, 57.1468], [-134.4353, 57.057], [-134.5915, 57.0919], [-134.4868, 57.482], [-134.6599, 57.6381], [-134.8369, 58.3201], [-134.6803, 58.1617]]], [[[-174.6774, 52.035], [-175.1176, 52.047], [-174.3061, 52.2161], [-174.4355, 52.3172], [-174.1689, 52.4202], [-174.0184, 52.3318], [-174.1206, 52.1352], [-174.3435, 52.0778], [-174.6774, 52.035]]], [[[-172.7422, 60.4575], [-172.5261, 60.3918], [-172.6358, 60.3288], [-173.074, 60.4932], [-172.8602, 60.5057], [-172.7422, 60.4575]]], [[[-176.5933, 51.8667], [-176.4373, 51.7543], [-176.7709, 51.6299], [-176.8744, 51.7905], [-176.7364, 51.84], [-176.6984, 51.986], [-176.5499, 51.9441], [-176.5933, 51.8667]]], [[[-165.8416, 54.0707], [-166.0364, 54.0472], [-166.0877, 54.1691], [-165.8928, 54.207], [-165.7042, 54.1199], [-165.8416, 54.0707]]], [[[-171.463, 63.64], [-171.0349, 63.5855], [-170.4304, 63.6988], [-170.1218, 63.6175], [-170.0174, 63.4917], [-169.6242, 63.4305], [-169.4276, 63.3483], [-168.996, 63.3473], [-168.716, 63.3106], [-168.8524, 63.1712], [-169.3647, 63.1711], [-169.6763, 62.9561], [-169.7778, 63.0938], [-170.1896, 63.1963], [-170.2727, 63.2843], [-170.5271, 63.3793], [-170.8484, 63.4444], [-171.0613, 63.4459], [-171.4012, 63.3392], [-171.6318, 63.3512], [-171.791, 63.4247], [-171.7464, 63.7031], [-171.463, 63.64]]], [[[-147.6583, 60.4505], [-147.7321, 60.222], [-147.8714, 60.2297], [-147.7945, 60.4599], [-147.6583, 60.4505]]], [[[-152.4169, 58.3602], [-152.3163, 58.4135], [-151.9825, 58.2443], [-152.1091, 58.1612], [-152.5377, 58.101], [-152.7815, 58.016], [-152.9826, 57.9971], [-153.3813, 58.0872], [-152.9762, 58.2969], [-152.7719, 58.2786], [-152.8411, 58.4164], [-152.6747, 58.4505], [-152.4169, 58.3602]]], [[[-134.9697, 57.3515], [-134.8232, 57.1565], [-134.6207, 56.7183], [-134.6571, 56.5233], [-134.6301, 56.3025], [-134.7503, 56.2408], [-134.9806, 56.5189], [-135.0178, 56.6601], [-135.159, 56.7254], [-135.1631, 56.8241], [-135.3306, 56.8218], [-135.3151, 56.9318], [-135.1996, 57.0273], [-135.3413, 57.0816], [-135.3753, 57.1885], [-135.5019, 57.2438], [-135.6089, 57.0715], [-135.7677, 57.1004], [-135.7871, 57.3172], [-135.5805, 57.39], [-135.4872, 57.5164], [-135.3463, 57.5332], [-134.9697, 57.3515]]], [[[-159.873, 55.1287], [-160.0384, 55.0445], [-160.1721, 55.1231], [-159.8983, 55.2213], [-159.873, 55.1287]]], [[[-141.0022, 69.6508], [-141.0022, 68.7742], [-141.0022, 68.1897], [-141.0022, 67.3132], [-141.0022, 66.1443], [-141.0022, 65.5599], [-141.0022, 64.3911], [-141.0022, 63.2223], [-141.0022, 62.0535], [-141.0022, 61.1768], [-141.0022, 60.3002], [-140.5254, 60.2183], [-140.4529, 60.2998], [-139.9733, 60.1832], [-139.6763, 60.3283], [-139.0793, 60.3436], [-139.1852, 60.0835], [-139.0434, 59.9933], [-138.7054, 59.9013], [-138.6323, 59.7783], [-137.5933, 59.2262], [-137.4386, 58.9032], [-137.2776, 58.9882], [-136.8133, 59.15], [-136.5788, 59.1523], [-136.4667, 59.28], [-136.4664, 59.4591], [-136.2472, 59.533], [-136.3218, 59.6048], [-135.9347, 59.6627], [-135.4759, 59.7932], [-135.051, 59.5786], [-135.0713, 59.4414], [-134.9437, 59.2882], [-134.4407, 59.0854], [-134.2185, 58.8498], [-133.8207, 58.705], [-133.4011, 58.4109], [-133.4226, 58.337], [-133.2753, 58.2229], [-132.5505, 57.4999], [-132.2322, 57.1986], [-132.3379, 57.0794], [-132.0315, 57.0265], [-132.1043, 56.8568], [-131.8662, 56.7929], [-131.8243, 56.5899], [-131.5751, 56.5988], [-131.0829, 56.4048], [-130.7416, 56.3408], [-130.6491, 56.2637], [-130.4771, 56.2306], [-130.4132, 56.1225], [-130.0229, 56.0145], [-130.0251, 55.8883], [-130.1465, 55.6545], [-130.0365, 55.2979], [-130.2141, 55.0259], [-130.4932, 54.8342], [-130.6158, 54.7909], [-130.8496, 54.8076], [-131.0478, 55.1577], [-130.856, 55.3551], [-130.9185, 55.736], [-131.1277, 55.9601], [-131.2876, 56.0121], [-131.7842, 55.8765], [-131.8694, 55.6472], [-131.9834, 55.535], [-132.119, 55.5697], [-132.2234, 55.7211], [-132.0058, 55.9301], [-131.8438, 56.16], [-132.0219, 56.3801], [-132.182, 56.4206], [-132.3577, 56.6258], [-132.476, 56.6497], [-132.4871, 56.7664], [-132.6395, 56.7964], [-132.8022, 56.8951], [-132.8143, 57.0406], [-133.4658, 57.1721], [-133.4367, 57.3368], [-133.539, 57.5542], [-133.6487, 57.6423], [-133.5542, 57.6951], [-133.1171, 57.5662], [-133.6573, 57.841], [-133.7441, 57.8546], [-134.0311, 58.0722], [-134.0633, 58.2111], [-134.2088, 58.2329], [-134.4854, 58.3672], [-134.6636, 58.3847], [-134.7761, 58.4538], [-134.9425, 58.6463], [-134.9648, 58.7422], [-135.1319, 58.8428], [-135.2174, 59.0766], [-135.3303, 59.2391], [-135.5023, 59.2024], [-135.3862, 59.0876], [-135.334, 58.9096], [-135.0497, 58.3068], [-135.1415, 58.2335], [-135.3025, 58.2559], [-135.5718, 58.412], [-135.8735, 58.3942], [-135.8617, 58.5771], [-136.0455, 58.7891], [-136.2258, 58.7655], [-136.4511, 58.8463], [-136.5662, 58.9409], [-136.831, 58.9838], [-136.8791, 58.8815], [-136.5682, 58.7863], [-136.4101, 58.7006], [-136.4838, 58.6177], [-136.2246, 58.6023], [-136.1029, 58.5063], [-136.1296, 58.3504], [-136.4624, 58.3279], [-136.5826, 58.2453], [-137.072, 58.3951], [-137.544, 58.5812], [-137.75, 58.7071], [-138.0269, 58.9414], [-138.3525, 59.0873], [-139.3409, 59.3757], [-139.7991, 59.5463], [-139.6116, 59.6103], [-139.5056, 59.7263], [-139.5822, 59.8484], [-139.5189, 60.0172], [-139.8502, 59.8307], [-140.2167, 59.7266], [-140.4199, 59.7107], [-140.8432, 59.7488], [-141.4083, 59.9028], [-141.2946, 59.98], [-141.3295, 60.0828], [-141.6702, 59.9698], [-142.5486, 60.0861], [-142.9457, 60.097], [-143.5061, 60.055], [-143.805, 60.0129], [-144.1472, 60.0163], [-144.0885, 60.0843], [-144.3326, 60.191], [-144.643, 60.2246], [-144.9013, 60.3351], [-144.8245, 60.5336], [-144.984, 60.537], [-145.2483, 60.3801], [-145.8989, 60.4782], [-145.6749, 60.6511], [-146.1491, 60.6607], [-146.251, 60.7491], [-146.6385, 60.8973], [-146.5828, 61.1278], [-146.874, 61.0048], [-147.255, 60.9782], [-147.321, 60.9255], [-147.5926, 60.9795], [-147.6557, 60.9095], [-147.8911, 60.8899], [-148.0052, 60.9686], [-147.8448, 61.1864], [-148.2086, 61.0299], [-148.3444, 60.8536], [-148.5574, 60.8029], [-148.2679, 60.6997], [-148.2964, 60.532], [-148.0507, 60.5671], [-147.9641, 60.4849], [-148.1817, 60.393], [-148.1976, 60.1678], [-148.3331, 60.122], [-148.4307, 59.9892], [-148.8427, 59.9512], [-149.1216, 60.0335], [-149.4323, 60.0011], [-149.5491, 59.8943], [-149.7948, 59.8559], [-149.7825, 59.7503], [-150.198, 59.5666], [-150.5815, 59.5645], [-150.6775, 59.427], [-150.9608, 59.2439], [-151.3664, 59.2456], [-151.7382, 59.1885], [-151.9641, 59.2852], [-151.8499, 59.4064], [-151.3996, 59.5164], [-151.1894, 59.6377], [-151.7638, 59.7], [-151.8532, 59.7821], [-151.7345, 59.9884], [-151.4515, 60.2027], [-151.3127, 60.4665], [-151.3218, 60.7429], [-150.9538, 60.8413], [-150.4413, 61.0236], [-149.9975, 60.9352], [-149.6325, 60.9519], [-149.1728, 60.8805], [-149.1422, 60.9357], [-149.5925, 60.9939], [-149.9677, 61.1218], [-149.9452, 61.2943], [-150.4718, 61.26], [-150.6123, 61.3012], [-150.9455, 61.1982], [-151.1502, 61.0859], [-151.5935, 60.9796], [-151.734, 60.9108], [-151.7504, 60.7549], [-151.9962, 60.6822], [-152.2707, 60.5281], [-152.2603, 60.4095], [-152.3689, 60.3364], [-152.6539, 60.2385], [-152.6286, 60.0411], [-152.7595, 59.9209], [-153.106, 59.8751], [-153.0482, 59.73], [-153.364, 59.6598], [-153.4144, 59.7402], [-153.8141, 59.4737], [-154.0883, 59.3634], [-154.1783, 59.1556], [-154.1298, 59.1198], [-153.6564, 59.0386], [-153.4183, 58.9599], [-153.3344, 58.8579], [-153.6173, 58.6547], [-153.8619, 58.5878], [-154.0199, 58.4929], [-154.0859, 58.3658], [-154.2081, 58.2887], [-154.247, 58.1594], [-154.5706, 58.118], [-154.5849, 58.0556], [-155.0069, 58.0161], [-155.0993, 57.9133], [-155.3128, 57.8071], [-155.5903, 57.7336], [-155.7779, 57.5683], [-156.0002, 57.545], [-156.0554, 57.4476], [-156.2422, 57.4493], [-156.4784, 57.3279], [-156.3976, 57.2406], [-156.4751, 57.1052], [-156.629, 57.0099], [-156.7799, 57.0057], [-157.2058, 56.812], [-157.3902, 56.8099], [-157.5784, 56.6345], [-157.8691, 56.6452], [-157.9783, 56.5432], [-158.4144, 56.4358], [-158.5374, 56.3354], [-158.3861, 56.3015], [-158.2757, 56.1962], [-158.5233, 56.0724], [-158.6267, 56.1547], [-158.7898, 55.987], [-159.5232, 55.81], [-159.743, 55.8438], [-159.9623, 55.7949], [-160.4627, 55.5578], [-160.8967, 55.5136], [-161.0995, 55.4057], [-161.3819, 55.3713], [-161.4767, 55.465], [-161.3727, 55.5563], [-161.4588, 55.6291], [-161.6836, 55.53], [-161.7416, 55.3912], [-162.074, 55.1393], [-162.3329, 55.0503], [-162.5419, 55.2427], [-162.6441, 55.218], [-162.6143, 55.0714], [-162.6744, 54.9965], [-162.865, 54.9546], [-163.1196, 55.0647], [-163.1311, 54.9166], [-163.2887, 54.8376], [-163.2788, 55.1219], [-163.1145, 55.194], [-162.962, 55.1839], [-162.5133, 55.45], [-162.1571, 55.7195], [-161.6973, 55.9072], [-161.2156, 56.0214], [-160.8513, 55.7718], [-160.7584, 55.8547], [-160.3085, 55.8645], [-160.5391, 56.0063], [-160.302, 56.3142], [-159.7851, 56.5617], [-159.2831, 56.6886], [-158.9904, 56.86], [-158.6752, 56.7949], [-158.6608, 57.0394], [-158.3209, 57.2979], [-158.0457, 57.4095], [-157.8944, 57.5114], [-157.6076, 57.6015], [-157.684, 57.7439], [-157.6109, 58.0508], [-157.4427, 58.1722], [-157.5236, 58.4213], [-157.4609, 58.503], [-157.2288, 58.6409], [-156.9747, 58.7363], [-157.142, 58.8777], [-157.6657, 58.7485], [-158.0219, 58.6402], [-158.3026, 58.6418], [-158.5032, 58.8504], [-158.4256, 58.9993], [-158.5144, 59.0728], [-158.7606, 58.9501], [-158.8614, 58.7187], [-158.7721, 58.5203], [-158.7886, 58.4409], [-158.9507, 58.4046], [-159.0827, 58.4697], [-159.3583, 58.7213], [-159.6702, 58.9111], [-159.9202, 58.8199], [-160.1526, 58.9059], [-160.3631, 59.0511], [-160.8171, 58.8718], [-161.2159, 58.801], [-161.3613, 58.6695], [-161.7555, 58.6121], [-162.1449, 58.6443], [-161.8564, 58.7171], [-161.7244, 58.7943], [-161.7805, 58.8974], [-161.7945, 59.1094], [-161.9811, 59.1461], [-162.0233, 59.284], [-161.9201, 59.3654], [-161.8287, 59.5886], [-162.1382, 59.98], [-162.2425, 60.1783], [-162.4213, 60.284], [-162.1389, 60.6143], [-162.2651, 60.5953], [-162.5996, 60.297], [-162.5005, 60.1266], [-162.5707, 59.9897], [-162.7326, 59.9937], [-162.8779, 59.9228], [-163.2194, 59.8456], [-163.6804, 59.8015], [-163.9069, 59.8068], [-164.1428, 59.8968], [-164.1316, 59.9943], [-164.4705, 60.1493], [-164.6623, 60.3039], [-164.7999, 60.3073], [-165.0611, 60.4125], [-165.0265, 60.5006], [-165.3538, 60.5412], [-165.016, 60.7401], [-164.8051, 60.892], [-164.37, 60.7959], [-164.2656, 60.7247], [-163.8949, 60.7451], [-163.73, 60.5899], [-163.5287, 60.6645], [-163.421, 60.7575], [-163.6554, 60.8775], [-163.749, 60.9697], [-163.9946, 60.8647], [-164.4415, 60.8699], [-164.754, 60.9313], [-165.0657, 60.9207], [-165.1755, 60.9656], [-165.0771, 61.0942], [-165.3921, 61.2123], [-165.3808, 61.1063], [-165.5659, 61.1023], [-165.6914, 61.2999], [-165.9063, 61.4037], [-165.7971, 61.4912], [-166.1005, 61.6451], [-165.8346, 61.6793], [-166.0788, 61.8031], [-165.6128, 61.8693], [-165.7439, 62.0117], [-165.7073, 62.1005], [-165.1946, 62.4735], [-164.7927, 62.6232], [-164.8454, 62.801], [-164.6775, 63.0205], [-164.409, 63.2151], [-164.1076, 63.2617], [-163.7363, 63.1928], [-163.3588, 63.0458], [-163.0622, 63.0797], [-162.6215, 63.2658], [-162.2828, 63.5292], [-162.1125, 63.5342], [-161.974, 63.453], [-161.5054, 63.4682], [-161.0997, 63.5579], [-160.8265, 63.7293], [-160.7786, 63.8189], [-160.9876, 64.2513], [-161.2201, 64.3966], [-161.3857, 64.44], [-160.932, 64.5791], [-160.836, 64.6819], [-160.887, 64.7955], [-161.1869, 64.9241], [-161.4663, 64.7948], [-161.7594, 64.8162], [-161.8684, 64.7427], [-162.1722, 64.6781], [-162.807, 64.3742], [-162.8764, 64.5164], [-163.0517, 64.5197], [-163.1444, 64.4238], [-163.4862, 64.5498], [-163.7131, 64.5883], [-164.3039, 64.5839], [-164.8995, 64.4607], [-166.1428, 64.5828], [-166.3251, 64.6257], [-166.4814, 64.7281], [-166.4152, 64.9265], [-166.5509, 64.953], [-166.8269, 65.0961], [-166.531, 65.1547], [-166.4516, 65.2473], [-166.6654, 65.3383], [-167.404, 65.4221], [-167.9873, 65.5678], [-168.0884, 65.6578], [-167.58, 65.7583], [-167.4053, 65.8593], [-167.0742, 65.8771], [-166.7477, 66.0518], [-166.2146, 66.1703], [-165.7237, 66.1125], [-165.5602, 66.1671], [-165.8403, 66.245], [-165.7762, 66.319], [-165.4494, 66.4099], [-165.0639, 66.4378], [-164.6741, 66.555], [-164.0583, 66.6108], [-163.7755, 66.5311], [-163.9029, 66.3784], [-163.894, 66.2869], [-164.0337, 66.2156], [-163.6954, 66.0839], [-163.1715, 66.0754], [-162.8865, 66.0992], [-162.5868, 66.0509], [-162.2143, 66.071], [-161.8163, 66.0536], [-161.5569, 66.2505], [-161.2011, 66.2193], [-161.1203, 66.3343], [-161.5444, 66.4071], [-161.8281, 66.3709], [-161.8876, 66.4931], [-162.1912, 66.6932], [-162.4675, 66.7357], [-162.6075, 66.8944], [-162.3617, 66.9473], [-162.1314, 66.8014], [-161.9096, 66.5596], [-161.591, 66.4595], [-161.3359, 66.4964], [-161.0481, 66.4742], [-160.6505, 66.3731], [-160.2317, 66.4203], [-160.2625, 66.5724], [-160.6438, 66.605], [-160.864, 66.6709], [-161.398, 66.5519], [-161.8566, 66.7004], [-161.8787, 66.804], [-161.6222, 66.9793], [-161.9655, 67.0495], [-162.3915, 67.0199], [-163.0017, 67.0273], [-163.5318, 67.1025], [-163.7206, 67.1955], [-163.9427, 67.4776], [-164.1252, 67.6067], [-165.386, 68.0456], [-165.9596, 68.1559], [-166.236, 68.278], [-166.5745, 68.3203], [-166.3805, 68.4251], [-166.182, 68.7972], [-166.2091, 68.8853], [-165.5095, 68.8676], [-165.0439, 68.8825], [-164.3024, 68.9365], [-163.868, 69.0367], [-163.5356, 69.1701], [-163.1615, 69.388], [-163.0936, 69.6107], [-162.9521, 69.7581], [-161.881, 70.3318], [-161.639, 70.2346], [-160.9963, 70.3046], [-160.6341, 70.4464], [-160.1172, 70.5912], [-159.9632, 70.5682], [-160.095, 70.3333], [-159.8552, 70.3242], [-159.7463, 70.5305], [-159.9618, 70.6341], [-159.6809, 70.7868], [-159.3145, 70.8785], [-158.9963, 70.8016], [-158.4844, 70.8411], [-157.9985, 70.8453], [-157.6056, 70.9412], [-157.1953, 71.0933], [-156.7833, 71.3189], [-155.8112, 71.1885], [-155.5795, 71.1211], [-155.8043, 70.9955], [-156.1466, 70.9279], [-155.8722, 70.8346], [-155.5794, 70.8943], [-155.1669, 71.0993], [-154.9438, 71.0831], [-154.6737, 70.9871], [-154.7852, 70.8943], [-154.1953, 70.8011], [-153.9182, 70.8773], [-153.2329, 70.9326], [-152.7849, 70.876], [-152.4912, 70.881], [-152.2329, 70.8103], [-152.4705, 70.6536], [-152.1729, 70.5567], [-151.769, 70.5602], [-151.9447, 70.4521], [-151.2248, 70.4188], [-150.6627, 70.5099], [-150.4032, 70.4439], [-150.1525, 70.4437], [-149.8701, 70.5096], [-149.2695, 70.5008], [-148.6884, 70.4163], [-148.4793, 70.3179], [-148.2487, 70.3567], [-147.8695, 70.3033], [-147.7054, 70.2172], [-147.0629, 70.1704], [-146.7449, 70.1917], [-145.8232, 70.16], [-145.1974, 70.0087], [-144.6192, 69.9821], [-144.4169, 70.039], [-143.7465, 70.102], [-143.2183, 70.1162], [-142.7079, 70.0338], [-142.2969, 69.8699], [-141.6992, 69.7704], [-141.4079, 69.6534], [-141.0022, 69.6508]]], [[[-134.3127, 58.2289], [-134.594, 58.2431], [-134.52, 58.3326], [-134.3127, 58.2289]]], [[[-132.8623, 54.8944], [-132.6173, 54.8925], [-132.6469, 54.7562], [-132.8073, 54.7091], [-133.1227, 54.9698], [-133.2511, 55.1751], [-133.418, 55.2107], [-133.2966, 55.3258], [-133.0974, 55.2137], [-132.8623, 54.8944]]], [[[-160.919, 58.5771], [-161.0703, 58.5691], [-161.1315, 58.6681], [-160.9863, 58.7364], [-160.7151, 58.7953], [-160.919, 58.5771]]], [[[-167.9644, 53.345], [-168.2707, 53.2381], [-168.446, 53.0844], [-168.6986, 52.9634], [-169.0659, 52.834], [-168.7959, 53.0449], [-168.7596, 53.175], [-168.639, 53.2558], [-168.4367, 53.2569], [-168.3572, 53.4576], [-168.1931, 53.5333], [-167.9857, 53.5581], [-167.8047, 53.4849], [-167.9644, 53.345]]], [[[-166.1354, 60.3835], [-166.0436, 60.3339], [-165.7297, 60.3142], [-165.7123, 60.0694], [-165.5918, 59.9131], [-165.9467, 59.89], [-166.1876, 59.7738], [-166.343, 59.8345], [-166.6276, 59.8647], [-167.1389, 60.0085], [-167.4364, 60.2067], [-167.2517, 60.2335], [-166.8363, 60.2169], [-166.7844, 60.2965], [-166.4757, 60.3827], [-166.1354, 60.3835]]], [[[-177.1482, 51.7167], [-177.5776, 51.6942], [-177.2098, 51.8414], [-177.1482, 51.7167]]], [[[-146.394, 60.4496], [-146.1283, 60.3926], [-146.6184, 60.2737], [-146.7026, 60.4085], [-146.5603, 60.4805], [-146.394, 60.4496]]], [[[-147.7358, 59.8132], [-147.8143, 59.902], [-147.4658, 60.097], [-147.12, 60.3631], [-146.9867, 60.2544], [-147.3184, 60.0753], [-147.4993, 59.8902], [-147.7358, 59.8132]]], [[[-177.8791, 51.6497], [-178.0589, 51.6726], [-177.9864, 51.7643], [-178.1945, 51.8822], [-177.9538, 51.9184], [-177.7706, 51.7779], [-177.8791, 51.6497]]], [[[-135.7304, 58.2443], [-135.5875, 58.1468], [-135.6133, 57.9919], [-135.3466, 58.124], [-135.0021, 58.0511], [-134.928, 57.9528], [-134.9706, 57.8173], [-135.2312, 57.8158], [-135.2495, 57.7326], [-134.9789, 57.7243], [-134.8731, 57.5893], [-134.9315, 57.4811], [-135.0848, 57.511], [-135.4979, 57.6623], [-135.6086, 57.6507], [-135.6178, 57.4804], [-135.692, 57.4199], [-135.9108, 57.4465], [-136.0766, 57.6745], [-136.4599, 57.8731], [-136.5686, 57.9722], [-136.5123, 58.0959], [-136.1424, 58.1539], [-135.7871, 58.2684], [-135.7304, 58.2443]]], [[[-166.6153, 53.9009], [-166.4975, 53.8835], [-166.3724, 53.999], [-166.2309, 53.9326], [-166.4887, 53.7855], [-166.5492, 53.701], [-166.4442, 53.6518], [-166.7704, 53.476], [-167.1537, 53.4078], [-167.5225, 53.2762], [-167.6695, 53.2599], [-167.8088, 53.3238], [-167.5302, 53.3937], [-167.1361, 53.5265], [-167.0157, 53.6984], [-167.1182, 53.8726], [-166.9781, 53.9629], [-166.6274, 53.9957], [-166.6153, 53.9009]]], [[[-131.3398, 55.0798], [-131.232, 54.9037], [-131.4062, 54.8943], [-131.4314, 54.9965], [-131.5951, 55.0908], [-131.5778, 55.2009], [-131.4046, 55.2133], [-131.3398, 55.0798]]], [[[-152.898, 57.8239], [-152.5115, 57.8514], [-152.4115, 57.6462], [-152.2163, 57.5771], [-152.4122, 57.4547], [-152.7814, 57.4534], [-152.679, 57.3452], [-152.879, 57.3208], [-153.0516, 57.2377], [-153.2744, 57.2263], [-153.5036, 57.138], [-153.6465, 57.0295], [-153.7572, 56.8584], [-153.9727, 56.7742], [-154.0709, 56.8207], [-153.7932, 56.9895], [-153.9994, 57.05], [-154.0653, 57.1336], [-154.3244, 57.1318], [-154.1843, 57.0053], [-154.3389, 56.9209], [-154.4988, 57.0365], [-154.5693, 57.2059], [-154.706, 57.3353], [-154.6732, 57.4461], [-154.5353, 57.5595], [-154.2814, 57.6381], [-154.0298, 57.6307], [-153.8054, 57.3582], [-153.8184, 57.5956], [-153.6931, 57.6634], [-153.9044, 57.8199], [-153.6627, 57.8579], [-153.5245, 57.731], [-153.2003, 57.82], [-153.1605, 57.972], [-152.8504, 57.8968], [-152.898, 57.8239]]], [[[-163.4761, 54.9808], [-163.3581, 54.7356], [-163.583, 54.6256], [-164.0733, 54.621], [-164.2346, 54.5713], [-164.4635, 54.4273], [-164.8234, 54.4191], [-164.8877, 54.6078], [-164.7062, 54.692], [-164.5298, 54.8808], [-164.2737, 54.9], [-163.868, 55.0392], [-163.6075, 55.0508], [-163.4761, 54.9808]]], [[[-133.9896, 56.845], [-133.8309, 56.7813], [-133.7384, 56.6505], [-133.8553, 56.5822], [-133.8846, 56.2921], [-133.9497, 56.1277], [-134.1896, 56.0769], [-134.245, 56.2032], [-134.1955, 56.4134], [-134.0844, 56.4564], [-134.2902, 56.58], [-134.3844, 56.724], [-134.3737, 56.8387], [-134.1433, 56.9323], [-133.9896, 56.845]]], [[[-133.5661, 56.3393], [-133.203, 56.3198], [-133.0818, 56.1942], [-133.0966, 56.09], [-132.7576, 55.9949], [-132.5977, 55.8951], [-132.4302, 55.687], [-132.5916, 55.4644], [-132.4178, 55.4829], [-132.2153, 55.3835], [-132.2066, 55.2244], [-131.9764, 55.2085], [-132.0004, 55.0338], [-131.9809, 54.8048], [-132.1343, 54.7126], [-132.3413, 54.9073], [-132.5494, 54.9525], [-132.5885, 55.0524], [-132.7823, 55.0485], [-133.103, 55.3602], [-132.9589, 55.3956], [-133.0824, 55.504], [-133.0896, 55.6126], [-133.2983, 55.6069], [-133.369, 55.689], [-133.5533, 55.6912], [-133.6802, 55.7851], [-133.4469, 55.7971], [-133.2415, 55.9209], [-133.3712, 56.0359], [-133.6842, 55.9428], [-133.7552, 55.9995], [-133.5308, 56.1456], [-133.5944, 56.2164], [-133.5661, 56.3393]]], [[[-133.3051, 55.5438], [-133.2817, 55.4979], [-133.6502, 55.2693], [-133.6342, 55.5393], [-133.3051, 55.5438]]], [[[-132.7799, 56.2472], [-133.0351, 56.3409], [-132.9021, 56.4537], [-132.7061, 56.4485], [-132.6694, 56.2873], [-132.7799, 56.2472]]], [[[-153.007, 57.1248], [-153.3746, 57.0519], [-153.2852, 57.185], [-153.007, 57.1248]]], [[[-133.3662, 57.0035], [-133.0708, 56.9743], [-132.9541, 56.8803], [-132.954, 56.713], [-133.1442, 56.5669], [-133.2126, 56.4646], [-133.6028, 56.464], [-133.6493, 56.5168], [-133.681, 56.7975], [-133.9794, 57.0096], [-133.866, 57.0687], [-133.3662, 57.0035]]], [[[-130.9791, 55.4892], [-131.0828, 55.2668], [-131.1879, 55.2063], [-131.4207, 55.2759], [-131.4745, 55.3735], [-131.811, 55.2231], [-131.8461, 55.4163], [-131.6476, 55.5855], [-131.625, 55.8316], [-131.2692, 55.9554], [-131.1207, 55.8566], [-130.966, 55.6695], [-130.9791, 55.4892]]], [[[-160.6849, 55.3148], [-160.5832, 55.3077], [-160.4875, 55.1848], [-160.8255, 55.174], [-160.8465, 55.3114], [-160.6849, 55.3148]]], [[[-132.1123, 56.1094], [-132.1329, 55.9432], [-132.2873, 55.9294], [-132.4511, 56.0564], [-132.6599, 56.0782], [-132.6991, 56.1982], [-132.5987, 56.2416], [-132.3798, 56.4987], [-132.3165, 56.4875], [-132.0669, 56.2442], [-132.1123, 56.1094]]], [[[-132.7468, 56.5257], [-132.9308, 56.5245], [-132.8425, 56.7948], [-132.6559, 56.6847], [-132.568, 56.5758], [-132.7468, 56.5257]]]]\n },\n \"properties\": {\n \"name\": \"Alaska\",\n \"id\": \"US-AK\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-AK\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-85.6235, 35.0009], [-85.3859, 33.8507], [-85.2009, 32.9562], [-85.1565, 32.8042], [-85.0151, 32.5261], [-84.986, 32.3609], [-84.9297, 32.2466], [-85.0346, 32.1474], [-85.1241, 31.8804], [-85.1248, 31.7768], [-85.0549, 31.5726], [-85.0926, 31.2957], [-85.0675, 31.1176], [-85.0073, 31.0016], [-85.9769, 31.0009], [-86.6236, 31.0009], [-87.5937, 31.0008], [-87.6011, 30.8605], [-87.4216, 30.6716], [-87.4294, 30.4778], [-87.4896, 30.3777], [-87.6222, 30.2647], [-87.7903, 30.2919], [-87.9243, 30.4496], [-87.9489, 30.627], [-88.0325, 30.6812], [-88.1355, 30.3666], [-88.3996, 30.3709], [-88.4443, 31.1397], [-88.4862, 31.8904], [-88.3397, 32.9988], [-88.1688, 34.292], [-88.0847, 34.9331], [-88.1733, 34.999], [-88.1905, 35.0249], [-86.9071, 35.0129], [-85.6235, 35.0009]]]\n },\n \"properties\": {\n \"name\": \"Alabama\",\n \"id\": \"US-AL\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-AL\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-89.7047, 36.0015], [-89.7037, 35.9069], [-89.7796, 35.8057], [-89.9436, 35.6791], [-89.9674, 35.5033], [-90.066, 35.4141], [-90.0929, 35.2036], [-90.1423, 35.1142], [-90.2938, 35.0012], [-90.3198, 34.8992], [-90.5392, 34.7281], [-90.5841, 34.5037], [-90.718, 34.3917], [-90.8172, 34.2522], [-90.9097, 34.1888], [-90.9431, 34.0297], [-91.0702, 33.9743], [-91.0528, 33.8276], [-91.2076, 33.6756], [-91.2146, 33.5834], [-91.1411, 33.4386], [-91.1633, 33.2944], [-91.1068, 33.2179], [-91.15, 33.0159], [-92.4243, 33.0139], [-93.3227, 33.0128], [-94.0413, 33.012], [-94.0472, 33.5544], [-94.2947, 33.5875], [-94.3778, 33.5661], [-94.4841, 33.6485], [-94.4616, 34.5178], [-94.4391, 35.3872], [-94.6184, 36.5009], [-93.7829, 36.5009], [-92.3904, 36.5009], [-91.5548, 36.5009], [-90.1623, 36.5009], [-90.0744, 36.3719], [-90.0758, 36.2967], [-90.303, 36.0993], [-90.3811, 35.9927], [-89.7047, 36.0015]]]\n },\n \"properties\": {\n \"name\": \"Arkansas\",\n \"id\": \"US-AR\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-AR\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-109.0467, 37.0009], [-109.0468, 36.2918], [-109.0469, 35.5829], [-109.0469, 34.5194], [-109.0472, 33.4558], [-109.0473, 32.3922], [-109.0478, 31.328], [-110.3351, 31.3255], [-111.0421, 31.3243], [-111.9905, 31.6202], [-112.939, 31.9162], [-113.8875, 32.2123], [-114.836, 32.5083], [-114.7248, 32.7154], [-114.5822, 32.7347], [-114.4775, 32.8419], [-114.4908, 32.9836], [-114.6481, 33.0718], [-114.7045, 33.1698], [-114.7017, 33.4179], [-114.6026, 33.47], [-114.4992, 33.6858], [-114.5091, 33.904], [-114.3293, 34.142], [-114.1255, 34.2865], [-114.1589, 34.3552], [-114.371, 34.4885], [-114.398, 34.5897], [-114.5575, 34.7946], [-114.6105, 34.9912], [-114.5909, 35.3528], [-114.6485, 35.4759], [-114.6452, 35.6305], [-114.6871, 35.9173], [-114.7414, 36.0136], [-114.6691, 36.1218], [-114.4061, 36.1484], [-114.1833, 36.0303], [-114.0429, 36.1817], [-114.0402, 37.0042], [-113.104, 37.0035], [-111.8556, 37.0026], [-111.2313, 37.0022], [-109.9829, 37.0014], [-109.0467, 37.0009]]]\n },\n \"properties\": {\n \"name\": \"Arizona\",\n \"id\": \"US-AZ\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-AZ\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-120.0008, 42.0005], [-120.0006, 40.6879], [-120.0001, 39.5627], [-120.0001, 39.0002], [-119.2974, 38.5098], [-118.5948, 38.0193], [-118.1262, 37.6924], [-117.2097, 37.0033], [-116.6596, 36.5899], [-115.8978, 35.9955], [-115.3901, 35.5991], [-114.6105, 34.9912], [-114.5575, 34.7946], [-114.398, 34.5897], [-114.371, 34.4885], [-114.1589, 34.3552], [-114.1255, 34.2865], [-114.3293, 34.142], [-114.5091, 33.904], [-114.4992, 33.6858], [-114.6026, 33.47], [-114.7017, 33.4179], [-114.7045, 33.1698], [-114.6481, 33.0718], [-114.4908, 32.9836], [-114.4775, 32.8419], [-114.5822, 32.7347], [-114.7248, 32.7154], [-115.6975, 32.6404], [-117.1282, 32.5334], [-117.1374, 32.6491], [-117.2436, 32.6641], [-117.2629, 32.9389], [-117.3188, 33.1], [-117.4675, 33.2955], [-117.7885, 33.5385], [-117.9521, 33.6196], [-118.0806, 33.7221], [-118.2644, 33.7586], [-118.4105, 33.7439], [-118.3929, 33.8583], [-118.5062, 34.0175], [-118.832, 34.0245], [-119.1437, 34.112], [-119.2358, 34.1641], [-119.2676, 34.2575], [-119.606, 34.418], [-119.8533, 34.412], [-120.0529, 34.4692], [-120.4812, 34.4716], [-120.6446, 34.58], [-120.6249, 34.812], [-120.663, 34.9494], [-120.6336, 35.0765], [-120.707, 35.1577], [-120.8574, 35.2096], [-120.8603, 35.3654], [-121.0228, 35.4809], [-121.138, 35.6071], [-121.2839, 35.6764], [-121.3438, 35.7923], [-121.6644, 36.154], [-121.8775, 36.331], [-121.9186, 36.5724], [-121.79, 36.7322], [-121.8074, 36.8513], [-121.8806, 36.9389], [-122.1642, 36.991], [-122.3948, 37.2075], [-122.4084, 37.3731], [-122.4993, 37.5426], [-122.5142, 37.772], [-122.3842, 37.7886], [-122.3698, 37.6559], [-122.2287, 37.5639], [-122.2222, 37.7321], [-122.296, 37.7904], [-122.3854, 37.9606], [-122.217, 38.0407], [-121.7168, 38.0341], [-122.0315, 38.1235], [-122.1538, 38.0655], [-122.3933, 38.1447], [-122.4839, 38.1088], [-122.4669, 37.8381], [-122.7604, 37.9456], [-122.9682, 38.097], [-122.9865, 38.2771], [-123.1212, 38.4493], [-123.2897, 38.5359], [-123.4248, 38.6757], [-123.7011, 38.9073], [-123.7195, 39.111], [-123.8202, 39.3684], [-123.7835, 39.6187], [-123.8845, 39.8608], [-124.1085, 40.0945], [-124.324, 40.2519], [-124.3717, 40.4912], [-124.2837, 40.7106], [-124.1331, 40.9697], [-124.14, 41.1558], [-124.0685, 41.3841], [-124.1177, 41.6218], [-124.2446, 41.7879], [-124.2284, 42.0008], [-123.4283, 42.0005], [-122.3737, 42.0005], [-121.0554, 42.0005], [-120.0008, 42.0005]]], [[[-119.8824, 34.0797], [-119.5622, 34.0065], [-119.8095, 33.9677], [-119.8824, 34.0797]]], [[[-120.0436, 33.9188], [-120.1672, 33.9181], [-120.2519, 34.0138], [-120.0719, 34.0265], [-120.0436, 33.9188]]]]\n },\n \"properties\": {\n \"name\": \"California\",\n \"id\": \"US-CA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-CA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-102.0245, 40.0011], [-102.0209, 39.0636], [-102.018, 38.3135], [-102.0128, 37.0009], [-103.0008, 37.0009], [-103.7566, 37.0009], [-104.8901, 37.0009], [-106.0238, 37.0009], [-106.7795, 37.0009], [-107.9131, 37.0009], [-109.0467, 37.0009], [-109.0465, 38.0009], [-109.0465, 39.2509], [-109.0465, 40.0008], [-109.0464, 41.0009], [-108.1044, 41.0009], [-107.1622, 41.0009], [-105.906, 41.0009], [-104.9638, 41.0009], [-104.0217, 41.0009], [-103.273, 41.0007], [-102.025, 41.0006], [-102.0245, 40.0011]]]\n },\n \"properties\": {\n \"name\": \"Colorado\",\n \"id\": \"US-CO\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-CO\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-71.8009, 42.0119], [-71.7958, 41.5199], [-71.8423, 41.3354], [-72.2653, 41.2917], [-72.8471, 41.2659], [-73.1823, 41.1758], [-73.6305, 40.9918], [-73.7231, 41.1045], [-73.4841, 41.2189], [-73.5447, 41.296], [-73.4806, 42.0556], [-72.8078, 42.0341], [-71.8017, 42.0227], [-71.8009, 42.0119]]]\n },\n \"properties\": {\n \"name\": \"Connecticut\",\n \"id\": \"US-CT\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-CT\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-77.0303, 38.8893], [-77.1221, 38.9435], [-77.0421, 39.0118], [-76.9312, 38.8882], [-77.0303, 38.8893]]]\n },\n \"properties\": {\n \"name\": \"District of Columbia\",\n \"id\": \"US-DC\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"Federal District\"\n },\n \"id\": \"US-DC\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-75.4211, 39.8154], [-75.5877, 39.6407], [-75.5738, 39.477], [-75.4127, 39.2813], [-75.3921, 39.0927], [-75.1851, 38.8194], [-75.0887, 38.7776], [-75.1284, 38.6325], [-75.0377, 38.4556], [-75.7071, 38.455], [-75.7847, 39.7223], [-75.6346, 39.8394], [-75.4211, 39.8154]]]\n },\n \"properties\": {\n \"name\": \"Delaware\",\n \"id\": \"US-DE\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-DE\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-81.504, 30.7313], [-81.4572, 30.6407], [-81.3858, 30.2699], [-81.2495, 29.7938], [-81.1045, 29.4569], [-80.8999, 29.0498], [-80.5241, 28.4861], [-80.6229, 28.3203], [-80.7317, 28.4629], [-80.6885, 28.5785], [-80.766, 28.6328], [-80.7487, 28.3809], [-80.6501, 28.1809], [-80.2261, 27.207], [-80.1257, 27.0829], [-80.05, 26.8077], [-80.0413, 26.5686], [-80.1107, 26.1316], [-80.1264, 25.8335], [-80.3008, 25.6186], [-80.3669, 25.3312], [-80.4846, 25.2299], [-80.5577, 25.2325], [-80.7366, 25.1564], [-80.8622, 25.1761], [-81.1104, 25.138], [-81.1675, 25.2285], [-81.0977, 25.3191], [-81.2272, 25.5834], [-81.3452, 25.7319], [-81.3649, 25.831], [-81.5683, 25.8916], [-81.7155, 25.9832], [-81.8114, 26.1461], [-81.8665, 26.435], [-82.0396, 26.5521], [-82.0778, 26.7043], [-82.067, 26.8915], [-82.1807, 26.8401], [-82.2901, 26.8708], [-82.4413, 27.0596], [-82.6204, 27.4011], [-82.6359, 27.5246], [-82.4006, 27.8353], [-82.5206, 27.8778], [-82.6609, 27.7185], [-82.7429, 27.7094], [-82.8435, 27.846], [-82.7485, 28.2368], [-82.6607, 28.4858], [-82.6515, 28.8875], [-82.7693, 29.0515], [-83.2905, 29.4519], [-83.6944, 29.926], [-84.0443, 30.1037], [-84.3098, 30.0648], [-84.3828, 29.9074], [-84.55, 29.8979], [-84.8005, 29.7731], [-85.0292, 29.7212], [-85.3188, 29.6802], [-85.3069, 29.7978], [-85.3537, 29.8757], [-85.6758, 30.1218], [-85.6035, 30.2868], [-85.7408, 30.2444], [-85.7557, 30.167], [-86.1752, 30.3325], [-86.2574, 30.493], [-86.4479, 30.4956], [-86.6796, 30.4028], [-87.2011, 30.3393], [-86.9858, 30.4308], [-87.1705, 30.5388], [-87.1847, 30.4537], [-87.2811, 30.3393], [-87.4758, 30.2942], [-87.4896, 30.3777], [-87.4294, 30.4778], [-87.4216, 30.6716], [-87.6011, 30.8605], [-87.5937, 31.0008], [-86.6236, 31.0009], [-85.9769, 31.0009], [-85.0073, 31.0016], [-84.8839, 30.7209], [-84.1528, 30.6777], [-82.8775, 30.603], [-82.2399, 30.5657], [-82.1942, 30.3935], [-82.0618, 30.4046], [-82.0219, 30.5598], [-82.0382, 30.7319], [-81.9356, 30.8195], [-81.6733, 30.7403], [-81.504, 30.7313]]]\n },\n \"properties\": {\n \"name\": \"Florida\",\n \"id\": \"US-FL\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-FL\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-80.8724, 32.0295], [-80.9234, 31.9449], [-81.1133, 31.8787], [-81.065, 31.8135], [-81.1979, 31.7042], [-81.1754, 31.5313], [-81.295, 31.3712], [-81.2885, 31.2639], [-81.4532, 31.0883], [-81.5204, 30.8746], [-81.504, 30.7313], [-81.6733, 30.7403], [-81.9356, 30.8195], [-82.0382, 30.7319], [-82.0219, 30.5598], [-82.0618, 30.4046], [-82.1942, 30.3935], [-82.2399, 30.5657], [-82.8775, 30.603], [-84.1528, 30.6777], [-84.8839, 30.7209], [-85.0073, 31.0016], [-85.0675, 31.1176], [-85.0926, 31.2957], [-85.0549, 31.5726], [-85.1248, 31.7768], [-85.1241, 31.8804], [-85.0346, 32.1474], [-84.9297, 32.2466], [-84.986, 32.3609], [-85.0151, 32.5261], [-85.1565, 32.8042], [-85.2009, 32.9562], [-85.3859, 33.8507], [-85.6235, 35.0009], [-84.3247, 34.988], [-83.1149, 35.0015], [-83.3167, 34.8057], [-83.3557, 34.7083], [-83.0528, 34.5109], [-82.8478, 34.4369], [-82.8187, 34.3661], [-82.5894, 34.0176], [-82.2566, 33.7493], [-82.2084, 33.6636], [-82.0057, 33.5229], [-81.9329, 33.3899], [-81.6994, 33.1267], [-81.5783, 33.0686], [-81.4897, 32.9356], [-81.377, 32.6075], [-81.2903, 32.5573], [-81.1714, 32.3801], [-81.1351, 32.1818], [-81.0748, 32.1097], [-80.8724, 32.0295]]]\n },\n \"properties\": {\n \"name\": \"Georgia\",\n \"id\": \"US-GA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-GA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-156.4868, 20.9326], [-156.2775, 20.9514], [-156.1484, 20.8855], [-155.9899, 20.7572], [-156.1072, 20.6448], [-156.31, 20.5988], [-156.4383, 20.6179], [-156.4801, 20.8012], [-156.6155, 20.8218], [-156.6897, 20.9014], [-156.6568, 21.0244], [-156.5855, 21.0343], [-156.4868, 20.9326]]], [[[-157.2136, 21.2155], [-156.7423, 21.1635], [-156.8599, 21.0563], [-157.0209, 21.0978], [-157.2903, 21.1126], [-157.2136, 21.2155]]], [[[-156.8496, 20.7727], [-156.9734, 20.7575], [-157.0506, 20.9126], [-156.9418, 20.9301], [-156.8094, 20.8311], [-156.8496, 20.7727]]], [[[-155.5813, 19.012], [-155.6808, 18.9676], [-155.8813, 19.0704], [-155.9056, 19.1258], [-155.8907, 19.3825], [-155.9659, 19.5908], [-156.0487, 19.7499], [-155.8203, 20.0143], [-155.8928, 20.1674], [-155.8316, 20.2758], [-155.6221, 20.1633], [-155.1988, 19.9944], [-155.0861, 19.8756], [-155.0659, 19.7481], [-154.8042, 19.5245], [-154.8503, 19.4541], [-155.0535, 19.3192], [-155.3097, 19.2601], [-155.5352, 19.109], [-155.5813, 19.012]]], [[[-160.1801, 21.841], [-160.2209, 21.8972], [-160.1006, 22.0153], [-160.08, 21.9075], [-160.1801, 21.841]]], [[[-157.7993, 21.4567], [-157.6355, 21.3076], [-157.7988, 21.2687], [-157.9018, 21.3405], [-158.1104, 21.3186], [-158.2391, 21.4893], [-158.2732, 21.5851], [-158.1231, 21.6002], [-157.9625, 21.7014], [-157.7993, 21.4567]]], [[[-159.3728, 21.9323], [-159.4607, 21.8761], [-159.6089, 21.9094], [-159.7892, 22.0419], [-159.7267, 22.1402], [-159.5792, 22.2232], [-159.3521, 22.2196], [-159.3007, 22.1052], [-159.3728, 21.9323]]]]\n },\n \"properties\": {\n \"name\": \"Hawaii\",\n \"id\": \"US-HI\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-HI\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-90.6506, 42.5129], [-90.4848, 42.3833], [-90.3466, 42.2148], [-90.1675, 42.1003], [-90.1524, 41.9816], [-90.2177, 41.813], [-90.4367, 41.5603], [-90.7541, 41.4498], [-90.9387, 41.4255], [-91.0482, 41.369], [-91.0665, 41.2059], [-90.9638, 41.0825], [-91.0001, 40.9047], [-91.1021, 40.7498], [-91.2151, 40.6496], [-91.3391, 40.604], [-91.4419, 40.3794], [-91.682, 40.5519], [-91.7315, 40.6246], [-93.2451, 40.616], [-94.5063, 40.6087], [-95.765, 40.6018], [-95.859, 40.7451], [-95.8341, 40.8895], [-95.8836, 41.2876], [-95.9329, 41.4254], [-96.0586, 41.5458], [-96.0688, 41.7343], [-96.1543, 41.9652], [-96.2954, 42.1329], [-96.3837, 42.4177], [-96.4809, 42.5113], [-96.5388, 42.6587], [-96.6218, 42.7296], [-96.4627, 43.0992], [-96.5555, 43.2317], [-96.5416, 43.3735], [-96.5985, 43.4976], [-96.4536, 43.5012], [-95.478, 43.5013], [-94.5023, 43.5014], [-93.5267, 43.5016], [-92.2258, 43.5018], [-91.2453, 43.5024], [-91.2187, 43.3953], [-91.1172, 43.3311], [-91.1614, 43.1023], [-91.0695, 42.7885], [-90.9599, 42.7204], [-90.7887, 42.6769], [-90.6879, 42.6104], [-90.6506, 42.5129]]]\n },\n \"properties\": {\n \"name\": \"Iowa\",\n \"id\": \"US-IA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-IA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-111.0514, 44.4989], [-111.051, 43.7182], [-111.0508, 43.0938], [-111.0503, 42.0009], [-111.9855, 42.0009], [-112.7333, 42.001], [-114.0426, 42.001], [-115.1578, 42.0009], [-115.9014, 42.0008], [-117.0166, 42.0005], [-117.019, 43.1165], [-117.0205, 43.8132], [-116.9113, 44.1574], [-116.9531, 44.2453], [-117.1398, 44.2903], [-117.2017, 44.4362], [-117.1189, 44.5783], [-116.9489, 44.7701], [-116.8396, 44.9851], [-116.5492, 45.4567], [-116.4771, 45.6411], [-116.6168, 45.7992], [-116.7647, 45.873], [-116.8965, 46.0021], [-116.943, 46.2321], [-117.025, 46.4291], [-117.0317, 47.7115], [-117.039, 48.993], [-116.0485, 48.993], [-116.0491, 48.0047], [-115.7337, 47.7064], [-115.6697, 47.4979], [-115.7024, 47.4377], [-115.3495, 47.2612], [-114.9357, 46.9229], [-114.7537, 46.7345], [-114.6015, 46.6603], [-114.3368, 46.6592], [-114.3459, 46.5506], [-114.4853, 46.1582], [-114.4784, 46.0356], [-114.4051, 45.8742], [-114.5338, 45.7819], [-114.4958, 45.6859], [-114.5292, 45.5757], [-114.2976, 45.4875], [-113.9426, 45.6815], [-113.8023, 45.601], [-113.697, 45.305], [-113.4711, 45.0729], [-113.4693, 44.93], [-113.3389, 44.8081], [-113.1872, 44.7986], [-113.0933, 44.7154], [-112.9998, 44.4803], [-112.8156, 44.406], [-112.7159, 44.498], [-112.3929, 44.468], [-112.2313, 44.5607], [-111.7972, 44.5399], [-111.4998, 44.5448], [-111.4481, 44.7111], [-111.3374, 44.7449], [-111.1976, 44.5906], [-111.0514, 44.4989]]]\n },\n \"properties\": {\n \"name\": \"Idaho\",\n \"id\": \"US-ID\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-ID\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-87.8121, 42.4971], [-87.7975, 42.2114], [-87.6946, 42.0844], [-87.5212, 41.7277], [-87.5254, 40.8615], [-87.5283, 40.2619], [-87.533, 39.3749], [-87.611, 39.2914], [-87.6472, 39.1688], [-87.5304, 38.9089], [-87.5295, 38.7423], [-87.6359, 38.5427], [-87.784, 38.4191], [-87.8271, 38.3356], [-87.9805, 38.2492], [-88.0425, 37.9366], [-88.0953, 37.8756], [-88.042, 37.7888], [-88.1289, 37.6995], [-88.1075, 37.5343], [-88.1906, 37.4646], [-88.4947, 37.3642], [-88.4533, 37.1782], [-88.4717, 37.0883], [-88.8726, 37.1856], [-89.0462, 37.183], [-89.1345, 37.1025], [-89.1543, 36.9921], [-89.2725, 37.08], [-89.414, 37.1023], [-89.503, 37.3005], [-89.462, 37.4342], [-89.5234, 37.6445], [-89.6233, 37.7472], [-89.823, 37.8841], [-90.1737, 38.069], [-90.299, 38.1739], [-90.374, 38.3097], [-90.3165, 38.4578], [-90.1268, 38.8325], [-90.2201, 38.8977], [-90.4781, 38.9481], [-90.5771, 38.9096], [-90.6635, 38.9875], [-90.7372, 39.1818], [-90.9195, 39.3869], [-91.2099, 39.6029], [-91.3787, 39.7493], [-91.4669, 39.9428], [-91.4998, 40.226], [-91.4419, 40.3794], [-91.3391, 40.604], [-91.2151, 40.6496], [-91.1021, 40.7498], [-91.0001, 40.9047], [-90.9638, 41.0825], [-91.0665, 41.2059], [-91.0482, 41.369], [-90.9387, 41.4255], [-90.7541, 41.4498], [-90.4367, 41.5603], [-90.2177, 41.813], [-90.1524, 41.9816], [-90.1675, 42.1003], [-90.3466, 42.2148], [-90.4848, 42.3833], [-90.6506, 42.5129], [-89.2905, 42.5052], [-87.8121, 42.4971]]]\n },\n \"properties\": {\n \"name\": \"Illinois\",\n \"id\": \"US-IL\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-IL\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-84.7961, 41.7014], [-84.803, 41.0506], [-84.8133, 40.0745], [-84.8216, 39.092], [-84.8541, 38.9129], [-84.8007, 38.8194], [-85.1699, 38.6903], [-85.3068, 38.7372], [-85.4447, 38.6831], [-85.4248, 38.5966], [-85.6464, 38.3473], [-85.8549, 38.2151], [-85.9611, 38.0139], [-86.1035, 37.9918], [-86.2838, 38.1298], [-86.4297, 38.1397], [-86.5487, 37.9171], [-86.6731, 37.889], [-86.7703, 37.9598], [-86.9694, 37.938], [-87.1411, 37.8052], [-87.3724, 37.9234], [-87.5995, 37.9465], [-87.7145, 37.8997], [-87.9059, 37.9019], [-87.9125, 37.8177], [-88.042, 37.7888], [-88.0953, 37.8756], [-88.0425, 37.9366], [-87.9805, 38.2492], [-87.8271, 38.3356], [-87.784, 38.4191], [-87.6359, 38.5427], [-87.5295, 38.7423], [-87.5304, 38.9089], [-87.6472, 39.1688], [-87.611, 39.2914], [-87.533, 39.3749], [-87.5283, 40.2619], [-87.5254, 40.8615], [-87.5212, 41.7277], [-87.4124, 41.6564], [-87.2532, 41.6377], [-87.0726, 41.6695], [-86.8627, 41.7607], [-85.4026, 41.76], [-84.7964, 41.7597], [-84.7961, 41.7014]]]\n },\n \"properties\": {\n \"name\": \"Indiana\",\n \"id\": \"US-IN\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-IN\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-94.6181, 37.0009], [-95.5424, 37.0009], [-96.4668, 37.0009], [-97.1601, 37.0009], [-98.0844, 37.0009], [-99.0086, 37.0009], [-99.9329, 37.0009], [-101.0885, 37.0009], [-102.0128, 37.0009], [-102.018, 38.3135], [-102.0209, 39.0636], [-102.0245, 40.0011], [-100.7669, 40.0011], [-99.2997, 40.0011], [-97.8325, 40.0011], [-96.7845, 40.0011], [-95.3466, 40.0015], [-95.1162, 39.8721], [-94.9841, 39.8911], [-94.8933, 39.7818], [-95.0754, 39.5974], [-95.058, 39.509], [-94.9525, 39.4264], [-94.7778, 39.194], [-94.6225, 39.1245], [-94.623, 38.5647], [-94.62, 37.6525], [-94.6181, 37.0009]]]\n },\n \"properties\": {\n \"name\": \"Kansas\",\n \"id\": \"US-KS\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-KS\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-82.6129, 38.4482], [-82.5784, 38.272], [-82.5887, 38.0998], [-82.2802, 37.6872], [-82.1035, 37.5706], [-81.9652, 37.5396], [-82.3431, 37.2969], [-82.6816, 37.1381], [-82.7319, 37.048], [-82.8945, 36.9064], [-83.1502, 36.7624], [-83.6676, 36.605], [-83.7304, 36.5868], [-84.4247, 36.6062], [-85.8133, 36.6453], [-86.5076, 36.6648], [-87.8392, 36.6439], [-88.0964, 36.693], [-88.0591, 36.4997], [-89.4503, 36.5], [-89.3974, 36.5878], [-89.203, 36.6256], [-89.1225, 36.9116], [-89.1543, 36.9921], [-89.1345, 37.1025], [-89.0462, 37.183], [-88.8726, 37.1856], [-88.4717, 37.0883], [-88.4533, 37.1782], [-88.4947, 37.3642], [-88.1906, 37.4646], [-88.1075, 37.5343], [-88.1289, 37.6995], [-88.042, 37.7888], [-87.9125, 37.8177], [-87.9059, 37.9019], [-87.7145, 37.8997], [-87.5995, 37.9465], [-87.3724, 37.9234], [-87.1411, 37.8052], [-86.9694, 37.938], [-86.7703, 37.9598], [-86.6731, 37.889], [-86.5487, 37.9171], [-86.4297, 38.1397], [-86.2838, 38.1298], [-86.1035, 37.9918], [-85.9611, 38.0139], [-85.8549, 38.2151], [-85.6464, 38.3473], [-85.4248, 38.5966], [-85.4447, 38.6831], [-85.3068, 38.7372], [-85.1699, 38.6903], [-84.8007, 38.8194], [-84.8541, 38.9129], [-84.8216, 39.092], [-84.7069, 39.1289], [-84.5946, 39.0858], [-84.43, 39.0909], [-84.2904, 38.9747], [-84.2272, 38.8652], [-84.1133, 38.7984], [-83.9484, 38.7743], [-83.6898, 38.6495], [-83.5384, 38.6998], [-83.357, 38.6274], [-83.2035, 38.6389], [-83.0001, 38.7141], [-82.8805, 38.7102], [-82.7582, 38.5412], [-82.6129, 38.4482]]]\n },\n \"properties\": {\n \"name\": \"Kentucky\",\n \"id\": \"US-KY\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-KY\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-91.7938, 29.5007], [-91.9963, 29.5731], [-91.8754, 29.6409], [-91.7677, 29.5847], [-91.7938, 29.5007]]], [[[-89.521, 30.1926], [-89.5884, 30.166], [-89.9543, 30.2688], [-90.0452, 30.3514], [-90.2252, 30.3794], [-90.332, 30.2776], [-90.4131, 30.1403], [-90.1753, 30.0291], [-89.9942, 30.0593], [-89.8941, 30.1258], [-89.7373, 30.172], [-89.6651, 30.117], [-89.8152, 30.0073], [-89.7438, 29.9299], [-89.5895, 29.9151], [-89.4945, 30.0582], [-89.3578, 29.9211], [-89.3545, 29.8202], [-89.5307, 29.7722], [-89.7209, 29.6193], [-89.6748, 29.5387], [-89.5137, 29.42], [-89.2456, 29.3331], [-89.0158, 29.2028], [-89.1555, 29.0166], [-89.2362, 29.0811], [-89.3535, 29.0702], [-89.4431, 29.1942], [-89.6202, 29.3024], [-89.7923, 29.3331], [-89.8772, 29.458], [-90.0523, 29.4314], [-90.1013, 29.1817], [-90.2129, 29.1049], [-90.3016, 29.2558], [-90.3792, 29.2951], [-90.5863, 29.2715], [-90.6775, 29.1506], [-90.7511, 29.1309], [-91.0027, 29.1935], [-91.2901, 29.289], [-91.1555, 29.3507], [-91.331, 29.5136], [-91.5142, 29.5554], [-91.6724, 29.7461], [-91.8243, 29.7506], [-91.8932, 29.8361], [-92.0173, 29.8003], [-92.1355, 29.6995], [-92.0841, 29.5928], [-92.2608, 29.5569], [-92.6712, 29.5971], [-92.9525, 29.7142], [-93.1757, 29.7789], [-93.6948, 29.7698], [-93.8265, 29.7251], [-93.8839, 29.81], [-93.7731, 29.9141], [-93.794, 29.9772], [-93.7106, 30.1128], [-93.7504, 30.3448], [-93.7202, 30.5583], [-93.5792, 30.8238], [-93.5306, 31.0462], [-93.5577, 31.1804], [-93.6659, 31.3226], [-93.7376, 31.5138], [-93.8206, 31.604], [-93.8269, 31.7503], [-93.905, 31.877], [-94.0434, 31.9992], [-94.0413, 33.012], [-93.3227, 33.0128], [-92.4243, 33.0139], [-91.15, 33.0159], [-91.0961, 32.9376], [-91.1424, 32.6611], [-91.1038, 32.4905], [-90.9447, 32.3307], [-90.9477, 32.2401], [-91.0887, 32.1042], [-91.1566, 31.9707], [-91.2864, 31.884], [-91.3725, 31.7736], [-91.4146, 31.6399], [-91.529, 31.4488], [-91.529, 31.3451], [-91.6307, 31.2176], [-91.5963, 31.1099], [-91.6565, 31.0018], [-91.1769, 31.0012], [-89.7353, 31.0011], [-89.8354, 30.7308], [-89.82, 30.6112], [-89.6858, 30.4627], [-89.5917, 30.223], [-89.521, 30.1926]]]]\n },\n \"properties\": {\n \"name\": \"Louisiana\",\n \"id\": \"US-LA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-LA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-70.5099, 41.3763], [-70.7854, 41.3275], [-70.6737, 41.4486], [-70.5099, 41.3763]]], [[[-70.8062, 42.8767], [-70.8291, 42.8254], [-70.7357, 42.6692], [-71.0462, 42.3311], [-70.7383, 42.2289], [-70.5488, 41.9386], [-70.5147, 41.8033], [-70.2954, 41.729], [-70.0014, 41.8262], [-69.9486, 41.6772], [-70.4047, 41.6268], [-70.657, 41.5343], [-70.7012, 41.7149], [-70.9742, 41.5485], [-71.1885, 41.5164], [-71.2338, 41.7065], [-71.3407, 41.7978], [-71.3871, 42.0169], [-71.8009, 42.0119], [-71.8017, 42.0227], [-72.8078, 42.0341], [-73.4806, 42.0556], [-73.5072, 42.08], [-73.2533, 42.7522], [-72.4669, 42.7303], [-71.3296, 42.7024], [-70.974, 42.8716], [-70.8062, 42.8767]]]]\n },\n \"properties\": {\n \"name\": \"Massachusetts\",\n \"id\": \"US-MA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-75.7847, 39.7223], [-75.7071, 38.455], [-75.0377, 38.4556], [-75.1342, 38.3843], [-75.376, 38.025], [-75.62, 37.9993], [-75.6592, 37.954], [-75.8508, 37.9716], [-75.7953, 38.0866], [-75.928, 38.1693], [-75.864, 38.2613], [-76.0513, 38.2795], [-76.2116, 38.3613], [-76.2948, 38.4947], [-76.2641, 38.6], [-76.0569, 38.6212], [-76.3003, 38.8183], [-76.1682, 38.8527], [-76.2357, 39.1917], [-76.1532, 39.3151], [-75.9547, 39.4596], [-75.959, 39.5851], [-76.0629, 39.5611], [-76.0972, 39.433], [-76.2764, 39.3228], [-76.4056, 39.3038], [-76.4208, 39.225], [-76.5739, 39.2543], [-76.42, 39.0739], [-76.5196, 38.8982], [-76.5368, 38.7426], [-76.5013, 38.5321], [-76.4164, 38.4202], [-76.4388, 38.3615], [-76.3329, 38.1408], [-76.5936, 38.2282], [-76.8896, 38.2921], [-77.0767, 38.4417], [-77.2326, 38.4077], [-77.2416, 38.4948], [-77.0183, 38.7777], [-77.0303, 38.8893], [-76.9312, 38.8882], [-77.0421, 39.0118], [-77.1221, 38.9435], [-77.3012, 39.0533], [-77.4809, 39.113], [-77.4789, 39.2209], [-77.7266, 39.3465], [-77.7981, 39.5172], [-77.8832, 39.6107], [-78.1812, 39.6857], [-78.4068, 39.6279], [-78.4956, 39.5334], [-78.8148, 39.5701], [-78.9714, 39.4537], [-79.0752, 39.4761], [-79.2935, 39.3115], [-79.488, 39.2109], [-79.4776, 39.7227], [-78.0926, 39.7226], [-76.708, 39.7225], [-75.7847, 39.7223]]]\n },\n \"properties\": {\n \"name\": \"Maryland\",\n \"id\": \"US-MD\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MD\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-68.1872, 44.3325], [-68.4118, 44.2944], [-68.2995, 44.4565], [-68.1872, 44.3325]]], [[[-70.7331, 43.07], [-70.829, 43.2391], [-70.9557, 43.3894], [-71.0314, 44.5297], [-71.0846, 45.294], [-70.8369, 45.3106], [-70.7992, 45.4048], [-70.6898, 45.4283], [-70.7023, 45.5514], [-70.421, 45.7383], [-70.2962, 45.9061], [-70.3045, 46.0574], [-70.2483, 46.2509], [-70.0673, 46.4411], [-70.0076, 46.7089], [-69.2429, 47.4629], [-69.0502, 47.4267], [-69.0486, 47.2737], [-68.8286, 47.2033], [-68.4805, 47.2857], [-68.3109, 47.3544], [-68.0968, 47.2749], [-67.8068, 47.0828], [-67.7958, 46.4984], [-67.7846, 45.7017], [-67.5958, 45.6208], [-67.4326, 45.6031], [-67.4936, 45.4741], [-67.4279, 45.378], [-67.4726, 45.2759], [-67.3669, 45.1738], [-67.1249, 45.1694], [-67.0805, 44.9891], [-67.1066, 44.885], [-66.9871, 44.8277], [-67.1912, 44.6756], [-67.364, 44.6969], [-67.556, 44.6448], [-67.6529, 44.5623], [-67.8392, 44.5763], [-67.907, 44.4536], [-68.0566, 44.3842], [-68.1174, 44.4906], [-68.2774, 44.5074], [-68.6121, 44.3105], [-68.7939, 44.3818], [-68.8473, 44.485], [-68.9615, 44.4339], [-68.9562, 44.3482], [-69.0635, 44.1724], [-69.0685, 44.0975], [-69.2261, 43.9864], [-69.3446, 44.001], [-69.4809, 43.9051], [-69.7298, 43.8521], [-69.7916, 43.8053], [-69.9652, 43.8551], [-70.1789, 43.7663], [-70.2692, 43.6719], [-70.2026, 43.6262], [-70.5207, 43.3488], [-70.6423, 43.1344], [-70.7331, 43.07]]]]\n },\n \"properties\": {\n \"name\": \"Maine\",\n \"id\": \"US-ME\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-ME\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-88.9552, 47.926], [-89.1568, 47.8408], [-89.1466, 47.9526], [-88.5883, 48.1585], [-88.6247, 48.042], [-88.9552, 47.926]]], [[[-88.2219, 47.2106], [-88.2368, 47.1589], [-88.4341, 47.1223], [-88.6158, 47.1741], [-88.5619, 47.2722], [-88.3944, 47.3887], [-88.1102, 47.4725], [-88.0155, 47.3208], [-88.2219, 47.2106]]], [[[-84.1329, 46.3622], [-84.2741, 46.4875], [-84.1423, 46.5309], [-84.1329, 46.3622]]], [[[-87.6059, 45.1085], [-87.721, 45.2427], [-87.6964, 45.3829], [-87.8653, 45.3678], [-87.8152, 45.5059], [-87.8091, 45.6861], [-87.9225, 45.76], [-88.1161, 45.8158], [-88.1518, 45.9454], [-88.4931, 46.0135], [-88.8374, 46.0365], [-89.1193, 46.1491], [-90.1185, 46.3416], [-90.2304, 46.5098], [-90.4077, 46.593], [-90.1536, 46.6546], [-89.8605, 46.7928], [-89.6951, 46.8386], [-89.355, 46.8819], [-89.1548, 46.9886], [-88.9482, 47.043], [-88.8297, 47.1459], [-88.6327, 47.167], [-88.5154, 47.0955], [-88.4558, 46.9628], [-88.4761, 46.8367], [-88.2162, 46.9516], [-87.7776, 46.8878], [-87.6374, 46.8265], [-87.3581, 46.5244], [-87.0341, 46.5432], [-86.8515, 46.4703], [-86.6375, 46.453], [-86.531, 46.5244], [-86.2313, 46.6563], [-85.9467, 46.7021], [-85.6161, 46.6906], [-85.0146, 46.7835], [-85.0343, 46.5058], [-84.7789, 46.4683], [-84.6973, 46.4907], [-84.5283, 46.436], [-84.3274, 46.4915], [-84.229, 46.3658], [-84.2036, 46.247], [-84.0409, 46.0881], [-83.9787, 45.9615], [-84.3409, 45.9998], [-84.5212, 45.9946], [-84.6314, 46.0526], [-84.8019, 45.8743], [-85.1007, 46.0461], [-85.3859, 46.1087], [-85.5551, 46.0782], [-85.7079, 45.9876], [-85.9593, 45.9407], [-86.1229, 45.9689], [-86.2717, 45.9367], [-86.3995, 45.8007], [-86.5594, 45.8063], [-86.5634, 45.8824], [-86.7985, 45.8317], [-86.9378, 45.7003], [-87.0848, 45.7298], [-87.2165, 45.6074], [-87.3989, 45.3646], [-87.6022, 45.157], [-87.6059, 45.1085]]], [[[-83.5035, 46.0131], [-83.518, 45.9578], [-83.7307, 45.9429], [-83.8658, 45.9791], [-83.6082, 46.0965], [-83.5035, 46.0131]]], [[[-83.4542, 41.7456], [-83.4643, 41.7394], [-84.7961, 41.7014], [-84.7964, 41.7597], [-85.4026, 41.76], [-86.8627, 41.7607], [-86.6325, 41.9114], [-86.4073, 42.2237], [-86.2995, 42.4176], [-86.2328, 42.65], [-86.2215, 42.9004], [-86.3292, 43.2242], [-86.5421, 43.6373], [-86.4405, 43.7943], [-86.4486, 43.924], [-86.5192, 44.0738], [-86.296, 44.3306], [-86.2422, 44.5514], [-86.237, 44.7202], [-86.1259, 44.7477], [-86.0577, 44.9164], [-85.8579, 44.9615], [-85.6893, 45.1281], [-85.5877, 45.1613], [-85.6472, 44.8376], [-85.4846, 44.8403], [-85.389, 45.0328], [-85.3756, 45.277], [-85.2229, 45.3561], [-84.9671, 45.3926], [-85.0877, 45.5068], [-85.0878, 45.6053], [-84.9515, 45.7753], [-84.772, 45.7948], [-84.4414, 45.6763], [-84.1892, 45.6112], [-84.1278, 45.5325], [-83.4785, 45.3389], [-83.3201, 45.1389], [-83.4482, 45.0246], [-83.3278, 44.8692], [-83.2944, 44.6834], [-83.3306, 44.3752], [-83.5125, 44.2707], [-83.614, 44.0583], [-83.8789, 43.9626], [-83.9395, 43.782], [-83.9157, 43.7005], [-83.7352, 43.6266], [-83.6217, 43.6365], [-83.4689, 43.7308], [-83.3382, 43.929], [-82.9946, 44.0612], [-82.8782, 44.0477], [-82.7161, 43.939], [-82.5968, 43.6344], [-82.4612, 43.081], [-82.4173, 43.0174], [-82.4884, 42.7394], [-82.5453, 42.6247], [-82.8678, 42.3853], [-83.1047, 42.2864], [-83.2619, 41.9463], [-83.3621, 41.8798], [-83.4542, 41.7456]]]]\n },\n \"properties\": {\n \"name\": \"Michigan\",\n \"id\": \"US-MI\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MI\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-93.3778, 48.6165], [-93.0517, 48.6199], [-92.8367, 48.5678], [-92.5005, 48.4354], [-92.4147, 48.2766], [-92.1718, 48.3384], [-92.0052, 48.3018], [-91.8584, 48.1976], [-91.5183, 48.0583], [-91.2207, 48.1046], [-91.0434, 48.1938], [-90.8402, 48.2005], [-90.7444, 48.1046], [-90.3201, 48.0991], [-90.0918, 48.1181], [-89.9936, 48.0152], [-89.6338, 47.9937], [-89.8288, 47.9009], [-90.1972, 47.7864], [-90.5975, 47.6878], [-90.957, 47.5236], [-91.3862, 47.2147], [-91.6451, 47.05], [-92.0644, 46.8188], [-92.107, 46.7623], [-92.2917, 46.6607], [-92.2926, 46.0843], [-92.6938, 45.909], [-92.8747, 45.7061], [-92.8924, 45.5947], [-92.7071, 45.4937], [-92.6857, 45.3806], [-92.7661, 45.2364], [-92.7931, 45.0713], [-92.7634, 44.9342], [-92.7991, 44.79], [-92.6435, 44.6453], [-92.3669, 44.5522], [-92.2404, 44.4621], [-92.0551, 44.3999], [-91.8409, 44.1942], [-91.3827, 43.9908], [-91.2785, 43.7975], [-91.2453, 43.5024], [-92.2258, 43.5018], [-93.5267, 43.5016], [-94.5023, 43.5014], [-95.478, 43.5013], [-96.4536, 43.5012], [-96.4536, 44.1747], [-96.4536, 45.2973], [-96.5298, 45.3715], [-96.696, 45.4317], [-96.8455, 45.5958], [-96.8137, 45.6592], [-96.6146, 45.8], [-96.5563, 45.9428], [-96.5608, 46.1383], [-96.6175, 46.3271], [-96.7309, 46.4727], [-96.7867, 46.6483], [-96.7702, 46.9196], [-96.8183, 46.9742], [-96.8588, 47.5884], [-96.988, 47.8204], [-97.0074, 47.9255], [-97.1259, 48.1735], [-97.1439, 48.5367], [-97.1281, 48.6811], [-97.2257, 48.9932], [-95.8242, 48.9932], [-95.162, 48.9918], [-95.1553, 49.3697], [-94.8543, 49.3046], [-94.8425, 49.1192], [-94.7052, 48.8085], [-94.6208, 48.7425], [-94.0552, 48.659], [-93.8517, 48.6073], [-93.7077, 48.5255], [-93.4636, 48.5612], [-93.3778, 48.6165]]]\n },\n \"properties\": {\n \"name\": \"Minnesota\",\n \"id\": \"US-MN\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MN\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-91.4419, 40.3794], [-91.4998, 40.226], [-91.4669, 39.9428], [-91.3787, 39.7493], [-91.2099, 39.6029], [-90.9195, 39.3869], [-90.7372, 39.1818], [-90.6635, 38.9875], [-90.5771, 38.9096], [-90.4781, 38.9481], [-90.2201, 38.8977], [-90.1268, 38.8325], [-90.3165, 38.4578], [-90.374, 38.3097], [-90.299, 38.1739], [-90.1737, 38.069], [-89.823, 37.8841], [-89.6233, 37.7472], [-89.5234, 37.6445], [-89.462, 37.4342], [-89.503, 37.3005], [-89.414, 37.1023], [-89.2725, 37.08], [-89.1543, 36.9921], [-89.1225, 36.9116], [-89.203, 36.6256], [-89.3974, 36.5878], [-89.4503, 36.5], [-89.4872, 36.5031], [-89.5573, 36.5011], [-89.5946, 36.2594], [-89.6745, 36.2206], [-89.6419, 36.1045], [-89.7047, 36.0015], [-90.3811, 35.9927], [-90.303, 36.0993], [-90.0758, 36.2967], [-90.0744, 36.3719], [-90.1623, 36.5009], [-91.5548, 36.5009], [-92.3904, 36.5009], [-93.7829, 36.5009], [-94.6184, 36.5009], [-94.6181, 37.0009], [-94.62, 37.6525], [-94.623, 38.5647], [-94.6225, 39.1245], [-94.7778, 39.194], [-94.9525, 39.4264], [-95.058, 39.509], [-95.0754, 39.5974], [-94.8933, 39.7818], [-94.9841, 39.8911], [-95.1162, 39.8721], [-95.3466, 40.0015], [-95.4637, 40.1981], [-95.6071, 40.2955], [-95.765, 40.6018], [-94.5063, 40.6087], [-93.2451, 40.616], [-91.7315, 40.6246], [-91.682, 40.5519], [-91.4419, 40.3794]]]\n },\n \"properties\": {\n \"name\": \"Missouri\",\n \"id\": \"US-MO\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MO\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-88.1733, 34.999], [-88.0847, 34.9331], [-88.1688, 34.292], [-88.3397, 32.9988], [-88.4862, 31.8904], [-88.4443, 31.1397], [-88.3996, 30.3709], [-88.6921, 30.3554], [-88.9051, 30.4151], [-89.2237, 30.3323], [-89.3206, 30.3453], [-89.521, 30.1926], [-89.5917, 30.223], [-89.6858, 30.4627], [-89.82, 30.6112], [-89.8354, 30.7308], [-89.7353, 31.0011], [-91.1769, 31.0012], [-91.6565, 31.0018], [-91.5963, 31.1099], [-91.6307, 31.2176], [-91.529, 31.3451], [-91.529, 31.4488], [-91.4146, 31.6399], [-91.3725, 31.7736], [-91.2864, 31.884], [-91.1566, 31.9707], [-91.0887, 32.1042], [-90.9477, 32.2401], [-90.9447, 32.3307], [-91.1038, 32.4905], [-91.1424, 32.6611], [-91.0961, 32.9376], [-91.15, 33.0159], [-91.1068, 33.2179], [-91.1633, 33.2944], [-91.1411, 33.4386], [-91.2146, 33.5834], [-91.2076, 33.6756], [-91.0528, 33.8276], [-91.0702, 33.9743], [-90.9431, 34.0297], [-90.9097, 34.1888], [-90.8172, 34.2522], [-90.718, 34.3917], [-90.5841, 34.5037], [-90.5392, 34.7281], [-90.3198, 34.8992], [-90.2938, 35.0012], [-89.2418, 35], [-88.1733, 34.999]]]\n },\n \"properties\": {\n \"name\": \"Mississippi\",\n \"id\": \"US-MS\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MS\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-104.0111, 45.943], [-104.0055, 45.001], [-104.0372, 45.0011], [-105.133, 45.0011], [-106.0098, 45.001], [-106.8864, 45.001], [-107.9824, 45.001], [-109.0783, 45.001], [-109.7358, 45.001], [-111.0508, 45.001], [-111.0514, 44.4989], [-111.1976, 44.5906], [-111.3374, 44.7449], [-111.4481, 44.7111], [-111.4998, 44.5448], [-111.7972, 44.5399], [-112.2313, 44.5607], [-112.3929, 44.468], [-112.7159, 44.498], [-112.8156, 44.406], [-112.9998, 44.4803], [-113.0933, 44.7154], [-113.1872, 44.7986], [-113.3389, 44.8081], [-113.4693, 44.93], [-113.4711, 45.0729], [-113.697, 45.305], [-113.8023, 45.601], [-113.9426, 45.6815], [-114.2976, 45.4875], [-114.5292, 45.5757], [-114.4958, 45.6859], [-114.5338, 45.7819], [-114.4051, 45.8742], [-114.4784, 46.0356], [-114.4853, 46.1582], [-114.3459, 46.5506], [-114.3368, 46.6592], [-114.6015, 46.6603], [-114.7537, 46.7345], [-114.9357, 46.9229], [-115.3495, 47.2612], [-115.7024, 47.4377], [-115.6697, 47.4979], [-115.7337, 47.7064], [-116.0491, 48.0047], [-116.0485, 48.993], [-115.4379, 48.993], [-114.1587, 48.993], [-113.306, 48.993], [-112.0269, 48.993], [-110.3213, 48.993], [-109.4684, 48.993], [-107.7631, 48.9932], [-106.0575, 48.9932], [-105.2048, 48.9932], [-104.034, 48.9932], [-104.025, 47.8499], [-104.0195, 47.0872], [-104.0111, 45.943]]]\n },\n \"properties\": {\n \"name\": \"Montana\",\n \"id\": \"US-MT\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-MT\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-75.9664, 36.5514], [-75.9927, 36.4738], [-75.8666, 36.2679], [-75.883, 36.1757], [-76.1478, 36.2793], [-76.15, 36.1458], [-76.3837, 36.1336], [-76.4788, 36.0281], [-76.6789, 36.0753], [-76.7262, 35.9576], [-76.3583, 35.9528], [-76.2065, 35.9912], [-76.0698, 35.9704], [-76.0835, 35.6905], [-76.0012, 35.7222], [-75.979, 35.8959], [-75.8538, 35.9601], [-75.7722, 35.8999], [-75.7447, 35.7655], [-75.774, 35.6469], [-76.1739, 35.3542], [-76.4895, 35.3971], [-76.5326, 35.5084], [-76.7414, 35.4315], [-76.513, 35.2704], [-76.628, 35.0733], [-76.7791, 34.9902], [-76.745, 34.9409], [-76.4568, 34.9894], [-76.3621, 34.9365], [-76.5168, 34.7773], [-76.7071, 34.7521], [-76.7332, 34.7069], [-77.1339, 34.7079], [-77.2518, 34.6156], [-77.3583, 34.6203], [-77.3797, 34.5266], [-77.7508, 34.285], [-77.926, 34.0732], [-78.0134, 33.9118], [-78.4058, 33.9175], [-78.5643, 33.8767], [-78.9784, 34.2261], [-79.6535, 34.7968], [-80.7841, 34.8286], [-80.793, 34.9628], [-80.9337, 35.1136], [-81.0451, 35.0657], [-81.0874, 35.1556], [-82.356, 35.2015], [-83.1149, 35.0015], [-84.3247, 34.988], [-84.287, 35.2009], [-84.2324, 35.2605], [-84.0623, 35.286], [-84.0038, 35.4141], [-83.8712, 35.5149], [-83.5112, 35.5841], [-83.1204, 35.7746], [-82.9902, 35.8004], [-82.8878, 35.9517], [-82.8128, 35.9473], [-82.6111, 36.0474], [-82.5211, 35.9812], [-82.3682, 36.0996], [-82.1826, 36.1539], [-82.0513, 36.1229], [-81.9082, 36.3065], [-81.7342, 36.3554], [-81.6589, 36.6106], [-81.6416, 36.5951], [-80.1944, 36.5837], [-79.471, 36.5781], [-78.3855, 36.5697], [-76.9385, 36.5585], [-75.9664, 36.5514]]]\n },\n \"properties\": {\n \"name\": \"North Carolina\",\n \"id\": \"US-NC\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NC\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-96.5563, 45.9428], [-98.1871, 45.9428], [-99.8179, 45.9429], [-100.7496, 45.9429], [-101.9144, 45.9429], [-103.3122, 45.943], [-104.0111, 45.943], [-104.0195, 47.0872], [-104.025, 47.8499], [-104.034, 48.9932], [-103.0728, 48.9932], [-102.22, 48.9932], [-100.5145, 48.9932], [-99.2354, 48.9932], [-97.9562, 48.9932], [-97.2257, 48.9932], [-97.1281, 48.6811], [-97.1439, 48.5367], [-97.1259, 48.1735], [-97.0074, 47.9255], [-96.988, 47.8204], [-96.8588, 47.5884], [-96.8183, 46.9742], [-96.7702, 46.9196], [-96.7867, 46.6483], [-96.7309, 46.4727], [-96.6175, 46.3271], [-96.5608, 46.1383], [-96.5563, 45.9428]]]\n },\n \"properties\": {\n \"name\": \"North Dakota\",\n \"id\": \"US-ND\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-ND\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-96.4809, 42.5113], [-96.3837, 42.4177], [-96.2954, 42.1329], [-96.1543, 41.9652], [-96.0688, 41.7343], [-96.0586, 41.5458], [-95.9329, 41.4254], [-95.8836, 41.2876], [-95.8341, 40.8895], [-95.859, 40.7451], [-95.765, 40.6018], [-95.6071, 40.2955], [-95.4637, 40.1981], [-95.3466, 40.0015], [-96.7845, 40.0011], [-97.8325, 40.0011], [-99.2997, 40.0011], [-100.7669, 40.0011], [-102.0245, 40.0011], [-102.025, 41.0006], [-103.273, 41.0007], [-104.0217, 41.0009], [-104.0252, 42.0012], [-104.0288, 43.0013], [-103.3366, 43.0013], [-101.9522, 43.0013], [-100.9139, 43.0013], [-99.5294, 43.0012], [-98.4417, 43.0011], [-98.1432, 42.8523], [-97.965, 42.8058], [-97.6981, 42.8746], [-97.4166, 42.8811], [-97.2388, 42.8605], [-97.0198, 42.7601], [-96.8045, 42.7015], [-96.6328, 42.5686], [-96.4809, 42.5113]]]\n },\n \"properties\": {\n \"name\": \"Nebraska\",\n \"id\": \"US-NE\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NE\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-70.7331, 43.07], [-70.8062, 42.8767], [-70.974, 42.8716], [-71.3296, 42.7024], [-72.4669, 42.7303], [-72.5499, 42.8867], [-72.4736, 43.0385], [-72.4071, 43.3319], [-72.385, 43.5293], [-72.2967, 43.7149], [-72.1149, 43.9655], [-72.0313, 44.3007], [-71.683, 44.4503], [-71.5685, 44.6076], [-71.6206, 44.7719], [-71.5102, 44.9083], [-71.5175, 45.0076], [-71.419, 45.2004], [-71.3273, 45.2901], [-71.2017, 45.2603], [-71.0846, 45.294], [-71.0314, 44.5297], [-70.9557, 43.3894], [-70.829, 43.2391], [-70.7331, 43.07]]]\n },\n \"properties\": {\n \"name\": \"New Hampshire\",\n \"id\": \"US-NH\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NH\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-73.9101, 40.9922], [-74.0256, 40.7564], [-74.2267, 40.608], [-74.2415, 40.4563], [-74.0498, 40.4299], [-73.9576, 40.3284], [-74.0283, 40.073], [-74.1177, 39.9382], [-74.1761, 39.7266], [-74.3899, 39.4869], [-74.4288, 39.3872], [-74.603, 39.2926], [-74.7944, 39.0019], [-74.9543, 38.9499], [-74.8971, 39.1455], [-75.1361, 39.2078], [-75.3535, 39.3399], [-75.5243, 39.4902], [-75.5235, 39.6019], [-75.4219, 39.7897], [-75.1538, 39.8706], [-75.0741, 39.9834], [-74.7349, 40.1545], [-75.0975, 40.5431], [-75.1889, 40.5958], [-75.1748, 40.7756], [-75.075, 40.8844], [-75.123, 40.9991], [-74.9123, 41.1553], [-74.8414, 41.2687], [-74.699, 41.3572], [-73.9101, 40.9922]]]\n },\n \"properties\": {\n \"name\": \"New Jersey\",\n \"id\": \"US-NJ\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NJ\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-103.0002, 36.5012], [-103.0422, 36.5006], [-103.048, 35.3761], [-103.0539, 34.2517], [-103.0582, 33.4084], [-103.0613, 32.8461], [-103.0656, 32.0027], [-103.9648, 32.0023], [-105.0886, 32.0019], [-105.9879, 32.0015], [-106.6683, 32.001], [-106.5664, 31.8196], [-106.4454, 31.7684], [-107.3326, 31.7747], [-108.2119, 31.7794], [-108.2145, 31.3295], [-109.0478, 31.328], [-109.0473, 32.3922], [-109.0472, 33.4558], [-109.0469, 34.5194], [-109.0469, 35.5829], [-109.0468, 36.2918], [-109.0467, 37.0009], [-107.9131, 37.0009], [-106.7795, 37.0009], [-106.0238, 37.0009], [-104.8901, 37.0009], [-103.7566, 37.0009], [-103.0008, 37.0009], [-103.0002, 36.5012]]]\n },\n \"properties\": {\n \"name\": \"New Mexico\",\n \"id\": \"US-NM\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NM\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-114.0402, 37.0042], [-114.0429, 36.1817], [-114.1833, 36.0303], [-114.4061, 36.1484], [-114.6691, 36.1218], [-114.7414, 36.0136], [-114.6871, 35.9173], [-114.6452, 35.6305], [-114.6485, 35.4759], [-114.5909, 35.3528], [-114.6105, 34.9912], [-115.3901, 35.5991], [-115.8978, 35.9955], [-116.6596, 36.5899], [-117.2097, 37.0033], [-118.1262, 37.6924], [-118.5948, 38.0193], [-119.2974, 38.5098], [-120.0001, 39.0002], [-120.0001, 39.5627], [-120.0006, 40.6879], [-120.0008, 42.0005], [-119.2547, 42.0005], [-118.1357, 42.0005], [-117.0166, 42.0005], [-115.9014, 42.0008], [-115.1578, 42.0009], [-114.0426, 42.001], [-114.042, 40.908], [-114.0418, 40.1273], [-114.0412, 39.1903], [-114.0408, 37.9411], [-114.0402, 37.0042]]]\n },\n \"properties\": {\n \"name\": \"Nevada\",\n \"id\": \"US-NV\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NV\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-72.5098, 40.9861], [-72.2874, 41.024], [-72.339, 40.8942], [-73.1943, 40.6542], [-73.2655, 40.6635], [-73.6209, 40.5999], [-73.7667, 40.5926], [-73.8228, 40.656], [-74.032, 40.6387], [-73.8793, 40.7916], [-73.5739, 40.9195], [-73.3727, 40.9438], [-73.1858, 40.9298], [-73.0338, 40.966], [-72.5098, 40.9861]]], [[[-73.2533, 42.7522], [-73.5072, 42.08], [-73.4806, 42.0556], [-73.5447, 41.296], [-73.4841, 41.2189], [-73.7231, 41.1045], [-73.6305, 40.9918], [-73.8513, 40.8314], [-73.9485, 40.8388], [-73.9101, 40.9922], [-74.699, 41.3572], [-74.7566, 41.4239], [-74.9354, 41.4743], [-75.0227, 41.5529], [-75.0537, 41.765], [-75.1219, 41.8534], [-75.2388, 41.8922], [-75.3513, 41.9984], [-76.4541, 41.999], [-77.9707, 41.9998], [-78.66, 42.0002], [-79.763, 42.0009], [-79.763, 42.2757], [-79.2092, 42.5551], [-78.8778, 42.7991], [-78.9197, 42.9481], [-78.9082, 43.0703], [-79.0661, 43.1061], [-79.0532, 43.285], [-78.6895, 43.3614], [-78.1749, 43.3946], [-77.8381, 43.3572], [-77.529, 43.2674], [-77.2708, 43.2945], [-76.9764, 43.2775], [-76.6929, 43.3609], [-76.4728, 43.5073], [-76.2027, 43.5745], [-76.1984, 43.8745], [-76.0987, 43.967], [-76.2378, 44.1832], [-75.8322, 44.3972], [-75.792, 44.4971], [-75.4012, 44.7723], [-75.1795, 44.8994], [-74.8565, 45.0039], [-73.3522, 45.0054], [-73.372, 44.5973], [-73.3098, 44.4596], [-73.3209, 44.2689], [-73.425, 44.0383], [-73.3757, 43.7622], [-73.4133, 43.6279], [-73.2471, 43.553], [-73.2666, 42.8648], [-73.2533, 42.7522]]]]\n },\n \"properties\": {\n \"name\": \"New York\",\n \"id\": \"US-NY\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-NY\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-80.519, 40.647], [-80.6591, 40.5629], [-80.6018, 40.3639], [-80.6683, 40.1853], [-80.8722, 39.7355], [-80.9633, 39.5711], [-81.3334, 39.3628], [-81.4396, 39.3926], [-81.6571, 39.272], [-81.8026, 39.0861], [-81.7778, 38.9728], [-82.0722, 38.9629], [-82.2034, 38.7682], [-82.18, 38.6376], [-82.387, 38.4339], [-82.6129, 38.4482], [-82.7582, 38.5412], [-82.8805, 38.7102], [-83.0001, 38.7141], [-83.2035, 38.6389], [-83.357, 38.6274], [-83.5384, 38.6998], [-83.6898, 38.6495], [-83.9484, 38.7743], [-84.1133, 38.7984], [-84.2272, 38.8652], [-84.2904, 38.9747], [-84.43, 39.0909], [-84.5946, 39.0858], [-84.7069, 39.1289], [-84.8216, 39.092], [-84.8133, 40.0745], [-84.803, 41.0506], [-84.7961, 41.7014], [-83.4643, 41.7394], [-83.4542, 41.7456], [-82.9108, 41.5382], [-82.8308, 41.5797], [-82.5243, 41.407], [-82.1213, 41.493], [-81.7232, 41.511], [-81.4471, 41.6714], [-81.2286, 41.7704], [-80.8692, 41.8933], [-80.5202, 41.9895], [-80.5202, 41.2769], [-80.519, 40.647]]]\n },\n \"properties\": {\n \"name\": \"Ohio\",\n \"id\": \"US-OH\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-OH\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-94.6184, 36.5009], [-94.4391, 35.3872], [-94.4616, 34.5178], [-94.4841, 33.6485], [-94.7091, 33.6994], [-94.9624, 33.8433], [-95.238, 33.9565], [-95.3739, 33.8743], [-95.6228, 33.9303], [-95.7839, 33.8645], [-95.9416, 33.8828], [-96.2785, 33.7576], [-96.4111, 33.7752], [-96.5917, 33.8492], [-96.7464, 33.8542], [-96.9777, 33.938], [-97.1724, 33.7568], [-97.2149, 33.8971], [-97.4302, 33.8385], [-97.6604, 33.9901], [-97.8424, 33.8757], [-98.0695, 34.0404], [-98.0987, 34.145], [-98.3559, 34.1414], [-98.4938, 34.0888], [-98.6085, 34.1612], [-98.7989, 34.1547], [-98.9688, 34.2086], [-99.1866, 34.2355], [-99.1999, 34.3183], [-99.3603, 34.4561], [-99.405, 34.392], [-99.6321, 34.3885], [-99.867, 34.5434], [-99.9995, 34.5867], [-100.0005, 35.3045], [-100.0023, 36.5009], [-101.314, 36.5011], [-102.0636, 36.5012], [-103.0002, 36.5012], [-103.0008, 37.0009], [-102.0128, 37.0009], [-101.0885, 37.0009], [-99.9329, 37.0009], [-99.0086, 37.0009], [-98.0844, 37.0009], [-97.1601, 37.0009], [-96.4668, 37.0009], [-95.5424, 37.0009], [-94.6181, 37.0009], [-94.6184, 36.5009]]]\n },\n \"properties\": {\n \"name\": \"Oklahoma\",\n \"id\": \"US-OK\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-OK\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-123.2206, 46.1537], [-123.1209, 46.1787], [-122.942, 46.1148], [-122.8434, 45.9781], [-122.7259, 45.6737], [-122.6498, 45.6275], [-122.2026, 45.591], [-122.0851, 45.6026], [-121.882, 45.6895], [-121.6625, 45.7182], [-121.4021, 45.7118], [-121.1843, 45.6437], [-121.0451, 45.639], [-120.3514, 45.7251], [-119.9343, 45.8379], [-119.4292, 45.9343], [-119.1773, 45.9451], [-119.0197, 46.0003], [-118.2062, 46.0013], [-116.8965, 46.0021], [-116.7647, 45.873], [-116.6168, 45.7992], [-116.4771, 45.6411], [-116.5492, 45.4567], [-116.8396, 44.9851], [-116.9489, 44.7701], [-117.1189, 44.5783], [-117.2017, 44.4362], [-117.1398, 44.2903], [-116.9531, 44.2453], [-116.9113, 44.1574], [-117.0205, 43.8132], [-117.019, 43.1165], [-117.0166, 42.0005], [-118.1357, 42.0005], [-119.2547, 42.0005], [-120.0008, 42.0005], [-121.0554, 42.0005], [-122.3737, 42.0005], [-123.4283, 42.0005], [-124.2284, 42.0008], [-124.3553, 42.1228], [-124.4205, 42.381], [-124.4062, 42.5837], [-124.5396, 42.8128], [-124.4544, 43.0123], [-124.3466, 43.3415], [-124.288, 43.4097], [-124.1487, 43.6918], [-124.0991, 44.3338], [-124.0474, 44.4255], [-124.0592, 44.7778], [-123.9486, 45.4008], [-123.9294, 45.5771], [-123.9612, 45.8429], [-123.9471, 46.1406], [-123.9117, 46.1822], [-123.6737, 46.1826], [-123.5217, 46.2226], [-123.4023, 46.155], [-123.2206, 46.1537]]]\n },\n \"properties\": {\n \"name\": \"Oregon\",\n \"id\": \"US-OR\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-OR\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-74.699, 41.3572], [-74.8414, 41.2687], [-74.9123, 41.1553], [-75.123, 40.9991], [-75.075, 40.8844], [-75.1748, 40.7756], [-75.1889, 40.5958], [-75.0975, 40.5431], [-74.7349, 40.1545], [-75.0741, 39.9834], [-75.1729, 39.8948], [-75.4211, 39.8154], [-75.6346, 39.8394], [-75.7847, 39.7223], [-76.708, 39.7225], [-78.0926, 39.7226], [-79.4776, 39.7227], [-80.5194, 39.7226], [-80.519, 40.647], [-80.5202, 41.2769], [-80.5202, 41.9895], [-80.3344, 42.0408], [-79.763, 42.2757], [-79.763, 42.0009], [-78.66, 42.0002], [-77.9707, 41.9998], [-76.4541, 41.999], [-75.3513, 41.9984], [-75.2388, 41.8922], [-75.1219, 41.8534], [-75.0537, 41.765], [-75.0227, 41.5529], [-74.9354, 41.4743], [-74.7566, 41.4239], [-74.699, 41.3572]]]\n },\n \"properties\": {\n \"name\": \"Pennsylvania\",\n \"id\": \"US-PA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-PA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-71.2338, 41.7065], [-71.3306, 41.7622], [-71.4265, 41.6333], [-71.4437, 41.4536], [-71.5229, 41.3789], [-71.8423, 41.3354], [-71.7958, 41.5199], [-71.8009, 42.0119], [-71.3871, 42.0169], [-71.3407, 41.7978], [-71.2338, 41.7065]]]\n },\n \"properties\": {\n \"name\": \"Rhode Island\",\n \"id\": \"US-RI\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-RI\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-78.5643, 33.8767], [-78.8414, 33.724], [-79.1382, 33.4059], [-79.1937, 33.2441], [-79.276, 33.1354], [-79.42, 33.0425], [-79.5871, 33.0009], [-79.615, 32.9093], [-79.8936, 32.7287], [-80.0217, 32.6199], [-80.2297, 32.5765], [-80.4743, 32.4228], [-80.4857, 32.3517], [-80.6083, 32.2928], [-80.6472, 32.3959], [-80.7653, 32.2984], [-80.6942, 32.2157], [-80.8492, 32.114], [-80.8724, 32.0295], [-81.0748, 32.1097], [-81.1351, 32.1818], [-81.1714, 32.3801], [-81.2903, 32.5573], [-81.377, 32.6075], [-81.4897, 32.9356], [-81.5783, 33.0686], [-81.6994, 33.1267], [-81.9329, 33.3899], [-82.0057, 33.5229], [-82.2084, 33.6636], [-82.2566, 33.7493], [-82.5894, 34.0176], [-82.8187, 34.3661], [-82.8478, 34.4369], [-83.0528, 34.5109], [-83.3557, 34.7083], [-83.3167, 34.8057], [-83.1149, 35.0015], [-82.356, 35.2015], [-81.0874, 35.1556], [-81.0451, 35.0657], [-80.9337, 35.1136], [-80.793, 34.9628], [-80.7841, 34.8286], [-79.6535, 34.7968], [-78.9784, 34.2261], [-78.5643, 33.8767]]]\n },\n \"properties\": {\n \"name\": \"South Carolina\",\n \"id\": \"US-SC\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-SC\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-96.5563, 45.9428], [-96.6146, 45.8], [-96.8137, 45.6592], [-96.8455, 45.5958], [-96.696, 45.4317], [-96.5298, 45.3715], [-96.4536, 45.2973], [-96.4536, 44.1747], [-96.4536, 43.5012], [-96.5985, 43.4976], [-96.5416, 43.3735], [-96.5555, 43.2317], [-96.4627, 43.0992], [-96.6218, 42.7296], [-96.5388, 42.6587], [-96.4809, 42.5113], [-96.6328, 42.5686], [-96.8045, 42.7015], [-97.0198, 42.7601], [-97.2388, 42.8605], [-97.4166, 42.8811], [-97.6981, 42.8746], [-97.965, 42.8058], [-98.1432, 42.8523], [-98.4417, 43.0011], [-99.5294, 43.0012], [-100.9139, 43.0013], [-101.9522, 43.0013], [-103.3366, 43.0013], [-104.0288, 43.0013], [-104.031, 43.5013], [-104.0351, 44.5012], [-104.0372, 45.0011], [-104.0055, 45.001], [-104.0111, 45.943], [-103.3122, 45.943], [-101.9144, 45.9429], [-100.7496, 45.9429], [-99.8179, 45.9429], [-98.1871, 45.9428], [-96.5563, 45.9428]]]\n },\n \"properties\": {\n \"name\": \"South Dakota\",\n \"id\": \"US-SD\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-SD\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-83.6676, 36.605], [-82.9558, 36.6021], [-81.9525, 36.598], [-81.6589, 36.6106], [-81.7342, 36.3554], [-81.9082, 36.3065], [-82.0513, 36.1229], [-82.1826, 36.1539], [-82.3682, 36.0996], [-82.5211, 35.9812], [-82.6111, 36.0474], [-82.8128, 35.9473], [-82.8878, 35.9517], [-82.9902, 35.8004], [-83.1204, 35.7746], [-83.5112, 35.5841], [-83.8712, 35.5149], [-84.0038, 35.4141], [-84.0623, 35.286], [-84.2324, 35.2605], [-84.287, 35.2009], [-84.3247, 34.988], [-85.6235, 35.0009], [-86.9071, 35.0129], [-88.1905, 35.0249], [-88.1733, 34.999], [-89.2418, 35], [-90.2938, 35.0012], [-90.1423, 35.1142], [-90.0929, 35.2036], [-90.066, 35.4141], [-89.9674, 35.5033], [-89.9436, 35.6791], [-89.7796, 35.8057], [-89.7037, 35.9069], [-89.7047, 36.0015], [-89.6419, 36.1045], [-89.6745, 36.2206], [-89.5946, 36.2594], [-89.5573, 36.5011], [-89.4872, 36.5031], [-89.4503, 36.5], [-88.0591, 36.4997], [-88.0964, 36.693], [-87.8392, 36.6439], [-86.5076, 36.6648], [-85.8133, 36.6453], [-84.4247, 36.6062], [-83.7304, 36.5868], [-83.6676, 36.605]]]\n },\n \"properties\": {\n \"name\": \"Tennessee\",\n \"id\": \"US-TN\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-TN\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-97.1708, 26.1594], [-97.2673, 26.3299], [-97.4021, 26.8205], [-97.3512, 26.8014], [-97.1708, 26.1594]]], [[[-97.0144, 27.9017], [-96.8992, 28.1174], [-96.8397, 28.0889], [-97.0144, 27.9017]]], [[[-94.4841, 33.6485], [-94.3778, 33.5661], [-94.2947, 33.5875], [-94.0472, 33.5544], [-94.0413, 33.012], [-94.0434, 31.9992], [-93.905, 31.877], [-93.8269, 31.7503], [-93.8206, 31.604], [-93.7376, 31.5138], [-93.6659, 31.3226], [-93.5577, 31.1804], [-93.5306, 31.0462], [-93.5792, 30.8238], [-93.7202, 30.5583], [-93.7504, 30.3448], [-93.7106, 30.1128], [-93.794, 29.9772], [-93.8414, 29.9798], [-93.9462, 29.815], [-93.8905, 29.6894], [-94.0996, 29.6704], [-94.7501, 29.418], [-94.6053, 29.5677], [-94.7782, 29.5478], [-94.7243, 29.6552], [-94.7419, 29.75], [-94.8323, 29.7526], [-94.8899, 29.6769], [-95.0229, 29.7024], [-94.9928, 29.531], [-94.8883, 29.3705], [-95.139, 29.1679], [-95.1522, 29.0792], [-95.2735, 28.9638], [-95.8534, 28.6404], [-96.0204, 28.5869], [-96.2753, 28.6552], [-96.4488, 28.5944], [-96.5756, 28.7156], [-96.6401, 28.7088], [-96.5246, 28.4887], [-96.5618, 28.3671], [-96.6764, 28.3413], [-96.7736, 28.4217], [-96.8068, 28.2202], [-96.8916, 28.1576], [-96.9667, 28.1895], [-97.1565, 28.1444], [-97.0731, 27.9862], [-97.1714, 27.8796], [-97.3741, 27.87], [-97.4316, 27.8372], [-97.2888, 27.6706], [-97.3804, 27.4194], [-97.4391, 27.3282], [-97.5238, 27.314], [-97.6821, 27.3949], [-97.6924, 27.2872], [-97.4852, 27.2373], [-97.4757, 27.1179], [-97.5547, 26.9673], [-97.4658, 26.6917], [-97.4024, 26.3965], [-97.1462, 25.9614], [-97.2818, 25.9417], [-97.3582, 25.8705], [-97.5872, 25.9843], [-97.8015, 26.042], [-98.0828, 26.0645], [-98.275, 26.1113], [-98.4859, 26.2245], [-98.5983, 26.2378], [-98.7652, 26.3404], [-99.0153, 26.399], [-99.1077, 26.4468], [-99.1721, 26.5641], [-99.2299, 26.7619], [-99.3025, 26.8848], [-99.4436, 27.0366], [-99.4403, 27.1701], [-99.5101, 27.3403], [-99.5053, 27.5483], [-99.7543, 27.73], [-99.8896, 27.8673], [-100.0014, 28.0479], [-100.1119, 28.1729], [-100.296, 28.3277], [-100.3317, 28.5026], [-100.5497, 28.8214], [-100.6586, 29.0686], [-100.7546, 29.1825], [-101.0164, 29.4007], [-101.039, 29.4605], [-101.3035, 29.6341], [-101.4405, 29.7768], [-101.9909, 29.7958], [-102.269, 29.8712], [-102.4763, 29.769], [-102.6149, 29.7523], [-102.7342, 29.644], [-102.834, 29.444], [-102.8919, 29.2164], [-103.0227, 29.1322], [-103.0901, 29.0419], [-103.2576, 29.0011], [-103.423, 29.0707], [-103.664, 29.207], [-104.1107, 29.3862], [-104.3122, 29.5425], [-104.4007, 29.5738], [-104.5041, 29.6777], [-104.6223, 29.8543], [-104.6812, 29.9905], [-104.6812, 30.1343], [-104.8359, 30.4476], [-104.9788, 30.6459], [-105.2758, 30.8073], [-105.514, 30.9808], [-105.8126, 31.241], [-106.0241, 31.3978], [-106.148, 31.4508], [-106.2558, 31.5446], [-106.4454, 31.7684], [-106.5664, 31.8196], [-106.6683, 32.001], [-105.9879, 32.0015], [-105.0886, 32.0019], [-103.9648, 32.0023], [-103.0656, 32.0027], [-103.0613, 32.8461], [-103.0582, 33.4084], [-103.0539, 34.2517], [-103.048, 35.3761], [-103.0422, 36.5006], [-103.0002, 36.5012], [-102.0636, 36.5012], [-101.314, 36.5011], [-100.0023, 36.5009], [-100.0005, 35.3045], [-99.9995, 34.5867], [-99.867, 34.5434], [-99.6321, 34.3885], [-99.405, 34.392], [-99.3603, 34.4561], [-99.1999, 34.3183], [-99.1866, 34.2355], [-98.9688, 34.2086], [-98.7989, 34.1547], [-98.6085, 34.1612], [-98.4938, 34.0888], [-98.3559, 34.1414], [-98.0987, 34.145], [-98.0695, 34.0404], [-97.8424, 33.8757], [-97.6604, 33.9901], [-97.4302, 33.8385], [-97.2149, 33.8971], [-97.1724, 33.7568], [-96.9777, 33.938], [-96.7464, 33.8542], [-96.5917, 33.8492], [-96.4111, 33.7752], [-96.2785, 33.7576], [-95.9416, 33.8828], [-95.7839, 33.8645], [-95.6228, 33.9303], [-95.3739, 33.8743], [-95.238, 33.9565], [-94.9624, 33.8433], [-94.7091, 33.6994], [-94.4841, 33.6485]]]]\n },\n \"properties\": {\n \"name\": \"Texas\",\n \"id\": \"US-TX\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-TX\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-111.0503, 42.0009], [-111.05, 41.0009], [-109.7978, 41.0009], [-109.0464, 41.0009], [-109.0465, 40.0008], [-109.0465, 39.2509], [-109.0465, 38.0009], [-109.0467, 37.0009], [-109.9829, 37.0014], [-111.2313, 37.0022], [-111.8556, 37.0026], [-113.104, 37.0035], [-114.0402, 37.0042], [-114.0408, 37.9411], [-114.0412, 39.1903], [-114.0418, 40.1273], [-114.042, 40.908], [-114.0426, 42.001], [-112.7333, 42.001], [-111.9855, 42.0009], [-111.0503, 42.0009]]]\n },\n \"properties\": {\n \"name\": \"Utah\",\n \"id\": \"US-UT\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-UT\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-77.7266, 39.3465], [-77.4789, 39.2209], [-77.4809, 39.113], [-77.3012, 39.0533], [-77.1221, 38.9435], [-77.0303, 38.8893], [-77.0456, 38.7758], [-77.2603, 38.6], [-77.3136, 38.3966], [-77.2319, 38.34], [-77.0468, 38.3566], [-76.9062, 38.197], [-76.5496, 38.0946], [-76.4717, 38.0112], [-76.2642, 37.8935], [-76.3056, 37.7216], [-76.484, 37.6289], [-76.3055, 37.5714], [-76.2635, 37.357], [-76.4009, 37.3862], [-76.4011, 37.2127], [-76.2833, 37.0527], [-76.4008, 36.9913], [-76.6719, 37.173], [-76.6339, 37.0475], [-76.3996, 36.8899], [-76.2442, 36.9526], [-75.9994, 36.9126], [-75.8575, 36.5506], [-75.8891, 36.5504], [-75.9664, 36.5514], [-76.9385, 36.5585], [-78.3855, 36.5697], [-79.471, 36.5781], [-80.1944, 36.5837], [-81.6416, 36.5951], [-81.6589, 36.6106], [-81.9525, 36.598], [-82.9558, 36.6021], [-83.6676, 36.605], [-83.1502, 36.7624], [-82.8945, 36.9064], [-82.7319, 37.048], [-82.6816, 37.1381], [-82.3431, 37.2969], [-81.9652, 37.5396], [-81.913, 37.369], [-81.8293, 37.2986], [-81.5648, 37.2097], [-81.35, 37.3337], [-81.2272, 37.2633], [-80.9437, 37.3018], [-80.8211, 37.4231], [-80.7199, 37.401], [-80.3161, 37.5097], [-80.2459, 37.6208], [-80.2853, 37.677], [-80.1881, 37.8241], [-79.9717, 38.0461], [-79.9028, 38.1807], [-79.7153, 38.404], [-79.6687, 38.5443], [-79.5977, 38.5771], [-79.3958, 38.4545], [-79.2402, 38.4766], [-79.0412, 38.7896], [-78.8687, 38.8179], [-78.5815, 38.999], [-78.4352, 39.1608], [-78.3223, 39.4519], [-77.8358, 39.1452], [-77.7266, 39.3465]]], [[[-75.6592, 37.954], [-75.62, 37.9993], [-75.376, 38.025], [-75.5963, 37.6312], [-75.5871, 37.5587], [-75.812, 37.4251], [-75.9343, 37.152], [-75.9974, 37.2639], [-75.975, 37.3985], [-75.8882, 37.6191], [-75.7193, 37.8214], [-75.6592, 37.954]]]]\n },\n \"properties\": {\n \"name\": \"Virginia\",\n \"id\": \"US-VA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-VA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-72.4669, 42.7303], [-73.2533, 42.7522], [-73.2666, 42.8648], [-73.2471, 43.553], [-73.4133, 43.6279], [-73.3757, 43.7622], [-73.425, 44.0383], [-73.3209, 44.2689], [-73.3098, 44.4596], [-73.372, 44.5973], [-73.3522, 45.0054], [-72.766, 45.0061], [-71.5175, 45.0076], [-71.5102, 44.9083], [-71.6206, 44.7719], [-71.5685, 44.6076], [-71.683, 44.4503], [-72.0313, 44.3007], [-72.1149, 43.9655], [-72.2967, 43.7149], [-72.385, 43.5293], [-72.4071, 43.3319], [-72.4736, 43.0385], [-72.5499, 42.8867], [-72.4669, 42.7303]]]\n },\n \"properties\": {\n \"name\": \"Vermont\",\n \"id\": \"US-VT\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-VT\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-116.8965, 46.0021], [-118.2062, 46.0013], [-119.0197, 46.0003], [-119.1773, 45.9451], [-119.4292, 45.9343], [-119.9343, 45.8379], [-120.3514, 45.7251], [-121.0451, 45.639], [-121.1843, 45.6437], [-121.4021, 45.7118], [-121.6625, 45.7182], [-121.882, 45.6895], [-122.0851, 45.6026], [-122.2026, 45.591], [-122.6498, 45.6275], [-122.7259, 45.6737], [-122.8434, 45.9781], [-122.942, 46.1148], [-123.1209, 46.1787], [-123.2206, 46.1537], [-123.4649, 46.2712], [-123.6884, 46.2998], [-123.8957, 46.2677], [-124.0727, 46.2795], [-124.0502, 46.4906], [-123.9461, 46.4326], [-123.8891, 46.66], [-124.0717, 46.7448], [-124.1126, 46.8627], [-123.8429, 46.9632], [-124.0422, 47.0297], [-124.1635, 47.0153], [-124.1989, 47.2085], [-124.3093, 47.4046], [-124.376, 47.6587], [-124.46, 47.7843], [-124.6211, 47.9042], [-124.7017, 48.1517], [-124.6326, 48.375], [-123.9758, 48.1685], [-123.2944, 48.1196], [-123.1244, 48.151], [-123.0242, 48.0816], [-122.8609, 48.0901], [-122.7398, 48.0133], [-122.6567, 47.8811], [-122.8214, 47.7931], [-122.7571, 47.7005], [-122.5879, 47.8559], [-122.5239, 47.7694], [-122.6184, 47.7129], [-122.5536, 47.4049], [-122.5779, 47.2931], [-122.8125, 47.3289], [-122.9195, 47.2897], [-122.9876, 47.1726], [-122.7019, 47.1109], [-122.5422, 47.2756], [-122.3538, 47.3716], [-122.3684, 47.6039], [-122.4105, 47.6527], [-122.3928, 47.8205], [-122.242, 48.0108], [-122.353, 48.1138], [-122.494, 48.1304], [-122.5203, 48.2291], [-122.4086, 48.2939], [-122.669, 48.4653], [-122.4967, 48.5056], [-122.562, 48.778], [-122.653, 48.7639], [-122.7888, 48.993], [-121.4072, 48.993], [-119.7018, 48.993], [-117.9962, 48.993], [-117.039, 48.993], [-117.0317, 47.7115], [-117.025, 46.4291], [-116.943, 46.2321], [-116.8965, 46.0021]]], [[[-122.5728, 48.1567], [-122.3667, 47.9855], [-122.5575, 47.9925], [-122.5728, 48.1567]]]]\n },\n \"properties\": {\n \"name\": \"Washington\",\n \"id\": \"US-WA\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-WA\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"MultiPolygon\",\n \"coordinates\": [[[[-90.4077, 46.593], [-90.2304, 46.5098], [-90.1185, 46.3416], [-89.1193, 46.1491], [-88.8374, 46.0365], [-88.4931, 46.0135], [-88.1518, 45.9454], [-88.1161, 45.8158], [-87.9225, 45.76], [-87.8091, 45.6861], [-87.8152, 45.5059], [-87.8653, 45.3678], [-87.6964, 45.3829], [-87.721, 45.2427], [-87.6059, 45.1085], [-87.627, 45.0323], [-87.8302, 44.9424], [-88.0282, 44.6179], [-87.929, 44.5595], [-87.741, 44.6921], [-87.6044, 44.8469], [-87.4197, 44.8657], [-87.3374, 44.7758], [-87.4866, 44.5086], [-87.5275, 44.3857], [-87.5349, 44.1743], [-87.6584, 44.059], [-87.7238, 43.9073], [-87.6997, 43.7237], [-87.774, 43.5989], [-87.9017, 43.2449], [-87.8935, 43.0411], [-87.787, 42.8092], [-87.8121, 42.4971], [-89.2905, 42.5052], [-90.6506, 42.5129], [-90.6879, 42.6104], [-90.7887, 42.6769], [-90.9599, 42.7204], [-91.0695, 42.7885], [-91.1614, 43.1023], [-91.1172, 43.3311], [-91.2187, 43.3953], [-91.2453, 43.5024], [-91.2785, 43.7975], [-91.3827, 43.9908], [-91.8409, 44.1942], [-92.0551, 44.3999], [-92.2404, 44.4621], [-92.3669, 44.5522], [-92.6435, 44.6453], [-92.7991, 44.79], [-92.7634, 44.9342], [-92.7931, 45.0713], [-92.7661, 45.2364], [-92.6857, 45.3806], [-92.7071, 45.4937], [-92.8924, 45.5947], [-92.8747, 45.7061], [-92.6938, 45.909], [-92.2926, 46.0843], [-92.2917, 46.6607], [-92.107, 46.7623], [-91.9874, 46.699], [-91.8356, 46.7021], [-91.4991, 46.7662], [-91.2177, 46.8856], [-91.1272, 46.8676], [-90.9461, 46.9538], [-90.7684, 46.908], [-90.923, 46.6031], [-90.7368, 46.6888], [-90.5361, 46.5994], [-90.4077, 46.593]]], [[[-86.9919, 45.241], [-87.0589, 45.1025], [-87.2804, 44.8349], [-87.3965, 44.9541], [-87.2587, 45.138], [-87.122, 45.2245], [-86.9919, 45.241]]]]\n },\n \"properties\": {\n \"name\": \"Wisconsin\",\n \"id\": \"US-WI\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-WI\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-79.4776, 39.7227], [-79.488, 39.2109], [-79.2935, 39.3115], [-79.0752, 39.4761], [-78.9714, 39.4537], [-78.8148, 39.5701], [-78.4956, 39.5334], [-78.4068, 39.6279], [-78.1812, 39.6857], [-77.8832, 39.6107], [-77.7981, 39.5172], [-77.7266, 39.3465], [-77.8358, 39.1452], [-78.3223, 39.4519], [-78.4352, 39.1608], [-78.5815, 38.999], [-78.8687, 38.8179], [-79.0412, 38.7896], [-79.2402, 38.4766], [-79.3958, 38.4545], [-79.5977, 38.5771], [-79.6687, 38.5443], [-79.7153, 38.404], [-79.9028, 38.1807], [-79.9717, 38.0461], [-80.1881, 37.8241], [-80.2853, 37.677], [-80.2459, 37.6208], [-80.3161, 37.5097], [-80.7199, 37.401], [-80.8211, 37.4231], [-80.9437, 37.3018], [-81.2272, 37.2633], [-81.35, 37.3337], [-81.5648, 37.2097], [-81.8293, 37.2986], [-81.913, 37.369], [-81.9652, 37.5396], [-82.1035, 37.5706], [-82.2802, 37.6872], [-82.5887, 38.0998], [-82.5784, 38.272], [-82.6129, 38.4482], [-82.387, 38.4339], [-82.18, 38.6376], [-82.2034, 38.7682], [-82.0722, 38.9629], [-81.7778, 38.9728], [-81.8026, 39.0861], [-81.6571, 39.272], [-81.4396, 39.3926], [-81.3334, 39.3628], [-80.9633, 39.5711], [-80.8722, 39.7355], [-80.6683, 40.1853], [-80.6018, 40.3639], [-80.6591, 40.5629], [-80.519, 40.647], [-80.5194, 39.7226], [-79.4776, 39.7227]]]\n },\n \"properties\": {\n \"name\": \"West Virginia\",\n \"id\": \"US-WV\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-WV\"\n }, {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Polygon\",\n \"coordinates\": [[[-104.0288, 43.0013], [-104.0252, 42.0012], [-104.0217, 41.0009], [-104.9638, 41.0009], [-105.906, 41.0009], [-107.1622, 41.0009], [-108.1044, 41.0009], [-109.0464, 41.0009], [-109.7978, 41.0009], [-111.05, 41.0009], [-111.0503, 42.0009], [-111.0508, 43.0938], [-111.051, 43.7182], [-111.0514, 44.4989], [-111.0508, 45.001], [-109.7358, 45.001], [-109.0783, 45.001], [-107.9824, 45.001], [-106.8864, 45.001], [-106.0098, 45.001], [-105.133, 45.0011], [-104.0372, 45.0011], [-104.0351, 44.5012], [-104.031, 43.5013], [-104.0288, 43.0013]]]\n },\n \"properties\": {\n \"name\": \"Wyoming\",\n \"id\": \"US-WY\",\n \"CNTRY\": \"United States of America\",\n \"TYPE\": \"State\"\n },\n \"id\": \"US-WY\"\n }]\n};\nexport default map;","import React from 'react';\nimport * as am4core from '@amcharts/amcharts4/core';\nimport * as am4maps from '@amcharts/amcharts4/maps';\nimport am4geodata_usaLow from '@amcharts/amcharts4-geodata/usaLow';\nimport {colorGradient} from '../../../shared/utils';\n\nimport data from '../../data/map_data.json';\n\nexport default class IndustryBreakdown extends React.Component {\n\n constructor(props) {\n super(props);\n\n this.state = {};\n this.mapRef = React.createRef();\n }\n\n colorFor(value) {\n const colors = colorGradient(colorGradient.defaultLightest, colorGradient.defaultDarkest, 6);\n if (value < 25) {\n return colors[0];\n } else if (value < 50) {\n return colors[1];\n } else if (value < 100) {\n return colors[2];\n } else if (value < 200) {\n return colors[3];\n } else if (value < 500) {\n return colors[4];\n } else {\n return colors[5];\n }\n }\n\n componentDidMount() {\n let chart = am4core.create(this.mapRef.current, am4maps.MapChart);\n chart.height = 300;\n\n chart.projection = new am4maps.projections.Miller();\n chart.geodata = am4geodata_usaLow;\n\n chart.zoomLevel = 4;\n\n let polygonSeries = chart.series.push(new am4maps.MapPolygonSeries());\n\n // Make map load polygon (like country names) data from GeoJSON\n polygonSeries.useGeodata = true;\n polygonSeries.exclude = ['US-AK', 'US-HI'];\n polygonSeries.data = data.counts.map((entry) => {\n entry.fill = am4core.color(this.colorFor(entry.value));\n return entry;\n });\n\n // Configure series\n let polygonTemplate = polygonSeries.mapPolygons.template;\n\n polygonTemplate.tooltipText = '{name} ({value})';\n polygonTemplate.propertyFields.fill = 'fill';\n\n // Create hover state and set alternative fill color\n var hs = polygonTemplate.states.create('hover');\n hs.properties.fill = am4core.color('#FD2A33');\n }\n\n render() {\n return (\n <div ref={this.mapRef} className='map-container' />\n );\n }\n\n}\n","import _ from 'lodash';\nimport React from 'react';\nimport Select from 'react-select';\nimport { Pie } from 'react-chartjs-2';\nimport data from '../../data/source_data.json';\nimport {colorGradient} from '../../../shared/utils';\n\nexport default class Source extends React.Component {\n constructor(props) {\n super(props);\n\n this.state = {\n timeSelection: { value: '30', label: '30 days' },\n timeInterval: '30',\n statusSelection: { value: 'Engage', label: 'Engage' },\n status: 'Engage',\n source: null\n };\n\n this.mainChartRef = React.createRef();\n }\n\n getMainData() {\n const status = this.state.status === 'All' ? '' : this.state.status;\n return _.get(data, [status, this.state.timeInterval, 'summary']);\n }\n\n getBreakdownData() {\n const status = this.state.status === 'All' ? '' : this.state.status;\n return this.state.source\n ? _.get(data, [status, this.state.timeInterval, 'details', this.state.source])\n : null\n ;\n }\n\n colorPalette(count) {\n return colorGradient(colorGradient.defaultLightest, colorGradient.defaultDarkest, count);\n }\n\n renderMainChart() {\n const mainData = this.getMainData();\n return (\n <Pie\n ref={this.mainChartRef}\n data={{\n labels: mainData.labels,\n datasets: [{\n label: `Startups Added: ${this.state.status}: ${this.state.timeInterval}`,\n backgroundColor: this.colorPalette(_.compact(mainData.counts).length),\n data: mainData.counts,\n borderWidth: 0,\n datalabels: {\n anchor: 'end'\n }\n }]\n }}\n options={{\n legend: {\n display: false\n },\n onHover: (e, el) => e.target.style.cursor = el.length ? 'pointer' : 'default',\n pieceLabel: {\n render: args => `${args.label} (${args.percentage}%)`,\n arc: true,\n position: 'border',\n fontSize: 16,\n fontStyle: 'bold',\n fontColor: '#000',\n },\n tooltips: {\n callbacks: {\n label: (tooltipItem, data) => {\n const dataset = data.datasets[tooltipItem.datasetIndex];\n const meta = dataset._meta[Object.keys(dataset._meta)[0]];\n const total = meta.total;\n const currentValue = dataset.data[tooltipItem.index];\n const percentage = parseFloat((currentValue/total*100).toFixed(1));\n return currentValue + ' (' + percentage + '%)';\n },\n title: function(tooltipItem) {\n return mainData.labels[tooltipItem[0].index];\n }\n }\n },\n plugins: {\n datalabels: {\n display: false\n }\n }\n }}\n onElementsClick={targets => {\n if (targets.length === 0) return;\n const target = targets[0];\n if (target) {\n const chartData = target._chart.config.data;\n const idx = target._index;\n\n const label = chartData.labels[idx];\n this.setState({source: label});\n }\n }}\n />\n );\n }\n\n renderBreakdownChart() {\n const breakdownData = this.getBreakdownData();\n return breakdownData\n ? (\n <Pie\n data={{\n labels: breakdownData.labels,\n datasets: [{\n label: `Startups Added: ${this.state.status}: ${this.state.timeInterval}: ${this.state.source}`,\n backgroundColor: this.colorPalette(breakdownData.labels.length),\n data: breakdownData.counts,\n borderWidth: 0,\n datalabels: {\n anchor: 'end'\n }\n }]\n }}\n options={{\n pieceLabel: {\n render: function (args) {\n return `${args.label} (${args.percentage}%)`;\n },\n arc: true,\n position: 'border',\n fontSize: 16,\n fontStyle: 'bold',\n fontColor: '#000',\n },\n legend: {\n display: false,\n position: 'bottom',\n\n labels: {\n fontSize: 10,\n boxWidth: 10\n }\n },\n plugins: {\n datalabels: {\n display: false\n }\n }\n }}\n style={{visibility: this.state.source ? 'visible' : 'hidden'}}\n />\n ) : (\n <h4>{this.props.copy.voyager_sources_prompt}</h4>\n )\n ;\n }\n\n handleStatusChange(selectedStatus) {\n this.setState({\n statusSelection: selectedStatus,\n status: selectedStatus.value,\n loading: true\n }, this.fetchChartData);\n }\n\n statusFilter() {\n return (\n <Select\n name=\"industry-breakdown-status-filter\"\n clearable={false}\n value={this.state.statusSelection}\n onChange={selected => this.handleStatusChange(selected)}\n options={[\n { value: '', label: 'All' },\n { value: 'Engage', label: 'Engage' },\n { value: 'Evaluate', label: 'Evaluate' },\n { value: 'Term sheet phase', label: 'Term Sheet' },\n { value: 'Portfolio Company', label: 'Portfolio' },\n ]}\n />\n );\n }\n\n handleTimeChange(selectedTime) {\n this.setState({\n timeSelection: selectedTime,\n timeInterval: selectedTime.value,\n loading: true\n }, this.fetchChartData);\n }\n\n timeFilter() {\n return (\n <Select\n name=\"industry-breakdown-time-filter\"\n clearable={false}\n value={this.state.timeSelection}\n onChange={selected => this.handleTimeChange(selected)}\n options={[\n { value: '7', label: '7 days' },\n { value: '30', label: '30 days' },\n { value: '90', label: '90 days' },\n ]}\n />\n );\n }\n\n render() {\n return(\n <div className='source-breakdown-component'>\n <div className='row' style={{marginBottom: '15px'}}>\n <div className='col-md-3'>\n {this.statusFilter()}\n </div>\n <div className='col-md-3'>\n {this.timeFilter()}\n </div>\n </div>\n <div className='row'>\n <div className='col-md-6'>\n {this.renderMainChart()}\n </div>\n <div className='col-md-6'>\n {this.renderBreakdownChart()}\n </div>\n </div>\n </div>\n );\n }\n}\n\n","import _ from 'lodash';\nimport React from 'react';\nimport { Container, Row, Col } from 'reactstrap';\n\nimport MeetingsPace from './voyager/MeetingsPace';\nimport Stage from './voyager/Stage';\nimport IndustryBreakdown from './voyager/IndustryBreakdown';\nimport Map from './voyager/Map';\nimport Source from './voyager/Source';\n\nexport default class Voyager extends React.Component {\n constructor(props) {\n super(props);\n this.copy = _.reduce(props.copy, (obj, copy) => _.set(obj, copy.slug, copy.copy), {});\n\n this.state = {};\n }\n\n\n render() {\n return (\n <Container fluid>\n <Row className='overview-data-box voyager-chart pace-chart'>\n <Col sm='12'>\n <div className='page-description'>{this.copy.voyager_disclaimer}</div>\n <hr />\n <h3>First Meetings Pace</h3>\n <MeetingsPace />\n </Col>\n </Row>\n <Row className='overview-data-box voyager-chart stage-chart'>\n <Col sm='12'>\n <h3>Stage of Pipeline Deals (Last 90 days)</h3>\n <Stage />\n </Col>\n </Row>\n <Row className='overview-data-box voyager-chart source-chart'>\n <Col sm='12'>\n <h3>Sources Breakdown</h3>\n <Source copy={this.copy} />\n </Col>\n </Row>\n <Row className='overview-data-box voyager-chart industry-chart'>\n <Col sm='12'>\n <h3>Industries Breakdown (Last 90 days)</h3>\n <IndustryBreakdown />\n </Col>\n </Row>\n <Row className='overview-data-box voyager-chart map-chart'>\n <Col sm='12'>\n <h3>Sources Geography (All time)</h3>\n <Map />\n </Col>\n </Row>\n </Container>\n );\n }\n}\n","import ReactOnRails from 'react-on-rails';\n\nimport DataRoom from '../bundles/DataRoom/components/DataRoom';\nimport Downloads from '../bundles/DataRoom/components/Downloads';\nimport Dashboard from '../bundles/Dashboard/components/Dashboard';\nimport AnnualMeeting from '../bundles/AnnualMeeting/components/AnnualMeeting';\nimport Voyager from '../bundles/DataRoom/components/Voyager';\n\n// This is how react_on_rails can see the HelloWorld in the browser.\nReactOnRails.register({\n DataRoom,\n Downloads,\n Dashboard,\n AnnualMeeting,\n Voyager\n});\n"],"sourceRoot":""}